diff --git a/dist/index.js b/dist/index.js index abfe662b..5b0db2b1 100644 --- a/dist/index.js +++ b/dist/index.js @@ -3772,7 +3772,7 @@ function copyFile(srcFile, destFile, force) { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.resolveHttpAuthSchemeConfig = exports.defaultCodeDeployHttpAuthSchemeProvider = exports.defaultCodeDeployHttpAuthSchemeParametersProvider = void 0; -const core_1 = __nccwpck_require__(79191); +const core_1 = __nccwpck_require__(8704); const util_middleware_1 = __nccwpck_require__(25695); const defaultCodeDeployHttpAuthSchemeParametersProvider = async (config, context, input) => { return { @@ -3827,7 +3827,7 @@ exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(11911); +const util_endpoints_1 = __nccwpck_require__(83068); const util_endpoints_2 = __nccwpck_require__(79674); const ruleset_1 = __nccwpck_require__(88635); const cache = new util_endpoints_2.EndpointCache({ @@ -4095,10 +4095,10 @@ __export(index_exports, { module.exports = __toCommonJS(index_exports); // src/CodeDeployClient.ts -var import_middleware_host_header = __nccwpck_require__(29477); -var import_middleware_logger = __nccwpck_require__(38703); -var import_middleware_recursion_detection = __nccwpck_require__(21067); -var import_middleware_user_agent = __nccwpck_require__(58534); +var import_middleware_host_header = __nccwpck_require__(52590); +var import_middleware_logger = __nccwpck_require__(85242); +var import_middleware_recursion_detection = __nccwpck_require__(81568); +var import_middleware_user_agent = __nccwpck_require__(32959); var import_config_resolver = __nccwpck_require__(39316); var import_core = __nccwpck_require__(90475); var import_middleware_content_length = __nccwpck_require__(47212); @@ -4126,7 +4126,7 @@ var commonParams = { var import_runtimeConfig = __nccwpck_require__(74277); // src/runtimeExtensions.ts -var import_region_config_resolver = __nccwpck_require__(2472); +var import_region_config_resolver = __nccwpck_require__(36463); var import_protocol_http = __nccwpck_require__(5559); var import_smithy_client = __nccwpck_require__(61411); @@ -4244,7 +4244,7 @@ var import_middleware_serde = __nccwpck_require__(29514); // src/protocols/Aws_json1_1.ts -var import_core2 = __nccwpck_require__(79191); +var import_core2 = __nccwpck_require__(8704); @@ -9907,9 +9907,9 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); exports.getRuntimeConfig = void 0; const tslib_1 = __nccwpck_require__(61860); const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(30909)); -const core_1 = __nccwpck_require__(79191); -const credential_provider_node_1 = __nccwpck_require__(89694); -const util_user_agent_node_1 = __nccwpck_require__(25195); +const core_1 = __nccwpck_require__(8704); +const credential_provider_node_1 = __nccwpck_require__(5861); +const util_user_agent_node_1 = __nccwpck_require__(51656); const config_resolver_1 = __nccwpck_require__(39316); const hash_node_1 = __nccwpck_require__(5092); const middleware_retry_1 = __nccwpck_require__(19618); @@ -9969,7 +9969,7 @@ exports.getRuntimeConfig = getRuntimeConfig; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.getRuntimeConfig = void 0; -const core_1 = __nccwpck_require__(79191); +const core_1 = __nccwpck_require__(8704); const smithy_client_1 = __nccwpck_require__(61411); const url_parser_1 = __nccwpck_require__(81983); const util_base64_1 = __nccwpck_require__(26262); @@ -10004,128 +10004,9 @@ exports.getRuntimeConfig = getRuntimeConfig; /***/ }), -/***/ 13878: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveHttpAuthSchemeConfig = exports.defaultSSOHttpAuthSchemeProvider = exports.defaultSSOHttpAuthSchemeParametersProvider = void 0; -const core_1 = __nccwpck_require__(79191); -const util_middleware_1 = __nccwpck_require__(25695); -const defaultSSOHttpAuthSchemeParametersProvider = async (config, context, input) => { - return { - operation: (0, util_middleware_1.getSmithyContext)(context).operation, - region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || - (() => { - throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); - })(), - }; -}; -exports.defaultSSOHttpAuthSchemeParametersProvider = defaultSSOHttpAuthSchemeParametersProvider; -function createAwsAuthSigv4HttpAuthOption(authParameters) { - return { - schemeId: "aws.auth#sigv4", - signingProperties: { - name: "awsssoportal", - region: authParameters.region, - }, - propertiesExtractor: (config, context) => ({ - signingProperties: { - config, - context, - }, - }), - }; -} -function createSmithyApiNoAuthHttpAuthOption(authParameters) { - return { - schemeId: "smithy.api#noAuth", - }; -} -const defaultSSOHttpAuthSchemeProvider = (authParameters) => { - const options = []; - switch (authParameters.operation) { - case "GetRoleCredentials": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "ListAccountRoles": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "ListAccounts": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "Logout": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - default: { - options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); - } - } - return options; -}; -exports.defaultSSOHttpAuthSchemeProvider = defaultSSOHttpAuthSchemeProvider; -const resolveHttpAuthSchemeConfig = (config) => { - const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); - return Object.assign(config_0, { - authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), - }); -}; -exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; - - -/***/ }), - -/***/ 68112: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(11911); -const util_endpoints_2 = __nccwpck_require__(79674); -const ruleset_1 = __nccwpck_require__(88749); -const cache = new util_endpoints_2.EndpointCache({ - size: 50, - params: ["Endpoint", "Region", "UseDualStack", "UseFIPS"], -}); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - })); -}; -exports.defaultEndpointResolver = defaultEndpointResolver; -util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; - - -/***/ }), - -/***/ 88749: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const u = "required", v = "fn", w = "argv", x = "ref"; -const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "String" }, j = { [u]: true, "default": false, "type": "Boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }]; -const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; -exports.ruleSet = _data; - - -/***/ }), - -/***/ 44869: +/***/ 90475: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -"use strict"; - var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; @@ -10146,584 +10027,413 @@ var __copyProps = (to, from, except, desc) => { var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -__export(index_exports, { - GetRoleCredentialsCommand: () => GetRoleCredentialsCommand, - GetRoleCredentialsRequestFilterSensitiveLog: () => GetRoleCredentialsRequestFilterSensitiveLog, - GetRoleCredentialsResponseFilterSensitiveLog: () => GetRoleCredentialsResponseFilterSensitiveLog, - InvalidRequestException: () => InvalidRequestException, - ListAccountRolesCommand: () => ListAccountRolesCommand, - ListAccountRolesRequestFilterSensitiveLog: () => ListAccountRolesRequestFilterSensitiveLog, - ListAccountsCommand: () => ListAccountsCommand, - ListAccountsRequestFilterSensitiveLog: () => ListAccountsRequestFilterSensitiveLog, - LogoutCommand: () => LogoutCommand, - LogoutRequestFilterSensitiveLog: () => LogoutRequestFilterSensitiveLog, - ResourceNotFoundException: () => ResourceNotFoundException, - RoleCredentialsFilterSensitiveLog: () => RoleCredentialsFilterSensitiveLog, - SSO: () => SSO, - SSOClient: () => SSOClient, - SSOServiceException: () => SSOServiceException, - TooManyRequestsException: () => TooManyRequestsException, - UnauthorizedException: () => UnauthorizedException, - __Client: () => import_smithy_client.Client, - paginateListAccountRoles: () => paginateListAccountRoles, - paginateListAccounts: () => paginateListAccounts +var src_exports = {}; +__export(src_exports, { + DefaultIdentityProviderConfig: () => DefaultIdentityProviderConfig, + EXPIRATION_MS: () => EXPIRATION_MS, + HttpApiKeyAuthSigner: () => HttpApiKeyAuthSigner, + HttpBearerAuthSigner: () => HttpBearerAuthSigner, + NoAuthSigner: () => NoAuthSigner, + createIsIdentityExpiredFunction: () => createIsIdentityExpiredFunction, + createPaginator: () => createPaginator, + doesIdentityRequireRefresh: () => doesIdentityRequireRefresh, + getHttpAuthSchemeEndpointRuleSetPlugin: () => getHttpAuthSchemeEndpointRuleSetPlugin, + getHttpAuthSchemePlugin: () => getHttpAuthSchemePlugin, + getHttpSigningPlugin: () => getHttpSigningPlugin, + getSmithyContext: () => getSmithyContext, + httpAuthSchemeEndpointRuleSetMiddlewareOptions: () => httpAuthSchemeEndpointRuleSetMiddlewareOptions, + httpAuthSchemeMiddleware: () => httpAuthSchemeMiddleware, + httpAuthSchemeMiddlewareOptions: () => httpAuthSchemeMiddlewareOptions, + httpSigningMiddleware: () => httpSigningMiddleware, + httpSigningMiddlewareOptions: () => httpSigningMiddlewareOptions, + isIdentityExpired: () => isIdentityExpired, + memoizeIdentityProvider: () => memoizeIdentityProvider, + normalizeProvider: () => normalizeProvider, + requestBuilder: () => import_protocols.requestBuilder, + setFeature: () => setFeature }); -module.exports = __toCommonJS(index_exports); - -// src/SSOClient.ts -var import_middleware_host_header = __nccwpck_require__(29477); -var import_middleware_logger = __nccwpck_require__(38703); -var import_middleware_recursion_detection = __nccwpck_require__(21067); -var import_middleware_user_agent = __nccwpck_require__(58534); -var import_config_resolver = __nccwpck_require__(39316); -var import_core = __nccwpck_require__(90475); -var import_middleware_content_length = __nccwpck_require__(47212); -var import_middleware_endpoint = __nccwpck_require__(53152); -var import_middleware_retry = __nccwpck_require__(19618); - -var import_httpAuthSchemeProvider = __nccwpck_require__(13878); - -// src/endpoint/EndpointParameters.ts -var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { - return Object.assign(options, { - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - defaultSigningName: "awsssoportal" - }); -}, "resolveClientEndpointParameters"); -var commonParams = { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } -}; +module.exports = __toCommonJS(src_exports); -// src/SSOClient.ts -var import_runtimeConfig = __nccwpck_require__(74895); +// src/getSmithyContext.ts +var import_types = __nccwpck_require__(20873); +var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); -// src/runtimeExtensions.ts -var import_region_config_resolver = __nccwpck_require__(2472); -var import_protocol_http = __nccwpck_require__(5559); -var import_smithy_client = __nccwpck_require__(61411); +// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts +var import_util_middleware = __nccwpck_require__(25695); -// src/auth/httpAuthExtensionConfiguration.ts -var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; - let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; - let _credentials = runtimeConfig.credentials; - return { - setHttpAuthScheme(httpAuthScheme) { - const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); - if (index === -1) { - _httpAuthSchemes.push(httpAuthScheme); - } else { - _httpAuthSchemes.splice(index, 1, httpAuthScheme); +// src/middleware-http-auth-scheme/resolveAuthOptions.ts +var resolveAuthOptions = /* @__PURE__ */ __name((candidateAuthOptions, authSchemePreference) => { + if (!authSchemePreference || authSchemePreference.length === 0) { + return candidateAuthOptions; + } + const preferredAuthOptions = []; + for (const preferredSchemeName of authSchemePreference) { + for (const candidateAuthOption of candidateAuthOptions) { + const candidateAuthSchemeName = candidateAuthOption.schemeId.split("#")[1]; + if (candidateAuthSchemeName === preferredSchemeName) { + preferredAuthOptions.push(candidateAuthOption); } - }, - httpAuthSchemes() { - return _httpAuthSchemes; - }, - setHttpAuthSchemeProvider(httpAuthSchemeProvider) { - _httpAuthSchemeProvider = httpAuthSchemeProvider; - }, - httpAuthSchemeProvider() { - return _httpAuthSchemeProvider; - }, - setCredentials(credentials) { - _credentials = credentials; - }, - credentials() { - return _credentials; } - }; -}, "getHttpAuthExtensionConfiguration"); -var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { - return { - httpAuthSchemes: config.httpAuthSchemes(), - httpAuthSchemeProvider: config.httpAuthSchemeProvider(), - credentials: config.credentials() - }; -}, "resolveHttpAuthRuntimeConfig"); - -// src/runtimeExtensions.ts -var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { - const extensionConfiguration = Object.assign( - (0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig), - (0, import_smithy_client.getDefaultExtensionConfiguration)(runtimeConfig), - (0, import_protocol_http.getHttpHandlerExtensionConfiguration)(runtimeConfig), - getHttpAuthExtensionConfiguration(runtimeConfig) - ); - extensions.forEach((extension) => extension.configure(extensionConfiguration)); - return Object.assign( - runtimeConfig, - (0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), - (0, import_smithy_client.resolveDefaultRuntimeConfig)(extensionConfiguration), - (0, import_protocol_http.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), - resolveHttpAuthRuntimeConfig(extensionConfiguration) - ); -}, "resolveRuntimeExtensions"); + } + for (const candidateAuthOption of candidateAuthOptions) { + if (!preferredAuthOptions.find(({ schemeId }) => schemeId === candidateAuthOption.schemeId)) { + preferredAuthOptions.push(candidateAuthOption); + } + } + return preferredAuthOptions; +}, "resolveAuthOptions"); -// src/SSOClient.ts -var SSOClient = class extends import_smithy_client.Client { - static { - __name(this, "SSOClient"); +// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts +function convertHttpAuthSchemesToMap(httpAuthSchemes) { + const map = /* @__PURE__ */ new Map(); + for (const scheme of httpAuthSchemes) { + map.set(scheme.schemeId, scheme); } - /** - * The resolved configuration of SSOClient class. This is resolved and normalized from the {@link SSOClientConfig | constructor configuration interface}. - */ - config; - constructor(...[configuration]) { - const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); - super(_config_0); - this.initConfig = _config_0; - const _config_1 = resolveClientEndpointParameters(_config_0); - const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, import_middleware_retry.resolveRetryConfig)(_config_2); - const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); - const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_5); - const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); - const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []); - this.config = _config_8; - this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use( - (0, import_core.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { - httpAuthSchemeParametersProvider: import_httpAuthSchemeProvider.defaultSSOHttpAuthSchemeParametersProvider, - identityProviderConfigProvider: /* @__PURE__ */ __name(async (config) => new import_core.DefaultIdentityProviderConfig({ - "aws.auth#sigv4": config.credentials - }), "identityProviderConfigProvider") - }) - ); - this.middlewareStack.use((0, import_core.getHttpSigningPlugin)(this.config)); + return map; +} +__name(convertHttpAuthSchemesToMap, "convertHttpAuthSchemesToMap"); +var httpAuthSchemeMiddleware = /* @__PURE__ */ __name((config, mwOptions) => (next, context) => async (args) => { + const options = config.httpAuthSchemeProvider( + await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input) + ); + const authSchemePreference = config.authSchemePreference ? await config.authSchemePreference() : []; + const resolvedOptions = resolveAuthOptions(options, authSchemePreference); + const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const failureReasons = []; + for (const option of resolvedOptions) { + const scheme = authSchemes.get(option.schemeId); + if (!scheme) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` was not enabled for this service.`); + continue; + } + const identityProvider = scheme.identityProvider(await mwOptions.identityProviderConfigProvider(config)); + if (!identityProvider) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` did not have an IdentityProvider configured.`); + continue; + } + const { identityProperties = {}, signingProperties = {} } = option.propertiesExtractor?.(config, context) || {}; + option.identityProperties = Object.assign(option.identityProperties || {}, identityProperties); + option.signingProperties = Object.assign(option.signingProperties || {}, signingProperties); + smithyContext.selectedHttpAuthScheme = { + httpAuthOption: option, + identity: await identityProvider(option.identityProperties), + signer: scheme.signer + }; + break; } - /** - * Destroy underlying resources, like sockets. It's usually not necessary to do this. - * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. - * Otherwise, sockets might stay open for quite a long time before the server terminates them. - */ - destroy() { - super.destroy(); + if (!smithyContext.selectedHttpAuthScheme) { + throw new Error(failureReasons.join("\n")); } -}; - -// src/SSO.ts - + return next(args); +}, "httpAuthSchemeMiddleware"); -// src/commands/GetRoleCredentialsCommand.ts +// src/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.ts +var httpAuthSchemeEndpointRuleSetMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: "endpointV2Middleware" +}; +var getHttpAuthSchemeEndpointRuleSetPlugin = /* @__PURE__ */ __name((config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider +}) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), + httpAuthSchemeEndpointRuleSetMiddlewareOptions + ); + } +}), "getHttpAuthSchemeEndpointRuleSetPlugin"); +// src/middleware-http-auth-scheme/getHttpAuthSchemePlugin.ts var import_middleware_serde = __nccwpck_require__(29514); +var httpAuthSchemeMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde.serializerMiddlewareOption.name +}; +var getHttpAuthSchemePlugin = /* @__PURE__ */ __name((config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider +}) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), + httpAuthSchemeMiddlewareOptions + ); + } +}), "getHttpAuthSchemePlugin"); +// src/middleware-http-signing/httpSigningMiddleware.ts +var import_protocol_http = __nccwpck_require__(5559); -// src/models/models_0.ts - - -// src/models/SSOServiceException.ts - -var SSOServiceException = class _SSOServiceException extends import_smithy_client.ServiceException { - static { - __name(this, "SSOServiceException"); +var defaultErrorHandler = /* @__PURE__ */ __name((signingProperties) => (error) => { + throw error; +}, "defaultErrorHandler"); +var defaultSuccessHandler = /* @__PURE__ */ __name((httpResponse, signingProperties) => { +}, "defaultSuccessHandler"); +var httpSigningMiddleware = /* @__PURE__ */ __name((config) => (next, context) => async (args) => { + if (!import_protocol_http.HttpRequest.isInstance(args.request)) { + return next(args); } - /** - * @internal - */ - constructor(options) { - super(options); - Object.setPrototypeOf(this, _SSOServiceException.prototype); + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const scheme = smithyContext.selectedHttpAuthScheme; + if (!scheme) { + throw new Error(`No HttpAuthScheme was selected: unable to sign request`); } -}; + const { + httpAuthOption: { signingProperties = {} }, + identity, + signer + } = scheme; + const output = await next({ + ...args, + request: await signer.sign(args.request, identity, signingProperties) + }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); + (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); + return output; +}, "httpSigningMiddleware"); -// src/models/models_0.ts -var InvalidRequestException = class _InvalidRequestException extends SSOServiceException { - static { - __name(this, "InvalidRequestException"); - } - name = "InvalidRequestException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidRequestException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidRequestException.prototype); - } -}; -var ResourceNotFoundException = class _ResourceNotFoundException extends SSOServiceException { - static { - __name(this, "ResourceNotFoundException"); - } - name = "ResourceNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ResourceNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ResourceNotFoundException.prototype); - } +// src/middleware-http-signing/getHttpSigningMiddleware.ts +var httpSigningMiddlewareOptions = { + step: "finalizeRequest", + tags: ["HTTP_SIGNING"], + name: "httpSigningMiddleware", + aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], + override: true, + relation: "after", + toMiddleware: "retryMiddleware" }; -var TooManyRequestsException = class _TooManyRequestsException extends SSOServiceException { - static { - __name(this, "TooManyRequestsException"); +var getHttpSigningPlugin = /* @__PURE__ */ __name((config) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); } - name = "TooManyRequestsException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "TooManyRequestsException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _TooManyRequestsException.prototype); - } -}; -var UnauthorizedException = class _UnauthorizedException extends SSOServiceException { - static { - __name(this, "UnauthorizedException"); - } - name = "UnauthorizedException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "UnauthorizedException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _UnauthorizedException.prototype); - } -}; -var GetRoleCredentialsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } -}), "GetRoleCredentialsRequestFilterSensitiveLog"); -var RoleCredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.secretAccessKey && { secretAccessKey: import_smithy_client.SENSITIVE_STRING }, - ...obj.sessionToken && { sessionToken: import_smithy_client.SENSITIVE_STRING } -}), "RoleCredentialsFilterSensitiveLog"); -var GetRoleCredentialsResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.roleCredentials && { roleCredentials: RoleCredentialsFilterSensitiveLog(obj.roleCredentials) } -}), "GetRoleCredentialsResponseFilterSensitiveLog"); -var ListAccountRolesRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } -}), "ListAccountRolesRequestFilterSensitiveLog"); -var ListAccountsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } -}), "ListAccountsRequestFilterSensitiveLog"); -var LogoutRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } -}), "LogoutRequestFilterSensitiveLog"); - -// src/protocols/Aws_restJson1.ts -var import_core2 = __nccwpck_require__(79191); - +}), "getHttpSigningPlugin"); -var se_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core.requestBuilder)(input, context); - const headers = (0, import_smithy_client.map)({}, import_smithy_client.isSerializableHeaderValue, { - [_xasbt]: input[_aT] - }); - b.bp("/federation/credentials"); - const query = (0, import_smithy_client.map)({ - [_rn]: [, (0, import_smithy_client.expectNonNull)(input[_rN], `roleName`)], - [_ai]: [, (0, import_smithy_client.expectNonNull)(input[_aI], `accountId`)] - }); - let body; - b.m("GET").h(headers).q(query).b(body); - return b.build(); -}, "se_GetRoleCredentialsCommand"); -var se_ListAccountRolesCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core.requestBuilder)(input, context); - const headers = (0, import_smithy_client.map)({}, import_smithy_client.isSerializableHeaderValue, { - [_xasbt]: input[_aT] - }); - b.bp("/assignment/roles"); - const query = (0, import_smithy_client.map)({ - [_nt]: [, input[_nT]], - [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()], - [_ai]: [, (0, import_smithy_client.expectNonNull)(input[_aI], `accountId`)] - }); - let body; - b.m("GET").h(headers).q(query).b(body); - return b.build(); -}, "se_ListAccountRolesCommand"); -var se_ListAccountsCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core.requestBuilder)(input, context); - const headers = (0, import_smithy_client.map)({}, import_smithy_client.isSerializableHeaderValue, { - [_xasbt]: input[_aT] - }); - b.bp("/assignment/accounts"); - const query = (0, import_smithy_client.map)({ - [_nt]: [, input[_nT]], - [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()] - }); - let body; - b.m("GET").h(headers).q(query).b(body); - return b.build(); -}, "se_ListAccountsCommand"); -var se_LogoutCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core.requestBuilder)(input, context); - const headers = (0, import_smithy_client.map)({}, import_smithy_client.isSerializableHeaderValue, { - [_xasbt]: input[_aT] - }); - b.bp("/logout"); - let body; - b.m("POST").h(headers).b(body); - return b.build(); -}, "se_LogoutCommand"); -var de_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client.map)({ - $metadata: deserializeMetadata(output) - }); - const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client.take)(data, { - roleCredentials: import_smithy_client._json - }); - Object.assign(contents, doc); - return contents; -}, "de_GetRoleCredentialsCommand"); -var de_ListAccountRolesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client.map)({ - $metadata: deserializeMetadata(output) - }); - const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client.take)(data, { - nextToken: import_smithy_client.expectString, - roleList: import_smithy_client._json - }); - Object.assign(contents, doc); - return contents; -}, "de_ListAccountRolesCommand"); -var de_ListAccountsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client.map)({ - $metadata: deserializeMetadata(output) - }); - const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client.take)(data, { - accountList: import_smithy_client._json, - nextToken: import_smithy_client.expectString - }); - Object.assign(contents, doc); - return contents; -}, "de_ListAccountsCommand"); -var de_LogoutCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client.map)({ - $metadata: deserializeMetadata(output) - }); - await (0, import_smithy_client.collectBody)(output.body, context); - return contents; -}, "de_LogoutCommand"); -var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { - const parsedOutput = { - ...output, - body: await (0, import_core2.parseJsonErrorBody)(output.body, context) - }; - const errorCode = (0, import_core2.loadRestJsonErrorCode)(output, parsedOutput.body); - switch (errorCode) { - case "InvalidRequestException": - case "com.amazonaws.sso#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "ResourceNotFoundException": - case "com.amazonaws.sso#ResourceNotFoundException": - throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); - case "TooManyRequestsException": - case "com.amazonaws.sso#TooManyRequestsException": - throw await de_TooManyRequestsExceptionRes(parsedOutput, context); - case "UnauthorizedException": - case "com.amazonaws.sso#UnauthorizedException": - throw await de_UnauthorizedExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode - }); - } -}, "de_CommandError"); -var throwDefaultError = (0, import_smithy_client.withBaseException)(SSOServiceException); -var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client.take)(data, { - message: import_smithy_client.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidRequestException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidRequestExceptionRes"); -var de_ResourceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client.take)(data, { - message: import_smithy_client.expectString - }); - Object.assign(contents, doc); - const exception = new ResourceNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); -}, "de_ResourceNotFoundExceptionRes"); -var de_TooManyRequestsExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client.take)(data, { - message: import_smithy_client.expectString - }); - Object.assign(contents, doc); - const exception = new TooManyRequestsException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); -}, "de_TooManyRequestsExceptionRes"); -var de_UnauthorizedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client.take)(data, { - message: import_smithy_client.expectString - }); - Object.assign(contents, doc); - const exception = new UnauthorizedException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); -}, "de_UnauthorizedExceptionRes"); -var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] -}), "deserializeMetadata"); -var _aI = "accountId"; -var _aT = "accessToken"; -var _ai = "account_id"; -var _mR = "maxResults"; -var _mr = "max_result"; -var _nT = "nextToken"; -var _nt = "next_token"; -var _rN = "roleName"; -var _rn = "role_name"; -var _xasbt = "x-amz-sso_bearer_token"; +// src/normalizeProvider.ts +var normalizeProvider = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}, "normalizeProvider"); -// src/commands/GetRoleCredentialsCommand.ts -var GetRoleCredentialsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("SWBPortalService", "GetRoleCredentials", {}).n("SSOClient", "GetRoleCredentialsCommand").f(GetRoleCredentialsRequestFilterSensitiveLog, GetRoleCredentialsResponseFilterSensitiveLog).ser(se_GetRoleCredentialsCommand).de(de_GetRoleCredentialsCommand).build() { - static { - __name(this, "GetRoleCredentialsCommand"); +// src/pagination/createPaginator.ts +var makePagedClientRequest = /* @__PURE__ */ __name(async (CommandCtor, client, input, withCommand = (_) => _, ...args) => { + let command = new CommandCtor(input); + command = withCommand(command) ?? command; + return await client.send(command, ...args); +}, "makePagedClientRequest"); +function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { + return /* @__PURE__ */ __name(async function* paginateOperation(config, input, ...additionalArguments) { + const _input = input; + let token = config.startingToken ?? _input[inputTokenName]; + let hasNext = true; + let page; + while (hasNext) { + _input[inputTokenName] = token; + if (pageSizeTokenName) { + _input[pageSizeTokenName] = _input[pageSizeTokenName] ?? config.pageSize; + } + if (config.client instanceof ClientCtor) { + page = await makePagedClientRequest( + CommandCtor, + config.client, + input, + config.withCommand, + ...additionalArguments + ); + } else { + throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); + } + yield page; + const prevToken = token; + token = get(page, outputTokenName); + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return void 0; + }, "paginateOperation"); +} +__name(createPaginator, "createPaginator"); +var get = /* @__PURE__ */ __name((fromObject, path) => { + let cursor = fromObject; + const pathComponents = path.split("."); + for (const step of pathComponents) { + if (!cursor || typeof cursor !== "object") { + return void 0; + } + cursor = cursor[step]; } -}; - -// src/commands/ListAccountRolesCommand.ts + return cursor; +}, "get"); +// src/protocols/requestBuilder.ts +var import_protocols = __nccwpck_require__(50029); +// src/setFeature.ts +function setFeature(context, feature, value) { + if (!context.__smithy_context) { + context.__smithy_context = { + features: {} + }; + } else if (!context.__smithy_context.features) { + context.__smithy_context.features = {}; + } + context.__smithy_context.features[feature] = value; +} +__name(setFeature, "setFeature"); -var ListAccountRolesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("SWBPortalService", "ListAccountRoles", {}).n("SSOClient", "ListAccountRolesCommand").f(ListAccountRolesRequestFilterSensitiveLog, void 0).ser(se_ListAccountRolesCommand).de(de_ListAccountRolesCommand).build() { +// src/util-identity-and-auth/DefaultIdentityProviderConfig.ts +var DefaultIdentityProviderConfig = class { + /** + * Creates an IdentityProviderConfig with a record of scheme IDs to identity providers. + * + * @param config scheme IDs and identity providers to configure + */ + constructor(config) { + this.authSchemes = /* @__PURE__ */ new Map(); + for (const [key, value] of Object.entries(config)) { + if (value !== void 0) { + this.authSchemes.set(key, value); + } + } + } static { - __name(this, "ListAccountRolesCommand"); + __name(this, "DefaultIdentityProviderConfig"); + } + getIdentityProvider(schemeId) { + return this.authSchemes.get(schemeId); } }; -// src/commands/ListAccountsCommand.ts - +// src/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.ts -var ListAccountsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("SWBPortalService", "ListAccounts", {}).n("SSOClient", "ListAccountsCommand").f(ListAccountsRequestFilterSensitiveLog, void 0).ser(se_ListAccountsCommand).de(de_ListAccountsCommand).build() { +var HttpApiKeyAuthSigner = class { static { - __name(this, "ListAccountsCommand"); + __name(this, "HttpApiKeyAuthSigner"); + } + async sign(httpRequest, identity, signingProperties) { + if (!signingProperties) { + throw new Error( + "request could not be signed with `apiKey` since the `name` and `in` signer properties are missing" + ); + } + if (!signingProperties.name) { + throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); + } + if (!signingProperties.in) { + throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); + } + if (!identity.apiKey) { + throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); + } + const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); + if (signingProperties.in === import_types.HttpApiKeyAuthLocation.QUERY) { + clonedRequest.query[signingProperties.name] = identity.apiKey; + } else if (signingProperties.in === import_types.HttpApiKeyAuthLocation.HEADER) { + clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; + } else { + throw new Error( + "request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`" + ); + } + return clonedRequest; } }; -// src/commands/LogoutCommand.ts - - +// src/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.ts -var LogoutCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("SWBPortalService", "Logout", {}).n("SSOClient", "LogoutCommand").f(LogoutRequestFilterSensitiveLog, void 0).ser(se_LogoutCommand).de(de_LogoutCommand).build() { +var HttpBearerAuthSigner = class { static { - __name(this, "LogoutCommand"); + __name(this, "HttpBearerAuthSigner"); + } + async sign(httpRequest, identity, signingProperties) { + const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); + if (!identity.token) { + throw new Error("request could not be signed with `token` since the `token` is not defined"); + } + clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; + return clonedRequest; } }; -// src/SSO.ts -var commands = { - GetRoleCredentialsCommand, - ListAccountRolesCommand, - ListAccountsCommand, - LogoutCommand -}; -var SSO = class extends SSOClient { +// src/util-identity-and-auth/httpAuthSchemes/noAuth.ts +var NoAuthSigner = class { static { - __name(this, "SSO"); + __name(this, "NoAuthSigner"); + } + async sign(httpRequest, identity, signingProperties) { + return httpRequest; } }; -(0, import_smithy_client.createAggregatedClient)(commands, SSO); - -// src/pagination/ListAccountRolesPaginator.ts - -var paginateListAccountRoles = (0, import_core.createPaginator)(SSOClient, ListAccountRolesCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListAccountsPaginator.ts -var paginateListAccounts = (0, import_core.createPaginator)(SSOClient, ListAccountsCommand, "nextToken", "nextToken", "maxResults"); +// src/util-identity-and-auth/memoizeIdentityProvider.ts +var createIsIdentityExpiredFunction = /* @__PURE__ */ __name((expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs, "createIsIdentityExpiredFunction"); +var EXPIRATION_MS = 3e5; +var isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); +var doesIdentityRequireRefresh = /* @__PURE__ */ __name((identity) => identity.expiration !== void 0, "doesIdentityRequireRefresh"); +var memoizeIdentityProvider = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + if (provider === void 0) { + return void 0; + } + const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async (options) => { + if (!pending) { + pending = normalizedProvider(options); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + if (isConstant) { + return resolved; + } + if (!requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(options); + return resolved; + } + return resolved; + }; +}, "memoizeIdentityProvider"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -10732,140 +10442,13 @@ var paginateListAccounts = (0, import_core.createPaginator)(SSOClient, ListAccou /***/ }), -/***/ 74895: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const tslib_1 = __nccwpck_require__(61860); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(51973)); -const core_1 = __nccwpck_require__(79191); -const util_user_agent_node_1 = __nccwpck_require__(25195); -const config_resolver_1 = __nccwpck_require__(39316); -const hash_node_1 = __nccwpck_require__(5092); -const middleware_retry_1 = __nccwpck_require__(19618); -const node_config_provider_1 = __nccwpck_require__(44297); -const node_http_handler_1 = __nccwpck_require__(11176); -const util_body_length_node_1 = __nccwpck_require__(13638); -const util_retry_1 = __nccwpck_require__(15518); -const runtimeConfig_shared_1 = __nccwpck_require__(99676); -const smithy_client_1 = __nccwpck_require__(61411); -const util_defaults_mode_node_1 = __nccwpck_require__(15435); -const smithy_client_2 = __nccwpck_require__(61411); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); - (0, core_1.emitWarningIfUnsupportedVersion)(process.version); - const loaderConfig = { - profile: config?.profile, - logger: clientSharedValues.logger, - }; - return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), - region: config?.region ?? - (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), - requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }, config), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; - - -/***/ }), - -/***/ 99676: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const core_1 = __nccwpck_require__(79191); -const core_2 = __nccwpck_require__(90475); -const smithy_client_1 = __nccwpck_require__(61411); -const url_parser_1 = __nccwpck_require__(81983); -const util_base64_1 = __nccwpck_require__(26262); -const util_utf8_1 = __nccwpck_require__(21038); -const httpAuthSchemeProvider_1 = __nccwpck_require__(13878); -const endpointResolver_1 = __nccwpck_require__(68112); -const getRuntimeConfig = (config) => { - return { - apiVersion: "2019-06-10", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - extensions: config?.extensions ?? [], - httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOHttpAuthSchemeProvider, - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), - signer: new core_1.AwsSdkSigV4Signer(), - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner(), - }, - ], - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "SSO", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; - - -/***/ }), - -/***/ 79191: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(61860); -tslib_1.__exportStar(__nccwpck_require__(78639), exports); -tslib_1.__exportStar(__nccwpck_require__(86202), exports); -tslib_1.__exportStar(__nccwpck_require__(48273), exports); - - -/***/ }), - -/***/ 78639: -/***/ ((module) => { - -"use strict"; +/***/ 50029: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { for (var name in all) __defProp(target, name, { get: all[name], enumerable: true }); @@ -10880,2149 +10463,1635 @@ var __copyProps = (to, from, except, desc) => { }; var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/client/index.ts -var index_exports = {}; -__export(index_exports, { - emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, - setCredentialFeature: () => setCredentialFeature, - setFeature: () => setFeature, - setTokenFeature: () => setTokenFeature, - state: () => state +// src/submodules/protocols/index.ts +var protocols_exports = {}; +__export(protocols_exports, { + FromStringShapeDeserializer: () => FromStringShapeDeserializer, + HttpBindingProtocol: () => HttpBindingProtocol, + HttpInterceptingShapeDeserializer: () => HttpInterceptingShapeDeserializer, + HttpInterceptingShapeSerializer: () => HttpInterceptingShapeSerializer, + RequestBuilder: () => RequestBuilder, + RpcProtocol: () => RpcProtocol, + ToStringShapeSerializer: () => ToStringShapeSerializer, + collectBody: () => collectBody, + determineTimestampFormat: () => determineTimestampFormat, + extendedEncodeURIComponent: () => extendedEncodeURIComponent, + requestBuilder: () => requestBuilder, + resolvedPath: () => resolvedPath }); -module.exports = __toCommonJS(index_exports); - -// src/submodules/client/emitWarningIfUnsupportedVersion.ts -var state = { - warningEmitted: false -}; -var emitWarningIfUnsupportedVersion = /* @__PURE__ */ __name((version) => { - if (version && !state.warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 18) { - state.warningEmitted = true; - process.emitWarning( - `NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will -no longer support Node.js 16.x on January 6, 2025. - -To continue receiving updates to AWS services, bug fixes, and security -updates please upgrade to a supported Node.js LTS version. - -More information can be found at: https://a.co/74kJMmI` - ); - } -}, "emitWarningIfUnsupportedVersion"); - -// src/submodules/client/setCredentialFeature.ts -function setCredentialFeature(credentials, feature, value) { - if (!credentials.$source) { - credentials.$source = {}; - } - credentials.$source[feature] = value; - return credentials; -} -__name(setCredentialFeature, "setCredentialFeature"); - -// src/submodules/client/setFeature.ts -function setFeature(context, feature, value) { - if (!context.__aws_sdk_context) { - context.__aws_sdk_context = { - features: {} - }; - } else if (!context.__aws_sdk_context.features) { - context.__aws_sdk_context.features = {}; - } - context.__aws_sdk_context.features[feature] = value; -} -__name(setFeature, "setFeature"); +module.exports = __toCommonJS(protocols_exports); -// src/submodules/client/setTokenFeature.ts -function setTokenFeature(token, feature, value) { - if (!token.$source) { - token.$source = {}; +// src/submodules/protocols/collect-stream-body.ts +var import_util_stream = __nccwpck_require__(71975); +var collectBody = async (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); } - token.$source[feature] = value; - return token; -} -__name(setTokenFeature, "setTokenFeature"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 86202: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + if (!streamBody) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); } - return to; + const fromContext = context.streamCollector(streamBody); + return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/httpAuthSchemes/index.ts -var index_exports = {}; -__export(index_exports, { - AWSSDKSigV4Signer: () => AWSSDKSigV4Signer, - AwsSdkSigV4ASigner: () => AwsSdkSigV4ASigner, - AwsSdkSigV4Signer: () => AwsSdkSigV4Signer, - NODE_AUTH_SCHEME_PREFERENCE_OPTIONS: () => NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, - NODE_SIGV4A_CONFIG_OPTIONS: () => NODE_SIGV4A_CONFIG_OPTIONS, - getBearerTokenEnvKey: () => getBearerTokenEnvKey, - resolveAWSSDKSigV4Config: () => resolveAWSSDKSigV4Config, - resolveAwsSdkSigV4AConfig: () => resolveAwsSdkSigV4AConfig, - resolveAwsSdkSigV4Config: () => resolveAwsSdkSigV4Config, - validateSigningProperties: () => validateSigningProperties -}); -module.exports = __toCommonJS(index_exports); +// src/submodules/protocols/extended-encode-uri-component.ts +function extendedEncodeURIComponent(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); +} -// src/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.ts +// src/submodules/protocols/HttpBindingProtocol.ts +var import_schema2 = __nccwpck_require__(93247); var import_protocol_http2 = __nccwpck_require__(5559); -// src/submodules/httpAuthSchemes/utils/getDateHeader.ts +// src/submodules/protocols/HttpProtocol.ts +var import_schema = __nccwpck_require__(93247); +var import_serde = __nccwpck_require__(38669); var import_protocol_http = __nccwpck_require__(5559); -var getDateHeader = /* @__PURE__ */ __name((response) => import_protocol_http.HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : void 0, "getDateHeader"); - -// src/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.ts -var getSkewCorrectedDate = /* @__PURE__ */ __name((systemClockOffset) => new Date(Date.now() + systemClockOffset), "getSkewCorrectedDate"); - -// src/submodules/httpAuthSchemes/utils/isClockSkewed.ts -var isClockSkewed = /* @__PURE__ */ __name((clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 3e5, "isClockSkewed"); - -// src/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.ts -var getUpdatedSystemClockOffset = /* @__PURE__ */ __name((clockTime, currentSystemClockOffset) => { - const clockTimeInMs = Date.parse(clockTime); - if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) { - return clockTimeInMs - Date.now(); +var import_util_stream2 = __nccwpck_require__(71975); +var HttpProtocol = class { + constructor(options) { + this.options = options; } - return currentSystemClockOffset; -}, "getUpdatedSystemClockOffset"); - -// src/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.ts -var throwSigningPropertyError = /* @__PURE__ */ __name((name, property) => { - if (!property) { - throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`); + getRequestType() { + return import_protocol_http.HttpRequest; } - return property; -}, "throwSigningPropertyError"); -var validateSigningProperties = /* @__PURE__ */ __name(async (signingProperties) => { - const context = throwSigningPropertyError( - "context", - signingProperties.context - ); - const config = throwSigningPropertyError("config", signingProperties.config); - const authScheme = context.endpointV2?.properties?.authSchemes?.[0]; - const signerFunction = throwSigningPropertyError( - "signer", - config.signer - ); - const signer = await signerFunction(authScheme); - const signingRegion = signingProperties?.signingRegion; - const signingRegionSet = signingProperties?.signingRegionSet; - const signingName = signingProperties?.signingName; - return { - config, - signer, - signingRegion, - signingRegionSet, - signingName - }; -}, "validateSigningProperties"); -var AwsSdkSigV4Signer = class { - static { - __name(this, "AwsSdkSigV4Signer"); + getResponseType() { + return import_protocol_http.HttpResponse; } - async sign(httpRequest, identity, signingProperties) { - if (!import_protocol_http2.HttpRequest.isInstance(httpRequest)) { - throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; + this.serializer.setSerdeContext(serdeContext); + this.deserializer.setSerdeContext(serdeContext); + if (this.getPayloadCodec()) { + this.getPayloadCodec().setSerdeContext(serdeContext); } - const validatedProps = await validateSigningProperties(signingProperties); - const { config, signer } = validatedProps; - let { signingRegion, signingName } = validatedProps; - const handlerExecutionContext = signingProperties.context; - if (handlerExecutionContext?.authSchemes?.length ?? 0 > 1) { - const [first, second] = handlerExecutionContext.authSchemes; - if (first?.name === "sigv4a" && second?.name === "sigv4") { - signingRegion = second?.signingRegion ?? signingRegion; - signingName = second?.signingName ?? signingName; + } + updateServiceEndpoint(request, endpoint) { + if ("url" in endpoint) { + request.protocol = endpoint.url.protocol; + request.hostname = endpoint.url.hostname; + request.port = endpoint.url.port ? Number(endpoint.url.port) : void 0; + request.path = endpoint.url.pathname; + request.fragment = endpoint.url.hash || void 0; + request.username = endpoint.url.username || void 0; + request.password = endpoint.url.password || void 0; + for (const [k, v] of endpoint.url.searchParams.entries()) { + if (!request.query) { + request.query = {}; + } + request.query[k] = v; } + return request; + } else { + request.protocol = endpoint.protocol; + request.hostname = endpoint.hostname; + request.port = endpoint.port ? Number(endpoint.port) : void 0; + request.path = endpoint.path; + request.query = { + ...endpoint.query + }; + return request; } - const signedRequest = await signer.sign(httpRequest, { - signingDate: getSkewCorrectedDate(config.systemClockOffset), - signingRegion, - signingService: signingName - }); - return signedRequest; } - errorHandler(signingProperties) { - return (error) => { - const serverTime = error.ServerTime ?? getDateHeader(error.$response); - if (serverTime) { - const config = throwSigningPropertyError("config", signingProperties.config); - const initialSystemClockOffset = config.systemClockOffset; - config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset); - const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset; - if (clockSkewCorrected && error.$metadata) { - error.$metadata.clockSkewCorrected = true; + setHostPrefix(request, operationSchema, input) { + const operationNs = import_schema.NormalizedSchema.of(operationSchema); + const inputNs = import_schema.NormalizedSchema.of(operationSchema.input); + if (operationNs.getMergedTraits().endpoint) { + let hostPrefix = operationNs.getMergedTraits().endpoint?.[0]; + if (typeof hostPrefix === "string") { + const hostLabelInputs = [...inputNs.structIterator()].filter( + ([, member]) => member.getMergedTraits().hostLabel + ); + for (const [name] of hostLabelInputs) { + const replacement = input[name]; + if (typeof replacement !== "string") { + throw new Error(`@smithy/core/schema - ${name} in input must be a string as hostLabel.`); + } + hostPrefix = hostPrefix.replace(`{${name}}`, replacement); } + request.hostname = hostPrefix + request.hostname; } - throw error; - }; - } - successHandler(httpResponse, signingProperties) { - const dateHeader = getDateHeader(httpResponse); - if (dateHeader) { - const config = throwSigningPropertyError("config", signingProperties.config); - config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset); } } -}; -var AWSSDKSigV4Signer = AwsSdkSigV4Signer; - -// src/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4ASigner.ts -var import_protocol_http3 = __nccwpck_require__(5559); -var AwsSdkSigV4ASigner = class extends AwsSdkSigV4Signer { - static { - __name(this, "AwsSdkSigV4ASigner"); + deserializeMetadata(output) { + return { + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }; } - async sign(httpRequest, identity, signingProperties) { - if (!import_protocol_http3.HttpRequest.isInstance(httpRequest)) { - throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + async deserializeHttpMessage(schema, context, response, arg4, arg5) { + let dataObject; + if (arg4 instanceof Set) { + dataObject = arg5; + } else { + dataObject = arg4; } - const { config, signer, signingRegion, signingRegionSet, signingName } = await validateSigningProperties( - signingProperties - ); - const configResolvedSigningRegionSet = await config.sigv4aSigningRegionSet?.(); - const multiRegionOverride = (configResolvedSigningRegionSet ?? signingRegionSet ?? [signingRegion]).join(","); - const signedRequest = await signer.sign(httpRequest, { - signingDate: getSkewCorrectedDate(config.systemClockOffset), - signingRegion: multiRegionOverride, - signingService: signingName - }); - return signedRequest; + const deserializer = this.deserializer; + const ns = import_schema.NormalizedSchema.of(schema); + const nonHttpBindingMembers = []; + for (const [memberName, memberSchema] of ns.structIterator()) { + const memberTraits = memberSchema.getMemberTraits(); + if (memberTraits.httpPayload) { + const isStreaming = memberSchema.isStreaming(); + if (isStreaming) { + const isEventStream = memberSchema.isStructSchema(); + if (isEventStream) { + const context2 = this.serdeContext; + if (!context2.eventStreamMarshaller) { + throw new Error("@smithy/core - HttpProtocol: eventStreamMarshaller missing in serdeContext."); + } + const memberSchemas = memberSchema.getMemberSchemas(); + dataObject[memberName] = context2.eventStreamMarshaller.deserialize(response.body, async (event) => { + const unionMember = Object.keys(event).find((key) => { + return key !== "__type"; + }) ?? ""; + if (unionMember in memberSchemas) { + const eventStreamSchema = memberSchemas[unionMember]; + return { + [unionMember]: await deserializer.read(eventStreamSchema, event[unionMember].body) + }; + } else { + return { + $unknown: event + }; + } + }); + } else { + dataObject[memberName] = (0, import_util_stream2.sdkStreamMixin)(response.body); + } + } else if (response.body) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + dataObject[memberName] = await deserializer.read(memberSchema, bytes); + } + } + } else if (memberTraits.httpHeader) { + const key = String(memberTraits.httpHeader).toLowerCase(); + const value = response.headers[key]; + if (null != value) { + if (memberSchema.isListSchema()) { + const headerListValueSchema = memberSchema.getValueSchema(); + let sections; + if (headerListValueSchema.isTimestampSchema() && headerListValueSchema.getSchema() === import_schema.SCHEMA.TIMESTAMP_DEFAULT) { + sections = (0, import_serde.splitEvery)(value, ",", 2); + } else { + sections = (0, import_serde.splitHeader)(value); + } + const list = []; + for (const section of sections) { + list.push(await deserializer.read([headerListValueSchema, { httpHeader: key }], section.trim())); + } + dataObject[memberName] = list; + } else { + dataObject[memberName] = await deserializer.read(memberSchema, value); + } + } + } else if (memberTraits.httpPrefixHeaders !== void 0) { + dataObject[memberName] = {}; + for (const [header, value] of Object.entries(response.headers)) { + if (header.startsWith(memberTraits.httpPrefixHeaders)) { + dataObject[memberName][header.slice(memberTraits.httpPrefixHeaders.length)] = await deserializer.read( + [memberSchema.getValueSchema(), { httpHeader: header }], + value + ); + } + } + } else if (memberTraits.httpResponseCode) { + dataObject[memberName] = response.statusCode; + } else { + nonHttpBindingMembers.push(memberName); + } + } + return nonHttpBindingMembers; } }; -// src/submodules/httpAuthSchemes/utils/getArrayForCommaSeparatedString.ts -var getArrayForCommaSeparatedString = /* @__PURE__ */ __name((str) => typeof str === "string" && str.length > 0 ? str.split(",").map((item) => item.trim()) : [], "getArrayForCommaSeparatedString"); - -// src/submodules/httpAuthSchemes/utils/getBearerTokenEnvKey.ts -var getBearerTokenEnvKey = /* @__PURE__ */ __name((signingName) => `AWS_BEARER_TOKEN_${signingName.replace(/[\s-]/g, "_").toUpperCase()}`, "getBearerTokenEnvKey"); - -// src/submodules/httpAuthSchemes/aws_sdk/NODE_AUTH_SCHEME_PREFERENCE_OPTIONS.ts -var NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY = "AWS_AUTH_SCHEME_PREFERENCE"; -var NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY = "auth_scheme_preference"; -var NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = { - /** - * Retrieves auth scheme preference from environment variables - * @param env - Node process environment object - * @returns Array of auth scheme strings if preference is set, undefined otherwise - */ - environmentVariableSelector: /* @__PURE__ */ __name((env, options) => { - if (options?.signingName) { - const bearerTokenKey = getBearerTokenEnvKey(options.signingName); - if (bearerTokenKey in env) return ["httpBearerAuth"]; - } - if (!(NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY in env)) return void 0; - return getArrayForCommaSeparatedString(env[NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY]); - }, "environmentVariableSelector"), - /** - * Retrieves auth scheme preference from config file - * @param profile - Config profile object - * @returns Array of auth scheme strings if preference is set, undefined otherwise - */ - configFileSelector: /* @__PURE__ */ __name((profile) => { - if (!(NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY in profile)) return void 0; - return getArrayForCommaSeparatedString(profile[NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY]); - }, "configFileSelector"), - /** - * Default auth scheme preference if not specified in environment or config - */ - default: [] -}; - -// src/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.ts -var import_core = __nccwpck_require__(90475); -var import_property_provider = __nccwpck_require__(57745); -var resolveAwsSdkSigV4AConfig = /* @__PURE__ */ __name((config) => { - config.sigv4aSigningRegionSet = (0, import_core.normalizeProvider)(config.sigv4aSigningRegionSet); - return config; -}, "resolveAwsSdkSigV4AConfig"); -var NODE_SIGV4A_CONFIG_OPTIONS = { - environmentVariableSelector(env) { - if (env.AWS_SIGV4A_SIGNING_REGION_SET) { - return env.AWS_SIGV4A_SIGNING_REGION_SET.split(",").map((_) => _.trim()); - } - throw new import_property_provider.ProviderError("AWS_SIGV4A_SIGNING_REGION_SET not set in env.", { - tryNextLink: true +// src/submodules/protocols/HttpBindingProtocol.ts +var HttpBindingProtocol = class extends HttpProtocol { + async serializeRequest(operationSchema, _input, context) { + const input = { + ..._input ?? {} + }; + const serializer = this.serializer; + const query = {}; + const headers = {}; + const endpoint = await context.endpoint(); + const ns = import_schema2.NormalizedSchema.of(operationSchema?.input); + const schema = ns.getSchema(); + let hasNonHttpBindingMember = false; + let payload; + const request = new import_protocol_http2.HttpRequest({ + protocol: "", + hostname: "", + port: void 0, + path: "", + fragment: void 0, + query, + headers, + body: void 0 }); - }, - configFileSelector(profile) { - if (profile.sigv4a_signing_region_set) { - return (profile.sigv4a_signing_region_set ?? "").split(",").map((_) => _.trim()); + if (endpoint) { + this.updateServiceEndpoint(request, endpoint); + this.setHostPrefix(request, operationSchema, input); + const opTraits = import_schema2.NormalizedSchema.translateTraits(operationSchema.traits); + if (opTraits.http) { + request.method = opTraits.http[0]; + const [path, search] = opTraits.http[1].split("?"); + if (request.path == "/") { + request.path = path; + } else { + request.path += path; + } + const traitSearchParams = new URLSearchParams(search ?? ""); + Object.assign(query, Object.fromEntries(traitSearchParams)); + } } - throw new import_property_provider.ProviderError("sigv4a_signing_region_set not set in profile.", { - tryNextLink: true - }); - }, - default: void 0 -}; - -// src/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.ts -var import_client = __nccwpck_require__(78639); -var import_core2 = __nccwpck_require__(90475); -var import_signature_v4 = __nccwpck_require__(75118); -var resolveAwsSdkSigV4Config = /* @__PURE__ */ __name((config) => { - let inputCredentials = config.credentials; - let isUserSupplied = !!config.credentials; - let resolvedCredentials = void 0; - Object.defineProperty(config, "credentials", { - set(credentials) { - if (credentials && credentials !== inputCredentials && credentials !== resolvedCredentials) { - isUserSupplied = true; + for (const [memberName, memberNs] of ns.structIterator()) { + const memberTraits = memberNs.getMergedTraits() ?? {}; + const inputMemberValue = input[memberName]; + if (inputMemberValue == null) { + continue; } - inputCredentials = credentials; - const memoizedProvider = normalizeCredentialProvider(config, { - credentials: inputCredentials, - credentialDefaultProvider: config.credentialDefaultProvider - }); - const boundProvider = bindCallerConfig(config, memoizedProvider); - if (isUserSupplied && !boundProvider.attributed) { - resolvedCredentials = /* @__PURE__ */ __name(async (options) => boundProvider(options).then( - (creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_CODE", "e") - ), "resolvedCredentials"); - resolvedCredentials.memoized = boundProvider.memoized; - resolvedCredentials.configBound = boundProvider.configBound; - resolvedCredentials.attributed = true; + if (memberTraits.httpPayload) { + const isStreaming = memberNs.isStreaming(); + if (isStreaming) { + const isEventStream = memberNs.isStructSchema(); + if (isEventStream) { + throw new Error("serialization of event streams is not yet implemented"); + } else { + payload = inputMemberValue; + } + } else { + serializer.write(memberNs, inputMemberValue); + payload = serializer.flush(); + } + delete input[memberName]; + } else if (memberTraits.httpLabel) { + serializer.write(memberNs, inputMemberValue); + const replacement = serializer.flush(); + if (request.path.includes(`{${memberName}+}`)) { + request.path = request.path.replace( + `{${memberName}+}`, + replacement.split("/").map(extendedEncodeURIComponent).join("/") + ); + } else if (request.path.includes(`{${memberName}}`)) { + request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); + } + delete input[memberName]; + } else if (memberTraits.httpHeader) { + serializer.write(memberNs, inputMemberValue); + headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); + delete input[memberName]; + } else if (typeof memberTraits.httpPrefixHeaders === "string") { + for (const [key, val] of Object.entries(inputMemberValue)) { + const amalgam = memberTraits.httpPrefixHeaders + key; + serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); + headers[amalgam.toLowerCase()] = serializer.flush(); + } + delete input[memberName]; + } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { + this.serializeQuery(memberNs, inputMemberValue, query); + delete input[memberName]; } else { - resolvedCredentials = boundProvider; + hasNonHttpBindingMember = true; } - }, - get() { - return resolvedCredentials; - }, - enumerable: true, - configurable: true - }); - config.credentials = inputCredentials; - const { - // Default for signingEscapePath - signingEscapePath = true, - // Default for systemClockOffset - systemClockOffset = config.systemClockOffset || 0, - // No default for sha256 since it is platform dependent - sha256 - } = config; - let signer; - if (config.signer) { - signer = (0, import_core2.normalizeProvider)(config.signer); - } else if (config.regionInfoProvider) { - signer = /* @__PURE__ */ __name(() => (0, import_core2.normalizeProvider)(config.region)().then( - async (region) => [ - await config.regionInfoProvider(region, { - useFipsEndpoint: await config.useFipsEndpoint(), - useDualstackEndpoint: await config.useDualstackEndpoint() - }) || {}, - region - ] - ).then(([regionInfo, region]) => { - const { signingRegion, signingService } = regionInfo; - config.signingRegion = config.signingRegion || signingRegion || region; - config.signingName = config.signingName || signingService || config.serviceId; - const params = { - ...config, - credentials: config.credentials, - region: config.signingRegion, - service: config.signingName, - sha256, - uriEscapePath: signingEscapePath - }; - const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; - return new SignerCtor(params); - }), "signer"); - } else { - signer = /* @__PURE__ */ __name(async (authScheme) => { - authScheme = Object.assign( - {}, - { - name: "sigv4", - signingName: config.signingName || config.defaultSigningName, - signingRegion: await (0, import_core2.normalizeProvider)(config.region)(), - properties: {} - }, - authScheme - ); - const signingRegion = authScheme.signingRegion; - const signingService = authScheme.signingName; - config.signingRegion = config.signingRegion || signingRegion; - config.signingName = config.signingName || signingService || config.serviceId; - const params = { - ...config, - credentials: config.credentials, - region: config.signingRegion, - service: config.signingName, - sha256, - uriEscapePath: signingEscapePath - }; - const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; - return new SignerCtor(params); - }, "signer"); + } + if (hasNonHttpBindingMember && input) { + serializer.write(schema, input); + payload = serializer.flush(); + } + request.headers = headers; + request.query = query; + request.body = payload; + return request; } - const resolvedConfig = Object.assign(config, { - systemClockOffset, - signingEscapePath, - signer - }); - return resolvedConfig; -}, "resolveAwsSdkSigV4Config"); -var resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config; -function normalizeCredentialProvider(config, { - credentials, - credentialDefaultProvider -}) { - let credentialsProvider; - if (credentials) { - if (!credentials?.memoized) { - credentialsProvider = (0, import_core2.memoizeIdentityProvider)(credentials, import_core2.isIdentityExpired, import_core2.doesIdentityRequireRefresh); - } else { - credentialsProvider = credentials; + serializeQuery(ns, data, query) { + const serializer = this.serializer; + const traits = ns.getMergedTraits(); + if (traits.httpQueryParams) { + for (const [key, val] of Object.entries(data)) { + if (!(key in query)) { + this.serializeQuery( + import_schema2.NormalizedSchema.of([ + ns.getValueSchema(), + { + // We pass on the traits to the sub-schema + // because we are still in the process of serializing the map itself. + ...traits, + httpQuery: key, + httpQueryParams: void 0 + } + ]), + val, + query + ); + } + } + return; } - } else { - if (credentialDefaultProvider) { - credentialsProvider = (0, import_core2.normalizeProvider)( - credentialDefaultProvider( - Object.assign({}, config, { - parentClientConfig: config - }) - ) - ); + if (ns.isListSchema()) { + const sparse = !!ns.getMergedTraits().sparse; + const buffer = []; + for (const item of data) { + serializer.write([ns.getValueSchema(), traits], item); + const serializable = serializer.flush(); + if (sparse || serializable !== void 0) { + buffer.push(serializable); + } + } + query[traits.httpQuery] = buffer; } else { - credentialsProvider = /* @__PURE__ */ __name(async () => { - throw new Error( - "@aws-sdk/core::resolveAwsSdkSigV4Config - `credentials` not provided and no credentialDefaultProvider was configured." - ); - }, "credentialsProvider"); + serializer.write([ns, traits], data); + query[traits.httpQuery] = serializer.flush(); } } - credentialsProvider.memoized = true; - return credentialsProvider; -} -__name(normalizeCredentialProvider, "normalizeCredentialProvider"); -function bindCallerConfig(config, credentialsProvider) { - if (credentialsProvider.configBound) { - return credentialsProvider; + async deserializeResponse(operationSchema, context, response) { + const deserializer = this.deserializer; + const ns = import_schema2.NormalizedSchema.of(operationSchema.output); + const dataObject = {}; + if (response.statusCode >= 300) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(import_schema2.SCHEMA.DOCUMENT, bytes)); + } + await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); + throw new Error("@smithy/core/protocols - HTTP Protocol error handler failed to throw."); + } + for (const header in response.headers) { + const value = response.headers[header]; + delete response.headers[header]; + response.headers[header.toLowerCase()] = value; + } + const nonHttpBindingMembers = await this.deserializeHttpMessage(ns, context, response, dataObject); + if (nonHttpBindingMembers.length) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + const dataFromBody = await deserializer.read(ns, bytes); + for (const member of nonHttpBindingMembers) { + dataObject[member] = dataFromBody[member]; + } + } + } + const output = { + $metadata: this.deserializeMetadata(response), + ...dataObject + }; + return output; } - const fn = /* @__PURE__ */ __name(async (options) => credentialsProvider({ ...options, callerClientConfig: config }), "fn"); - fn.memoized = credentialsProvider.memoized; - fn.configBound = true; - return fn; -} -__name(bindCallerConfig, "bindCallerConfig"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 48273: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + +// src/submodules/protocols/RpcProtocol.ts +var import_schema3 = __nccwpck_require__(93247); +var import_protocol_http3 = __nccwpck_require__(5559); +var RpcProtocol = class extends HttpProtocol { + async serializeRequest(operationSchema, input, context) { + const serializer = this.serializer; + const query = {}; + const headers = {}; + const endpoint = await context.endpoint(); + const ns = import_schema3.NormalizedSchema.of(operationSchema?.input); + const schema = ns.getSchema(); + let payload; + const request = new import_protocol_http3.HttpRequest({ + protocol: "", + hostname: "", + port: void 0, + path: "/", + fragment: void 0, + query, + headers, + body: void 0 + }); + if (endpoint) { + this.updateServiceEndpoint(request, endpoint); + this.setHostPrefix(request, operationSchema, input); + } + const _input = { + ...input + }; + if (input) { + serializer.write(schema, _input); + payload = serializer.flush(); + } + request.headers = headers; + request.query = query; + request.body = payload; + request.method = "POST"; + return request; + } + async deserializeResponse(operationSchema, context, response) { + const deserializer = this.deserializer; + const ns = import_schema3.NormalizedSchema.of(operationSchema.output); + const dataObject = {}; + if (response.statusCode >= 300) { + const bytes2 = await collectBody(response.body, context); + if (bytes2.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(import_schema3.SCHEMA.DOCUMENT, bytes2)); + } + await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); + throw new Error("@smithy/core/protocols - RPC Protocol error handler failed to throw."); + } + for (const header in response.headers) { + const value = response.headers[header]; + delete response.headers[header]; + response.headers[header.toLowerCase()] = value; + } + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(ns, bytes)); + } + const output = { + $metadata: this.deserializeMetadata(response), + ...dataObject + }; + return output; } - return to; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/protocols/index.ts -var index_exports = {}; -__export(index_exports, { - AwsEc2QueryProtocol: () => AwsEc2QueryProtocol, - AwsJson1_0Protocol: () => AwsJson1_0Protocol, - AwsJson1_1Protocol: () => AwsJson1_1Protocol, - AwsJsonRpcProtocol: () => AwsJsonRpcProtocol, - AwsQueryProtocol: () => AwsQueryProtocol, - AwsRestJsonProtocol: () => AwsRestJsonProtocol, - AwsRestXmlProtocol: () => AwsRestXmlProtocol, - JsonCodec: () => JsonCodec, - JsonShapeDeserializer: () => JsonShapeDeserializer, - JsonShapeSerializer: () => JsonShapeSerializer, - XmlCodec: () => XmlCodec, - XmlShapeDeserializer: () => XmlShapeDeserializer, - XmlShapeSerializer: () => XmlShapeSerializer, - _toBool: () => _toBool, - _toNum: () => _toNum, - _toStr: () => _toStr, - awsExpectUnion: () => awsExpectUnion, - loadRestJsonErrorCode: () => loadRestJsonErrorCode, - loadRestXmlErrorCode: () => loadRestXmlErrorCode, - parseJsonBody: () => parseJsonBody, - parseJsonErrorBody: () => parseJsonErrorBody, - parseXmlBody: () => parseXmlBody, - parseXmlErrorBody: () => parseXmlErrorBody -}); -module.exports = __toCommonJS(index_exports); +// src/submodules/protocols/requestBuilder.ts +var import_protocol_http4 = __nccwpck_require__(5559); -// src/submodules/protocols/coercing-serializers.ts -var _toStr = /* @__PURE__ */ __name((val) => { - if (val == null) { - return val; - } - if (typeof val === "number" || typeof val === "bigint") { - const warning = new Error(`Received number ${val} where a string was expected.`); - warning.name = "Warning"; - console.warn(warning); - return String(val); - } - if (typeof val === "boolean") { - const warning = new Error(`Received boolean ${val} where a string was expected.`); - warning.name = "Warning"; - console.warn(warning); - return String(val); - } - return val; -}, "_toStr"); -var _toBool = /* @__PURE__ */ __name((val) => { - if (val == null) { - return val; - } - if (typeof val === "number") { - } - if (typeof val === "string") { - const lowercase = val.toLowerCase(); - if (val !== "" && lowercase !== "false" && lowercase !== "true") { - const warning = new Error(`Received string "${val}" where a boolean was expected.`); - warning.name = "Warning"; - console.warn(warning); +// src/submodules/protocols/resolve-path.ts +var resolvedPath = (resolvedPath2, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== void 0) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); } - return val !== "" && lowercase !== "false"; + resolvedPath2 = resolvedPath2.replace( + uriLabel, + isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) + ); + } else { + throw new Error("No value provided for input HTTP label: " + memberName + "."); } - return val; -}, "_toBool"); -var _toNum = /* @__PURE__ */ __name((val) => { - if (val == null) { - return val; - } - if (typeof val === "boolean") { + return resolvedPath2; +}; + +// src/submodules/protocols/requestBuilder.ts +function requestBuilder(input, context) { + return new RequestBuilder(input, context); +} +var RequestBuilder = class { + constructor(input, context) { + this.input = input; + this.context = context; + this.query = {}; + this.method = ""; + this.headers = {}; + this.path = ""; + this.body = null; + this.hostname = ""; + this.resolvePathStack = []; } - if (typeof val === "string") { - const num = Number(val); - if (num.toString() !== val) { - const warning = new Error(`Received string "${val}" where a number was expected.`); - warning.name = "Warning"; - console.warn(warning); - return val; + async build() { + const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); + this.path = basePath; + for (const resolvePath of this.resolvePathStack) { + resolvePath(this.path); } - return num; + return new import_protocol_http4.HttpRequest({ + protocol, + hostname: this.hostname || hostname, + port, + method: this.method, + path: this.path, + query: this.query, + body: this.body, + headers: this.headers + }); } - return val; -}, "_toNum"); - -// src/submodules/protocols/json/AwsJsonRpcProtocol.ts -var import_protocols = __nccwpck_require__(50029); -var import_schema3 = __nccwpck_require__(93247); -var import_util_body_length_browser = __nccwpck_require__(60103); - -// src/submodules/protocols/ConfigurableSerdeContext.ts -var SerdeContextConfig = class { - static { - __name(this, "SerdeContextConfig"); + /** + * Brevity setter for "hostname". + */ + hn(hostname) { + this.hostname = hostname; + return this; } - serdeContext; - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; + /** + * Brevity initial builder for "basepath". + */ + bp(uriLabel) { + this.resolvePathStack.push((basePath) => { + this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; + }); + return this; + } + /** + * Brevity incremental builder for "path". + */ + p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { + this.resolvePathStack.push((path) => { + this.path = resolvedPath(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); + }); + return this; + } + /** + * Brevity setter for "headers". + */ + h(headers) { + this.headers = headers; + return this; + } + /** + * Brevity setter for "query". + */ + q(query) { + this.query = query; + return this; + } + /** + * Brevity setter for "body". + */ + b(body) { + this.body = body; + return this; + } + /** + * Brevity setter for "method". + */ + m(method) { + this.method = method; + return this; } }; -// src/submodules/protocols/json/JsonShapeDeserializer.ts -var import_schema = __nccwpck_require__(93247); +// src/submodules/protocols/serde/FromStringShapeDeserializer.ts +var import_schema5 = __nccwpck_require__(93247); var import_serde2 = __nccwpck_require__(38669); var import_util_base64 = __nccwpck_require__(26262); +var import_util_utf8 = __nccwpck_require__(21038); -// src/submodules/protocols/json/jsonReviver.ts -var import_serde = __nccwpck_require__(38669); -function jsonReviver(key, value, context) { - if (context?.source) { - const numericString = context.source; - if (typeof value === "number") { - if (value > Number.MAX_SAFE_INTEGER || value < Number.MIN_SAFE_INTEGER || numericString !== String(value)) { - const isFractional = numericString.includes("."); - if (isFractional) { - return new import_serde.NumericValue(numericString, "bigDecimal"); - } else { - return BigInt(numericString); - } - } +// src/submodules/protocols/serde/determineTimestampFormat.ts +var import_schema4 = __nccwpck_require__(93247); +function determineTimestampFormat(ns, settings) { + if (settings.timestampFormat.useTrait) { + if (ns.isTimestampSchema() && (ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_DATE_TIME || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_EPOCH_SECONDS)) { + return ns.getSchema(); } } - return value; + const { httpLabel, httpPrefixHeaders, httpHeader, httpQuery } = ns.getMergedTraits(); + const bindingFormat = settings.httpBindings ? typeof httpPrefixHeaders === "string" || Boolean(httpHeader) ? import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE : Boolean(httpQuery) || Boolean(httpLabel) ? import_schema4.SCHEMA.TIMESTAMP_DATE_TIME : void 0 : void 0; + return bindingFormat ?? settings.timestampFormat.default; } -__name(jsonReviver, "jsonReviver"); - -// src/submodules/protocols/common.ts -var import_smithy_client = __nccwpck_require__(61411); -var collectBodyString = /* @__PURE__ */ __name((streamBody, context) => (0, import_smithy_client.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)), "collectBodyString"); - -// src/submodules/protocols/json/parseJsonBody.ts -var parseJsonBody = /* @__PURE__ */ __name((streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - try { - return JSON.parse(encoded); - } catch (e) { - if (e?.name === "SyntaxError") { - Object.defineProperty(e, "$responseBodyText", { - value: encoded - }); - } - throw e; - } - } - return {}; -}), "parseJsonBody"); -var parseJsonErrorBody = /* @__PURE__ */ __name(async (errorBody, context) => { - const value = await parseJsonBody(errorBody, context); - value.message = value.message ?? value.Message; - return value; -}, "parseJsonErrorBody"); -var loadRestJsonErrorCode = /* @__PURE__ */ __name((output, data) => { - const findKey = /* @__PURE__ */ __name((object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()), "findKey"); - const sanitizeErrorCode = /* @__PURE__ */ __name((rawValue) => { - let cleanValue = rawValue; - if (typeof cleanValue === "number") { - cleanValue = cleanValue.toString(); - } - if (cleanValue.indexOf(",") >= 0) { - cleanValue = cleanValue.split(",")[0]; - } - if (cleanValue.indexOf(":") >= 0) { - cleanValue = cleanValue.split(":")[0]; - } - if (cleanValue.indexOf("#") >= 0) { - cleanValue = cleanValue.split("#")[1]; - } - return cleanValue; - }, "sanitizeErrorCode"); - const headerKey = findKey(output.headers, "x-amzn-errortype"); - if (headerKey !== void 0) { - return sanitizeErrorCode(output.headers[headerKey]); - } - if (data && typeof data === "object") { - const codeKey = findKey(data, "code"); - if (codeKey && data[codeKey] !== void 0) { - return sanitizeErrorCode(data[codeKey]); - } - if (data["__type"] !== void 0) { - return sanitizeErrorCode(data["__type"]); - } - } -}, "loadRestJsonErrorCode"); -// src/submodules/protocols/json/JsonShapeDeserializer.ts -var JsonShapeDeserializer = class extends SerdeContextConfig { +// src/submodules/protocols/serde/FromStringShapeDeserializer.ts +var FromStringShapeDeserializer = class { constructor(settings) { - super(); this.settings = settings; } - static { - __name(this, "JsonShapeDeserializer"); - } - async read(schema, data) { - return this._read( - schema, - typeof data === "string" ? JSON.parse(data, jsonReviver) : await parseJsonBody(data, this.serdeContext) - ); - } - readObject(schema, data) { - return this._read(schema, data); + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; } - _read(schema, value) { - const isObject = value !== null && typeof value === "object"; - const ns = import_schema.NormalizedSchema.of(schema); - if (ns.isListSchema() && Array.isArray(value)) { - const listMember = ns.getValueSchema(); - const out = []; - const sparse = !!ns.getMergedTraits().sparse; - for (const item of value) { - if (sparse || item != null) { - out.push(this._read(listMember, item)); - } - } - return out; - } else if (ns.isMapSchema() && isObject) { - const mapMember = ns.getValueSchema(); - const out = {}; - const sparse = !!ns.getMergedTraits().sparse; - for (const [_k, _v] of Object.entries(value)) { - if (sparse || _v != null) { - out[_k] = this._read(mapMember, _v); - } - } - return out; - } else if (ns.isStructSchema() && isObject) { - const out = {}; - for (const [memberName, memberSchema] of ns.structIterator()) { - const fromKey = this.settings.jsonName ? memberSchema.getMergedTraits().jsonName ?? memberName : memberName; - const deserializedValue = this._read(memberSchema, value[fromKey]); - if (deserializedValue != null) { - out[memberName] = deserializedValue; - } - } - return out; - } - if (ns.isBlobSchema() && typeof value === "string") { - return (0, import_util_base64.fromBase64)(value); + read(_schema, data) { + const ns = import_schema5.NormalizedSchema.of(_schema); + if (ns.isListSchema()) { + return (0, import_serde2.splitHeader)(data).map((item) => this.read(ns.getValueSchema(), item)); } - const mediaType = ns.getMergedTraits().mediaType; - if (ns.isStringSchema() && typeof value === "string" && mediaType) { - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - return import_serde2.LazyJsonString.from(value); - } + if (ns.isBlobSchema()) { + return (this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(data); } if (ns.isTimestampSchema()) { - const options = this.settings.timestampFormat; - const format = options.useTrait ? ns.getSchema() === import_schema.SCHEMA.TIMESTAMP_DEFAULT ? options.default : ns.getSchema() ?? options.default : options.default; + const format = determineTimestampFormat(ns, this.settings); switch (format) { - case import_schema.SCHEMA.TIMESTAMP_DATE_TIME: - return (0, import_serde2.parseRfc3339DateTimeWithOffset)(value); - case import_schema.SCHEMA.TIMESTAMP_HTTP_DATE: - return (0, import_serde2.parseRfc7231DateTime)(value); - case import_schema.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - return (0, import_serde2.parseEpochTimestamp)(value); + case import_schema5.SCHEMA.TIMESTAMP_DATE_TIME: + return (0, import_serde2.parseRfc3339DateTimeWithOffset)(data); + case import_schema5.SCHEMA.TIMESTAMP_HTTP_DATE: + return (0, import_serde2.parseRfc7231DateTime)(data); + case import_schema5.SCHEMA.TIMESTAMP_EPOCH_SECONDS: + return (0, import_serde2.parseEpochTimestamp)(data); default: - console.warn("Missing timestamp format, parsing value with Date constructor:", value); - return new Date(value); + console.warn("Missing timestamp format, parsing value with Date constructor:", data); + return new Date(data); } } - if (ns.isBigIntegerSchema() && (typeof value === "number" || typeof value === "string")) { - return BigInt(value); - } - if (ns.isBigDecimalSchema() && value != void 0) { - if (value instanceof import_serde2.NumericValue) { - return value; + if (ns.isStringSchema()) { + const mediaType = ns.getMergedTraits().mediaType; + let intermediateValue = data; + if (mediaType) { + if (ns.getMergedTraits().httpHeader) { + intermediateValue = this.base64ToUtf8(intermediateValue); + } + const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); + if (isJson) { + intermediateValue = import_serde2.LazyJsonString.from(intermediateValue); + } + return intermediateValue; } - return new import_serde2.NumericValue(String(value), "bigDecimal"); } - if (ns.isNumericSchema() && typeof value === "string") { - switch (value) { - case "Infinity": - return Infinity; - case "-Infinity": - return -Infinity; - case "NaN": - return NaN; - } + switch (true) { + case ns.isNumericSchema(): + return Number(data); + case ns.isBigIntegerSchema(): + return BigInt(data); + case ns.isBigDecimalSchema(): + return new import_serde2.NumericValue(data, "bigDecimal"); + case ns.isBooleanSchema(): + return String(data).toLowerCase() === "true"; } - return value; + return data; + } + base64ToUtf8(base64String) { + return (this.serdeContext?.utf8Encoder ?? import_util_utf8.toUtf8)((this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(base64String)); } }; -// src/submodules/protocols/json/JsonShapeSerializer.ts -var import_schema2 = __nccwpck_require__(93247); -var import_serde4 = __nccwpck_require__(38669); -var import_serde5 = __nccwpck_require__(38669); - -// src/submodules/protocols/json/jsonReplacer.ts -var import_serde3 = __nccwpck_require__(38669); -var NUMERIC_CONTROL_CHAR = String.fromCharCode(925); -var JsonReplacer = class { - static { - __name(this, "JsonReplacer"); +// src/submodules/protocols/serde/HttpInterceptingShapeDeserializer.ts +var import_schema6 = __nccwpck_require__(93247); +var import_util_utf82 = __nccwpck_require__(21038); +var HttpInterceptingShapeDeserializer = class { + constructor(codecDeserializer, codecSettings) { + this.codecDeserializer = codecDeserializer; + this.stringDeserializer = new FromStringShapeDeserializer(codecSettings); } - /** - * Stores placeholder key to true serialized value lookup. - */ - values = /* @__PURE__ */ new Map(); - counter = 0; - stage = 0; - /** - * Creates a jsonReplacer function that reserves big integer and big decimal values - * for later replacement. - */ - createReplacer() { - if (this.stage === 1) { - throw new Error("@aws-sdk/core/protocols - JsonReplacer already created."); - } - if (this.stage === 2) { - throw new Error("@aws-sdk/core/protocols - JsonReplacer exhausted."); - } - this.stage = 1; - return (key, value) => { - if (value instanceof import_serde3.NumericValue) { - const v = `${NUMERIC_CONTROL_CHAR + +"nv" + this.counter++}_` + value.string; - this.values.set(`"${v}"`, value.string); - return v; - } - if (typeof value === "bigint") { - const s = value.toString(); - const v = `${NUMERIC_CONTROL_CHAR + "b" + this.counter++}_` + s; - this.values.set(`"${v}"`, s); - return v; - } - return value; - }; + setSerdeContext(serdeContext) { + this.stringDeserializer.setSerdeContext(serdeContext); + this.codecDeserializer.setSerdeContext(serdeContext); + this.serdeContext = serdeContext; } - /** - * Replaces placeholder keys with their true values. - */ - replaceInJson(json) { - if (this.stage === 0) { - throw new Error("@aws-sdk/core/protocols - JsonReplacer not created yet."); - } - if (this.stage === 2) { - throw new Error("@aws-sdk/core/protocols - JsonReplacer exhausted."); - } - this.stage = 2; - if (this.counter === 0) { - return json; + read(schema, data) { + const ns = import_schema6.NormalizedSchema.of(schema); + const traits = ns.getMergedTraits(); + const toString = this.serdeContext?.utf8Encoder ?? import_util_utf82.toUtf8; + if (traits.httpHeader || traits.httpResponseCode) { + return this.stringDeserializer.read(ns, toString(data)); } - for (const [key, value] of this.values) { - json = json.replace(key, value); + if (traits.httpPayload) { + if (ns.isBlobSchema()) { + const toBytes = this.serdeContext?.utf8Decoder ?? import_util_utf82.fromUtf8; + if (typeof data === "string") { + return toBytes(data); + } + return data; + } else if (ns.isStringSchema()) { + if ("byteLength" in data) { + return toString(data); + } + return data; + } } - return json; + return this.codecDeserializer.read(ns, data); } }; -// src/submodules/protocols/json/JsonShapeSerializer.ts -var JsonShapeSerializer = class extends SerdeContextConfig { +// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts +var import_schema8 = __nccwpck_require__(93247); + +// src/submodules/protocols/serde/ToStringShapeSerializer.ts +var import_schema7 = __nccwpck_require__(93247); +var import_serde3 = __nccwpck_require__(38669); +var import_util_base642 = __nccwpck_require__(26262); +var ToStringShapeSerializer = class { constructor(settings) { - super(); this.settings = settings; + this.stringBuffer = ""; + this.serdeContext = void 0; } - static { - __name(this, "JsonShapeSerializer"); + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; } - buffer; - rootSchema; write(schema, value) { - this.rootSchema = import_schema2.NormalizedSchema.of(schema); - this.buffer = this._write(this.rootSchema, value); - } - flush() { - if (this.rootSchema?.isStructSchema() || this.rootSchema?.isDocumentSchema()) { - const replacer = new JsonReplacer(); - return replacer.replaceInJson(JSON.stringify(this.buffer, replacer.createReplacer(), 0)); - } - return this.buffer; - } - _write(schema, value, container) { - const isObject = value !== null && typeof value === "object"; - const ns = import_schema2.NormalizedSchema.of(schema); - if (ns.isListSchema() && Array.isArray(value)) { - const listMember = ns.getValueSchema(); - const out = []; - const sparse = !!ns.getMergedTraits().sparse; - for (const item of value) { - if (sparse || item != null) { - out.push(this._write(listMember, item)); + const ns = import_schema7.NormalizedSchema.of(schema); + switch (typeof value) { + case "object": + if (value === null) { + this.stringBuffer = "null"; + return; } - } - return out; - } else if (ns.isMapSchema() && isObject) { - const mapMember = ns.getValueSchema(); - const out = {}; - const sparse = !!ns.getMergedTraits().sparse; - for (const [_k, _v] of Object.entries(value)) { - if (sparse || _v != null) { - out[_k] = this._write(mapMember, _v); + if (ns.isTimestampSchema()) { + if (!(value instanceof Date)) { + throw new Error( + `@smithy/core/protocols - received non-Date value ${value} when schema expected Date in ${ns.getName(true)}` + ); + } + const format = determineTimestampFormat(ns, this.settings); + switch (format) { + case import_schema7.SCHEMA.TIMESTAMP_DATE_TIME: + this.stringBuffer = value.toISOString().replace(".000Z", "Z"); + break; + case import_schema7.SCHEMA.TIMESTAMP_HTTP_DATE: + this.stringBuffer = (0, import_serde3.dateToUtcString)(value); + break; + case import_schema7.SCHEMA.TIMESTAMP_EPOCH_SECONDS: + this.stringBuffer = String(value.getTime() / 1e3); + break; + default: + console.warn("Missing timestamp format, using epoch seconds", value); + this.stringBuffer = String(value.getTime() / 1e3); + } + return; } - } - return out; - } else if (ns.isStructSchema() && isObject) { - const out = {}; - for (const [memberName, memberSchema] of ns.structIterator()) { - const targetKey = this.settings.jsonName ? memberSchema.getMergedTraits().jsonName ?? memberName : memberName; - const serializableValue = this._write(memberSchema, value[memberName], ns); - if (serializableValue !== void 0) { - out[targetKey] = serializableValue; + if (ns.isBlobSchema() && "byteLength" in value) { + this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(value); + return; } - } - return out; - } - if (value === null && container?.isStructSchema()) { - return void 0; - } - if (ns.isBlobSchema() && (value instanceof Uint8Array || typeof value === "string")) { - if (ns === this.rootSchema) { - return value; - } - if (!this.serdeContext?.base64Encoder) { - throw new Error("Missing base64Encoder in serdeContext"); - } - return this.serdeContext?.base64Encoder(value); - } - if (ns.isTimestampSchema() && value instanceof Date) { - const options = this.settings.timestampFormat; - const format = options.useTrait ? ns.getSchema() === import_schema2.SCHEMA.TIMESTAMP_DEFAULT ? options.default : ns.getSchema() ?? options.default : options.default; - switch (format) { - case import_schema2.SCHEMA.TIMESTAMP_DATE_TIME: - return value.toISOString().replace(".000Z", "Z"); - case import_schema2.SCHEMA.TIMESTAMP_HTTP_DATE: - return (0, import_serde4.dateToUtcString)(value); - case import_schema2.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - return value.getTime() / 1e3; - default: - console.warn("Missing timestamp format, using epoch seconds", value); - return value.getTime() / 1e3; - } - } - if (ns.isNumericSchema() && typeof value === "number") { - if (Math.abs(value) === Infinity || isNaN(value)) { - return String(value); - } - } - const mediaType = ns.getMergedTraits().mediaType; - if (ns.isStringSchema() && typeof value === "string" && mediaType) { - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - return import_serde5.LazyJsonString.from(value); - } + if (ns.isListSchema() && Array.isArray(value)) { + let buffer = ""; + for (const item of value) { + this.write([ns.getValueSchema(), ns.getMergedTraits()], item); + const headerItem = this.flush(); + const serialized = ns.getValueSchema().isTimestampSchema() ? headerItem : (0, import_serde3.quoteHeader)(headerItem); + if (buffer !== "") { + buffer += ", "; + } + buffer += serialized; + } + this.stringBuffer = buffer; + return; + } + this.stringBuffer = JSON.stringify(value, null, 2); + break; + case "string": + const mediaType = ns.getMergedTraits().mediaType; + let intermediateValue = value; + if (mediaType) { + const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); + if (isJson) { + intermediateValue = import_serde3.LazyJsonString.from(intermediateValue); + } + if (ns.getMergedTraits().httpHeader) { + this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(intermediateValue.toString()); + return; + } + } + this.stringBuffer = value; + break; + default: + this.stringBuffer = String(value); } - return value; - } -}; - -// src/submodules/protocols/json/JsonCodec.ts -var JsonCodec = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - } - static { - __name(this, "JsonCodec"); - } - createSerializer() { - const serializer = new JsonShapeSerializer(this.settings); - serializer.setSerdeContext(this.serdeContext); - return serializer; } - createDeserializer() { - const deserializer = new JsonShapeDeserializer(this.settings); - deserializer.setSerdeContext(this.serdeContext); - return deserializer; + flush() { + const buffer = this.stringBuffer; + this.stringBuffer = ""; + return buffer; } }; -// src/submodules/protocols/json/AwsJsonRpcProtocol.ts -var AwsJsonRpcProtocol = class extends import_protocols.RpcProtocol { - static { - __name(this, "AwsJsonRpcProtocol"); +// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts +var HttpInterceptingShapeSerializer = class { + constructor(codecSerializer, codecSettings, stringSerializer = new ToStringShapeSerializer(codecSettings)) { + this.codecSerializer = codecSerializer; + this.stringSerializer = stringSerializer; } - serializer; - deserializer; - codec; - constructor({ defaultNamespace }) { - super({ - defaultNamespace - }); - this.codec = new JsonCodec({ - timestampFormat: { - useTrait: true, - default: import_schema3.SCHEMA.TIMESTAMP_EPOCH_SECONDS - }, - jsonName: false - }); - this.serializer = this.codec.createSerializer(); - this.deserializer = this.codec.createDeserializer(); + setSerdeContext(serdeContext) { + this.codecSerializer.setSerdeContext(serdeContext); + this.stringSerializer.setSerdeContext(serdeContext); } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - if (!request.path.endsWith("/")) { - request.path += "/"; - } - Object.assign(request.headers, { - "content-type": `application/x-amz-json-${this.getJsonRpcVersion()}`, - "x-amz-target": (this.getJsonRpcVersion() === "1.0" ? `JsonRpc10.` : `JsonProtocol.`) + import_schema3.NormalizedSchema.of(operationSchema).getName() - }); - if ((0, import_schema3.deref)(operationSchema.input) === "unit" || !request.body) { - request.body = "{}"; - } - try { - request.headers["content-length"] = String((0, import_util_body_length_browser.calculateBodyLength)(request.body)); - } catch (e) { + write(schema, value) { + const ns = import_schema8.NormalizedSchema.of(schema); + const traits = ns.getMergedTraits(); + if (traits.httpHeader || traits.httpLabel || traits.httpQuery) { + this.stringSerializer.write(ns, value); + this.buffer = this.stringSerializer.flush(); + return; } - return request; - } - getPayloadCodec() { - return this.codec; + return this.codecSerializer.write(ns, value); } - async handleError(operationSchema, context, response, dataObject, metadata) { - const errorIdentifier = loadRestJsonErrorCode(response, dataObject) ?? "Unknown"; - let namespace = this.options.defaultNamespace; - let errorName = errorIdentifier; - if (errorIdentifier.includes("#")) { - [namespace, errorName] = errorIdentifier.split("#"); - } - const registry = import_schema3.TypeRegistry.for(namespace); - let errorSchema; - try { - errorSchema = registry.getSchema(errorIdentifier); - } catch (e) { - const baseExceptionSchema = import_schema3.TypeRegistry.for("smithy.ts.sdk.synthetic." + namespace).getBaseException(); - if (baseExceptionSchema) { - const ErrorCtor = baseExceptionSchema.ctor; - throw Object.assign(new ErrorCtor(errorName), dataObject); - } - throw new Error(errorName); - } - const ns = import_schema3.NormalizedSchema.of(errorSchema); - const message = dataObject.message ?? dataObject.Message ?? "Unknown"; - const exception = new errorSchema.ctor(message); - await this.deserializeHttpMessage(errorSchema, context, response, dataObject); - const output = {}; - for (const [name, member] of ns.structIterator()) { - const target = member.getMergedTraits().jsonName ?? name; - output[name] = this.codec.createDeserializer().readObject(member, dataObject[target]); + flush() { + if (this.buffer !== void 0) { + const buffer = this.buffer; + this.buffer = void 0; + return buffer; } - Object.assign(exception, { - $metadata: metadata, - $response: response, - $fault: ns.getMergedTraits().error, - message, - ...output - }); - throw exception; + return this.codecSerializer.flush(); } }; +// Annotate the CommonJS export names for ESM import in node: +0 && (0); -// src/submodules/protocols/json/AwsJson1_0Protocol.ts -var AwsJson1_0Protocol = class extends AwsJsonRpcProtocol { - static { - __name(this, "AwsJson1_0Protocol"); - } - constructor({ defaultNamespace }) { - super({ - defaultNamespace - }); - } - getShapeId() { - return "aws.protocols#awsJson1_0"; - } - getJsonRpcVersion() { - return "1.0"; + +/***/ }), + +/***/ 93247: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/protocols/json/AwsJson1_1Protocol.ts -var AwsJson1_1Protocol = class extends AwsJsonRpcProtocol { - static { - __name(this, "AwsJson1_1Protocol"); - } - constructor({ defaultNamespace }) { - super({ - defaultNamespace - }); - } - getShapeId() { - return "aws.protocols#awsJson1_1"; - } - getJsonRpcVersion() { - return "1.1"; +// src/submodules/schema/index.ts +var schema_exports = {}; +__export(schema_exports, { + ErrorSchema: () => ErrorSchema, + ListSchema: () => ListSchema, + MapSchema: () => MapSchema, + NormalizedSchema: () => NormalizedSchema, + OperationSchema: () => OperationSchema, + SCHEMA: () => SCHEMA, + Schema: () => Schema, + SimpleSchema: () => SimpleSchema, + StructureSchema: () => StructureSchema, + TypeRegistry: () => TypeRegistry, + deref: () => deref, + deserializerMiddlewareOption: () => deserializerMiddlewareOption, + error: () => error, + getSchemaSerdePlugin: () => getSchemaSerdePlugin, + list: () => list, + map: () => map, + op: () => op, + serializerMiddlewareOption: () => serializerMiddlewareOption, + sim: () => sim, + struct: () => struct +}); +module.exports = __toCommonJS(schema_exports); + +// src/submodules/schema/deref.ts +var deref = (schemaRef) => { + if (typeof schemaRef === "function") { + return schemaRef(); } + return schemaRef; }; -// src/submodules/protocols/json/AwsRestJsonProtocol.ts -var import_protocols2 = __nccwpck_require__(50029); -var import_schema4 = __nccwpck_require__(93247); -var import_util_body_length_browser2 = __nccwpck_require__(60103); -var AwsRestJsonProtocol = class extends import_protocols2.HttpBindingProtocol { - static { - __name(this, "AwsRestJsonProtocol"); - } - serializer; - deserializer; - codec; - constructor({ defaultNamespace }) { - super({ - defaultNamespace - }); - const settings = { - timestampFormat: { - useTrait: true, - default: import_schema4.SCHEMA.TIMESTAMP_EPOCH_SECONDS +// src/submodules/schema/middleware/schemaDeserializationMiddleware.ts +var import_protocol_http = __nccwpck_require__(5559); +var import_util_middleware = __nccwpck_require__(25695); +var schemaDeserializationMiddleware = (config) => (next, context) => async (args) => { + const { response } = await next(args); + const { operationSchema } = (0, import_util_middleware.getSmithyContext)(context); + try { + const parsed = await config.protocol.deserializeResponse( + operationSchema, + { + ...config, + ...context }, - httpBindings: true, - jsonName: true + response + ); + return { + response, + output: parsed }; - this.codec = new JsonCodec(settings); - this.serializer = new import_protocols2.HttpInterceptingShapeSerializer(this.codec.createSerializer(), settings); - this.deserializer = new import_protocols2.HttpInterceptingShapeDeserializer(this.codec.createDeserializer(), settings); - } - getShapeId() { - return "aws.protocols#restJson1"; - } - getPayloadCodec() { - return this.codec; - } - setSerdeContext(serdeContext) { - this.codec.setSerdeContext(serdeContext); - super.setSerdeContext(serdeContext); - } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - const inputSchema = import_schema4.NormalizedSchema.of(operationSchema.input); - const members = inputSchema.getMemberSchemas(); - if (!request.headers["content-type"]) { - const httpPayloadMember = Object.values(members).find((m) => { - return !!m.getMergedTraits().httpPayload; - }); - if (httpPayloadMember) { - const mediaType = httpPayloadMember.getMergedTraits().mediaType; - if (mediaType) { - request.headers["content-type"] = mediaType; - } else if (httpPayloadMember.isStringSchema()) { - request.headers["content-type"] = "text/plain"; - } else if (httpPayloadMember.isBlobSchema()) { - request.headers["content-type"] = "application/octet-stream"; + } catch (error2) { + Object.defineProperty(error2, "$response", { + value: response + }); + if (!("$metadata" in error2)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + try { + error2.message += "\n " + hint; + } catch (e) { + if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { + console.warn(hint); } else { - request.headers["content-type"] = "application/json"; + context.logger?.warn?.(hint); } - } else if (!inputSchema.isUnitSchema()) { - const hasBody = Object.values(members).find((m) => { - const { httpQuery, httpQueryParams, httpHeader, httpLabel, httpPrefixHeaders } = m.getMergedTraits(); - return !httpQuery && !httpQueryParams && !httpHeader && !httpLabel && httpPrefixHeaders === void 0; - }); - if (hasBody) { - request.headers["content-type"] = "application/json"; + } + if (typeof error2.$responseBodyText !== "undefined") { + if (error2.$response) { + error2.$response.body = error2.$responseBodyText; } } - } - if (request.headers["content-type"] && !request.body) { - request.body = "{}"; - } - if (request.body) { try { - request.headers["content-length"] = String((0, import_util_body_length_browser2.calculateBodyLength)(request.body)); + if (import_protocol_http.HttpResponse.isInstance(response)) { + const { headers = {} } = response; + const headerEntries = Object.entries(headers); + error2.$metadata = { + httpStatusCode: response.statusCode, + requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), + extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), + cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) + }; + } } catch (e) { } } - return request; - } - async handleError(operationSchema, context, response, dataObject, metadata) { - const errorIdentifier = loadRestJsonErrorCode(response, dataObject) ?? "Unknown"; - let namespace = this.options.defaultNamespace; - let errorName = errorIdentifier; - if (errorIdentifier.includes("#")) { - [namespace, errorName] = errorIdentifier.split("#"); - } - const registry = import_schema4.TypeRegistry.for(namespace); - let errorSchema; - try { - errorSchema = registry.getSchema(errorIdentifier); - } catch (e) { - const baseExceptionSchema = import_schema4.TypeRegistry.for("smithy.ts.sdk.synthetic." + namespace).getBaseException(); - if (baseExceptionSchema) { - const ErrorCtor = baseExceptionSchema.ctor; - throw Object.assign(new ErrorCtor(errorName), dataObject); - } - throw new Error(errorName); - } - const ns = import_schema4.NormalizedSchema.of(errorSchema); - const message = dataObject.message ?? dataObject.Message ?? "Unknown"; - const exception = new errorSchema.ctor(message); - await this.deserializeHttpMessage(errorSchema, context, response, dataObject); - const output = {}; - for (const [name, member] of ns.structIterator()) { - const target = member.getMergedTraits().jsonName ?? name; - output[name] = this.codec.createDeserializer().readObject(member, dataObject[target]); - } - Object.assign(exception, { - $metadata: metadata, - $response: response, - $fault: ns.getMergedTraits().error, - message, - ...output - }); - throw exception; + throw error2; } }; +var findHeader = (pattern, headers) => { + return (headers.find(([k]) => { + return k.match(pattern); + }) || [void 0, void 0])[1]; +}; -// src/submodules/protocols/json/awsExpectUnion.ts -var import_smithy_client2 = __nccwpck_require__(61411); -var awsExpectUnion = /* @__PURE__ */ __name((value) => { - if (value == null) { - return void 0; - } - if (typeof value === "object" && "__type" in value) { - delete value.__type; - } - return (0, import_smithy_client2.expectUnion)(value); -}, "awsExpectUnion"); +// src/submodules/schema/middleware/schemaSerializationMiddleware.ts +var import_util_middleware2 = __nccwpck_require__(25695); +var schemaSerializationMiddleware = (config) => (next, context) => async (args) => { + const { operationSchema } = (0, import_util_middleware2.getSmithyContext)(context); + const endpoint = context.endpointV2?.url && config.urlParser ? async () => config.urlParser(context.endpointV2.url) : config.endpoint; + const request = await config.protocol.serializeRequest(operationSchema, args.input, { + ...config, + ...context, + endpoint + }); + return next({ + ...args, + request + }); +}; -// src/submodules/protocols/query/AwsQueryProtocol.ts -var import_protocols5 = __nccwpck_require__(50029); -var import_schema7 = __nccwpck_require__(93247); -var import_util_body_length_browser3 = __nccwpck_require__(60103); +// src/submodules/schema/middleware/getSchemaSerdePlugin.ts +var deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true +}; +var serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true +}; +function getSchemaSerdePlugin(config) { + return { + applyToStack: (commandStack) => { + commandStack.add(schemaSerializationMiddleware(config), serializerMiddlewareOption); + commandStack.add(schemaDeserializationMiddleware(config), deserializerMiddlewareOption); + config.protocol.setSerdeContext(config); + } + }; +} -// src/submodules/protocols/xml/XmlShapeDeserializer.ts -var import_protocols3 = __nccwpck_require__(50029); -var import_schema5 = __nccwpck_require__(93247); -var import_smithy_client3 = __nccwpck_require__(61411); -var import_util_utf8 = __nccwpck_require__(21038); -var import_fast_xml_parser = __nccwpck_require__(30728); -var XmlShapeDeserializer = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - this.stringDeserializer = new import_protocols3.FromStringShapeDeserializer(settings); +// src/submodules/schema/TypeRegistry.ts +var TypeRegistry = class _TypeRegistry { + constructor(namespace, schemas = /* @__PURE__ */ new Map()) { + this.namespace = namespace; + this.schemas = schemas; } static { - __name(this, "XmlShapeDeserializer"); + this.registries = /* @__PURE__ */ new Map(); } - stringDeserializer; - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - this.stringDeserializer.setSerdeContext(serdeContext); + /** + * @param namespace - specifier. + * @returns the schema for that namespace, creating it if necessary. + */ + static for(namespace) { + if (!_TypeRegistry.registries.has(namespace)) { + _TypeRegistry.registries.set(namespace, new _TypeRegistry(namespace)); + } + return _TypeRegistry.registries.get(namespace); } /** - * @param schema - describing the data. - * @param bytes - serialized data. - * @param key - used by AwsQuery to step one additional depth into the object before reading it. + * Adds the given schema to a type registry with the same namespace. + * + * @param shapeId - to be registered. + * @param schema - to be registered. */ - read(schema, bytes, key) { - const ns = import_schema5.NormalizedSchema.of(schema); - const memberSchemas = ns.getMemberSchemas(); - const isEventPayload = ns.isStructSchema() && ns.isMemberSchema() && !!Object.values(memberSchemas).find((memberNs) => { - return !!memberNs.getMemberTraits().eventPayload; - }); - if (isEventPayload) { - const output = {}; - const memberName = Object.keys(memberSchemas)[0]; - const eventMemberSchema = memberSchemas[memberName]; - if (eventMemberSchema.isBlobSchema()) { - output[memberName] = bytes; - } else { - output[memberName] = this.read(memberSchemas[memberName], bytes); - } - return output; - } - const xmlString = (this.serdeContext?.utf8Encoder ?? import_util_utf8.toUtf8)(bytes); - const parsedObject = this.parseXml(xmlString); - return this.readSchema(schema, key ? parsedObject[key] : parsedObject); + register(shapeId, schema) { + const qualifiedName = this.normalizeShapeId(shapeId); + const registry = _TypeRegistry.for(this.getNamespace(shapeId)); + registry.schemas.set(qualifiedName, schema); } - readSchema(_schema, value) { - const ns = import_schema5.NormalizedSchema.of(_schema); - const traits = ns.getMergedTraits(); - if (ns.isListSchema() && !Array.isArray(value)) { - return this.readSchema(ns, [value]); - } - if (value == null) { - return value; + /** + * @param shapeId - query. + * @returns the schema. + */ + getSchema(shapeId) { + const id = this.normalizeShapeId(shapeId); + if (!this.schemas.has(id)) { + throw new Error(`@smithy/core/schema - schema not found for ${id}`); } - if (typeof value === "object") { - const sparse = !!traits.sparse; - const flat = !!traits.xmlFlattened; - if (ns.isListSchema()) { - const listValue = ns.getValueSchema(); - const buffer2 = []; - const sourceKey = listValue.getMergedTraits().xmlName ?? "member"; - const source = flat ? value : (value[0] ?? value)[sourceKey]; - const sourceArray = Array.isArray(source) ? source : [source]; - for (const v of sourceArray) { - if (v != null || sparse) { - buffer2.push(this.readSchema(listValue, v)); - } - } - return buffer2; - } - const buffer = {}; - if (ns.isMapSchema()) { - const keyNs = ns.getKeySchema(); - const memberNs = ns.getValueSchema(); - let entries; - if (flat) { - entries = Array.isArray(value) ? value : [value]; - } else { - entries = Array.isArray(value.entry) ? value.entry : [value.entry]; - } - const keyProperty = keyNs.getMergedTraits().xmlName ?? "key"; - const valueProperty = memberNs.getMergedTraits().xmlName ?? "value"; - for (const entry of entries) { - const key = entry[keyProperty]; - const value2 = entry[valueProperty]; - if (value2 != null || sparse) { - buffer[key] = this.readSchema(memberNs, value2); - } - } - return buffer; - } - if (ns.isStructSchema()) { - for (const [memberName, memberSchema] of ns.structIterator()) { - const memberTraits = memberSchema.getMergedTraits(); - const xmlObjectKey = !memberTraits.httpPayload ? memberSchema.getMemberTraits().xmlName ?? memberName : memberTraits.xmlName ?? memberSchema.getName(); - if (value[xmlObjectKey] != null) { - buffer[memberName] = this.readSchema(memberSchema, value[xmlObjectKey]); - } - } - return buffer; - } - if (ns.isDocumentSchema()) { - return value; + return this.schemas.get(id); + } + /** + * The smithy-typescript code generator generates a synthetic (i.e. unmodeled) base exception, + * because generated SDKs before the introduction of schemas have the notion of a ServiceBaseException, which + * is unique per service/model. + * + * This is generated under a unique prefix that is combined with the service namespace, and this + * method is used to retrieve it. + * + * The base exception synthetic schema is used when an error is returned by a service, but we cannot + * determine what existing schema to use to deserialize it. + * + * @returns the synthetic base exception of the service namespace associated with this registry instance. + */ + getBaseException() { + for (const [id, schema] of this.schemas.entries()) { + if (id.startsWith("smithy.ts.sdk.synthetic.") && id.endsWith("ServiceException")) { + return schema; } - throw new Error(`@aws-sdk/core/protocols - xml deserializer unhandled schema type for ${ns.getName(true)}`); - } - if (ns.isListSchema()) { - return []; - } - if (ns.isMapSchema() || ns.isStructSchema()) { - return {}; } - return this.stringDeserializer.read(ns, value); + return void 0; } - parseXml(xml) { - if (xml.length) { - const parser = new import_fast_xml_parser.XMLParser({ - attributeNamePrefix: "", - htmlEntities: true, - ignoreAttributes: false, - ignoreDeclaration: true, - parseTagValue: false, - trimValues: false, - tagValueProcessor: /* @__PURE__ */ __name((_, val) => val.trim() === "" && val.includes("\n") ? "" : void 0, "tagValueProcessor") - }); - parser.addEntity("#xD", "\r"); - parser.addEntity("#10", "\n"); - let parsedObj; - try { - parsedObj = parser.parse(xml, true); - } catch (e) { - if (e && typeof e === "object") { - Object.defineProperty(e, "$responseBodyText", { - value: xml - }); - } - throw e; - } - const textNodeName = "#text"; - const key = Object.keys(parsedObj)[0]; - const parsedObjToReturn = parsedObj[key]; - if (parsedObjToReturn[textNodeName]) { - parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; - delete parsedObjToReturn[textNodeName]; - } - return (0, import_smithy_client3.getValueFromTextNode)(parsedObjToReturn); + /** + * @param predicate - criterion. + * @returns a schema in this registry matching the predicate. + */ + find(predicate) { + return [...this.schemas.values()].find(predicate); + } + /** + * Unloads the current TypeRegistry. + */ + destroy() { + _TypeRegistry.registries.delete(this.namespace); + this.schemas.clear(); + } + normalizeShapeId(shapeId) { + if (shapeId.includes("#")) { + return shapeId; } - return {}; + return this.namespace + "#" + shapeId; + } + getNamespace(shapeId) { + return this.normalizeShapeId(shapeId).split("#")[0]; } }; -// src/submodules/protocols/query/QueryShapeSerializer.ts -var import_protocols4 = __nccwpck_require__(50029); -var import_schema6 = __nccwpck_require__(93247); -var import_serde6 = __nccwpck_require__(38669); -var import_smithy_client4 = __nccwpck_require__(61411); -var import_util_base642 = __nccwpck_require__(26262); -var QueryShapeSerializer = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; +// src/submodules/schema/schemas/Schema.ts +var Schema = class { + constructor(name, traits) { + this.name = name; + this.traits = traits; + } +}; + +// src/submodules/schema/schemas/ListSchema.ts +var ListSchema = class _ListSchema extends Schema { + constructor(name, traits, valueSchema) { + super(name, traits); + this.name = name; + this.traits = traits; + this.valueSchema = valueSchema; + this.symbol = _ListSchema.symbol; } static { - __name(this, "QueryShapeSerializer"); + this.symbol = Symbol.for("@smithy/core/schema::ListSchema"); } - buffer; - write(schema, value, prefix = "") { - if (this.buffer === void 0) { - this.buffer = ""; - } - const ns = import_schema6.NormalizedSchema.of(schema); - if (prefix && !prefix.endsWith(".")) { - prefix += "."; - } - if (ns.isBlobSchema()) { - if (typeof value === "string" || value instanceof Uint8Array) { - this.writeKey(prefix); - this.writeValue((this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(value)); - } - } else if (ns.isBooleanSchema() || ns.isNumericSchema() || ns.isStringSchema()) { - if (value != null) { - this.writeKey(prefix); - this.writeValue(String(value)); - } - } else if (ns.isBigIntegerSchema()) { - if (value != null) { - this.writeKey(prefix); - this.writeValue(String(value)); - } - } else if (ns.isBigDecimalSchema()) { - if (value != null) { - this.writeKey(prefix); - this.writeValue(value instanceof import_serde6.NumericValue ? value.string : String(value)); - } - } else if (ns.isTimestampSchema()) { - if (value instanceof Date) { - this.writeKey(prefix); - const format = (0, import_protocols4.determineTimestampFormat)(ns, this.settings); - switch (format) { - case import_schema6.SCHEMA.TIMESTAMP_DATE_TIME: - this.writeValue(value.toISOString().replace(".000Z", "Z")); - break; - case import_schema6.SCHEMA.TIMESTAMP_HTTP_DATE: - this.writeValue((0, import_smithy_client4.dateToUtcString)(value)); - break; - case import_schema6.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - this.writeValue(String(value.getTime() / 1e3)); - break; - } - } - } else if (ns.isDocumentSchema()) { - throw new Error(`@aws-sdk/core/protocols - QuerySerializer unsupported document type ${ns.getName(true)}`); - } else if (ns.isListSchema()) { - if (Array.isArray(value)) { - if (value.length === 0) { - if (this.settings.serializeEmptyLists) { - this.writeKey(prefix); - this.writeValue(""); - } - } else { - const member = ns.getValueSchema(); - const flat = this.settings.flattenLists || ns.getMergedTraits().xmlFlattened; - let i = 1; - for (const item of value) { - if (item == null) { - continue; - } - const suffix = this.getKey("member", member.getMergedTraits().xmlName); - const key = flat ? `${prefix}${i}` : `${prefix}${suffix}.${i}`; - this.write(member, item, key); - ++i; - } - } - } - } else if (ns.isMapSchema()) { - if (value && typeof value === "object") { - const keySchema = ns.getKeySchema(); - const memberSchema = ns.getValueSchema(); - const flat = ns.getMergedTraits().xmlFlattened; - let i = 1; - for (const [k, v] of Object.entries(value)) { - if (v == null) { - continue; - } - const keySuffix = this.getKey("key", keySchema.getMergedTraits().xmlName); - const key = flat ? `${prefix}${i}.${keySuffix}` : `${prefix}entry.${i}.${keySuffix}`; - const valueSuffix = this.getKey("value", memberSchema.getMergedTraits().xmlName); - const valueKey = flat ? `${prefix}${i}.${valueSuffix}` : `${prefix}entry.${i}.${valueSuffix}`; - this.write(keySchema, k, key); - this.write(memberSchema, v, valueKey); - ++i; - } - } - } else if (ns.isStructSchema()) { - if (value && typeof value === "object") { - for (const [memberName, member] of ns.structIterator()) { - if (value[memberName] == null) { - continue; - } - const suffix = this.getKey(memberName, member.getMergedTraits().xmlName); - const key = `${prefix}${suffix}`; - this.write(member, value[memberName], key); - } - } - } else if (ns.isUnitSchema()) { - } else { - throw new Error(`@aws-sdk/core/protocols - QuerySerializer unrecognized schema type ${ns.getName(true)}`); + static [Symbol.hasInstance](lhs) { + const isPrototype = _ListSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const list2 = lhs; + return list2.symbol === _ListSchema.symbol; } + return isPrototype; } - flush() { - if (this.buffer === void 0) { - throw new Error("@aws-sdk/core/protocols - QuerySerializer cannot flush with nothing written to buffer."); - } - const str = this.buffer; - delete this.buffer; - return str; +}; +function list(namespace, name, traits = {}, valueSchema) { + const schema = new ListSchema( + namespace + "#" + name, + traits, + typeof valueSchema === "function" ? valueSchema() : valueSchema + ); + TypeRegistry.for(namespace).register(name, schema); + return schema; +} + +// src/submodules/schema/schemas/MapSchema.ts +var MapSchema = class _MapSchema extends Schema { + constructor(name, traits, keySchema, valueSchema) { + super(name, traits); + this.name = name; + this.traits = traits; + this.keySchema = keySchema; + this.valueSchema = valueSchema; + this.symbol = _MapSchema.symbol; } - getKey(memberName, xmlName) { - const key = xmlName ?? memberName; - if (this.settings.capitalizeKeys) { - return key[0].toUpperCase() + key.slice(1); - } - return key; + static { + this.symbol = Symbol.for("@smithy/core/schema::MapSchema"); } - writeKey(key) { - if (key.endsWith(".")) { - key = key.slice(0, key.length - 1); + static [Symbol.hasInstance](lhs) { + const isPrototype = _MapSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const map2 = lhs; + return map2.symbol === _MapSchema.symbol; } - this.buffer += `&${(0, import_protocols4.extendedEncodeURIComponent)(key)}=`; + return isPrototype; } - writeValue(value) { - this.buffer += (0, import_protocols4.extendedEncodeURIComponent)(value); +}; +function map(namespace, name, traits = {}, keySchema, valueSchema) { + const schema = new MapSchema( + namespace + "#" + name, + traits, + keySchema, + typeof valueSchema === "function" ? valueSchema() : valueSchema + ); + TypeRegistry.for(namespace).register(name, schema); + return schema; +} + +// src/submodules/schema/schemas/OperationSchema.ts +var OperationSchema = class extends Schema { + constructor(name, traits, input, output) { + super(name, traits); + this.name = name; + this.traits = traits; + this.input = input; + this.output = output; } }; +function op(namespace, name, traits = {}, input, output) { + const schema = new OperationSchema(namespace + "#" + name, traits, input, output); + TypeRegistry.for(namespace).register(name, schema); + return schema; +} -// src/submodules/protocols/query/AwsQueryProtocol.ts -var AwsQueryProtocol = class extends import_protocols5.RpcProtocol { - constructor(options) { - super({ - defaultNamespace: options.defaultNamespace - }); - this.options = options; - const settings = { - timestampFormat: { - useTrait: true, - default: import_schema7.SCHEMA.TIMESTAMP_DATE_TIME - }, - httpBindings: false, - xmlNamespace: options.xmlNamespace, - serviceNamespace: options.defaultNamespace, - serializeEmptyLists: true - }; - this.serializer = new QueryShapeSerializer(settings); - this.deserializer = new XmlShapeDeserializer(settings); +// src/submodules/schema/schemas/StructureSchema.ts +var StructureSchema = class _StructureSchema extends Schema { + constructor(name, traits, memberNames, memberList) { + super(name, traits); + this.name = name; + this.traits = traits; + this.memberNames = memberNames; + this.memberList = memberList; + this.symbol = _StructureSchema.symbol; + this.members = {}; + for (let i = 0; i < memberNames.length; ++i) { + this.members[memberNames[i]] = Array.isArray(memberList[i]) ? memberList[i] : [memberList[i], 0]; + } } static { - __name(this, "AwsQueryProtocol"); - } - serializer; - deserializer; - getShapeId() { - return "aws.protocols#awsQuery"; - } - setSerdeContext(serdeContext) { - this.serializer.setSerdeContext(serdeContext); - this.deserializer.setSerdeContext(serdeContext); - } - getPayloadCodec() { - throw new Error("AWSQuery protocol has no payload codec."); + this.symbol = Symbol.for("@smithy/core/schema::StructureSchema"); } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - if (!request.path.endsWith("/")) { - request.path += "/"; - } - Object.assign(request.headers, { - "content-type": `application/x-www-form-urlencoded` - }); - if ((0, import_schema7.deref)(operationSchema.input) === "unit" || !request.body) { - request.body = ""; - } - request.body = `Action=${operationSchema.name.split("#")[1]}&Version=${this.options.version}` + request.body; - if (request.body.endsWith("&")) { - request.body = request.body.slice(-1); - } - try { - request.headers["content-length"] = String((0, import_util_body_length_browser3.calculateBodyLength)(request.body)); - } catch (e) { + static [Symbol.hasInstance](lhs) { + const isPrototype = _StructureSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const struct2 = lhs; + return struct2.symbol === _StructureSchema.symbol; } - return request; + return isPrototype; } - async deserializeResponse(operationSchema, context, response) { - const deserializer = this.deserializer; - const ns = import_schema7.NormalizedSchema.of(operationSchema.output); - const dataObject = {}; - if (response.statusCode >= 300) { - const bytes2 = await (0, import_protocols5.collectBody)(response.body, context); - if (bytes2.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(import_schema7.SCHEMA.DOCUMENT, bytes2)); - } - await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); - } - for (const header in response.headers) { - const value = response.headers[header]; - delete response.headers[header]; - response.headers[header.toLowerCase()] = value; - } - const awsQueryResultKey = ns.isStructSchema() && this.useNestedResult() ? operationSchema.name.split("#")[1] + "Result" : void 0; - const bytes = await (0, import_protocols5.collectBody)(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(ns, bytes, awsQueryResultKey)); - } - const output = { - $metadata: this.deserializeMetadata(response), - ...dataObject - }; - return output; +}; +function struct(namespace, name, traits, memberNames, memberList) { + const schema = new StructureSchema(namespace + "#" + name, traits, memberNames, memberList); + TypeRegistry.for(namespace).register(name, schema); + return schema; +} + +// src/submodules/schema/schemas/ErrorSchema.ts +var ErrorSchema = class _ErrorSchema extends StructureSchema { + constructor(name, traits, memberNames, memberList, ctor) { + super(name, traits, memberNames, memberList); + this.name = name; + this.traits = traits; + this.memberNames = memberNames; + this.memberList = memberList; + this.ctor = ctor; + this.symbol = _ErrorSchema.symbol; } - /** - * EC2 Query overrides this. - */ - useNestedResult() { - return true; + static { + this.symbol = Symbol.for("@smithy/core/schema::ErrorSchema"); } - async handleError(operationSchema, context, response, dataObject, metadata) { - const errorIdentifier = this.loadQueryErrorCode(response, dataObject) ?? "Unknown"; - let namespace = this.options.defaultNamespace; - let errorName = errorIdentifier; - if (errorIdentifier.includes("#")) { - [namespace, errorName] = errorIdentifier.split("#"); + static [Symbol.hasInstance](lhs) { + const isPrototype = _ErrorSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const err = lhs; + return err.symbol === _ErrorSchema.symbol; } - const errorDataSource = this.loadQueryError(dataObject); - const registry = import_schema7.TypeRegistry.for(namespace); - let errorSchema; - try { - errorSchema = registry.find( - (schema) => import_schema7.NormalizedSchema.of(schema).getMergedTraits().awsQueryError?.[0] === errorName - ); - if (!errorSchema) { - errorSchema = registry.getSchema(errorIdentifier); - } - } catch (e) { - const baseExceptionSchema = import_schema7.TypeRegistry.for("smithy.ts.sdk.synthetic." + namespace).getBaseException(); - if (baseExceptionSchema) { - const ErrorCtor = baseExceptionSchema.ctor; - throw Object.assign(new ErrorCtor(errorName), errorDataSource); - } - throw new Error(errorName); - } - const ns = import_schema7.NormalizedSchema.of(errorSchema); - const message = this.loadQueryErrorMessage(dataObject); - const exception = new errorSchema.ctor(message); - const output = {}; - for (const [name, member] of ns.structIterator()) { - const target = member.getMergedTraits().xmlName ?? name; - const value = errorDataSource[target] ?? dataObject[target]; - output[name] = this.deserializer.readSchema(member, value); + return isPrototype; + } +}; +function error(namespace, name, traits = {}, memberNames, memberList, ctor) { + const schema = new ErrorSchema(namespace + "#" + name, traits, memberNames, memberList, ctor); + TypeRegistry.for(namespace).register(name, schema); + return schema; +} + +// src/submodules/schema/schemas/sentinels.ts +var SCHEMA = { + BLOB: 21, + // 21 + STREAMING_BLOB: 42, + // 42 + BOOLEAN: 2, + // 2 + STRING: 0, + // 0 + NUMERIC: 1, + // 1 + BIG_INTEGER: 17, + // 17 + BIG_DECIMAL: 19, + // 19 + DOCUMENT: 15, + // 15 + TIMESTAMP_DEFAULT: 4, + // 4 + TIMESTAMP_DATE_TIME: 5, + // 5 + TIMESTAMP_HTTP_DATE: 6, + // 6 + TIMESTAMP_EPOCH_SECONDS: 7, + // 7 + LIST_MODIFIER: 64, + // 64 + MAP_MODIFIER: 128 + // 128 +}; + +// src/submodules/schema/schemas/SimpleSchema.ts +var SimpleSchema = class _SimpleSchema extends Schema { + constructor(name, schemaRef, traits) { + super(name, traits); + this.name = name; + this.schemaRef = schemaRef; + this.traits = traits; + this.symbol = _SimpleSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::SimpleSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _SimpleSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const sim2 = lhs; + return sim2.symbol === _SimpleSchema.symbol; } - Object.assign(exception, { - $metadata: metadata, - $response: response, - $fault: ns.getMergedTraits().error, - message, - ...output - }); - throw exception; + return isPrototype; } +}; +function sim(namespace, name, schemaRef, traits) { + const schema = new SimpleSchema(namespace + "#" + name, schemaRef, traits); + TypeRegistry.for(namespace).register(name, schema); + return schema; +} + +// src/submodules/schema/schemas/NormalizedSchema.ts +var NormalizedSchema = class _NormalizedSchema { /** - * The variations in the error and error message locations are attributed to - * divergence between AWS Query and EC2 Query behavior. + * @param ref - a polymorphic SchemaRef to be dereferenced/normalized. + * @param memberName - optional memberName if this NormalizedSchema should be considered a member schema. */ - loadQueryErrorCode(output, data) { - const code = (data.Errors?.[0]?.Error ?? data.Errors?.Error ?? data.Error)?.Code; - if (code !== void 0) { - return code; + constructor(ref, memberName) { + this.ref = ref; + this.memberName = memberName; + this.symbol = _NormalizedSchema.symbol; + const traitStack = []; + let _ref = ref; + let schema = ref; + this._isMemberSchema = false; + while (Array.isArray(_ref)) { + traitStack.push(_ref[1]); + _ref = _ref[0]; + schema = deref(_ref); + this._isMemberSchema = true; } - if (output.statusCode == 404) { - return "NotFound"; + if (traitStack.length > 0) { + this.memberTraits = {}; + for (let i = traitStack.length - 1; i >= 0; --i) { + const traitSet = traitStack[i]; + Object.assign(this.memberTraits, _NormalizedSchema.translateTraits(traitSet)); + } + } else { + this.memberTraits = 0; + } + if (schema instanceof _NormalizedSchema) { + this.name = schema.name; + this.traits = schema.traits; + this._isMemberSchema = schema._isMemberSchema; + this.schema = schema.schema; + this.memberTraits = Object.assign({}, schema.getMemberTraits(), this.getMemberTraits()); + this.normalizedTraits = void 0; + this.ref = schema.ref; + this.memberName = memberName ?? schema.memberName; + return; + } + this.schema = deref(schema); + if (this.schema && typeof this.schema === "object") { + this.traits = this.schema?.traits ?? {}; + } else { + this.traits = 0; + } + this.name = (typeof this.schema === "object" ? this.schema?.name : void 0) ?? this.memberName ?? this.getSchemaName(); + if (this._isMemberSchema && !memberName) { + throw new Error( + `@smithy/core/schema - NormalizedSchema member schema ${this.getName( + true + )} must initialize with memberName argument.` + ); } } - loadQueryError(data) { - return data.Errors?.[0]?.Error ?? data.Errors?.Error ?? data.Error; + static { + this.symbol = Symbol.for("@smithy/core/schema::NormalizedSchema"); } - loadQueryErrorMessage(data) { - const errorData = this.loadQueryError(data); - return errorData?.message ?? errorData?.Message ?? data.message ?? data.Message ?? "Unknown"; + static [Symbol.hasInstance](lhs) { + const isPrototype = _NormalizedSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const ns = lhs; + return ns.symbol === _NormalizedSchema.symbol; + } + return isPrototype; } -}; - -// src/submodules/protocols/query/AwsEc2QueryProtocol.ts -var AwsEc2QueryProtocol = class extends AwsQueryProtocol { - constructor(options) { - super(options); - this.options = options; - const ec2Settings = { - capitalizeKeys: true, - flattenLists: true, - serializeEmptyLists: false - }; - Object.assign(this.serializer.settings, ec2Settings); + /** + * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. + */ + static of(ref, memberName) { + if (ref instanceof _NormalizedSchema) { + return ref; + } + return new _NormalizedSchema(ref, memberName); } - static { - __name(this, "AwsEc2QueryProtocol"); + /** + * @param indicator - numeric indicator for preset trait combination. + * @returns equivalent trait object. + */ + static translateTraits(indicator) { + if (typeof indicator === "object") { + return indicator; + } + indicator = indicator | 0; + const traits = {}; + if ((indicator & 1) === 1) { + traits.httpLabel = 1; + } + if ((indicator >> 1 & 1) === 1) { + traits.idempotent = 1; + } + if ((indicator >> 2 & 1) === 1) { + traits.idempotencyToken = 1; + } + if ((indicator >> 3 & 1) === 1) { + traits.sensitive = 1; + } + if ((indicator >> 4 & 1) === 1) { + traits.httpPayload = 1; + } + if ((indicator >> 5 & 1) === 1) { + traits.httpResponseCode = 1; + } + if ((indicator >> 6 & 1) === 1) { + traits.httpQueryParams = 1; + } + return traits; } /** - * EC2 Query reads XResponse.XResult instead of XResponse directly. + * Creates a normalized member schema from the given schema and member name. */ - useNestedResult() { - return false; + static memberFrom(memberSchema, memberName) { + if (memberSchema instanceof _NormalizedSchema) { + memberSchema.memberName = memberName; + memberSchema._isMemberSchema = true; + return memberSchema; + } + return new _NormalizedSchema(memberSchema, memberName); } -}; - -// src/submodules/protocols/xml/AwsRestXmlProtocol.ts -var import_protocols6 = __nccwpck_require__(50029); -var import_schema9 = __nccwpck_require__(93247); -var import_util_body_length_browser4 = __nccwpck_require__(60103); - -// src/submodules/protocols/xml/parseXmlBody.ts -var import_smithy_client5 = __nccwpck_require__(61411); -var import_fast_xml_parser2 = __nccwpck_require__(30728); -var parseXmlBody = /* @__PURE__ */ __name((streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - const parser = new import_fast_xml_parser2.XMLParser({ - attributeNamePrefix: "", - htmlEntities: true, - ignoreAttributes: false, - ignoreDeclaration: true, - parseTagValue: false, - trimValues: false, - tagValueProcessor: /* @__PURE__ */ __name((_, val) => val.trim() === "" && val.includes("\n") ? "" : void 0, "tagValueProcessor") - }); - parser.addEntity("#xD", "\r"); - parser.addEntity("#10", "\n"); - let parsedObj; - try { - parsedObj = parser.parse(encoded, true); - } catch (e) { - if (e && typeof e === "object") { - Object.defineProperty(e, "$responseBodyText", { - value: encoded - }); + /** + * @returns the underlying non-normalized schema. + */ + getSchema() { + if (this.schema instanceof _NormalizedSchema) { + return this.schema = this.schema.getSchema(); + } + if (this.schema instanceof SimpleSchema) { + return deref(this.schema.schemaRef); + } + return deref(this.schema); + } + /** + * @param withNamespace - qualifies the name. + * @returns e.g. `MyShape` or `com.namespace#MyShape`. + */ + getName(withNamespace = false) { + if (!withNamespace) { + if (this.name && this.name.includes("#")) { + return this.name.split("#")[1]; } - throw e; } - const textNodeName = "#text"; - const key = Object.keys(parsedObj)[0]; - const parsedObjToReturn = parsedObj[key]; - if (parsedObjToReturn[textNodeName]) { - parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; - delete parsedObjToReturn[textNodeName]; + return this.name || void 0; + } + /** + * @returns the member name if the schema is a member schema. + * @throws Error when the schema isn't a member schema. + */ + getMemberName() { + if (!this.isMemberSchema()) { + throw new Error(`@smithy/core/schema - cannot get member name on non-member schema: ${this.getName(true)}`); } - return (0, import_smithy_client5.getValueFromTextNode)(parsedObjToReturn); + return this.memberName; } - return {}; -}), "parseXmlBody"); -var parseXmlErrorBody = /* @__PURE__ */ __name(async (errorBody, context) => { - const value = await parseXmlBody(errorBody, context); - if (value.Error) { - value.Error.message = value.Error.message ?? value.Error.Message; + isMemberSchema() { + return this._isMemberSchema; } - return value; -}, "parseXmlErrorBody"); -var loadRestXmlErrorCode = /* @__PURE__ */ __name((output, data) => { - if (data?.Error?.Code !== void 0) { - return data.Error.Code; + isUnitSchema() { + return this.getSchema() === "unit"; } - if (data?.Code !== void 0) { - return data.Code; + /** + * boolean methods on this class help control flow in shape serialization and deserialization. + */ + isListSchema() { + const inner = this.getSchema(); + if (typeof inner === "number") { + return inner >= SCHEMA.LIST_MODIFIER && inner < SCHEMA.MAP_MODIFIER; + } + return inner instanceof ListSchema; } - if (output.statusCode == 404) { - return "NotFound"; + isMapSchema() { + const inner = this.getSchema(); + if (typeof inner === "number") { + return inner >= SCHEMA.MAP_MODIFIER && inner <= 255; + } + return inner instanceof MapSchema; } -}, "loadRestXmlErrorCode"); - -// src/submodules/protocols/xml/XmlShapeSerializer.ts -var import_xml_builder = __nccwpck_require__(94274); -var import_schema8 = __nccwpck_require__(93247); -var import_serde7 = __nccwpck_require__(38669); -var import_smithy_client6 = __nccwpck_require__(61411); -var import_util_base643 = __nccwpck_require__(26262); -var XmlShapeSerializer = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; + isDocumentSchema() { + return this.getSchema() === SCHEMA.DOCUMENT; } - static { - __name(this, "XmlShapeSerializer"); + isStructSchema() { + const inner = this.getSchema(); + return inner !== null && typeof inner === "object" && "members" in inner || inner instanceof StructureSchema; } - stringBuffer; - byteBuffer; - buffer; - write(schema, value) { - const ns = import_schema8.NormalizedSchema.of(schema); - if (ns.isStringSchema() && typeof value === "string") { - this.stringBuffer = value; - } else if (ns.isBlobSchema()) { - this.byteBuffer = "byteLength" in value ? value : (this.serdeContext?.base64Decoder ?? import_util_base643.fromBase64)(value); - } else { - this.buffer = this.writeStruct(ns, value, void 0); - const traits = ns.getMergedTraits(); - if (traits.httpPayload && !traits.xmlName) { - this.buffer.withName(ns.getName()); - } + isBlobSchema() { + return this.getSchema() === SCHEMA.BLOB || this.getSchema() === SCHEMA.STREAMING_BLOB; + } + isTimestampSchema() { + const schema = this.getSchema(); + return typeof schema === "number" && schema >= SCHEMA.TIMESTAMP_DEFAULT && schema <= SCHEMA.TIMESTAMP_EPOCH_SECONDS; + } + isStringSchema() { + return this.getSchema() === SCHEMA.STRING; + } + isBooleanSchema() { + return this.getSchema() === SCHEMA.BOOLEAN; + } + isNumericSchema() { + return this.getSchema() === SCHEMA.NUMERIC; + } + isBigIntegerSchema() { + return this.getSchema() === SCHEMA.BIG_INTEGER; + } + isBigDecimalSchema() { + return this.getSchema() === SCHEMA.BIG_DECIMAL; + } + isStreaming() { + const streaming = !!this.getMergedTraits().streaming; + if (streaming) { + return true; } + return this.getSchema() === SCHEMA.STREAMING_BLOB; } - flush() { - if (this.byteBuffer !== void 0) { - const bytes = this.byteBuffer; - delete this.byteBuffer; - return bytes; + /** + * @returns own traits merged with member traits, where member traits of the same trait key take priority. + * This method is cached. + */ + getMergedTraits() { + if (this.normalizedTraits) { + return this.normalizedTraits; } - if (this.stringBuffer !== void 0) { - const str = this.stringBuffer; - delete this.stringBuffer; - return str; + this.normalizedTraits = { + ...this.getOwnTraits(), + ...this.getMemberTraits() + }; + return this.normalizedTraits; + } + /** + * @returns only the member traits. If the schema is not a member, this returns empty. + */ + getMemberTraits() { + return _NormalizedSchema.translateTraits(this.memberTraits); + } + /** + * @returns only the traits inherent to the shape or member target shape if this schema is a member. + * If there are any member traits they are excluded. + */ + getOwnTraits() { + return _NormalizedSchema.translateTraits(this.traits); + } + /** + * @returns the map's key's schema. Returns a dummy Document schema if this schema is a Document. + * + * @throws Error if the schema is not a Map or Document. + */ + getKeySchema() { + if (this.isDocumentSchema()) { + return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], "key"); } - const buffer = this.buffer; - if (this.settings.xmlNamespace) { - if (!buffer?.attributes?.["xmlns"]) { - buffer.addAttribute("xmlns", this.settings.xmlNamespace); - } + if (!this.isMapSchema()) { + throw new Error(`@smithy/core/schema - cannot get key schema for non-map schema: ${this.getName(true)}`); } - delete this.buffer; - return buffer.toString(); - } - writeStruct(ns, value, parentXmlns) { - const traits = ns.getMergedTraits(); - const name = ns.isMemberSchema() && !traits.httpPayload ? ns.getMemberTraits().xmlName ?? ns.getMemberName() : traits.xmlName ?? ns.getName(); - if (!name || !ns.isStructSchema()) { - throw new Error( - `@aws-sdk/core/protocols - xml serializer, cannot write struct with empty name or non-struct, schema=${ns.getName( - true - )}.` - ); + const schema = this.getSchema(); + if (typeof schema === "number") { + return _NormalizedSchema.memberFrom([63 & schema, 0], "key"); } - const structXmlNode = import_xml_builder.XmlNode.of(name); - const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(ns, parentXmlns); - if (xmlns) { - structXmlNode.addAttribute(xmlnsAttr, xmlns); + return _NormalizedSchema.memberFrom([schema.keySchema, 0], "key"); + } + /** + * @returns the schema of the map's value or list's member. + * Returns a dummy Document schema if this schema is a Document. + * + * @throws Error if the schema is not a Map, List, nor Document. + */ + getValueSchema() { + const schema = this.getSchema(); + if (typeof schema === "number") { + if (this.isMapSchema()) { + return _NormalizedSchema.memberFrom([63 & schema, 0], "value"); + } else if (this.isListSchema()) { + return _NormalizedSchema.memberFrom([63 & schema, 0], "member"); + } } - for (const [memberName, memberSchema] of ns.structIterator()) { - const val = value[memberName]; - if (val != null) { - if (memberSchema.getMergedTraits().xmlAttribute) { - structXmlNode.addAttribute( - memberSchema.getMergedTraits().xmlName ?? memberName, - this.writeSimple(memberSchema, val) - ); - continue; - } - if (memberSchema.isListSchema()) { - this.writeList(memberSchema, val, structXmlNode, xmlns); - } else if (memberSchema.isMapSchema()) { - this.writeMap(memberSchema, val, structXmlNode, xmlns); - } else if (memberSchema.isStructSchema()) { - structXmlNode.addChildNode(this.writeStruct(memberSchema, val, xmlns)); - } else { - const memberNode = import_xml_builder.XmlNode.of(memberSchema.getMergedTraits().xmlName ?? memberSchema.getMemberName()); - this.writeSimpleInto(memberSchema, val, memberNode, xmlns); - structXmlNode.addChildNode(memberNode); + if (schema && typeof schema === "object") { + if (this.isStructSchema()) { + throw new Error(`cannot call getValueSchema() with StructureSchema ${this.getName(true)}`); + } + const collection = schema; + if ("valueSchema" in collection) { + if (this.isMapSchema()) { + return _NormalizedSchema.memberFrom([collection.valueSchema, 0], "value"); + } else if (this.isListSchema()) { + return _NormalizedSchema.memberFrom([collection.valueSchema, 0], "member"); } } } - return structXmlNode; - } - writeList(listMember, array, container, parentXmlns) { - if (!listMember.isMemberSchema()) { - throw new Error( - `@aws-sdk/core/protocols - xml serializer, cannot write non-member list: ${listMember.getName(true)}` - ); - } - const listTraits = listMember.getMergedTraits(); - const listValueSchema = listMember.getValueSchema(); - const listValueTraits = listValueSchema.getMergedTraits(); - const sparse = !!listValueTraits.sparse; - const flat = !!listTraits.xmlFlattened; - const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(listMember, parentXmlns); - const writeItem = /* @__PURE__ */ __name((container2, value) => { - if (listValueSchema.isListSchema()) { - this.writeList(listValueSchema, Array.isArray(value) ? value : [value], container2, xmlns); - } else if (listValueSchema.isMapSchema()) { - this.writeMap(listValueSchema, value, container2, xmlns); - } else if (listValueSchema.isStructSchema()) { - const struct = this.writeStruct(listValueSchema, value, xmlns); - container2.addChildNode( - struct.withName(flat ? listTraits.xmlName ?? listMember.getMemberName() : listValueTraits.xmlName ?? "member") - ); - } else { - const listItemNode = import_xml_builder.XmlNode.of( - flat ? listTraits.xmlName ?? listMember.getMemberName() : listValueTraits.xmlName ?? "member" - ); - this.writeSimpleInto(listValueSchema, value, listItemNode, xmlns); - container2.addChildNode(listItemNode); - } - }, "writeItem"); - if (flat) { - for (const value of array) { - if (sparse || value != null) { - writeItem(container, value); - } - } - } else { - const listNode = import_xml_builder.XmlNode.of(listTraits.xmlName ?? listMember.getMemberName()); - if (xmlns) { - listNode.addAttribute(xmlnsAttr, xmlns); - } - for (const value of array) { - if (sparse || value != null) { - writeItem(listNode, value); - } - } - container.addChildNode(listNode); - } - } - writeMap(mapMember, map, container, parentXmlns, containerIsMap = false) { - if (!mapMember.isMemberSchema()) { - throw new Error( - `@aws-sdk/core/protocols - xml serializer, cannot write non-member map: ${mapMember.getName(true)}` - ); - } - const mapTraits = mapMember.getMergedTraits(); - const mapKeySchema = mapMember.getKeySchema(); - const mapKeyTraits = mapKeySchema.getMergedTraits(); - const keyTag = mapKeyTraits.xmlName ?? "key"; - const mapValueSchema = mapMember.getValueSchema(); - const mapValueTraits = mapValueSchema.getMergedTraits(); - const valueTag = mapValueTraits.xmlName ?? "value"; - const sparse = !!mapValueTraits.sparse; - const flat = !!mapTraits.xmlFlattened; - const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(mapMember, parentXmlns); - const addKeyValue = /* @__PURE__ */ __name((entry, key, val) => { - const keyNode = import_xml_builder.XmlNode.of(keyTag, key); - const [keyXmlnsAttr, keyXmlns] = this.getXmlnsAttribute(mapKeySchema, xmlns); - if (keyXmlns) { - keyNode.addAttribute(keyXmlnsAttr, keyXmlns); - } - entry.addChildNode(keyNode); - let valueNode = import_xml_builder.XmlNode.of(valueTag); - if (mapValueSchema.isListSchema()) { - this.writeList(mapValueSchema, val, valueNode, xmlns); - } else if (mapValueSchema.isMapSchema()) { - this.writeMap(mapValueSchema, val, valueNode, xmlns, true); - } else if (mapValueSchema.isStructSchema()) { - valueNode = this.writeStruct(mapValueSchema, val, xmlns); - } else { - this.writeSimpleInto(mapValueSchema, val, valueNode, xmlns); - } - entry.addChildNode(valueNode); - }, "addKeyValue"); - if (flat) { - for (const [key, val] of Object.entries(map)) { - if (sparse || val != null) { - const entry = import_xml_builder.XmlNode.of(mapTraits.xmlName ?? mapMember.getMemberName()); - addKeyValue(entry, key, val); - container.addChildNode(entry); - } - } - } else { - let mapNode; - if (!containerIsMap) { - mapNode = import_xml_builder.XmlNode.of(mapTraits.xmlName ?? mapMember.getMemberName()); - if (xmlns) { - mapNode.addAttribute(xmlnsAttr, xmlns); - } - container.addChildNode(mapNode); - } - for (const [key, val] of Object.entries(map)) { - if (sparse || val != null) { - const entry = import_xml_builder.XmlNode.of("entry"); - addKeyValue(entry, key, val); - (containerIsMap ? container : mapNode).addChildNode(entry); - } - } + if (this.isDocumentSchema()) { + return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], "value"); } + throw new Error(`@smithy/core/schema - the schema ${this.getName(true)} does not have a value member.`); } - writeSimple(_schema, value) { - if (null === value) { - throw new Error("@aws-sdk/core/protocols - (XML serializer) cannot write null value."); - } - const ns = import_schema8.NormalizedSchema.of(_schema); - let nodeContents = null; - if (value && typeof value === "object") { - if (ns.isBlobSchema()) { - nodeContents = (this.serdeContext?.base64Encoder ?? import_util_base643.toBase64)(value); - } else if (ns.isTimestampSchema() && value instanceof Date) { - const options = this.settings.timestampFormat; - const format = options.useTrait ? ns.getSchema() === import_schema8.SCHEMA.TIMESTAMP_DEFAULT ? options.default : ns.getSchema() ?? options.default : options.default; - switch (format) { - case import_schema8.SCHEMA.TIMESTAMP_DATE_TIME: - nodeContents = value.toISOString().replace(".000Z", "Z"); - break; - case import_schema8.SCHEMA.TIMESTAMP_HTTP_DATE: - nodeContents = (0, import_smithy_client6.dateToUtcString)(value); - break; - case import_schema8.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - nodeContents = String(value.getTime() / 1e3); - break; - default: - console.warn("Missing timestamp format, using http date", value); - nodeContents = (0, import_smithy_client6.dateToUtcString)(value); - break; - } - } else if (ns.isBigDecimalSchema() && value) { - if (value instanceof import_serde7.NumericValue) { - return value.string; - } - return String(value); - } else if (ns.isMapSchema() || ns.isListSchema()) { - throw new Error( - "@aws-sdk/core/protocols - xml serializer, cannot call _write() on List/Map schema, call writeList or writeMap() instead." - ); - } else { + /** + * @returns the NormalizedSchema for the given member name. The returned instance will return true for `isMemberSchema()` + * and will have the member name given. + * @param member - which member to retrieve and wrap. + * + * @throws Error if member does not exist or the schema is neither a document nor structure. + * Note that errors are assumed to be structures and unions are considered structures for these purposes. + */ + getMemberSchema(member) { + if (this.isStructSchema()) { + const struct2 = this.getSchema(); + if (!(member in struct2.members)) { throw new Error( - `@aws-sdk/core/protocols - xml serializer, unhandled schema type for object value and schema: ${ns.getName( - true - )}` + `@smithy/core/schema - the schema ${this.getName(true)} does not have a member with name=${member}.` ); } + return _NormalizedSchema.memberFrom(struct2.members[member], member); } - if (ns.isStringSchema() || ns.isBooleanSchema() || ns.isNumericSchema() || ns.isBigIntegerSchema() || ns.isBigDecimalSchema()) { - nodeContents = String(value); - } - if (nodeContents === null) { - throw new Error(`Unhandled schema-value pair ${ns.getName(true)}=${value}`); + if (this.isDocumentSchema()) { + return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], member); } - return nodeContents; + throw new Error(`@smithy/core/schema - the schema ${this.getName(true)} does not have members.`); } - writeSimpleInto(_schema, value, into, parentXmlns) { - const nodeContents = this.writeSimple(_schema, value); - const ns = import_schema8.NormalizedSchema.of(_schema); - const content = new import_xml_builder.XmlText(nodeContents); - const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(ns, parentXmlns); - if (xmlns) { - into.addAttribute(xmlnsAttr, xmlns); + /** + * This can be used for checking the members as a hashmap. + * Prefer the structIterator method for iteration. + * + * This does NOT return list and map members, it is only for structures. + * + * @returns a map of member names to member schemas (normalized). + */ + getMemberSchemas() { + const { schema } = this; + const struct2 = schema; + if (!struct2 || typeof struct2 !== "object") { + return {}; } - into.addChildNode(content); - } - getXmlnsAttribute(ns, parentXmlns) { - const traits = ns.getMergedTraits(); - const [prefix, xmlns] = traits.xmlNamespace ?? []; - if (xmlns && xmlns !== parentXmlns) { - return [prefix ? `xmlns:${prefix}` : "xmlns", xmlns]; + if ("members" in struct2) { + const buffer = {}; + for (const member of struct2.memberNames) { + buffer[member] = this.getMemberSchema(member); + } + return buffer; } - return [void 0, void 0]; - } -}; - -// src/submodules/protocols/xml/XmlCodec.ts -var XmlCodec = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - } - static { - __name(this, "XmlCodec"); - } - createSerializer() { - const serializer = new XmlShapeSerializer(this.settings); - serializer.setSerdeContext(this.serdeContext); - return serializer; - } - createDeserializer() { - const deserializer = new XmlShapeDeserializer(this.settings); - deserializer.setSerdeContext(this.serdeContext); - return deserializer; - } -}; - -// src/submodules/protocols/xml/AwsRestXmlProtocol.ts -var AwsRestXmlProtocol = class extends import_protocols6.HttpBindingProtocol { - static { - __name(this, "AwsRestXmlProtocol"); - } - codec; - serializer; - deserializer; - constructor(options) { - super(options); - const settings = { - timestampFormat: { - useTrait: true, - default: import_schema9.SCHEMA.TIMESTAMP_DATE_TIME - }, - httpBindings: true, - xmlNamespace: options.xmlNamespace, - serviceNamespace: options.defaultNamespace - }; - this.codec = new XmlCodec(settings); - this.serializer = new import_protocols6.HttpInterceptingShapeSerializer(this.codec.createSerializer(), settings); - this.deserializer = new import_protocols6.HttpInterceptingShapeDeserializer(this.codec.createDeserializer(), settings); - } - getPayloadCodec() { - return this.codec; - } - getShapeId() { - return "aws.protocols#restXml"; + return {}; } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - const ns = import_schema9.NormalizedSchema.of(operationSchema.input); - const members = ns.getMemberSchemas(); - request.path = String(request.path).split("/").filter((segment) => { - return segment !== "{Bucket}"; - }).join("/") || "/"; - if (!request.headers["content-type"]) { - const httpPayloadMember = Object.values(members).find((m) => { - return !!m.getMergedTraits().httpPayload; - }); - if (httpPayloadMember) { - const mediaType = httpPayloadMember.getMergedTraits().mediaType; - if (mediaType) { - request.headers["content-type"] = mediaType; - } else if (httpPayloadMember.isStringSchema()) { - request.headers["content-type"] = "text/plain"; - } else if (httpPayloadMember.isBlobSchema()) { - request.headers["content-type"] = "application/octet-stream"; - } else { - request.headers["content-type"] = "application/xml"; - } - } else if (!ns.isUnitSchema()) { - const hasBody = Object.values(members).find((m) => { - const { httpQuery, httpQueryParams, httpHeader, httpLabel, httpPrefixHeaders } = m.getMergedTraits(); - return !httpQuery && !httpQueryParams && !httpHeader && !httpLabel && httpPrefixHeaders === void 0; - }); - if (hasBody) { - request.headers["content-type"] = "application/xml"; - } - } + /** + * Allows iteration over members of a structure schema. + * Each yield is a pair of the member name and member schema. + * + * This avoids the overhead of calling Object.entries(ns.getMemberSchemas()). + */ + *structIterator() { + if (this.isUnitSchema()) { + return; } - if (request.headers["content-type"] === "application/xml") { - if (typeof request.body === "string") { - request.body = '' + request.body; - } + if (!this.isStructSchema()) { + throw new Error("@smithy/core/schema - cannot acquire structIterator on non-struct schema."); } - if (request.body) { - try { - request.headers["content-length"] = String((0, import_util_body_length_browser4.calculateBodyLength)(request.body)); - } catch (e) { - } + const struct2 = this.getSchema(); + for (let i = 0; i < struct2.memberNames.length; ++i) { + yield [struct2.memberNames[i], _NormalizedSchema.memberFrom([struct2.memberList[i], 0], struct2.memberNames[i])]; } - return request; - } - async deserializeResponse(operationSchema, context, response) { - return super.deserializeResponse(operationSchema, context, response); } - async handleError(operationSchema, context, response, dataObject, metadata) { - const errorIdentifier = loadRestXmlErrorCode(response, dataObject) ?? "Unknown"; - let namespace = this.options.defaultNamespace; - let errorName = errorIdentifier; - if (errorIdentifier.includes("#")) { - [namespace, errorName] = errorIdentifier.split("#"); - } - const registry = import_schema9.TypeRegistry.for(namespace); - let errorSchema; - try { - errorSchema = registry.getSchema(errorIdentifier); - } catch (e) { - const baseExceptionSchema = import_schema9.TypeRegistry.for("smithy.ts.sdk.synthetic." + namespace).getBaseException(); - if (baseExceptionSchema) { - const ErrorCtor = baseExceptionSchema.ctor; - throw Object.assign(new ErrorCtor(errorName), dataObject); + /** + * @returns a last-resort human-readable name for the schema if it has no other identifiers. + */ + getSchemaName() { + const schema = this.getSchema(); + if (typeof schema === "number") { + const _schema = 63 & schema; + const container = 192 & schema; + const type = Object.entries(SCHEMA).find(([, value]) => { + return value === _schema; + })?.[0] ?? "Unknown"; + switch (container) { + case SCHEMA.MAP_MODIFIER: + return `${type}Map`; + case SCHEMA.LIST_MODIFIER: + return `${type}List`; + case 0: + return type; } - throw new Error(errorName); - } - const ns = import_schema9.NormalizedSchema.of(errorSchema); - const message = dataObject.Error?.message ?? dataObject.Error?.Message ?? dataObject.message ?? dataObject.Message ?? "Unknown"; - const exception = new errorSchema.ctor(message); - await this.deserializeHttpMessage(errorSchema, context, response, dataObject); - const output = {}; - for (const [name, member] of ns.structIterator()) { - const target = member.getMergedTraits().xmlName ?? name; - const value = dataObject.Error?.[target] ?? dataObject[target]; - output[name] = this.codec.createDeserializer().readSchema(member, value); } - Object.assign(exception, { - $metadata: metadata, - $response: response, - $fault: ns.getMergedTraits().error, - message, - ...output - }); - throw exception; + return "Unknown"; } }; // Annotate the CommonJS export names for ESM import in node: @@ -13031,16 +12100,13 @@ var AwsRestXmlProtocol = class extends import_protocols6.HttpBindingProtocol { /***/ }), -/***/ 90955: +/***/ 38669: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -"use strict"; - var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { for (var name in all) __defProp(target, name, { get: all[name], enumerable: true }); @@ -13055,579 +12121,714 @@ var __copyProps = (to, from, except, desc) => { }; var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - ENV_ACCOUNT_ID: () => ENV_ACCOUNT_ID, - ENV_CREDENTIAL_SCOPE: () => ENV_CREDENTIAL_SCOPE, - ENV_EXPIRATION: () => ENV_EXPIRATION, - ENV_KEY: () => ENV_KEY, - ENV_SECRET: () => ENV_SECRET, - ENV_SESSION: () => ENV_SESSION, - fromEnv: () => fromEnv +// src/submodules/serde/index.ts +var serde_exports = {}; +__export(serde_exports, { + LazyJsonString: () => LazyJsonString, + NumericValue: () => NumericValue, + copyDocumentWithTransform: () => copyDocumentWithTransform, + dateToUtcString: () => dateToUtcString, + expectBoolean: () => expectBoolean, + expectByte: () => expectByte, + expectFloat32: () => expectFloat32, + expectInt: () => expectInt, + expectInt32: () => expectInt32, + expectLong: () => expectLong, + expectNonNull: () => expectNonNull, + expectNumber: () => expectNumber, + expectObject: () => expectObject, + expectShort: () => expectShort, + expectString: () => expectString, + expectUnion: () => expectUnion, + handleFloat: () => handleFloat, + limitedParseDouble: () => limitedParseDouble, + limitedParseFloat: () => limitedParseFloat, + limitedParseFloat32: () => limitedParseFloat32, + logger: () => logger, + nv: () => nv, + parseBoolean: () => parseBoolean, + parseEpochTimestamp: () => parseEpochTimestamp, + parseRfc3339DateTime: () => parseRfc3339DateTime, + parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, + parseRfc7231DateTime: () => parseRfc7231DateTime, + quoteHeader: () => quoteHeader, + splitEvery: () => splitEvery, + splitHeader: () => splitHeader, + strictParseByte: () => strictParseByte, + strictParseDouble: () => strictParseDouble, + strictParseFloat: () => strictParseFloat, + strictParseFloat32: () => strictParseFloat32, + strictParseInt: () => strictParseInt, + strictParseInt32: () => strictParseInt32, + strictParseLong: () => strictParseLong, + strictParseShort: () => strictParseShort }); -module.exports = __toCommonJS(index_exports); +module.exports = __toCommonJS(serde_exports); -// src/fromEnv.ts -var import_client = __nccwpck_require__(78639); -var import_property_provider = __nccwpck_require__(57745); -var ENV_KEY = "AWS_ACCESS_KEY_ID"; -var ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; -var ENV_SESSION = "AWS_SESSION_TOKEN"; -var ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; -var ENV_CREDENTIAL_SCOPE = "AWS_CREDENTIAL_SCOPE"; -var ENV_ACCOUNT_ID = "AWS_ACCOUNT_ID"; -var fromEnv = /* @__PURE__ */ __name((init) => async () => { - init?.logger?.debug("@aws-sdk/credential-provider-env - fromEnv"); - const accessKeyId = process.env[ENV_KEY]; - const secretAccessKey = process.env[ENV_SECRET]; - const sessionToken = process.env[ENV_SESSION]; - const expiry = process.env[ENV_EXPIRATION]; - const credentialScope = process.env[ENV_CREDENTIAL_SCOPE]; - const accountId = process.env[ENV_ACCOUNT_ID]; - if (accessKeyId && secretAccessKey) { - const credentials = { - accessKeyId, - secretAccessKey, - ...sessionToken && { sessionToken }, - ...expiry && { expiration: new Date(expiry) }, - ...credentialScope && { credentialScope }, - ...accountId && { accountId } - }; - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_ENV_VARS", "g"); - return credentials; +// src/submodules/serde/copyDocumentWithTransform.ts +var import_schema = __nccwpck_require__(93247); +var copyDocumentWithTransform = (source, schemaRef, transform = (_) => _) => { + const ns = import_schema.NormalizedSchema.of(schemaRef); + switch (typeof source) { + case "undefined": + case "boolean": + case "number": + case "string": + case "bigint": + case "symbol": + return transform(source, ns); + case "function": + case "object": + if (source === null) { + return transform(null, ns); + } + if (Array.isArray(source)) { + const newArray = new Array(source.length); + let i = 0; + for (const item of source) { + newArray[i++] = copyDocumentWithTransform(item, ns.getValueSchema(), transform); + } + return transform(newArray, ns); + } + if ("byteLength" in source) { + const newBytes = new Uint8Array(source.byteLength); + newBytes.set(source, 0); + return transform(newBytes, ns); + } + if (source instanceof Date) { + return transform(source, ns); + } + const newObject = {}; + if (ns.isMapSchema()) { + for (const key of Object.keys(source)) { + newObject[key] = copyDocumentWithTransform(source[key], ns.getValueSchema(), transform); + } + } else if (ns.isStructSchema()) { + for (const [key, memberSchema] of ns.structIterator()) { + newObject[key] = copyDocumentWithTransform(source[key], memberSchema, transform); + } + } else if (ns.isDocumentSchema()) { + for (const key of Object.keys(source)) { + newObject[key] = copyDocumentWithTransform(source[key], ns.getValueSchema(), transform); + } + } + return transform(newObject, ns); + default: + return transform(source, ns); } - throw new import_property_provider.CredentialsProviderError("Unable to find environment variable credentials.", { logger: init?.logger }); -}, "fromEnv"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 32514: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; +}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.checkUrl = void 0; -const property_provider_1 = __nccwpck_require__(57745); -const LOOPBACK_CIDR_IPv4 = "127.0.0.0/8"; -const LOOPBACK_CIDR_IPv6 = "::1/128"; -const ECS_CONTAINER_HOST = "169.254.170.2"; -const EKS_CONTAINER_HOST_IPv4 = "169.254.170.23"; -const EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]"; -const checkUrl = (url, logger) => { - if (url.protocol === "https:") { - return; - } - if (url.hostname === ECS_CONTAINER_HOST || - url.hostname === EKS_CONTAINER_HOST_IPv4 || - url.hostname === EKS_CONTAINER_HOST_IPv6) { - return; - } - if (url.hostname.includes("[")) { - if (url.hostname === "[::1]" || url.hostname === "[0000:0000:0000:0000:0000:0000:0000:0001]") { - return; - } +// src/submodules/serde/parse-utils.ts +var parseBoolean = (value) => { + switch (value) { + case "true": + return true; + case "false": + return false; + default: + throw new Error(`Unable to parse boolean value "${value}"`); + } +}; +var expectBoolean = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "number") { + if (value === 0 || value === 1) { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); } - else { - if (url.hostname === "localhost") { - return; - } - const ipComponents = url.hostname.split("."); - const inRange = (component) => { - const num = parseInt(component, 10); - return 0 <= num && num <= 255; - }; - if (ipComponents[0] === "127" && - inRange(ipComponents[1]) && - inRange(ipComponents[2]) && - inRange(ipComponents[3]) && - ipComponents.length === 4) { - return; - } + if (value === 0) { + return false; } - throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following: - - loopback CIDR 127.0.0.0/8 or [::1/128] - - ECS container host 169.254.170.2 - - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger }); -}; -exports.checkUrl = checkUrl; - - -/***/ }), - -/***/ 25359: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromHttp = void 0; -const tslib_1 = __nccwpck_require__(61860); -const client_1 = __nccwpck_require__(78639); -const node_http_handler_1 = __nccwpck_require__(11176); -const property_provider_1 = __nccwpck_require__(57745); -const promises_1 = tslib_1.__importDefault(__nccwpck_require__(91943)); -const checkUrl_1 = __nccwpck_require__(32514); -const requestHelpers_1 = __nccwpck_require__(54177); -const retry_wrapper_1 = __nccwpck_require__(85995); -const AWS_CONTAINER_CREDENTIALS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; -const DEFAULT_LINK_LOCAL_HOST = "http://169.254.170.2"; -const AWS_CONTAINER_CREDENTIALS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; -const AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE = "AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE"; -const AWS_CONTAINER_AUTHORIZATION_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; -const fromHttp = (options = {}) => { - options.logger?.debug("@aws-sdk/credential-provider-http - fromHttp"); - let host; - const relative = options.awsContainerCredentialsRelativeUri ?? process.env[AWS_CONTAINER_CREDENTIALS_RELATIVE_URI]; - const full = options.awsContainerCredentialsFullUri ?? process.env[AWS_CONTAINER_CREDENTIALS_FULL_URI]; - const token = options.awsContainerAuthorizationToken ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN]; - const tokenFile = options.awsContainerAuthorizationTokenFile ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE]; - const warn = options.logger?.constructor?.name === "NoOpLogger" || !options.logger ? console.warn : options.logger.warn; - if (relative && full) { - warn("@aws-sdk/credential-provider-http: " + - "you have set both awsContainerCredentialsRelativeUri and awsContainerCredentialsFullUri."); - warn("awsContainerCredentialsFullUri will take precedence."); + if (value === 1) { + return true; } - if (token && tokenFile) { - warn("@aws-sdk/credential-provider-http: " + - "you have set both awsContainerAuthorizationToken and awsContainerAuthorizationTokenFile."); - warn("awsContainerAuthorizationToken will take precedence."); + } + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); } - if (full) { - host = full; + if (lower === "false") { + return false; } - else if (relative) { - host = `${DEFAULT_LINK_LOCAL_HOST}${relative}`; + if (lower === "true") { + return true; } - else { - throw new property_provider_1.CredentialsProviderError(`No HTTP credential provider host provided. -Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI.`, { logger: options.logger }); + } + if (typeof value === "boolean") { + return value; + } + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); +}; +var expectNumber = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); + } + return parsed; } - const url = new URL(host); - (0, checkUrl_1.checkUrl)(url, options.logger); - const requestHandler = new node_http_handler_1.NodeHttpHandler({ - requestTimeout: options.timeout ?? 1000, - connectionTimeout: options.timeout ?? 1000, - }); - return (0, retry_wrapper_1.retryWrapper)(async () => { - const request = (0, requestHelpers_1.createGetRequest)(url); - if (token) { - request.headers.Authorization = token; - } - else if (tokenFile) { - request.headers.Authorization = (await promises_1.default.readFile(tokenFile)).toString(); - } - try { - const result = await requestHandler.handle(request); - return (0, requestHelpers_1.getCredentials)(result.response).then((creds) => (0, client_1.setCredentialFeature)(creds, "CREDENTIALS_HTTP", "z")); - } - catch (e) { - throw new property_provider_1.CredentialsProviderError(String(e), { logger: options.logger }); - } - }, options.maxRetries ?? 3, options.timeout ?? 1000); + } + if (typeof value === "number") { + return value; + } + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); }; -exports.fromHttp = fromHttp; - - -/***/ }), - -/***/ 54177: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createGetRequest = createGetRequest; -exports.getCredentials = getCredentials; -const property_provider_1 = __nccwpck_require__(57745); -const protocol_http_1 = __nccwpck_require__(5559); -const smithy_client_1 = __nccwpck_require__(61411); -const util_stream_1 = __nccwpck_require__(71975); -function createGetRequest(url) { - return new protocol_http_1.HttpRequest({ - protocol: url.protocol, - hostname: url.hostname, - port: Number(url.port), - path: url.pathname, - query: Array.from(url.searchParams.entries()).reduce((acc, [k, v]) => { - acc[k] = v; - return acc; - }, {}), - fragment: url.hash, - }); -} -async function getCredentials(response, logger) { - const stream = (0, util_stream_1.sdkStreamMixin)(response.body); - const str = await stream.transformToString(); - if (response.statusCode === 200) { - const parsed = JSON.parse(str); - if (typeof parsed.AccessKeyId !== "string" || - typeof parsed.SecretAccessKey !== "string" || - typeof parsed.Token !== "string" || - typeof parsed.Expiration !== "string") { - throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: " + - "{ AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger }); - } - return { - accessKeyId: parsed.AccessKeyId, - secretAccessKey: parsed.SecretAccessKey, - sessionToken: parsed.Token, - expiration: (0, smithy_client_1.parseRfc3339DateTime)(parsed.Expiration), - }; +var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); +var expectFloat32 = (value) => { + const expected = expectNumber(value); + if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); } - if (response.statusCode >= 400 && response.statusCode < 500) { - let parsedBody = {}; - try { - parsedBody = JSON.parse(str); - } - catch (e) { } - throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }), { - Code: parsedBody.Code, - Message: parsedBody.Message, - }); + } + return expected; +}; +var expectLong = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); +}; +var expectInt = expectLong; +var expectInt32 = (value) => expectSizedInt(value, 32); +var expectShort = (value) => expectSizedInt(value, 16); +var expectByte = (value) => expectSizedInt(value, 8); +var expectSizedInt = (value, size) => { + const expected = expectLong(value); + if (expected !== void 0 && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; +}; +var castInt = (value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } +}; +var expectNonNull = (value, location) => { + if (value === null || value === void 0) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); } - throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }); -} - - -/***/ }), - -/***/ 85995: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.retryWrapper = void 0; -const retryWrapper = (toRetry, maxRetries, delayMs) => { - return async () => { - for (let i = 0; i < maxRetries; ++i) { - try { - return await toRetry(); - } - catch (e) { - await new Promise((resolve) => setTimeout(resolve, delayMs)); - } - } - return await toRetry(); - }; + throw new TypeError("Expected a non-null value"); + } + return value; }; -exports.retryWrapper = retryWrapper; - - -/***/ }), - -/***/ 56962: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromHttp = void 0; -var fromHttp_1 = __nccwpck_require__(25359); -Object.defineProperty(exports, "fromHttp", ({ enumerable: true, get: function () { return fromHttp_1.fromHttp; } })); - - -/***/ }), - -/***/ 63768: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +var expectObject = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +var expectString = (value) => { + if (value === null || value === void 0) { + return void 0; } - return to; + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); }; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromIni: () => fromIni -}); -module.exports = __toCommonJS(index_exports); - -// src/fromIni.ts - - -// src/resolveProfileData.ts - - -// src/resolveAssumeRoleCredentials.ts - - -var import_shared_ini_file_loader = __nccwpck_require__(80213); - -// src/resolveCredentialSource.ts -var import_client = __nccwpck_require__(78639); -var import_property_provider = __nccwpck_require__(57745); -var resolveCredentialSource = /* @__PURE__ */ __name((credentialSource, profileName, logger) => { - const sourceProvidersMap = { - EcsContainer: /* @__PURE__ */ __name(async (options) => { - const { fromHttp } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(56962))); - const { fromContainerMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(40566))); - logger?.debug("@aws-sdk/credential-provider-ini - credential_source is EcsContainer"); - return async () => (0, import_property_provider.chain)(fromHttp(options ?? {}), fromContainerMetadata(options))().then(setNamedProvider); - }, "EcsContainer"), - Ec2InstanceMetadata: /* @__PURE__ */ __name(async (options) => { - logger?.debug("@aws-sdk/credential-provider-ini - credential_source is Ec2InstanceMetadata"); - const { fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(40566))); - return async () => fromInstanceMetadata(options)().then(setNamedProvider); - }, "Ec2InstanceMetadata"), - Environment: /* @__PURE__ */ __name(async (options) => { - logger?.debug("@aws-sdk/credential-provider-ini - credential_source is Environment"); - const { fromEnv } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(90955))); - return async () => fromEnv(options)().then(setNamedProvider); - }, "Environment") - }; - if (credentialSource in sourceProvidersMap) { - return sourceProvidersMap[credentialSource]; - } else { - throw new import_property_provider.CredentialsProviderError( - `Unsupported credential source in profile ${profileName}. Got ${credentialSource}, expected EcsContainer or Ec2InstanceMetadata or Environment.`, - { logger } - ); +var expectUnion = (value) => { + if (value === null || value === void 0) { + return void 0; } -}, "resolveCredentialSource"); -var setNamedProvider = /* @__PURE__ */ __name((creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_NAMED_PROVIDER", "p"), "setNamedProvider"); - -// src/resolveAssumeRoleCredentials.ts -var isAssumeRoleProfile = /* @__PURE__ */ __name((arg, { profile = "default", logger } = {}) => { - return Boolean(arg) && typeof arg === "object" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && (isAssumeRoleWithSourceProfile(arg, { profile, logger }) || isCredentialSourceProfile(arg, { profile, logger })); -}, "isAssumeRoleProfile"); -var isAssumeRoleWithSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger }) => { - const withSourceProfile = typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined"; - if (withSourceProfile) { - logger?.debug?.(` ${profile} isAssumeRoleWithSourceProfile source_profile=${arg.source_profile}`); + const asObject = expectObject(value); + const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); } - return withSourceProfile; -}, "isAssumeRoleWithSourceProfile"); -var isCredentialSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger }) => { - const withProviderProfile = typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined"; - if (withProviderProfile) { - logger?.debug?.(` ${profile} isCredentialSourceProfile credential_source=${arg.credential_source}`); + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); } - return withProviderProfile; -}, "isCredentialSourceProfile"); -var resolveAssumeRoleCredentials = /* @__PURE__ */ __name(async (profileName, profiles, options, visitedProfiles = {}) => { - options.logger?.debug("@aws-sdk/credential-provider-ini - resolveAssumeRoleCredentials (STS)"); - const profileData = profiles[profileName]; - const { source_profile, region } = profileData; - if (!options.roleAssumer) { - const { getDefaultRoleAssumer } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(12801))); - options.roleAssumer = getDefaultRoleAssumer( - { - ...options.clientConfig, - credentialProviderLogger: options.logger, - parentClientConfig: { - ...options?.parentClientConfig, - region: region ?? options?.parentClientConfig?.region - } - }, - options.clientPlugins - ); + return asObject; +}; +var strictParseDouble = (value) => { + if (typeof value == "string") { + return expectNumber(parseNumber(value)); } - if (source_profile && source_profile in visitedProfiles) { - throw new import_property_provider.CredentialsProviderError( - `Detected a cycle attempting to resolve credentials for profile ${(0, import_shared_ini_file_loader.getProfileName)(options)}. Profiles visited: ` + Object.keys(visitedProfiles).join(", "), - { logger: options.logger } - ); + return expectNumber(value); +}; +var strictParseFloat = strictParseDouble; +var strictParseFloat32 = (value) => { + if (typeof value == "string") { + return expectFloat32(parseNumber(value)); } - options.logger?.debug( - `@aws-sdk/credential-provider-ini - finding credential resolver using ${source_profile ? `source_profile=[${source_profile}]` : `profile=[${profileName}]`}` - ); - const sourceCredsProvider = source_profile ? resolveProfileData( - source_profile, - profiles, - options, - { - ...visitedProfiles, - [source_profile]: true - }, - isCredentialSourceWithoutRoleArn(profiles[source_profile] ?? {}) - ) : (await resolveCredentialSource(profileData.credential_source, profileName, options.logger)(options))(); - if (isCredentialSourceWithoutRoleArn(profileData)) { - return sourceCredsProvider.then((creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_SOURCE_PROFILE", "o")); - } else { - const params = { - RoleArn: profileData.role_arn, - RoleSessionName: profileData.role_session_name || `aws-sdk-js-${Date.now()}`, - ExternalId: profileData.external_id, - DurationSeconds: parseInt(profileData.duration_seconds || "3600", 10) - }; - const { mfa_serial } = profileData; - if (mfa_serial) { - if (!options.mfaCodeProvider) { - throw new import_property_provider.CredentialsProviderError( - `Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, - { logger: options.logger, tryNextLink: false } - ); - } - params.SerialNumber = mfa_serial; - params.TokenCode = await options.mfaCodeProvider(mfa_serial); - } - const sourceCreds = await sourceCredsProvider; - return options.roleAssumer(sourceCreds, params).then( - (creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_SOURCE_PROFILE", "o") - ); + return expectFloat32(value); +}; +var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; +var parseNumber = (value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); } -}, "resolveAssumeRoleCredentials"); -var isCredentialSourceWithoutRoleArn = /* @__PURE__ */ __name((section) => { - return !section.role_arn && !!section.credential_source; -}, "isCredentialSourceWithoutRoleArn"); - -// src/resolveProcessCredentials.ts - -var isProcessProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string", "isProcessProfile"); -var resolveProcessCredentials = /* @__PURE__ */ __name(async (options, profile) => Promise.resolve().then(() => __toESM(__nccwpck_require__(82549))).then( - ({ fromProcess }) => fromProcess({ - ...options, - profile - })().then((creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_PROCESS", "v")) -), "resolveProcessCredentials"); - -// src/resolveSsoCredentials.ts - -var resolveSsoCredentials = /* @__PURE__ */ __name(async (profile, profileData, options = {}) => { - const { fromSSO } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(96767))); - return fromSSO({ - profile, - logger: options.logger, - parentClientConfig: options.parentClientConfig, - clientConfig: options.clientConfig - })().then((creds) => { - if (profileData.sso_session) { - return (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_SSO", "r"); - } else { - return (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_SSO_LEGACY", "t"); - } - }); -}, "resolveSsoCredentials"); -var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); - -// src/resolveStaticCredentials.ts - -var isStaticCredsProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.aws_access_key_id === "string" && typeof arg.aws_secret_access_key === "string" && ["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1 && ["undefined", "string"].indexOf(typeof arg.aws_account_id) > -1, "isStaticCredsProfile"); -var resolveStaticCredentials = /* @__PURE__ */ __name(async (profile, options) => { - options?.logger?.debug("@aws-sdk/credential-provider-ini - resolveStaticCredentials"); - const credentials = { - accessKeyId: profile.aws_access_key_id, - secretAccessKey: profile.aws_secret_access_key, - sessionToken: profile.aws_session_token, - ...profile.aws_credential_scope && { credentialScope: profile.aws_credential_scope }, - ...profile.aws_account_id && { accountId: profile.aws_account_id } - }; - return (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_PROFILE", "n"); -}, "resolveStaticCredentials"); + return parseFloat(value); +}; +var limitedParseDouble = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectNumber(value); +}; +var handleFloat = limitedParseDouble; +var limitedParseFloat = limitedParseDouble; +var limitedParseFloat32 = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectFloat32(value); +}; +var parseFloatString = (value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); + } +}; +var strictParseLong = (value) => { + if (typeof value === "string") { + return expectLong(parseNumber(value)); + } + return expectLong(value); +}; +var strictParseInt = strictParseLong; +var strictParseInt32 = (value) => { + if (typeof value === "string") { + return expectInt32(parseNumber(value)); + } + return expectInt32(value); +}; +var strictParseShort = (value) => { + if (typeof value === "string") { + return expectShort(parseNumber(value)); + } + return expectShort(value); +}; +var strictParseByte = (value) => { + if (typeof value === "string") { + return expectByte(parseNumber(value)); + } + return expectByte(value); +}; +var stackTraceWarning = (message) => { + return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); +}; +var logger = { + warn: console.warn +}; -// src/resolveWebIdentityCredentials.ts +// src/submodules/serde/date-utils.ts +var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; +var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; +function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; +} +var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); +var parseRfc3339DateTime = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); +}; +var RFC3339_WITH_OFFSET = new RegExp( + /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ +); +var parseRfc3339DateTimeWithOffset = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339_WITH_OFFSET.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + if (offsetStr.toUpperCase() != "Z") { + date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); + } + return date; +}; +var IMF_FIXDATE = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ +); +var RFC_850_DATE = new RegExp( + /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ +); +var ASC_TIME = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ +); +var parseRfc7231DateTime = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); + } + let match = IMF_FIXDATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr, "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + match = RFC_850_DATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year( + buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds + }) + ); + } + match = ASC_TIME.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr.trimLeft(), "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + throw new TypeError("Invalid RFC-7231 date-time value"); +}; +var parseEpochTimestamp = (value) => { + if (value === null || value === void 0) { + return void 0; + } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } else if (typeof value === "string") { + valueAsDouble = strictParseDouble(value); + } else if (typeof value === "object" && value.tag === 1) { + valueAsDouble = value.value; + } else { + throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + } + if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { + throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); + } + return new Date(Math.round(valueAsDouble * 1e3)); +}; +var buildDate = (year, month, day, time) => { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date( + Date.UTC( + year, + adjustedMonth, + day, + parseDateValue(time.hours, "hour", 0, 23), + parseDateValue(time.minutes, "minute", 0, 59), + // seconds can go up to 60 for leap seconds + parseDateValue(time.seconds, "seconds", 0, 60), + parseMilliseconds(time.fractionalMilliseconds) + ) + ); +}; +var parseTwoDigitYear = (value) => { + const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; + } + return valueInThisCentury; +}; +var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; +var adjustRfc850Year = (input) => { + if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date( + Date.UTC( + input.getUTCFullYear() - 100, + input.getUTCMonth(), + input.getUTCDate(), + input.getUTCHours(), + input.getUTCMinutes(), + input.getUTCSeconds(), + input.getUTCMilliseconds() + ) + ); + } + return input; +}; +var parseMonthByShortName = (value) => { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); + } + return monthIdx + 1; +}; +var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; +var validateDayOfMonth = (year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; + } + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); + } +}; +var isLeapYear = (year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +}; +var parseDateValue = (value, type, lower, upper) => { + const dateVal = strictParseByte(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + } + return dateVal; +}; +var parseMilliseconds = (value) => { + if (value === null || value === void 0) { + return 0; + } + return strictParseFloat32("0." + value) * 1e3; +}; +var parseOffsetToMilliseconds = (value) => { + const directionStr = value[0]; + let direction = 1; + if (directionStr == "+") { + direction = 1; + } else if (directionStr == "-") { + direction = -1; + } else { + throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + } + const hour = Number(value.substring(1, 3)); + const minute = Number(value.substring(4, 6)); + return direction * (hour * 60 + minute) * 60 * 1e3; +}; +var stripLeadingZeroes = (value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; + } + if (idx === 0) { + return value; + } + return value.slice(idx); +}; -var isWebIdentityProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.web_identity_token_file === "string" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1, "isWebIdentityProfile"); -var resolveWebIdentityCredentials = /* @__PURE__ */ __name(async (profile, options) => Promise.resolve().then(() => __toESM(__nccwpck_require__(52427))).then( - ({ fromTokenFile }) => fromTokenFile({ - webIdentityTokenFile: profile.web_identity_token_file, - roleArn: profile.role_arn, - roleSessionName: profile.role_session_name, - roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity, - logger: options.logger, - parentClientConfig: options.parentClientConfig - })().then((creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_STS_WEB_ID_TOKEN", "q")) -), "resolveWebIdentityCredentials"); +// src/submodules/serde/lazy-json.ts +var LazyJsonString = function LazyJsonString2(val) { + const str = Object.assign(new String(val), { + deserializeJSON() { + return JSON.parse(String(val)); + }, + toString() { + return String(val); + }, + toJSON() { + return String(val); + } + }); + return str; +}; +LazyJsonString.from = (object) => { + if (object && typeof object === "object" && (object instanceof LazyJsonString || "deserializeJSON" in object)) { + return object; + } else if (typeof object === "string" || Object.getPrototypeOf(object) === String.prototype) { + return LazyJsonString(String(object)); + } + return LazyJsonString(JSON.stringify(object)); +}; +LazyJsonString.fromObject = LazyJsonString.from; -// src/resolveProfileData.ts -var resolveProfileData = /* @__PURE__ */ __name(async (profileName, profiles, options, visitedProfiles = {}, isAssumeRoleRecursiveCall = false) => { - const data = profiles[profileName]; - if (Object.keys(visitedProfiles).length > 0 && isStaticCredsProfile(data)) { - return resolveStaticCredentials(data, options); +// src/submodules/serde/quote-header.ts +function quoteHeader(part) { + if (part.includes(",") || part.includes('"')) { + part = `"${part.replace(/"/g, '\\"')}"`; } - if (isAssumeRoleRecursiveCall || isAssumeRoleProfile(data, { profile: profileName, logger: options.logger })) { - return resolveAssumeRoleCredentials(profileName, profiles, options, visitedProfiles); + return part; +} + +// src/submodules/serde/split-every.ts +function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); } - if (isStaticCredsProfile(data)) { - return resolveStaticCredentials(data, options); + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; } - if (isWebIdentityProfile(data)) { - return resolveWebIdentityCredentials(data, options); + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; + } else { + currentSegment += delimiter + segments[i]; + } + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; + } } - if (isProcessProfile(data)) { - return resolveProcessCredentials(options, profileName); + if (currentSegment !== "") { + compoundSegments.push(currentSegment); } - if (isSsoProfile(data)) { - return await resolveSsoCredentials(profileName, data, options); + return compoundSegments; +} + +// src/submodules/serde/split-header.ts +var splitHeader = (value) => { + const z = value.length; + const values = []; + let withinQuotes = false; + let prevChar = void 0; + let anchor = 0; + for (let i = 0; i < z; ++i) { + const char = value[i]; + switch (char) { + case `"`: + if (prevChar !== "\\") { + withinQuotes = !withinQuotes; + } + break; + case ",": + if (!withinQuotes) { + values.push(value.slice(anchor, i)); + anchor = i + 1; + } + break; + default: + } + prevChar = char; } - throw new import_property_provider.CredentialsProviderError( - `Could not resolve credentials using profile: [${profileName}] in configuration/credentials file(s).`, - { logger: options.logger } - ); -}, "resolveProfileData"); + values.push(value.slice(anchor)); + return values.map((v) => { + v = v.trim(); + const z2 = v.length; + if (z2 < 2) { + return v; + } + if (v[0] === `"` && v[z2 - 1] === `"`) { + v = v.slice(1, z2 - 1); + } + return v.replace(/\\"/g, '"'); + }); +}; -// src/fromIni.ts -var fromIni = /* @__PURE__ */ __name((_init = {}) => async ({ callerClientConfig } = {}) => { - const init = { - ..._init, - parentClientConfig: { - ...callerClientConfig, - ..._init.parentClientConfig +// src/submodules/serde/value/NumericValue.ts +var NumericValue = class _NumericValue { + constructor(string, type) { + this.string = string; + this.type = type; + let dot = 0; + for (let i = 0; i < string.length; ++i) { + const char = string.charCodeAt(i); + if (i === 0 && char === 45) { + continue; + } + if (char === 46) { + if (dot) { + throw new Error("@smithy/core/serde - NumericValue must contain at most one decimal point."); + } + dot = 1; + continue; + } + if (char < 48 || char > 57) { + throw new Error( + `@smithy/core/serde - NumericValue must only contain [0-9], at most one decimal point ".", and an optional negation prefix "-".` + ); + } } - }; - init.logger?.debug("@aws-sdk/credential-provider-ini - fromIni"); - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - return resolveProfileData( - (0, import_shared_ini_file_loader.getProfileName)({ - profile: _init.profile ?? callerClientConfig?.profile - }), - profiles, - init - ); -}, "fromIni"); + } + toString() { + return this.string; + } + static [Symbol.hasInstance](object) { + if (!object || typeof object !== "object") { + return false; + } + const _nv = object; + const prototypeMatch = _NumericValue.prototype.isPrototypeOf(object.constructor?.prototype); + if (prototypeMatch) { + return prototypeMatch; + } + if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name === "NumericValue") { + return true; + } + return prototypeMatch; + } +}; +function nv(input) { + return new NumericValue(String(input), "bigDecimal"); +} // Annotate the CommonJS export names for ESM import in node: - 0 && (0); - /***/ }), -/***/ 89694: +/***/ 8540: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -"use strict"; - -var __create = Object.create; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { @@ -13642,125 +12843,245 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -__export(index_exports, { - credentialsTreatedAsExpired: () => credentialsTreatedAsExpired, - credentialsWillNeedRefresh: () => credentialsWillNeedRefresh, - defaultProvider: () => defaultProvider +var src_exports = {}; +__export(src_exports, { + FetchHttpHandler: () => FetchHttpHandler, + keepAliveSupport: () => keepAliveSupport, + streamCollector: () => streamCollector }); -module.exports = __toCommonJS(index_exports); +module.exports = __toCommonJS(src_exports); -// src/defaultProvider.ts -var import_credential_provider_env = __nccwpck_require__(90955); +// src/fetch-http-handler.ts +var import_protocol_http = __nccwpck_require__(5559); +var import_querystring_builder = __nccwpck_require__(75547); -var import_shared_ini_file_loader = __nccwpck_require__(80213); +// src/create-request.ts +function createRequest(url, requestOptions) { + return new Request(url, requestOptions); +} +__name(createRequest, "createRequest"); -// src/remoteProvider.ts -var import_property_provider = __nccwpck_require__(57745); -var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; -var remoteProvider = /* @__PURE__ */ __name(async (init) => { - const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(40566))); - if (process.env[ENV_CMDS_RELATIVE_URI] || process.env[ENV_CMDS_FULL_URI]) { - init.logger?.debug("@aws-sdk/credential-provider-node - remoteProvider::fromHttp/fromContainerMetadata"); - const { fromHttp } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(56962))); - return (0, import_property_provider.chain)(fromHttp(init), fromContainerMetadata(init)); +// src/request-timeout.ts +function requestTimeout(timeoutInMs = 0) { + return new Promise((resolve, reject) => { + if (timeoutInMs) { + setTimeout(() => { + const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); + timeoutError.name = "TimeoutError"; + reject(timeoutError); + }, timeoutInMs); + } + }); +} +__name(requestTimeout, "requestTimeout"); + +// src/fetch-http-handler.ts +var keepAliveSupport = { + supported: void 0 +}; +var FetchHttpHandler = class _FetchHttpHandler { + static { + __name(this, "FetchHttpHandler"); } - if (process.env[ENV_IMDS_DISABLED] && process.env[ENV_IMDS_DISABLED] !== "false") { - return async () => { - throw new import_property_provider.CredentialsProviderError("EC2 Instance Metadata Service access disabled", { logger: init.logger }); + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof instanceOrOptions?.handle === "function") { + return instanceOrOptions; + } + return new _FetchHttpHandler(instanceOrOptions); + } + constructor(options) { + if (typeof options === "function") { + this.configProvider = options().then((opts) => opts || {}); + } else { + this.config = options ?? {}; + this.configProvider = Promise.resolve(this.config); + } + if (keepAliveSupport.supported === void 0) { + keepAliveSupport.supported = Boolean( + typeof Request !== "undefined" && "keepalive" in createRequest("https://[::1]") + ); + } + } + destroy() { + } + async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; + const keepAlive = this.config.keepAlive === true; + const credentials = this.config.credentials; + if (abortSignal?.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + return Promise.reject(abortError); + } + let path = request.path; + const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const { port, method } = request; + const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; + const body = method === "GET" || method === "HEAD" ? void 0 : request.body; + const requestOptions = { + body, + headers: new Headers(request.headers), + method, + credentials }; + if (this.config?.cache) { + requestOptions.cache = this.config.cache; + } + if (body) { + requestOptions.duplex = "half"; + } + if (typeof AbortController !== "undefined") { + requestOptions.signal = abortSignal; + } + if (keepAliveSupport.supported) { + requestOptions.keepalive = keepAlive; + } + if (typeof this.config.requestInit === "function") { + Object.assign(requestOptions, this.config.requestInit(request)); + } + let removeSignalEventListener = /* @__PURE__ */ __name(() => { + }, "removeSignalEventListener"); + const fetchRequest = createRequest(url, requestOptions); + const raceOfPromises = [ + fetch(fetchRequest).then((response) => { + const fetchHeaders = response.headers; + const transformedHeaders = {}; + for (const pair of fetchHeaders.entries()) { + transformedHeaders[pair[0]] = pair[1]; + } + const hasReadableStream = response.body != void 0; + if (!hasReadableStream) { + return response.blob().then((body2) => ({ + response: new import_protocol_http.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: body2 + }) + })); + } + return { + response: new import_protocol_http.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: response.body + }) + }; + }), + requestTimeout(requestTimeoutInMs) + ]; + if (abortSignal) { + raceOfPromises.push( + new Promise((resolve, reject) => { + const onAbort = /* @__PURE__ */ __name(() => { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); + } else { + abortSignal.onabort = onAbort; + } + }) + ); + } + return Promise.race(raceOfPromises).finally(removeSignalEventListener); } - init.logger?.debug("@aws-sdk/credential-provider-node - remoteProvider::fromInstanceMetadata"); - return fromInstanceMetadata(init); -}, "remoteProvider"); + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + config[key] = value; + return config; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } +}; -// src/defaultProvider.ts -var multipleCredentialSourceWarningEmitted = false; -var defaultProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider.memoize)( - (0, import_property_provider.chain)( - async () => { - const profile = init.profile ?? process.env[import_shared_ini_file_loader.ENV_PROFILE]; - if (profile) { - const envStaticCredentialsAreSet = process.env[import_credential_provider_env.ENV_KEY] && process.env[import_credential_provider_env.ENV_SECRET]; - if (envStaticCredentialsAreSet) { - if (!multipleCredentialSourceWarningEmitted) { - const warnFn = init.logger?.warn && init.logger?.constructor?.name !== "NoOpLogger" ? init.logger.warn : console.warn; - warnFn( - `@aws-sdk/credential-provider-node - defaultProvider::fromEnv WARNING: - Multiple credential sources detected: - Both AWS_PROFILE and the pair AWS_ACCESS_KEY_ID/AWS_SECRET_ACCESS_KEY static credentials are set. - This SDK will proceed with the AWS_PROFILE value. - - However, a future version may change this behavior to prefer the ENV static credentials. - Please ensure that your environment only sets either the AWS_PROFILE or the - AWS_ACCESS_KEY_ID/AWS_SECRET_ACCESS_KEY pair. -` - ); - multipleCredentialSourceWarningEmitted = true; - } - } - throw new import_property_provider.CredentialsProviderError("AWS_PROFILE is set, skipping fromEnv provider.", { - logger: init.logger, - tryNextLink: true - }); - } - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromEnv"); - return (0, import_credential_provider_env.fromEnv)(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromSSO"); - const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; - if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { - throw new import_property_provider.CredentialsProviderError( - "Skipping SSO provider in default chain (inputs do not include SSO fields).", - { logger: init.logger } - ); - } - const { fromSSO } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(96767))); - return fromSSO(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromIni"); - const { fromIni } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(63768))); - return fromIni(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromProcess"); - const { fromProcess } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(82549))); - return fromProcess(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromTokenFile"); - const { fromTokenFile } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(52427))); - return fromTokenFile(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::remoteProvider"); - return (await remoteProvider(init))(); - }, - async () => { - throw new import_property_provider.CredentialsProviderError("Could not load credentials from any providers", { - tryNextLink: false, - logger: init.logger - }); +// src/stream-collector.ts +var import_util_base64 = __nccwpck_require__(26262); +var streamCollector = /* @__PURE__ */ __name(async (stream) => { + if (typeof Blob === "function" && stream instanceof Blob || stream.constructor?.name === "Blob") { + if (Blob.prototype.arrayBuffer !== void 0) { + return new Uint8Array(await stream.arrayBuffer()); } - ), - credentialsTreatedAsExpired, - credentialsWillNeedRefresh -), "defaultProvider"); -var credentialsWillNeedRefresh = /* @__PURE__ */ __name((credentials) => credentials?.expiration !== void 0, "credentialsWillNeedRefresh"); -var credentialsTreatedAsExpired = /* @__PURE__ */ __name((credentials) => credentials?.expiration !== void 0 && credentials.expiration.getTime() - Date.now() < 3e5, "credentialsTreatedAsExpired"); + return collectBlob(stream); + } + return collectStream(stream); +}, "streamCollector"); +async function collectBlob(blob) { + const base64 = await readToBase64(blob); + const arrayBuffer = (0, import_util_base64.fromBase64)(base64); + return new Uint8Array(arrayBuffer); +} +__name(collectBlob, "collectBlob"); +async function collectStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +__name(collectStream, "collectStream"); +function readToBase64(blob) { + return new Promise((resolve, reject) => { + const reader = new FileReader(); + reader.onloadend = () => { + if (reader.readyState !== 2) { + return reject(new Error("Reader aborted too early")); + } + const result = reader.result ?? ""; + const commaIndex = result.indexOf(","); + const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; + resolve(result.substring(dataOffset)); + }; + reader.onabort = () => reject(new Error("Read aborted")); + reader.onerror = () => reject(reader.error); + reader.readAsDataURL(blob); + }); +} +__name(readToBase64, "readToBase64"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -13769,10 +13090,8 @@ var credentialsTreatedAsExpired = /* @__PURE__ */ __name((credentials) => creden /***/ }), -/***/ 82549: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; +/***/ 95697: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -13794,114 +13113,86 @@ var __copyProps = (to, from, except, desc) => { var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -__export(index_exports, { - fromProcess: () => fromProcess +var src_exports = {}; +__export(src_exports, { + isArrayBuffer: () => isArrayBuffer }); -module.exports = __toCommonJS(index_exports); +module.exports = __toCommonJS(src_exports); +var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); +// Annotate the CommonJS export names for ESM import in node: -// src/fromProcess.ts -var import_shared_ini_file_loader = __nccwpck_require__(80213); +0 && (0); -// src/resolveProcessCredentials.ts -var import_property_provider = __nccwpck_require__(57745); -var import_child_process = __nccwpck_require__(35317); -var import_util = __nccwpck_require__(39023); -// src/getValidatedProcessCredentials.ts -var import_client = __nccwpck_require__(78639); -var getValidatedProcessCredentials = /* @__PURE__ */ __name((profileName, data, profiles) => { - if (data.Version !== 1) { - throw Error(`Profile ${profileName} credential_process did not return Version 1.`); - } - if (data.AccessKeyId === void 0 || data.SecretAccessKey === void 0) { - throw Error(`Profile ${profileName} credential_process returned invalid credentials.`); - } - if (data.Expiration) { - const currentTime = /* @__PURE__ */ new Date(); - const expireTime = new Date(data.Expiration); - if (expireTime < currentTime) { - throw Error(`Profile ${profileName} credential_process returned expired credentials.`); - } - } - let accountId = data.AccountId; - if (!accountId && profiles?.[profileName]?.aws_account_id) { - accountId = profiles[profileName].aws_account_id; - } - const credentials = { - accessKeyId: data.AccessKeyId, - secretAccessKey: data.SecretAccessKey, - ...data.SessionToken && { sessionToken: data.SessionToken }, - ...data.Expiration && { expiration: new Date(data.Expiration) }, - ...data.CredentialScope && { credentialScope: data.CredentialScope }, - ...accountId && { accountId } - }; - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_PROCESS", "w"); - return credentials; -}, "getValidatedProcessCredentials"); -// src/resolveProcessCredentials.ts -var resolveProcessCredentials = /* @__PURE__ */ __name(async (profileName, profiles, logger) => { - const profile = profiles[profileName]; - if (profiles[profileName]) { - const credentialProcess = profile["credential_process"]; - if (credentialProcess !== void 0) { - const execPromise = (0, import_util.promisify)(import_child_process.exec); - try { - const { stdout } = await execPromise(credentialProcess); - let data; - try { - data = JSON.parse(stdout.trim()); - } catch { - throw Error(`Profile ${profileName} credential_process returned invalid JSON.`); - } - return getValidatedProcessCredentials(profileName, data, profiles); - } catch (error) { - throw new import_property_provider.CredentialsProviderError(error.message, { logger }); - } - } else { - throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`, { logger }); - } - } else { - throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`, { - logger - }); - } -}, "resolveProcessCredentials"); +/***/ }), -// src/fromProcess.ts -var fromProcess = /* @__PURE__ */ __name((init = {}) => async ({ callerClientConfig } = {}) => { - init.logger?.debug("@aws-sdk/credential-provider-process - fromProcess"); - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - return resolveProcessCredentials( - (0, import_shared_ini_file_loader.getProfileName)({ - profile: init.profile ?? callerClientConfig?.profile - }), - profiles, - init.logger - ); -}, "fromProcess"); -// Annotate the CommonJS export names for ESM import in node: +/***/ 44412: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -0 && (0); +"use strict"; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointFromConfig = void 0; +const node_config_provider_1 = __nccwpck_require__(44297); +const getEndpointUrlConfig_1 = __nccwpck_require__(83135); +const getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId !== null && serviceId !== void 0 ? serviceId : ""))(); +exports.getEndpointFromConfig = getEndpointFromConfig; /***/ }), -/***/ 96767: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 83135: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointUrlConfig = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(80213); +const ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; +const CONFIG_ENDPOINT_URL = "endpoint_url"; +const getEndpointUrlConfig = (serviceId) => ({ + environmentVariableSelector: (env) => { + const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); + const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; + if (serviceEndpointUrl) + return serviceEndpointUrl; + const endpointUrl = env[ENV_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return undefined; + }, + configFileSelector: (profile, config) => { + if (config && profile.services) { + const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (servicesSection) { + const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); + const endpointUrl = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (endpointUrl) + return endpointUrl; + } + } + const endpointUrl = profile[CONFIG_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return undefined; + }, + default: undefined, +}); +exports.getEndpointUrlConfig = getEndpointUrlConfig; + + +/***/ }), + +/***/ 53152: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __esm = (fn, res) => function __init() { - return fn && (res = (0, fn[__getOwnPropNames(fn)[0]])(fn = 0)), res; -}; var __export = (target, all) => { for (var name in all) __defProp(target, name, { get: all[name], enumerable: true }); @@ -13916,348 +13207,292 @@ var __copyProps = (to, from, except, desc) => { }; var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/loadSso.ts -var loadSso_exports = {}; -__export(loadSso_exports, { - GetRoleCredentialsCommand: () => import_client_sso.GetRoleCredentialsCommand, - SSOClient: () => import_client_sso.SSOClient -}); -var import_client_sso; -var init_loadSso = __esm({ - "src/loadSso.ts"() { - "use strict"; - import_client_sso = __nccwpck_require__(44869); - } -}); - // src/index.ts -var index_exports = {}; -__export(index_exports, { - fromSSO: () => fromSSO, - isSsoProfile: () => isSsoProfile, - validateSsoProfile: () => validateSsoProfile +var src_exports = {}; +__export(src_exports, { + endpointMiddleware: () => endpointMiddleware, + endpointMiddlewareOptions: () => endpointMiddlewareOptions, + getEndpointFromInstructions: () => getEndpointFromInstructions, + getEndpointPlugin: () => getEndpointPlugin, + resolveEndpointConfig: () => resolveEndpointConfig, + resolveEndpointRequiredConfig: () => resolveEndpointRequiredConfig, + resolveParams: () => resolveParams, + toEndpointV1: () => toEndpointV1 }); -module.exports = __toCommonJS(index_exports); - -// src/fromSSO.ts - - - -// src/isSsoProfile.ts -var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); +module.exports = __toCommonJS(src_exports); -// src/resolveSSOCredentials.ts -var import_client = __nccwpck_require__(78639); -var import_token_providers = __nccwpck_require__(14852); -var import_property_provider = __nccwpck_require__(57745); -var import_shared_ini_file_loader = __nccwpck_require__(80213); -var SHOULD_FAIL_CREDENTIAL_CHAIN = false; -var resolveSSOCredentials = /* @__PURE__ */ __name(async ({ - ssoStartUrl, - ssoSession, - ssoAccountId, - ssoRegion, - ssoRoleName, - ssoClient, - clientConfig, - parentClientConfig, - profile, - logger -}) => { - let token; - const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`; - if (ssoSession) { - try { - const _token = await (0, import_token_providers.fromSso)({ profile })(); - token = { - accessToken: _token.token, - expiresAt: new Date(_token.expiration).toISOString() - }; - } catch (e) { - throw new import_property_provider.CredentialsProviderError(e.message, { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); - } - } else { - try { - token = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoStartUrl); - } catch (e) { - throw new import_property_provider.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); +// src/service-customizations/s3.ts +var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { + const bucket = endpointParams?.Bucket || ""; + if (typeof endpointParams.Bucket === "string") { + endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); + } + if (isArnBucketName(bucket)) { + if (endpointParams.ForcePathStyle === true) { + throw new Error("Path-style addressing cannot be used with ARN buckets"); } + } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { + endpointParams.ForcePathStyle = true; } - if (new Date(token.expiresAt).getTime() - Date.now() <= 0) { - throw new import_property_provider.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); + if (endpointParams.DisableMultiRegionAccessPoints) { + endpointParams.disableMultiRegionAccessPoints = true; + endpointParams.DisableMRAP = true; } - const { accessToken } = token; - const { SSOClient: SSOClient2, GetRoleCredentialsCommand: GetRoleCredentialsCommand2 } = await Promise.resolve().then(() => (init_loadSso(), loadSso_exports)); - const sso = ssoClient || new SSOClient2( - Object.assign({}, clientConfig ?? {}, { - logger: clientConfig?.logger ?? parentClientConfig?.logger, - region: clientConfig?.region ?? ssoRegion - }) - ); - let ssoResp; - try { - ssoResp = await sso.send( - new GetRoleCredentialsCommand2({ - accountId: ssoAccountId, - roleName: ssoRoleName, - accessToken - }) - ); - } catch (e) { - throw new import_property_provider.CredentialsProviderError(e, { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); + return endpointParams; +}, "resolveParamsForS3"); +var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; +var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; +var DOTS_PATTERN = /\.\./; +var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); +var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { + const [arn, partition, service, , , bucket] = bucketName.split(":"); + const isArn = arn === "arn" && bucketName.split(":").length >= 6; + const isValidArn = Boolean(isArn && partition && service && bucket); + if (isArn && !isValidArn) { + throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); } - const { - roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration, credentialScope, accountId } = {} - } = ssoResp; - if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) { - throw new import_property_provider.CredentialsProviderError("SSO returns an invalid temporary credential.", { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); + return isValidArn; +}, "isArnBucketName"); + +// src/adaptors/createConfigValueProvider.ts +var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { + const configProvider = /* @__PURE__ */ __name(async () => { + const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; + if (typeof configValue === "function") { + return configValue(); + } + return configValue; + }, "configProvider"); + if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = credentials?.credentialScope ?? credentials?.CredentialScope; + return configValue; + }; } - const credentials = { - accessKeyId, - secretAccessKey, - sessionToken, - expiration: new Date(expiration), - ...credentialScope && { credentialScope }, - ...accountId && { accountId } - }; - if (ssoSession) { - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_SSO", "s"); - } else { - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_SSO_LEGACY", "u"); + if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = credentials?.accountId ?? credentials?.AccountId; + return configValue; + }; } - return credentials; -}, "resolveSSOCredentials"); + if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { + return async () => { + if (config.isCustomEndpoint === false) { + return void 0; + } + const endpoint = await configProvider(); + if (endpoint && typeof endpoint === "object") { + if ("url" in endpoint) { + return endpoint.url.href; + } + if ("hostname" in endpoint) { + const { protocol, hostname, port, path } = endpoint; + return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; + } + } + return endpoint; + }; + } + return configProvider; +}, "createConfigValueProvider"); -// src/validateSsoProfile.ts +// src/adaptors/getEndpointFromInstructions.ts +var import_getEndpointFromConfig = __nccwpck_require__(44412); -var validateSsoProfile = /* @__PURE__ */ __name((profile, logger) => { - const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile; - if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) { - throw new import_property_provider.CredentialsProviderError( - `Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", "sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join( - ", " - )} -Reference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, - { tryNextLink: false, logger } - ); +// src/adaptors/toEndpointV1.ts +var import_url_parser = __nccwpck_require__(81983); +var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { + if (typeof endpoint === "object") { + if ("url" in endpoint) { + return (0, import_url_parser.parseUrl)(endpoint.url); + } + return endpoint; } - return profile; -}, "validateSsoProfile"); + return (0, import_url_parser.parseUrl)(endpoint); +}, "toEndpointV1"); -// src/fromSSO.ts -var fromSSO = /* @__PURE__ */ __name((init = {}) => async ({ callerClientConfig } = {}) => { - init.logger?.debug("@aws-sdk/credential-provider-sso - fromSSO"); - const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; - const { ssoClient } = init; - const profileName = (0, import_shared_ini_file_loader.getProfileName)({ - profile: init.profile ?? callerClientConfig?.profile - }); - if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - const profile = profiles[profileName]; - if (!profile) { - throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} was not found.`, { logger: init.logger }); +// src/adaptors/getEndpointFromInstructions.ts +var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { + if (!clientConfig.isCustomEndpoint) { + let endpointFromConfig; + if (clientConfig.serviceConfiguredEndpoint) { + endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); + } else { + endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId); } - if (!isSsoProfile(profile)) { - throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`, { - logger: init.logger - }); + if (endpointFromConfig) { + clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); + clientConfig.isCustomEndpoint = true; } - if (profile?.sso_session) { - const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); - const session = ssoSessions[profile.sso_session]; - const conflictMsg = ` configurations in profile ${profileName} and sso-session ${profile.sso_session}`; - if (ssoRegion && ssoRegion !== session.sso_region) { - throw new import_property_provider.CredentialsProviderError(`Conflicting SSO region` + conflictMsg, { - tryNextLink: false, - logger: init.logger - }); - } - if (ssoStartUrl && ssoStartUrl !== session.sso_start_url) { - throw new import_property_provider.CredentialsProviderError(`Conflicting SSO start_url` + conflictMsg, { - tryNextLink: false, - logger: init.logger - }); - } - profile.sso_region = session.sso_region; - profile.sso_start_url = session.sso_start_url; + } + const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); + if (typeof clientConfig.endpointProvider !== "function") { + throw new Error("config.endpointProvider is not set."); + } + const endpoint = clientConfig.endpointProvider(endpointParams, context); + return endpoint; +}, "getEndpointFromInstructions"); +var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { + const endpointParams = {}; + const instructions = instructionsSupplier?.getEndpointParameterInstructions?.() || {}; + for (const [name, instruction] of Object.entries(instructions)) { + switch (instruction.type) { + case "staticContextParams": + endpointParams[name] = instruction.value; + break; + case "contextParams": + endpointParams[name] = commandInput[instruction.name]; + break; + case "clientContextParams": + case "builtInParams": + endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); + break; + case "operationContextParams": + endpointParams[name] = instruction.get(commandInput); + break; + default: + throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); } - const { sso_start_url, sso_account_id, sso_region, sso_role_name, sso_session } = validateSsoProfile( - profile, - init.logger - ); - return resolveSSOCredentials({ - ssoStartUrl: sso_start_url, - ssoSession: sso_session, - ssoAccountId: sso_account_id, - ssoRegion: sso_region, - ssoRoleName: sso_role_name, - ssoClient, - clientConfig: init.clientConfig, - parentClientConfig: init.parentClientConfig, - profile: profileName - }); - } else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) { - throw new import_property_provider.CredentialsProviderError( - 'Incomplete configuration. The fromSSO() argument hash must include "ssoStartUrl", "ssoAccountId", "ssoRegion", "ssoRoleName"', - { tryNextLink: false, logger: init.logger } - ); - } else { - return resolveSSOCredentials({ - ssoStartUrl, - ssoSession, - ssoAccountId, - ssoRegion, - ssoRoleName, - ssoClient, - clientConfig: init.clientConfig, - parentClientConfig: init.parentClientConfig, - profile: profileName - }); } -}, "fromSSO"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 58792: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; + if (Object.keys(instructions).length === 0) { + Object.assign(endpointParams, clientConfig); + } + if (String(clientConfig.serviceId).toLowerCase() === "s3") { + await resolveParamsForS3(endpointParams); + } + return endpointParams; +}, "resolveParams"); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromTokenFile = void 0; -const client_1 = __nccwpck_require__(78639); -const property_provider_1 = __nccwpck_require__(57745); -const fs_1 = __nccwpck_require__(79896); -const fromWebToken_1 = __nccwpck_require__(9272); -const ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; -const ENV_ROLE_ARN = "AWS_ROLE_ARN"; -const ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME"; -const fromTokenFile = (init = {}) => async () => { - init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromTokenFile"); - const webIdentityTokenFile = init?.webIdentityTokenFile ?? process.env[ENV_TOKEN_FILE]; - const roleArn = init?.roleArn ?? process.env[ENV_ROLE_ARN]; - const roleSessionName = init?.roleSessionName ?? process.env[ENV_ROLE_SESSION_NAME]; - if (!webIdentityTokenFile || !roleArn) { - throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified", { - logger: init.logger, - }); +// src/endpointMiddleware.ts +var import_core = __nccwpck_require__(90475); +var import_util_middleware = __nccwpck_require__(25695); +var endpointMiddleware = /* @__PURE__ */ __name(({ + config, + instructions +}) => { + return (next, context) => async (args) => { + if (config.isCustomEndpoint) { + (0, import_core.setFeature)(context, "ENDPOINT_OVERRIDE", "N"); } - const credentials = await (0, fromWebToken_1.fromWebToken)({ - ...init, - webIdentityToken: (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }), - roleArn, - roleSessionName, - })(); - if (webIdentityTokenFile === process.env[ENV_TOKEN_FILE]) { - (0, client_1.setCredentialFeature)(credentials, "CREDENTIALS_ENV_VARS_STS_WEB_ID_TOKEN", "h"); + const endpoint = await getEndpointFromInstructions( + args.input, + { + getEndpointParameterInstructions() { + return instructions; + } + }, + { ...config }, + context + ); + context.endpointV2 = endpoint; + context.authSchemes = endpoint.properties?.authSchemes; + const authScheme = context.authSchemes?.[0]; + if (authScheme) { + context["signing_region"] = authScheme.signingRegion; + context["signing_service"] = authScheme.signingName; + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const httpAuthOption = smithyContext?.selectedHttpAuthScheme?.httpAuthOption; + if (httpAuthOption) { + httpAuthOption.signingProperties = Object.assign( + httpAuthOption.signingProperties || {}, + { + signing_region: authScheme.signingRegion, + signingRegion: authScheme.signingRegion, + signing_service: authScheme.signingName, + signingName: authScheme.signingName, + signingRegionSet: authScheme.signingRegionSet + }, + authScheme.properties + ); + } } - return credentials; + return next({ + ...args + }); + }; +}, "endpointMiddleware"); + +// src/getEndpointPlugin.ts +var import_middleware_serde = __nccwpck_require__(29514); +var endpointMiddlewareOptions = { + step: "serialize", + tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], + name: "endpointV2Middleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde.serializerMiddlewareOption.name }; -exports.fromTokenFile = fromTokenFile; +var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + endpointMiddleware({ + config, + instructions + }), + endpointMiddlewareOptions + ); + } +}), "getEndpointPlugin"); +// src/resolveEndpointConfig.ts -/***/ }), +var import_getEndpointFromConfig2 = __nccwpck_require__(44412); +var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { + const tls = input.tls ?? true; + const { endpoint, useDualstackEndpoint, useFipsEndpoint } = input; + const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware.normalizeProvider)(endpoint)()) : void 0; + const isCustomEndpoint = !!endpoint; + const resolvedConfig = Object.assign(input, { + endpoint: customEndpointProvider, + tls, + isCustomEndpoint, + useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(useDualstackEndpoint ?? false), + useFipsEndpoint: (0, import_util_middleware.normalizeProvider)(useFipsEndpoint ?? false) + }); + let configuredEndpointPromise = void 0; + resolvedConfig.serviceConfiguredEndpoint = async () => { + if (input.serviceId && !configuredEndpointPromise) { + configuredEndpointPromise = (0, import_getEndpointFromConfig2.getEndpointFromConfig)(input.serviceId); + } + return configuredEndpointPromise; + }; + return resolvedConfig; +}, "resolveEndpointConfig"); -/***/ 9272: -/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { +// src/resolveEndpointRequiredConfig.ts +var resolveEndpointRequiredConfig = /* @__PURE__ */ __name((input) => { + const { endpoint } = input; + if (endpoint === void 0) { + input.endpoint = async () => { + throw new Error( + "@smithy/middleware-endpoint: (default endpointRuleSet) endpoint is not set - you must configure an endpoint." + ); + }; + } + return input; +}, "resolveEndpointRequiredConfig"); +// Annotate the CommonJS export names for ESM import in node: -"use strict"; +0 && (0); -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { return m[k]; } }; - } - Object.defineProperty(o, k2, desc); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { - Object.defineProperty(o, "default", { enumerable: true, value: v }); -}) : function(o, v) { - o["default"] = v; -}); -var __importStar = (this && this.__importStar) || (function () { - var ownKeys = function(o) { - ownKeys = Object.getOwnPropertyNames || function (o) { - var ar = []; - for (var k in o) if (Object.prototype.hasOwnProperty.call(o, k)) ar[ar.length] = k; - return ar; - }; - return ownKeys(o); - }; - return function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k = ownKeys(mod), i = 0; i < k.length; i++) if (k[i] !== "default") __createBinding(result, mod, k[i]); - __setModuleDefault(result, mod); - return result; - }; -})(); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromWebToken = void 0; -const fromWebToken = (init) => async (awsIdentityProperties) => { - init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromWebToken"); - const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds } = init; - let { roleAssumerWithWebIdentity } = init; - if (!roleAssumerWithWebIdentity) { - const { getDefaultRoleAssumerWithWebIdentity } = await Promise.resolve().then(() => __importStar(__nccwpck_require__(12801))); - roleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity({ - ...init.clientConfig, - credentialProviderLogger: init.logger, - parentClientConfig: { - ...awsIdentityProperties?.callerClientConfig, - ...init.parentClientConfig, - }, - }, init.clientPlugins); - } - return roleAssumerWithWebIdentity({ - RoleArn: roleArn, - RoleSessionName: roleSessionName ?? `aws-sdk-js-session-${Date.now()}`, - WebIdentityToken: webIdentityToken, - ProviderId: providerId, - PolicyArns: policyArns, - Policy: policy, - DurationSeconds: durationSeconds, - }); -}; -exports.fromWebToken = fromWebToken; /***/ }), -/***/ 52427: +/***/ 29514: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -"use strict"; - var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; var __copyProps = (to, from, except, desc) => { if (from && typeof from === "object" || typeof from === "function") { for (let key of __getOwnPropNames(from)) @@ -14266,86 +13501,108 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -module.exports = __toCommonJS(index_exports); -__reExport(index_exports, __nccwpck_require__(58792), module.exports); -__reExport(index_exports, __nccwpck_require__(9272), module.exports); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 29477: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; +var src_exports = {}; +__export(src_exports, { + deserializerMiddleware: () => deserializerMiddleware, + deserializerMiddlewareOption: () => deserializerMiddlewareOption, + getSerdePlugin: () => getSerdePlugin, + serializerMiddleware: () => serializerMiddleware, + serializerMiddlewareOption: () => serializerMiddlewareOption +}); +module.exports = __toCommonJS(src_exports); -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +// src/deserializerMiddleware.ts +var import_protocol_http = __nccwpck_require__(5559); +var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next, context) => async (args) => { + const { response } = await next(args); + try { + const parsed = await deserializer(response, options); + return { + response, + output: parsed + }; + } catch (error) { + Object.defineProperty(error, "$response", { + value: response + }); + if (!("$metadata" in error)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + try { + error.message += "\n " + hint; + } catch (e) { + if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { + console.warn(hint); + } else { + context.logger?.warn?.(hint); + } + } + if (typeof error.$responseBodyText !== "undefined") { + if (error.$response) { + error.$response.body = error.$responseBodyText; + } + } + try { + if (import_protocol_http.HttpResponse.isInstance(response)) { + const { headers = {} } = response; + const headerEntries = Object.entries(headers); + error.$metadata = { + httpStatusCode: response.statusCode, + requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), + extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), + cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) + }; + } + } catch (e) { + } + } + throw error; } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +}, "deserializerMiddleware"); +var findHeader = /* @__PURE__ */ __name((pattern, headers) => { + return (headers.find(([k]) => { + return k.match(pattern); + }) || [void 0, void 0])[1]; +}, "findHeader"); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - getHostHeaderPlugin: () => getHostHeaderPlugin, - hostHeaderMiddleware: () => hostHeaderMiddleware, - hostHeaderMiddlewareOptions: () => hostHeaderMiddlewareOptions, - resolveHostHeaderConfig: () => resolveHostHeaderConfig -}); -module.exports = __toCommonJS(index_exports); -var import_protocol_http = __nccwpck_require__(5559); -function resolveHostHeaderConfig(input) { - return input; -} -__name(resolveHostHeaderConfig, "resolveHostHeaderConfig"); -var hostHeaderMiddleware = /* @__PURE__ */ __name((options) => (next) => async (args) => { - if (!import_protocol_http.HttpRequest.isInstance(args.request)) return next(args); - const { request } = args; - const { handlerProtocol = "" } = options.requestHandler.metadata || {}; - if (handlerProtocol.indexOf("h2") >= 0 && !request.headers[":authority"]) { - delete request.headers["host"]; - request.headers[":authority"] = request.hostname + (request.port ? ":" + request.port : ""); - } else if (!request.headers["host"]) { - let host = request.hostname; - if (request.port != null) host += `:${request.port}`; - request.headers["host"] = host; +// src/serializerMiddleware.ts +var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { + const endpointConfig = options; + const endpoint = context.endpointV2?.url && endpointConfig.urlParser ? async () => endpointConfig.urlParser(context.endpointV2.url) : endpointConfig.endpoint; + if (!endpoint) { + throw new Error("No valid endpoint provider available."); } - return next(args); -}, "hostHeaderMiddleware"); -var hostHeaderMiddlewareOptions = { - name: "hostHeaderMiddleware", - step: "build", - priority: "low", - tags: ["HOST"], + const request = await serializer(args.input, { ...options, endpoint }); + return next({ + ...args, + request + }); +}, "serializerMiddleware"); + +// src/serdePlugin.ts +var deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], override: true }; -var getHostHeaderPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(hostHeaderMiddleware(options), hostHeaderMiddlewareOptions); - }, "applyToStack") -}), "getHostHeaderPlugin"); +var serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true +}; +function getSerdePlugin(config, serializer, deserializer) { + return { + applyToStack: (commandStack) => { + commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); + commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption); + } + }; +} +__name(getSerdePlugin, "getSerdePlugin"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -14354,10 +13611,8 @@ var getHostHeaderPlugin = /* @__PURE__ */ __name((options) => ({ /***/ }), -/***/ 38703: -/***/ ((module) => { - -"use strict"; +/***/ 44297: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -14379,132 +13634,89 @@ var __copyProps = (to, from, except, desc) => { var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -__export(index_exports, { - getLoggerPlugin: () => getLoggerPlugin, - loggerMiddleware: () => loggerMiddleware, - loggerMiddlewareOptions: () => loggerMiddlewareOptions +var src_exports = {}; +__export(src_exports, { + loadConfig: () => loadConfig }); -module.exports = __toCommonJS(index_exports); - -// src/loggerMiddleware.ts -var loggerMiddleware = /* @__PURE__ */ __name(() => (next, context) => async (args) => { - try { - const response = await next(args); - const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; - const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions; - const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; - const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog ?? context.outputFilterSensitiveLog; - const { $metadata, ...outputWithoutMetadata } = response.output; - logger?.info?.({ - clientName, - commandName, - input: inputFilterSensitiveLog(args.input), - output: outputFilterSensitiveLog(outputWithoutMetadata), - metadata: $metadata - }); - return response; - } catch (error) { - const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; - const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions; - const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; - logger?.error?.({ - clientName, - commandName, - input: inputFilterSensitiveLog(args.input), - error, - metadata: error.$metadata - }); - throw error; - } -}, "loggerMiddleware"); -var loggerMiddlewareOptions = { - name: "loggerMiddleware", - tags: ["LOGGER"], - step: "initialize", - override: true -}; -var getLoggerPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(loggerMiddleware(), loggerMiddlewareOptions); - }, "applyToStack") -}), "getLoggerPlugin"); -// Annotate the CommonJS export names for ESM import in node: +module.exports = __toCommonJS(src_exports); -0 && (0); +// src/configLoader.ts +// src/fromEnv.ts +var import_property_provider = __nccwpck_require__(57745); -/***/ }), +// src/getSelectorName.ts +function getSelectorName(functionString) { + try { + const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); + constants.delete("CONFIG"); + constants.delete("CONFIG_PREFIX_SEPARATOR"); + constants.delete("ENV"); + return [...constants].join(", "); + } catch (e) { + return functionString; + } +} +__name(getSelectorName, "getSelectorName"); -/***/ 21067: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +// src/fromEnv.ts +var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { + try { + const config = envVarSelector(process.env, options); + if (config === void 0) { + throw new Error(); + } + return config; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, + { logger: options?.logger } + ); + } +}, "fromEnv"); -"use strict"; +// src/fromSharedConfigFiles.ts -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +var import_shared_ini_file_loader = __nccwpck_require__(80213); +var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, import_shared_ini_file_loader.getProfileName)(init); + const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; + try { + const cfgFile = preferredFile === "config" ? configFile : credentialsFile; + const configValue = configSelector(mergedProfile, cfgFile); + if (configValue === void 0) { + throw new Error(); + } + return configValue; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, + { logger: init.logger } + ); } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +}, "fromSharedConfigFiles"); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - addRecursionDetectionMiddlewareOptions: () => addRecursionDetectionMiddlewareOptions, - getRecursionDetectionPlugin: () => getRecursionDetectionPlugin, - recursionDetectionMiddleware: () => recursionDetectionMiddleware -}); -module.exports = __toCommonJS(index_exports); -var import_protocol_http = __nccwpck_require__(5559); -var TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id"; -var ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME"; -var ENV_TRACE_ID = "_X_AMZN_TRACE_ID"; -var recursionDetectionMiddleware = /* @__PURE__ */ __name((options) => (next) => async (args) => { - const { request } = args; - if (!import_protocol_http.HttpRequest.isInstance(request) || options.runtime !== "node") { - return next(args); - } - const traceIdHeader = Object.keys(request.headers ?? {}).find((h) => h.toLowerCase() === TRACE_ID_HEADER_NAME.toLowerCase()) ?? TRACE_ID_HEADER_NAME; - if (request.headers.hasOwnProperty(traceIdHeader)) { - return next(args); - } - const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME]; - const traceId = process.env[ENV_TRACE_ID]; - const nonEmptyString = /* @__PURE__ */ __name((str) => typeof str === "string" && str.length > 0, "nonEmptyString"); - if (nonEmptyString(functionName) && nonEmptyString(traceId)) { - request.headers[TRACE_ID_HEADER_NAME] = traceId; - } - return next({ - ...args, - request - }); -}, "recursionDetectionMiddleware"); -var addRecursionDetectionMiddlewareOptions = { - step: "build", - tags: ["RECURSION_DETECTION"], - name: "recursionDetectionMiddleware", - override: true, - priority: "low" -}; -var getRecursionDetectionPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(recursionDetectionMiddleware(options), addRecursionDetectionMiddlewareOptions); - }, "applyToStack") -}), "getRecursionDetectionPlugin"); +// src/fromStatic.ts + +var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); +var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); + +// src/configLoader.ts +var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { + const { signingName, logger } = configuration; + const envOptions = { signingName, logger }; + return (0, import_property_provider.memoize)( + (0, import_property_provider.chain)( + fromEnv(environmentVariableSelector, envOptions), + fromSharedConfigFiles(configFileSelector, configuration), + fromStatic(defaultValue) + ) + ); +}, "loadConfig"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -14513,14 +13725,14 @@ var getRecursionDetectionPlugin = /* @__PURE__ */ __name((options) => ({ /***/ }), -/***/ 58534: +/***/ 11176: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -"use strict"; - +var __create = Object.create; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { @@ -14535,322 +13747,796 @@ var __copyProps = (to, from, except, desc) => { } return to; }; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -__export(index_exports, { - DEFAULT_UA_APP_ID: () => DEFAULT_UA_APP_ID, - getUserAgentMiddlewareOptions: () => getUserAgentMiddlewareOptions, - getUserAgentPlugin: () => getUserAgentPlugin, - resolveUserAgentConfig: () => resolveUserAgentConfig, - userAgentMiddleware: () => userAgentMiddleware +var src_exports = {}; +__export(src_exports, { + DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, + NodeHttp2Handler: () => NodeHttp2Handler, + NodeHttpHandler: () => NodeHttpHandler, + streamCollector: () => streamCollector }); -module.exports = __toCommonJS(index_exports); +module.exports = __toCommonJS(src_exports); -// src/configurations.ts -var import_core = __nccwpck_require__(90475); -var DEFAULT_UA_APP_ID = void 0; -function isValidUserAgentAppId(appId) { - if (appId === void 0) { - return true; +// src/node-http-handler.ts +var import_protocol_http = __nccwpck_require__(5559); +var import_querystring_builder = __nccwpck_require__(75547); +var import_http = __nccwpck_require__(58611); +var import_https = __nccwpck_require__(65692); + +// src/constants.ts +var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + +// src/get-transformed-headers.ts +var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; } - return typeof appId === "string" && appId.length <= 50; -} -__name(isValidUserAgentAppId, "isValidUserAgentAppId"); -function resolveUserAgentConfig(input) { - const normalizedAppIdProvider = (0, import_core.normalizeProvider)(input.userAgentAppId ?? DEFAULT_UA_APP_ID); - const { customUserAgent } = input; - return Object.assign(input, { - customUserAgent: typeof customUserAgent === "string" ? [[customUserAgent]] : customUserAgent, - userAgentAppId: /* @__PURE__ */ __name(async () => { - const appId = await normalizedAppIdProvider(); - if (!isValidUserAgentAppId(appId)) { - const logger = input.logger?.constructor?.name === "NoOpLogger" || !input.logger ? console : input.logger; - if (typeof appId !== "string") { - logger?.warn("userAgentAppId must be a string or undefined."); - } else if (appId.length > 50) { - logger?.warn("The provided userAgentAppId exceeds the maximum length of 50 characters."); - } - } - return appId; - }, "userAgentAppId") - }); -} -__name(resolveUserAgentConfig, "resolveUserAgentConfig"); + return transformedHeaders; +}, "getTransformedHeaders"); -// src/user-agent-middleware.ts -var import_util_endpoints = __nccwpck_require__(11911); -var import_protocol_http = __nccwpck_require__(5559); +// src/timing.ts +var timing = { + setTimeout: (cb, ms) => setTimeout(cb, ms), + clearTimeout: (timeoutId) => clearTimeout(timeoutId) +}; -// src/check-features.ts -var import_core2 = __nccwpck_require__(79191); -var ACCOUNT_ID_ENDPOINT_REGEX = /\d{12}\.ddb/; -async function checkFeatures(context, config, args) { - const request = args.request; - if (request?.headers?.["smithy-protocol"] === "rpc-v2-cbor") { - (0, import_core2.setFeature)(context, "PROTOCOL_RPC_V2_CBOR", "M"); +// src/set-connection-timeout.ts +var DEFER_EVENT_LISTENER_TIME = 1e3; +var setConnectionTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return -1; } - if (typeof config.retryStrategy === "function") { - const retryStrategy = await config.retryStrategy(); - if (typeof retryStrategy.acquireInitialRetryToken === "function") { - if (retryStrategy.constructor?.name?.includes("Adaptive")) { - (0, import_core2.setFeature)(context, "RETRY_MODE_ADAPTIVE", "F"); + const registerTimeout = /* @__PURE__ */ __name((offset) => { + const timeoutId = timing.setTimeout(() => { + request.destroy(); + reject( + Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError" + }) + ); + }, timeoutInMs - offset); + const doWithSocket = /* @__PURE__ */ __name((socket) => { + if (socket?.connecting) { + socket.on("connect", () => { + timing.clearTimeout(timeoutId); + }); } else { - (0, import_core2.setFeature)(context, "RETRY_MODE_STANDARD", "E"); + timing.clearTimeout(timeoutId); } + }, "doWithSocket"); + if (request.socket) { + doWithSocket(request.socket); } else { - (0, import_core2.setFeature)(context, "RETRY_MODE_LEGACY", "D"); + request.on("socket", doWithSocket); } + }, "registerTimeout"); + if (timeoutInMs < 2e3) { + registerTimeout(0); + return 0; } - if (typeof config.accountIdEndpointMode === "function") { - const endpointV2 = context.endpointV2; - if (String(endpointV2?.url?.hostname).match(ACCOUNT_ID_ENDPOINT_REGEX)) { - (0, import_core2.setFeature)(context, "ACCOUNT_ID_ENDPOINT", "O"); - } - switch (await config.accountIdEndpointMode?.()) { - case "disabled": - (0, import_core2.setFeature)(context, "ACCOUNT_ID_MODE_DISABLED", "Q"); - break; - case "preferred": - (0, import_core2.setFeature)(context, "ACCOUNT_ID_MODE_PREFERRED", "P"); - break; - case "required": - (0, import_core2.setFeature)(context, "ACCOUNT_ID_MODE_REQUIRED", "R"); - break; - } + return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); +}, "setConnectionTimeout"); + +// src/set-socket-keep-alive.ts +var DEFER_EVENT_LISTENER_TIME2 = 3e3; +var setSocketKeepAlive = /* @__PURE__ */ __name((request, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { + if (keepAlive !== true) { + return -1; } - const identity = context.__smithy_context?.selectedHttpAuthScheme?.identity; - if (identity?.$source) { - const credentials = identity; - if (credentials.accountId) { - (0, import_core2.setFeature)(context, "RESOLVED_ACCOUNT_ID", "T"); - } - for (const [key, value] of Object.entries(credentials.$source ?? {})) { - (0, import_core2.setFeature)(context, key, value); + const registerListener = /* @__PURE__ */ __name(() => { + if (request.socket) { + request.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + } else { + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); } + }, "registerListener"); + if (deferTimeMs === 0) { + registerListener(); + return 0; } -} -__name(checkFeatures, "checkFeatures"); + return timing.setTimeout(registerListener, deferTimeMs); +}, "setSocketKeepAlive"); -// src/constants.ts -var USER_AGENT = "user-agent"; -var X_AMZ_USER_AGENT = "x-amz-user-agent"; -var SPACE = " "; -var UA_NAME_SEPARATOR = "/"; -var UA_NAME_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w]/g; -var UA_VALUE_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w\#]/g; -var UA_ESCAPE_CHAR = "-"; +// src/set-socket-timeout.ts +var DEFER_EVENT_LISTENER_TIME3 = 3e3; +var setSocketTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = DEFAULT_REQUEST_TIMEOUT) => { + const registerTimeout = /* @__PURE__ */ __name((offset) => { + const timeout = timeoutInMs - offset; + const onTimeout = /* @__PURE__ */ __name(() => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }, "onTimeout"); + if (request.socket) { + request.socket.setTimeout(timeout, onTimeout); + request.on("close", () => request.socket?.removeListener("timeout", onTimeout)); + } else { + request.setTimeout(timeout, onTimeout); + } + }, "registerTimeout"); + if (0 < timeoutInMs && timeoutInMs < 6e3) { + registerTimeout(0); + return 0; + } + return timing.setTimeout( + registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), + DEFER_EVENT_LISTENER_TIME3 + ); +}, "setSocketTimeout"); -// src/encode-features.ts -var BYTE_LIMIT = 1024; -function encodeFeatures(features) { - let buffer = ""; - for (const key in features) { - const val = features[key]; - if (buffer.length + val.length + 1 <= BYTE_LIMIT) { - if (buffer.length) { - buffer += "," + val; - } else { - buffer += val; - } - continue; +// src/write-request-body.ts +var import_stream = __nccwpck_require__(2203); +var MIN_WAIT_TIME = 6e3; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + const headers = request.headers ?? {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let sendBody = true; + if (expect === "100-continue") { + sendBody = await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(timing.setTimeout(() => resolve(true), Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + timing.clearTimeout(timeoutId); + resolve(true); + }); + httpRequest.on("response", () => { + timing.clearTimeout(timeoutId); + resolve(false); + }); + httpRequest.on("error", () => { + timing.clearTimeout(timeoutId); + resolve(false); + }); + }) + ]); + } + if (sendBody) { + writeBody(httpRequest, request.body); + } +} +__name(writeRequestBody, "writeRequestBody"); +function writeBody(httpRequest, body) { + if (body instanceof import_stream.Readable) { + body.pipe(httpRequest); + return; + } + if (body) { + if (Buffer.isBuffer(body) || typeof body === "string") { + httpRequest.end(body); + return; } - break; + const uint8 = body; + if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { + httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); + return; + } + httpRequest.end(Buffer.from(body)); + return; } - return buffer; + httpRequest.end(); } -__name(encodeFeatures, "encodeFeatures"); +__name(writeBody, "writeBody"); -// src/user-agent-middleware.ts -var userAgentMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { - const { request } = args; - if (!import_protocol_http.HttpRequest.isInstance(request)) { - return next(args); +// src/node-http-handler.ts +var DEFAULT_REQUEST_TIMEOUT = 0; +var NodeHttpHandler = class _NodeHttpHandler { + constructor(options) { + this.socketWarningTimestamp = 0; + // Node http handler is hard-coded to http/1.1: https://github.com/nodejs/node/blob/ff5664b83b89c55e4ab5d5f60068fb457f1f5872/lib/_http_server.js#L286 + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }).catch(reject); + } else { + resolve(this.resolveDefaultConfig(options)); + } + }); } - const { headers } = request; - const userAgent = context?.userAgent?.map(escapeUserAgent) || []; - const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent); - await checkFeatures(context, options, args); - const awsContext = context; - defaultUserAgent.push( - `m/${encodeFeatures( - Object.assign({}, context.__smithy_context?.features, awsContext.__aws_sdk_context?.features) - )}` - ); - const customUserAgent = options?.customUserAgent?.map(escapeUserAgent) || []; - const appId = await options.userAgentAppId(); - if (appId) { - defaultUserAgent.push(escapeUserAgent([`app/${appId}`])); + static { + __name(this, "NodeHttpHandler"); } - const prefix = (0, import_util_endpoints.getUserAgentPrefix)(); - const sdkUserAgentValue = (prefix ? [prefix] : []).concat([...defaultUserAgent, ...userAgent, ...customUserAgent]).join(SPACE); - const normalUAValue = [ - ...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")), - ...customUserAgent - ].join(SPACE); - if (options.runtime !== "browser") { - if (normalUAValue) { - headers[X_AMZ_USER_AGENT] = headers[X_AMZ_USER_AGENT] ? `${headers[USER_AGENT]} ${normalUAValue}` : normalUAValue; + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof instanceOrOptions?.handle === "function") { + return instanceOrOptions; } - headers[USER_AGENT] = sdkUserAgentValue; - } else { - headers[X_AMZ_USER_AGENT] = sdkUserAgentValue; - } - return next({ - ...args, - request - }); -}, "userAgentMiddleware"); -var escapeUserAgent = /* @__PURE__ */ __name((userAgentPair) => { - const name = userAgentPair[0].split(UA_NAME_SEPARATOR).map((part) => part.replace(UA_NAME_ESCAPE_REGEX, UA_ESCAPE_CHAR)).join(UA_NAME_SEPARATOR); - const version = userAgentPair[1]?.replace(UA_VALUE_ESCAPE_REGEX, UA_ESCAPE_CHAR); - const prefixSeparatorIndex = name.indexOf(UA_NAME_SEPARATOR); - const prefix = name.substring(0, prefixSeparatorIndex); - let uaName = name.substring(prefixSeparatorIndex + 1); - if (prefix === "api") { - uaName = uaName.toLowerCase(); + return new _NodeHttpHandler(instanceOrOptions); } - return [prefix, uaName, version].filter((item) => item && item.length > 0).reduce((acc, item, index) => { - switch (index) { - case 0: - return item; - case 1: - return `${acc}/${item}`; - default: - return `${acc}#${item}`; + /** + * @internal + * + * @param agent - http(s) agent in use by the NodeHttpHandler instance. + * @param socketWarningTimestamp - last socket usage check timestamp. + * @param logger - channel for the warning. + * @returns timestamp of last emitted warning. + */ + static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { + const { sockets, requests, maxSockets } = agent; + if (typeof maxSockets !== "number" || maxSockets === Infinity) { + return socketWarningTimestamp; } - }, ""); -}, "escapeUserAgent"); -var getUserAgentMiddlewareOptions = { - name: "getUserAgentMiddleware", - step: "build", - priority: "low", - tags: ["SET_USER_AGENT", "USER_AGENT"], - override: true -}; -var getUserAgentPlugin = /* @__PURE__ */ __name((config) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(userAgentMiddleware(config), getUserAgentMiddlewareOptions); - }, "applyToStack") -}), "getUserAgentPlugin"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 51351: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveHttpAuthSchemeConfig = exports.defaultSSOOIDCHttpAuthSchemeProvider = exports.defaultSSOOIDCHttpAuthSchemeParametersProvider = void 0; -const core_1 = __nccwpck_require__(79191); -const util_middleware_1 = __nccwpck_require__(25695); -const defaultSSOOIDCHttpAuthSchemeParametersProvider = async (config, context, input) => { - return { - operation: (0, util_middleware_1.getSmithyContext)(context).operation, - region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || - (() => { - throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); - })(), - }; -}; -exports.defaultSSOOIDCHttpAuthSchemeParametersProvider = defaultSSOOIDCHttpAuthSchemeParametersProvider; -function createAwsAuthSigv4HttpAuthOption(authParameters) { - return { - schemeId: "aws.auth#sigv4", - signingProperties: { - name: "sso-oauth", - region: authParameters.region, - }, - propertiesExtractor: (config, context) => ({ - signingProperties: { - config, - context, - }, - }), - }; -} -function createSmithyApiNoAuthHttpAuthOption(authParameters) { + const interval = 15e3; + if (Date.now() - interval < socketWarningTimestamp) { + return socketWarningTimestamp; + } + if (sockets && requests) { + for (const origin in sockets) { + const socketsInUse = sockets[origin]?.length ?? 0; + const requestsEnqueued = requests[origin]?.length ?? 0; + if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { + logger?.warn?.( + `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. +See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html +or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` + ); + return Date.now(); + } + } + } + return socketWarningTimestamp; + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, socketAcquisitionWarningTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; return { - schemeId: "smithy.api#noAuth", - }; -} -const defaultSSOOIDCHttpAuthSchemeProvider = (authParameters) => { - const options = []; - switch (authParameters.operation) { - case "CreateToken": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; + connectionTimeout, + requestTimeout: requestTimeout ?? socketTimeout, + socketAcquisitionWarningTimeout, + httpAgent: (() => { + if (httpAgent instanceof import_http.Agent || typeof httpAgent?.destroy === "function") { + return httpAgent; } - default: { - options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); + })(), + httpsAgent: (() => { + if (httpsAgent instanceof import_https.Agent || typeof httpsAgent?.destroy === "function") { + return httpsAgent; } + return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); + })(), + logger: console + }; + } + destroy() { + this.config?.httpAgent?.destroy(); + this.config?.httpsAgent?.destroy(); + } + async handle(request, { abortSignal, requestTimeout } = {}) { + if (!this.config) { + this.config = await this.configProvider; } - return options; -}; -exports.defaultSSOOIDCHttpAuthSchemeProvider = defaultSSOOIDCHttpAuthSchemeProvider; -const resolveHttpAuthSchemeConfig = (config) => { - const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); - return Object.assign(config_0, { - authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), + return new Promise((_resolve, _reject) => { + let writeRequestBodyPromise = void 0; + const timeouts = []; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(timing.clearTimeout); + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(timing.clearTimeout); + _reject(arg); + }, "reject"); + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal?.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; + timeouts.push( + timing.setTimeout( + () => { + this.socketWarningTimestamp = _NodeHttpHandler.checkSocketUsage( + agent, + this.socketWarningTimestamp, + this.config.logger + ); + }, + this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) + ) + ); + const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); + let auth = void 0; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + let hostname = request.hostname ?? ""; + if (hostname[0] === "[" && hostname.endsWith("]")) { + hostname = request.hostname.slice(1, -1); + } else { + hostname = request.hostname; + } + const nodeHttpsOptions = { + headers: request.headers, + host: hostname, + method: request.method, + path, + port: request.port, + agent, + auth + }; + const requestFunc = isSSL ? import_https.request : import_http.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new import_protocol_http.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: getTransformedHeaders(res.headers), + body: res + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } else { + reject(err); + } + }); + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.destroy(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; + } + } + const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; + timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); + timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + timeouts.push( + setSocketKeepAlive(req, { + // @ts-expect-error keepAlive is not public on httpAgent. + keepAlive: httpAgent.keepAlive, + // @ts-expect-error keepAliveMsecs is not public on httpAgent. + keepAliveMsecs: httpAgent.keepAliveMsecs + }) + ); + } + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { + timeouts.forEach(timing.clearTimeout); + return _reject(e); + }); + }); + } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } }; -exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; +// src/node-http2-handler.ts -/***/ }), -/***/ 97713: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +var import_http22 = __nccwpck_require__(85675); -"use strict"; +// src/node-http2-connection-manager.ts +var import_http2 = __toESM(__nccwpck_require__(85675)); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(11911); -const util_endpoints_2 = __nccwpck_require__(79674); -const ruleset_1 = __nccwpck_require__(58538); -const cache = new util_endpoints_2.EndpointCache({ - size: 50, - params: ["Endpoint", "Region", "UseDualStack", "UseFIPS"], -}); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - })); +// src/node-http2-connection-pool.ts +var NodeHttp2ConnectionPool = class { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions ?? []; + } + static { + __name(this, "NodeHttp2ConnectionPool"); + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } }; -exports.defaultEndpointResolver = defaultEndpointResolver; -util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; - - -/***/ }), - -/***/ 58538: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const u = "required", v = "fn", w = "argv", x = "ref"; -const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "String" }, j = { [u]: true, "default": false, "type": "Boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }]; -const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://oidc.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://oidc.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://oidc.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; -exports.ruleSet = _data; +// src/node-http2-connection-manager.ts +var NodeHttp2ConnectionManager = class { + constructor(config) { + this.sessionCache = /* @__PURE__ */ new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } + } + static { + __name(this, "NodeHttp2ConnectionManager"); + } + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = import_http2.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error( + "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() + ); + } + }); + } + session.unref(); + const destroySessionCb = /* @__PURE__ */ __name(() => { + session.destroy(); + this.deleteSession(url, session); + }, "destroySessionCb"); + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; + } + /** + * Delete a session from the connection pool. + * @param authority The authority of the session to delete. + * @param session The session to delete. + */ + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + const cacheKey = this.getUrlString(requestContext); + this.sessionCache.get(cacheKey)?.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } + } + setMaxConcurrentStreams(maxConcurrentStreams) { + if (maxConcurrentStreams && maxConcurrentStreams <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } +}; + +// src/node-http2-handler.ts +var NodeHttp2Handler = class _NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((opts) => { + resolve(opts || {}); + }).catch(reject); + } else { + resolve(options || {}); + } + }); + } + static { + __name(this, "NodeHttp2Handler"); + } + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof instanceOrOptions?.handle === "function") { + return instanceOrOptions; + } + return new _NodeHttp2Handler(instanceOrOptions); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal, requestTimeout } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; + const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; + return new Promise((_resolve, _reject) => { + let fulfilled = false; + let writeRequestBodyPromise = void 0; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }, "reject"); + if (abortSignal?.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: this.config?.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false + }); + const rejectWithDestroy = /* @__PURE__ */ __name((err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }, "rejectWithDestroy"); + const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [import_http22.constants.HTTP2_HEADER_PATH]: path, + [import_http22.constants.HTTP2_HEADER_METHOD]: method + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new import_protocol_http.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: getTransformedHeaders(headers), + body: req + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (effectiveRequestTimeout) { + req.setTimeout(effectiveRequestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; + } + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy( + new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) + ); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); + }); + } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } + /** + * Destroys a session. + * @param session - the session to destroy. + */ + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +}; +// src/stream-collector/collector.ts -/***/ }), +var Collector = class extends import_stream.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + static { + __name(this, "Collector"); + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } +}; -/***/ 19476: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +// src/stream-collector/index.ts +var streamCollector = /* @__PURE__ */ __name((stream) => { + if (isReadableStreamInstance(stream)) { + return collectReadableStream(stream); + } + return new Promise((resolve, reject) => { + const collector = new Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function() { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); + }); +}, "streamCollector"); +var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); +async function collectReadableStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +__name(collectReadableStream, "collectReadableStream"); +// Annotate the CommonJS export names for ESM import in node: -"use strict"; +0 && (0); + + + +/***/ }), + +/***/ 57745: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -14871,1205 +14557,829 @@ var __copyProps = (to, from, except, desc) => { }; var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/sso-oidc/index.ts -var index_exports = {}; -__export(index_exports, { - $Command: () => import_smithy_client6.Command, - AccessDeniedException: () => AccessDeniedException, - AuthorizationPendingException: () => AuthorizationPendingException, - CreateTokenCommand: () => CreateTokenCommand, - CreateTokenRequestFilterSensitiveLog: () => CreateTokenRequestFilterSensitiveLog, - CreateTokenResponseFilterSensitiveLog: () => CreateTokenResponseFilterSensitiveLog, - ExpiredTokenException: () => ExpiredTokenException, - InternalServerException: () => InternalServerException, - InvalidClientException: () => InvalidClientException, - InvalidGrantException: () => InvalidGrantException, - InvalidRequestException: () => InvalidRequestException, - InvalidScopeException: () => InvalidScopeException, - SSOOIDC: () => SSOOIDC, - SSOOIDCClient: () => SSOOIDCClient, - SSOOIDCServiceException: () => SSOOIDCServiceException, - SlowDownException: () => SlowDownException, - UnauthorizedClientException: () => UnauthorizedClientException, - UnsupportedGrantTypeException: () => UnsupportedGrantTypeException, - __Client: () => import_smithy_client2.Client +// src/index.ts +var src_exports = {}; +__export(src_exports, { + CredentialsProviderError: () => CredentialsProviderError, + ProviderError: () => ProviderError, + TokenProviderError: () => TokenProviderError, + chain: () => chain, + fromStatic: () => fromStatic, + memoize: () => memoize }); -module.exports = __toCommonJS(index_exports); - -// src/submodules/sso-oidc/SSOOIDCClient.ts -var import_middleware_host_header = __nccwpck_require__(29477); -var import_middleware_logger = __nccwpck_require__(38703); -var import_middleware_recursion_detection = __nccwpck_require__(21067); -var import_middleware_user_agent = __nccwpck_require__(58534); -var import_config_resolver = __nccwpck_require__(39316); -var import_core = __nccwpck_require__(90475); -var import_middleware_content_length = __nccwpck_require__(47212); -var import_middleware_endpoint = __nccwpck_require__(53152); -var import_middleware_retry = __nccwpck_require__(19618); -var import_smithy_client2 = __nccwpck_require__(61411); -var import_httpAuthSchemeProvider = __nccwpck_require__(51351); +module.exports = __toCommonJS(src_exports); -// src/submodules/sso-oidc/endpoint/EndpointParameters.ts -var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { - return Object.assign(options, { - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - defaultSigningName: "sso-oauth" - }); -}, "resolveClientEndpointParameters"); -var commonParams = { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } +// src/ProviderError.ts +var ProviderError = class _ProviderError extends Error { + constructor(message, options = true) { + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = void 0; + tryNextLink = options; + } else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; + } + super(message); + this.name = "ProviderError"; + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, _ProviderError.prototype); + logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); + } + static { + __name(this, "ProviderError"); + } + /** + * @deprecated use new operator. + */ + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); + } }; -// src/submodules/sso-oidc/SSOOIDCClient.ts -var import_runtimeConfig = __nccwpck_require__(57206); +// src/CredentialsProviderError.ts +var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, _CredentialsProviderError.prototype); + } + static { + __name(this, "CredentialsProviderError"); + } +}; -// src/submodules/sso-oidc/runtimeExtensions.ts -var import_region_config_resolver = __nccwpck_require__(2472); -var import_protocol_http = __nccwpck_require__(5559); -var import_smithy_client = __nccwpck_require__(61411); +// src/TokenProviderError.ts +var TokenProviderError = class _TokenProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, _TokenProviderError.prototype); + } + static { + __name(this, "TokenProviderError"); + } +}; -// src/submodules/sso-oidc/auth/httpAuthExtensionConfiguration.ts -var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; - let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; - let _credentials = runtimeConfig.credentials; - return { - setHttpAuthScheme(httpAuthScheme) { - const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); - if (index === -1) { - _httpAuthSchemes.push(httpAuthScheme); - } else { - _httpAuthSchemes.splice(index, 1, httpAuthScheme); +// src/chain.ts +var chain = /* @__PURE__ */ __name((...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } catch (err) { + lastProviderError = err; + if (err?.tryNextLink) { + continue; } - }, - httpAuthSchemes() { - return _httpAuthSchemes; - }, - setHttpAuthSchemeProvider(httpAuthSchemeProvider) { - _httpAuthSchemeProvider = httpAuthSchemeProvider; - }, - httpAuthSchemeProvider() { - return _httpAuthSchemeProvider; - }, - setCredentials(credentials) { - _credentials = credentials; - }, - credentials() { - return _credentials; + throw err; } - }; -}, "getHttpAuthExtensionConfiguration"); -var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { - return { - httpAuthSchemes: config.httpAuthSchemes(), - httpAuthSchemeProvider: config.httpAuthSchemeProvider(), - credentials: config.credentials() - }; -}, "resolveHttpAuthRuntimeConfig"); + } + throw lastProviderError; +}, "chain"); -// src/submodules/sso-oidc/runtimeExtensions.ts -var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { - const extensionConfiguration = Object.assign( - (0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig), - (0, import_smithy_client.getDefaultExtensionConfiguration)(runtimeConfig), - (0, import_protocol_http.getHttpHandlerExtensionConfiguration)(runtimeConfig), - getHttpAuthExtensionConfiguration(runtimeConfig) - ); - extensions.forEach((extension) => extension.configure(extensionConfiguration)); - return Object.assign( - runtimeConfig, - (0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), - (0, import_smithy_client.resolveDefaultRuntimeConfig)(extensionConfiguration), - (0, import_protocol_http.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), - resolveHttpAuthRuntimeConfig(extensionConfiguration) - ); -}, "resolveRuntimeExtensions"); +// src/fromStatic.ts +var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); -// src/submodules/sso-oidc/SSOOIDCClient.ts -var SSOOIDCClient = class extends import_smithy_client2.Client { - static { - __name(this, "SSOOIDCClient"); - } - /** - * The resolved configuration of SSOOIDCClient class. This is resolved and normalized from the {@link SSOOIDCClientConfig | constructor configuration interface}. - */ - config; - constructor(...[configuration]) { - const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); - super(_config_0); - this.initConfig = _config_0; - const _config_1 = resolveClientEndpointParameters(_config_0); - const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, import_middleware_retry.resolveRetryConfig)(_config_2); - const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); - const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_5); - const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); - const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []); - this.config = _config_8; - this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use( - (0, import_core.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { - httpAuthSchemeParametersProvider: import_httpAuthSchemeProvider.defaultSSOOIDCHttpAuthSchemeParametersProvider, - identityProviderConfigProvider: /* @__PURE__ */ __name(async (config) => new import_core.DefaultIdentityProviderConfig({ - "aws.auth#sigv4": config.credentials - }), "identityProviderConfigProvider") - }) - ); - this.middlewareStack.use((0, import_core.getHttpSigningPlugin)(this.config)); - } - /** - * Destroy underlying resources, like sockets. It's usually not necessary to do this. - * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. - * Otherwise, sockets might stay open for quite a long time before the server terminates them. - */ - destroy() { - super.destroy(); +// src/memoize.ts +var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async () => { + if (!pending) { + pending = provider(); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + return resolved; + }; } -}; + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; +}, "memoize"); +// Annotate the CommonJS export names for ESM import in node: -// src/submodules/sso-oidc/SSOOIDC.ts -var import_smithy_client7 = __nccwpck_require__(61411); +0 && (0); -// src/submodules/sso-oidc/commands/CreateTokenCommand.ts -var import_middleware_endpoint2 = __nccwpck_require__(53152); -var import_middleware_serde = __nccwpck_require__(29514); -var import_smithy_client6 = __nccwpck_require__(61411); -// src/submodules/sso-oidc/models/models_0.ts -var import_smithy_client4 = __nccwpck_require__(61411); -// src/submodules/sso-oidc/models/SSOOIDCServiceException.ts -var import_smithy_client3 = __nccwpck_require__(61411); -var SSOOIDCServiceException = class _SSOOIDCServiceException extends import_smithy_client3.ServiceException { - static { - __name(this, "SSOOIDCServiceException"); - } - /** - * @internal - */ - constructor(options) { - super(options); - Object.setPrototypeOf(this, _SSOOIDCServiceException.prototype); +/***/ }), + +/***/ 5559: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/sso-oidc/models/models_0.ts -var AccessDeniedException = class _AccessDeniedException extends SSOOIDCServiceException { +// src/index.ts +var src_exports = {}; +__export(src_exports, { + Field: () => Field, + Fields: () => Fields, + HttpRequest: () => HttpRequest, + HttpResponse: () => HttpResponse, + IHttpRequest: () => import_types.HttpRequest, + getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, + isValidHostname: () => isValidHostname, + resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/extensions/httpExtensionConfiguration.ts +var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return { + setHttpHandler(handler) { + runtimeConfig.httpHandler = handler; + }, + httpHandler() { + return runtimeConfig.httpHandler; + }, + updateHttpClientConfig(key, value) { + runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return runtimeConfig.httpHandler.httpHandlerConfigs(); + } + }; +}, "getHttpHandlerExtensionConfiguration"); +var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler() + }; +}, "resolveHttpHandlerRuntimeConfig"); + +// src/Field.ts +var import_types = __nccwpck_require__(20873); +var Field = class { static { - __name(this, "AccessDeniedException"); - } - name = "AccessDeniedException"; - $fault = "client"; - /** - *
Single error code. For this exception the value will be access_denied.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "AccessDeniedException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _AccessDeniedException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; + __name(this, "Field"); } -}; -var AuthorizationPendingException = class _AuthorizationPendingException extends SSOOIDCServiceException { - static { - __name(this, "AuthorizationPendingException"); + constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; } - name = "AuthorizationPendingException"; - $fault = "client"; - /** - *Single error code. For this exception the value will be
- * authorization_pending.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public + * Appends a value to the field. + * + * @param value The value to append. */ - error_description; + add(value) { + this.values.push(value); + } /** - * @internal + * Overwrite existing field values. + * + * @param values The new field values. */ - constructor(opts) { - super({ - name: "AuthorizationPendingException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _AuthorizationPendingException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var CreateTokenRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.clientSecret && { clientSecret: import_smithy_client4.SENSITIVE_STRING }, - ...obj.refreshToken && { refreshToken: import_smithy_client4.SENSITIVE_STRING }, - ...obj.codeVerifier && { codeVerifier: import_smithy_client4.SENSITIVE_STRING } -}), "CreateTokenRequestFilterSensitiveLog"); -var CreateTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client4.SENSITIVE_STRING }, - ...obj.refreshToken && { refreshToken: import_smithy_client4.SENSITIVE_STRING }, - ...obj.idToken && { idToken: import_smithy_client4.SENSITIVE_STRING } -}), "CreateTokenResponseFilterSensitiveLog"); -var ExpiredTokenException = class _ExpiredTokenException extends SSOOIDCServiceException { - static { - __name(this, "ExpiredTokenException"); + set(values) { + this.values = values; } - name = "ExpiredTokenException"; - $fault = "client"; /** - *Single error code. For this exception the value will be expired_token.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public + * Get comma-delimited string. + * + * @returns String representation of {@link Field}. */ - error_description; + toString() { + return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); + } /** - * @internal + * Get string values as a list + * + * @returns Values in {@link Field} as a list. */ - constructor(opts) { - super({ - name: "ExpiredTokenException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ExpiredTokenException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; + get() { + return this.values; } }; -var InternalServerException = class _InternalServerException extends SSOOIDCServiceException { + +// src/Fields.ts +var Fields = class { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } static { - __name(this, "InternalServerException"); + __name(this, "Fields"); } - name = "InternalServerException"; - $fault = "server"; - /** - *Single error code. For this exception the value will be server_error.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public - */ - error_description; /** - * @internal + * Set entry for a {@link Field} name. The `name` + * attribute will be used to key the collection. + * + * @param field The {@link Field} to set. */ - constructor(opts) { - super({ - name: "InternalServerException", - $fault: "server", - ...opts - }); - Object.setPrototypeOf(this, _InternalServerException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var InvalidClientException = class _InvalidClientException extends SSOOIDCServiceException { - static { - __name(this, "InvalidClientException"); + setField(field) { + this.entries[field.name.toLowerCase()] = field; } - name = "InvalidClientException"; - $fault = "client"; /** - *Single error code. For this exception the value will be
- * invalid_client.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public + * Delete entry from collection. + * + * @param name Name of the entry to delete. */ - error_description; + removeField(name) { + delete this.entries[name.toLowerCase()]; + } /** - * @internal + * Helper function for retrieving specific types of fields. + * Used to grab all headers or all trailers. + * + * @param kind {@link FieldPosition} of entries to retrieve. + * @returns The {@link Field} entries with the specified + * {@link FieldPosition}. */ - constructor(opts) { - super({ - name: "InvalidClientException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidClientException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); } }; -var InvalidGrantException = class _InvalidGrantException extends SSOOIDCServiceException { + +// src/httpRequest.ts + +var HttpRequest = class _HttpRequest { static { - __name(this, "InvalidGrantException"); + __name(this, "HttpRequest"); + } + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; + this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; } - name = "InvalidGrantException"; - $fault = "client"; - /** - *Single error code. For this exception the value will be invalid_grant.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public - */ - error_description; /** - * @internal + * Note: this does not deep-clone the body. */ - constructor(opts) { - super({ - name: "InvalidGrantException", - $fault: "client", - ...opts + static clone(request) { + const cloned = new _HttpRequest({ + ...request, + headers: { ...request.headers } }); - Object.setPrototypeOf(this, _InvalidGrantException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var InvalidRequestException = class _InvalidRequestException extends SSOOIDCServiceException { - static { - __name(this, "InvalidRequestException"); + if (cloned.query) { + cloned.query = cloneQuery(cloned.query); + } + return cloned; } - name = "InvalidRequestException"; - $fault = "client"; - /** - *Single error code. For this exception the value will be
- * invalid_request.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public + * This method only actually asserts that request is the interface {@link IHttpRequest}, + * and not necessarily this concrete class. Left in place for API stability. + * + * Do not call instance methods on the input of this function, and + * do not assume it has the HttpRequest prototype. */ - error_description; + static isInstance(request) { + if (!request) { + return false; + } + const req = request; + return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; + } /** - * @internal + * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call + * this method because {@link HttpRequest.isInstance} incorrectly + * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). */ - constructor(opts) { - super({ - name: "InvalidRequestException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidRequestException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; + clone() { + return _HttpRequest.clone(this); } }; -var InvalidScopeException = class _InvalidScopeException extends SSOOIDCServiceException { +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param + }; + }, {}); +} +__name(cloneQuery, "cloneQuery"); + +// src/httpResponse.ts +var HttpResponse = class { static { - __name(this, "InvalidScopeException"); + __name(this, "HttpResponse"); } - name = "InvalidScopeException"; - $fault = "client"; - /** - *Single error code. For this exception the value will be invalid_scope.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidScopeException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidScopeException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var SlowDownException = class _SlowDownException extends SSOOIDCServiceException { - static { - __name(this, "SlowDownException"); + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; } - name = "SlowDownException"; - $fault = "client"; - /** - *Single error code. For this exception the value will be slow_down.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "SlowDownException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _SlowDownException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; } }; -var UnauthorizedClientException = class _UnauthorizedClientException extends SSOOIDCServiceException { - static { - __name(this, "UnauthorizedClientException"); - } - name = "UnauthorizedClientException"; - $fault = "client"; - /** - *Single error code. For this exception the value will be
- * unauthorized_client.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "UnauthorizedClientException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _UnauthorizedClientException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } + +// src/isValidHostname.ts +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +__name(isValidHostname, "isValidHostname"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 75547: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); }; -var UnsupportedGrantTypeException = class _UnsupportedGrantTypeException extends SSOOIDCServiceException { - static { - __name(this, "UnsupportedGrantTypeException"); - } - name = "UnsupportedGrantTypeException"; - $fault = "client"; - /** - *Single error code. For this exception the value will be
- * unsupported_grant_type.
Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.
- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "UnsupportedGrantTypeException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _UnsupportedGrantTypeException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/sso-oidc/protocols/Aws_restJson1.ts -var import_core2 = __nccwpck_require__(79191); -var import_core3 = __nccwpck_require__(90475); -var import_smithy_client5 = __nccwpck_require__(61411); -var se_CreateTokenCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core3.requestBuilder)(input, context); - const headers = { - "content-type": "application/json" - }; - b.bp("/token"); - let body; - body = JSON.stringify( - (0, import_smithy_client5.take)(input, { - clientId: [], - clientSecret: [], - code: [], - codeVerifier: [], - deviceCode: [], - grantType: [], - redirectUri: [], - refreshToken: [], - scope: /* @__PURE__ */ __name((_) => (0, import_smithy_client5._json)(_), "scope") - }) - ); - b.m("POST").h(headers).b(body); - return b.build(); -}, "se_CreateTokenCommand"); -var de_CreateTokenCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client5.map)({ - $metadata: deserializeMetadata(output) - }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - accessToken: import_smithy_client5.expectString, - expiresIn: import_smithy_client5.expectInt32, - idToken: import_smithy_client5.expectString, - refreshToken: import_smithy_client5.expectString, - tokenType: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - return contents; -}, "de_CreateTokenCommand"); -var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { - const parsedOutput = { - ...output, - body: await (0, import_core2.parseJsonErrorBody)(output.body, context) - }; - const errorCode = (0, import_core2.loadRestJsonErrorCode)(output, parsedOutput.body); - switch (errorCode) { - case "AccessDeniedException": - case "com.amazonaws.ssooidc#AccessDeniedException": - throw await de_AccessDeniedExceptionRes(parsedOutput, context); - case "AuthorizationPendingException": - case "com.amazonaws.ssooidc#AuthorizationPendingException": - throw await de_AuthorizationPendingExceptionRes(parsedOutput, context); - case "ExpiredTokenException": - case "com.amazonaws.ssooidc#ExpiredTokenException": - throw await de_ExpiredTokenExceptionRes(parsedOutput, context); - case "InternalServerException": - case "com.amazonaws.ssooidc#InternalServerException": - throw await de_InternalServerExceptionRes(parsedOutput, context); - case "InvalidClientException": - case "com.amazonaws.ssooidc#InvalidClientException": - throw await de_InvalidClientExceptionRes(parsedOutput, context); - case "InvalidGrantException": - case "com.amazonaws.ssooidc#InvalidGrantException": - throw await de_InvalidGrantExceptionRes(parsedOutput, context); - case "InvalidRequestException": - case "com.amazonaws.ssooidc#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "InvalidScopeException": - case "com.amazonaws.ssooidc#InvalidScopeException": - throw await de_InvalidScopeExceptionRes(parsedOutput, context); - case "SlowDownException": - case "com.amazonaws.ssooidc#SlowDownException": - throw await de_SlowDownExceptionRes(parsedOutput, context); - case "UnauthorizedClientException": - case "com.amazonaws.ssooidc#UnauthorizedClientException": - throw await de_UnauthorizedClientExceptionRes(parsedOutput, context); - case "UnsupportedGrantTypeException": - case "com.amazonaws.ssooidc#UnsupportedGrantTypeException": - throw await de_UnsupportedGrantTypeExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode - }); +// src/index.ts +var src_exports = {}; +__export(src_exports, { + buildQueryString: () => buildQueryString +}); +module.exports = __toCommonJS(src_exports); +var import_util_uri_escape = __nccwpck_require__(5821); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, import_util_uri_escape.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); + } + } else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; + } + parts.push(qsEntry); + } } -}, "de_CommandError"); -var throwDefaultError = (0, import_smithy_client5.withBaseException)(SSOOIDCServiceException); -var de_AccessDeniedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new AccessDeniedException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_AccessDeniedExceptionRes"); -var de_AuthorizationPendingExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new AuthorizationPendingException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_AuthorizationPendingExceptionRes"); -var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new ExpiredTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_ExpiredTokenExceptionRes"); -var de_InternalServerExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InternalServerException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InternalServerExceptionRes"); -var de_InvalidClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidClientException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidClientExceptionRes"); -var de_InvalidGrantExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidGrantException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidGrantExceptionRes"); -var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidRequestException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidRequestExceptionRes"); -var de_InvalidScopeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidScopeException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidScopeExceptionRes"); -var de_SlowDownExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new SlowDownException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_SlowDownExceptionRes"); -var de_UnauthorizedClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new UnauthorizedClientException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_UnauthorizedClientExceptionRes"); -var de_UnsupportedGrantTypeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new UnsupportedGrantTypeException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_UnsupportedGrantTypeExceptionRes"); -var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] -}), "deserializeMetadata"); + return parts.join("&"); +} +__name(buildQueryString, "buildQueryString"); +// Annotate the CommonJS export names for ESM import in node: -// src/submodules/sso-oidc/commands/CreateTokenCommand.ts -var CreateTokenCommand = class extends import_smithy_client6.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AWSSSOOIDCService", "CreateToken", {}).n("SSOOIDCClient", "CreateTokenCommand").f(CreateTokenRequestFilterSensitiveLog, CreateTokenResponseFilterSensitiveLog).ser(se_CreateTokenCommand).de(de_CreateTokenCommand).build() { - static { - __name(this, "CreateTokenCommand"); - } -}; +0 && (0); -// src/submodules/sso-oidc/SSOOIDC.ts -var commands = { - CreateTokenCommand + + +/***/ }), + +/***/ 955: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); }; -var SSOOIDC = class extends SSOOIDCClient { - static { - __name(this, "SSOOIDC"); +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; -(0, import_smithy_client7.createAggregatedClient)(commands, SSOOIDC); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + parseQueryString: () => parseQueryString +}); +module.exports = __toCommonJS(src_exports); +function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } else if (Array.isArray(query[key])) { + query[key].push(value); + } else { + query[key] = [query[key], value]; + } + } + } + return query; +} +__name(parseQueryString, "parseQueryString"); // Annotate the CommonJS export names for ESM import in node: + 0 && (0); + /***/ }), -/***/ 57206: +/***/ 93715: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const tslib_1 = __nccwpck_require__(61860); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(16098)); -const core_1 = __nccwpck_require__(79191); -const util_user_agent_node_1 = __nccwpck_require__(25195); -const config_resolver_1 = __nccwpck_require__(39316); -const hash_node_1 = __nccwpck_require__(5092); -const middleware_retry_1 = __nccwpck_require__(19618); -const node_config_provider_1 = __nccwpck_require__(44297); -const node_http_handler_1 = __nccwpck_require__(11176); -const util_body_length_node_1 = __nccwpck_require__(13638); -const util_retry_1 = __nccwpck_require__(15518); -const runtimeConfig_shared_1 = __nccwpck_require__(50079); -const smithy_client_1 = __nccwpck_require__(61411); -const util_defaults_mode_node_1 = __nccwpck_require__(15435); -const smithy_client_2 = __nccwpck_require__(61411); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); - (0, core_1.emitWarningIfUnsupportedVersion)(process.version); - const loaderConfig = { - profile: config?.profile, - logger: clientSharedValues.logger, - }; - return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), - region: config?.region ?? - (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), - requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }, config), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), - }; +exports.getHomeDir = void 0; +const os_1 = __nccwpck_require__(70857); +const path_1 = __nccwpck_require__(16928); +const homeDirCache = {}; +const getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; + } + return "DEFAULT"; }; -exports.getRuntimeConfig = getRuntimeConfig; +const getHomeDir = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; +}; +exports.getHomeDir = getHomeDir; /***/ }), -/***/ 50079: +/***/ 28224: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const core_1 = __nccwpck_require__(79191); -const core_2 = __nccwpck_require__(90475); -const smithy_client_1 = __nccwpck_require__(61411); -const url_parser_1 = __nccwpck_require__(81983); -const util_base64_1 = __nccwpck_require__(26262); -const util_utf8_1 = __nccwpck_require__(21038); -const httpAuthSchemeProvider_1 = __nccwpck_require__(51351); -const endpointResolver_1 = __nccwpck_require__(97713); -const getRuntimeConfig = (config) => { - return { - apiVersion: "2019-06-10", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - extensions: config?.extensions ?? [], - httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOOIDCHttpAuthSchemeProvider, - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), - signer: new core_1.AwsSdkSigV4Signer(), - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner(), - }, - ], - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "SSO OIDC", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, - }; +exports.getSSOTokenFilepath = void 0; +const crypto_1 = __nccwpck_require__(76982); +const path_1 = __nccwpck_require__(16928); +const getHomeDir_1 = __nccwpck_require__(93715); +const getSSOTokenFilepath = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); }; -exports.getRuntimeConfig = getRuntimeConfig; +exports.getSSOTokenFilepath = getSSOTokenFilepath; /***/ }), -/***/ 21402: +/***/ 54375: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.STSClient = exports.__Client = void 0; -const middleware_host_header_1 = __nccwpck_require__(29477); -const middleware_logger_1 = __nccwpck_require__(38703); -const middleware_recursion_detection_1 = __nccwpck_require__(21067); -const middleware_user_agent_1 = __nccwpck_require__(58534); -const config_resolver_1 = __nccwpck_require__(39316); -const core_1 = __nccwpck_require__(90475); -const middleware_content_length_1 = __nccwpck_require__(47212); -const middleware_endpoint_1 = __nccwpck_require__(53152); -const middleware_retry_1 = __nccwpck_require__(19618); -const smithy_client_1 = __nccwpck_require__(61411); -Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); -const httpAuthSchemeProvider_1 = __nccwpck_require__(52506); -const EndpointParameters_1 = __nccwpck_require__(35486); -const runtimeConfig_1 = __nccwpck_require__(20907); -const runtimeExtensions_1 = __nccwpck_require__(85911); -class STSClient extends smithy_client_1.Client { - config; - constructor(...[configuration]) { - const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); - super(_config_0); - this.initConfig = _config_0; - const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); - const _config_2 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, middleware_retry_1.resolveRetryConfig)(_config_2); - const _config_4 = (0, config_resolver_1.resolveRegionConfig)(_config_3); - const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_5); - const _config_7 = (0, httpAuthSchemeProvider_1.resolveHttpAuthSchemeConfig)(_config_6); - const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []); - this.config = _config_8; - this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use((0, core_1.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { - httpAuthSchemeParametersProvider: httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeParametersProvider, - identityProviderConfigProvider: async (config) => new core_1.DefaultIdentityProviderConfig({ - "aws.auth#sigv4": config.credentials, - }), - })); - this.middlewareStack.use((0, core_1.getHttpSigningPlugin)(this.config)); - } - destroy() { - super.destroy(); - } -} -exports.STSClient = STSClient; +exports.getSSOTokenFromFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const getSSOTokenFilepath_1 = __nccwpck_require__(28224); +const { readFile } = fs_1.promises; +const getSSOTokenFromFile = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); +}; +exports.getSSOTokenFromFile = getSSOTokenFromFile; /***/ }), -/***/ 2749: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; +/***/ 80213: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveHttpAuthRuntimeConfig = exports.getHttpAuthExtensionConfiguration = void 0; -const getHttpAuthExtensionConfiguration = (runtimeConfig) => { - const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; - let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; - let _credentials = runtimeConfig.credentials; - return { - setHttpAuthScheme(httpAuthScheme) { - const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); - if (index === -1) { - _httpAuthSchemes.push(httpAuthScheme); - } - else { - _httpAuthSchemes.splice(index, 1, httpAuthScheme); - } - }, - httpAuthSchemes() { - return _httpAuthSchemes; - }, - setHttpAuthSchemeProvider(httpAuthSchemeProvider) { - _httpAuthSchemeProvider = httpAuthSchemeProvider; - }, - httpAuthSchemeProvider() { - return _httpAuthSchemeProvider; - }, - setCredentials(credentials) { - _credentials = credentials; - }, - credentials() { - return _credentials; - }, - }; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); }; -exports.getHttpAuthExtensionConfiguration = getHttpAuthExtensionConfiguration; -const resolveHttpAuthRuntimeConfig = (config) => { - return { - httpAuthSchemes: config.httpAuthSchemes(), - httpAuthSchemeProvider: config.httpAuthSchemeProvider(), - credentials: config.credentials(), - }; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; }; -exports.resolveHttpAuthRuntimeConfig = resolveHttpAuthRuntimeConfig; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +// src/index.ts +var src_exports = {}; +__export(src_exports, { + CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, + DEFAULT_PROFILE: () => DEFAULT_PROFILE, + ENV_PROFILE: () => ENV_PROFILE, + getProfileName: () => getProfileName, + loadSharedConfigFiles: () => loadSharedConfigFiles, + loadSsoSessionData: () => loadSsoSessionData, + parseKnownFiles: () => parseKnownFiles +}); +module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(93715), module.exports); -/***/ }), +// src/getProfileName.ts +var ENV_PROFILE = "AWS_PROFILE"; +var DEFAULT_PROFILE = "default"; +var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); -/***/ 52506: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/index.ts +__reExport(src_exports, __nccwpck_require__(28224), module.exports); +__reExport(src_exports, __nccwpck_require__(54375), module.exports); -"use strict"; +// src/loadSharedConfigFiles.ts -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveHttpAuthSchemeConfig = exports.resolveStsAuthConfig = exports.defaultSTSHttpAuthSchemeProvider = exports.defaultSTSHttpAuthSchemeParametersProvider = void 0; -const core_1 = __nccwpck_require__(79191); -const util_middleware_1 = __nccwpck_require__(25695); -const STSClient_1 = __nccwpck_require__(21402); -const defaultSTSHttpAuthSchemeParametersProvider = async (config, context, input) => { - return { - operation: (0, util_middleware_1.getSmithyContext)(context).operation, - region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || - (() => { - throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); - })(), - }; -}; -exports.defaultSTSHttpAuthSchemeParametersProvider = defaultSTSHttpAuthSchemeParametersProvider; -function createAwsAuthSigv4HttpAuthOption(authParameters) { - return { - schemeId: "aws.auth#sigv4", - signingProperties: { - name: "sts", - region: authParameters.region, - }, - propertiesExtractor: (config, context) => ({ - signingProperties: { - config, - context, - }, - }), - }; -} -function createSmithyApiNoAuthHttpAuthOption(authParameters) { - return { - schemeId: "smithy.api#noAuth", - }; -} -const defaultSTSHttpAuthSchemeProvider = (authParameters) => { - const options = []; - switch (authParameters.operation) { - case "AssumeRoleWithWebIdentity": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; + +// src/getConfigData.ts +var import_types = __nccwpck_require__(20873); +var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { + return false; + } + return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); +}).reduce( + (acc, [key, value]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + acc[updatedKey] = value; + return acc; + }, + { + // Populate default profile, if present. + ...data.default && { default: data.default } + } +), "getConfigData"); + +// src/getConfigFilepath.ts +var import_path = __nccwpck_require__(16928); +var import_getHomeDir = __nccwpck_require__(93715); +var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); + +// src/getCredentialsFilepath.ts + +var import_getHomeDir2 = __nccwpck_require__(93715); +var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); + +// src/loadSharedConfigFiles.ts +var import_getHomeDir3 = __nccwpck_require__(93715); + +// src/parseIni.ts + +var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; +var profileNameBlockList = ["__proto__", "profile __proto__"]; +var parseIni = /* @__PURE__ */ __name((iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = void 0; + currentSubSection = void 0; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(import_types.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); } - default: { - options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } else { + currentSection = sectionName; + } + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } + } else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim() + ]; + if (value === "") { + currentSubSection = name; + } else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = void 0; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; } + } } - return options; -}; -exports.defaultSTSHttpAuthSchemeProvider = defaultSTSHttpAuthSchemeProvider; -const resolveStsAuthConfig = (input) => Object.assign(input, { - stsClientCtor: STSClient_1.STSClient, -}); -exports.resolveStsAuthConfig = resolveStsAuthConfig; -const resolveHttpAuthSchemeConfig = (config) => { - const config_0 = (0, exports.resolveStsAuthConfig)(config); - const config_1 = (0, core_1.resolveAwsSdkSigV4Config)(config_0); - return Object.assign(config_1, { - authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), - }); -}; -exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; - - -/***/ }), + } + return map; +}, "parseIni"); -/***/ 35486: -/***/ ((__unused_webpack_module, exports) => { +// src/loadSharedConfigFiles.ts +var import_slurpFile = __nccwpck_require__(96231); +var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var CONFIG_PREFIX_SEPARATOR = "."; +var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const homeDir = (0, import_getHomeDir3.getHomeDir)(); + const relativeHomeDirPrefix = "~/"; + let resolvedFilepath = filepath; + if (filepath.startsWith(relativeHomeDirPrefix)) { + resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); + } + let resolvedConfigFilepath = configFilepath; + if (configFilepath.startsWith(relativeHomeDirPrefix)) { + resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); + } + const parsedFiles = await Promise.all([ + (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).then(getConfigData).catch(swallowError), + (0, import_slurpFile.slurpFile)(resolvedFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).catch(swallowError) + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1] + }; +}, "loadSharedConfigFiles"); -"use strict"; +// src/getSsoSessionData.ts -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.commonParams = exports.resolveClientEndpointParameters = void 0; -const resolveClientEndpointParameters = (options) => { - return Object.assign(options, { - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - useGlobalEndpoint: options.useGlobalEndpoint ?? false, - defaultSigningName: "sts", - }); -}; -exports.resolveClientEndpointParameters = resolveClientEndpointParameters; -exports.commonParams = { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, -}; +var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); +// src/loadSsoSessionData.ts +var import_slurpFile2 = __nccwpck_require__(96231); +var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); -/***/ }), +// src/mergeConfigFiles.ts +var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== void 0) { + Object.assign(merged[key], values); + } else { + merged[key] = values; + } + } + } + return merged; +}, "mergeConfigFiles"); -/***/ 90692: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/parseKnownFiles.ts +var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); +}, "parseKnownFiles"); +// Annotate the CommonJS export names for ESM import in node: -"use strict"; +0 && (0); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(11911); -const util_endpoints_2 = __nccwpck_require__(79674); -const ruleset_1 = __nccwpck_require__(31897); -const cache = new util_endpoints_2.EndpointCache({ - size: 50, - params: ["Endpoint", "Region", "UseDualStack", "UseFIPS", "UseGlobalEndpoint"], -}); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - })); -}; -exports.defaultEndpointResolver = defaultEndpointResolver; -util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; /***/ }), -/***/ 31897: -/***/ ((__unused_webpack_module, exports) => { +/***/ 96231: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const F = "required", G = "type", H = "fn", I = "argv", J = "ref"; -const a = false, b = true, c = "booleanEquals", d = "stringEquals", e = "sigv4", f = "sts", g = "us-east-1", h = "endpoint", i = "https://sts.{Region}.{PartitionResult#dnsSuffix}", j = "tree", k = "error", l = "getAttr", m = { [F]: false, [G]: "String" }, n = { [F]: true, "default": false, [G]: "Boolean" }, o = { [J]: "Endpoint" }, p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }, q = { [J]: "Region" }, r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }, s = { [J]: "UseFIPS" }, t = { [J]: "UseDualStack" }, u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": e, "signingName": f, "signingRegion": g }] }, "headers": {} }, v = {}, w = { "conditions": [{ [H]: d, [I]: [q, "aws-global"] }], [h]: u, [G]: h }, x = { [H]: c, [I]: [s, true] }, y = { [H]: c, [I]: [t, true] }, z = { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }, A = { [J]: "PartitionResult" }, B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }, C = [{ [H]: "isSet", [I]: [o] }], D = [x], E = [y]; -const _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], rules: [{ conditions: [{ [H]: d, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: h }, w, { conditions: [{ [H]: d, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, g] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-east-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-2"] }], endpoint: u, [G]: h }, { endpoint: { url: i, properties: { authSchemes: [{ name: e, signingName: f, signingRegion: "{Region}" }] }, headers: v }, [G]: h }], [G]: j }, { conditions: C, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: h }], [G]: j }, { conditions: [p], rules: [{ conditions: [r], rules: [{ conditions: [x, y], rules: [{ conditions: [{ [H]: c, [I]: [b, z] }, B], rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }], [G]: j }, { conditions: D, rules: [{ conditions: [{ [H]: c, [I]: [z, b] }], rules: [{ conditions: [{ [H]: d, [I]: [{ [H]: l, [I]: [A, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: h }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }], [G]: j }, { conditions: E, rules: [{ conditions: [B], rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }], [G]: j }, w, { endpoint: { url: i, properties: v, headers: v }, [G]: h }], [G]: j }], [G]: j }, { error: "Invalid Configuration: Missing Region", [G]: k }] }; -exports.ruleSet = _data; +exports.slurpFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const { readFile } = fs_1.promises; +const filePromisesHash = {}; +const slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); + } + return filePromisesHash[path]; +}; +exports.slurpFile = slurpFile; /***/ }), -/***/ 12801: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; +/***/ 20873: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -16088,7822 +15398,377 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/sts/index.ts -var index_exports = {}; -__export(index_exports, { - AssumeRoleCommand: () => AssumeRoleCommand, - AssumeRoleResponseFilterSensitiveLog: () => AssumeRoleResponseFilterSensitiveLog, - AssumeRoleWithWebIdentityCommand: () => AssumeRoleWithWebIdentityCommand, - AssumeRoleWithWebIdentityRequestFilterSensitiveLog: () => AssumeRoleWithWebIdentityRequestFilterSensitiveLog, - AssumeRoleWithWebIdentityResponseFilterSensitiveLog: () => AssumeRoleWithWebIdentityResponseFilterSensitiveLog, - ClientInputEndpointParameters: () => import_EndpointParameters3.ClientInputEndpointParameters, - CredentialsFilterSensitiveLog: () => CredentialsFilterSensitiveLog, - ExpiredTokenException: () => ExpiredTokenException, - IDPCommunicationErrorException: () => IDPCommunicationErrorException, - IDPRejectedClaimException: () => IDPRejectedClaimException, - InvalidIdentityTokenException: () => InvalidIdentityTokenException, - MalformedPolicyDocumentException: () => MalformedPolicyDocumentException, - PackedPolicyTooLargeException: () => PackedPolicyTooLargeException, - RegionDisabledException: () => RegionDisabledException, - STS: () => STS, - STSServiceException: () => STSServiceException, - decorateDefaultCredentialProvider: () => decorateDefaultCredentialProvider, - getDefaultRoleAssumer: () => getDefaultRoleAssumer2, - getDefaultRoleAssumerWithWebIdentity: () => getDefaultRoleAssumerWithWebIdentity2 +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AlgorithmId: () => AlgorithmId, + EndpointURLScheme: () => EndpointURLScheme, + FieldPosition: () => FieldPosition, + HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, + HttpAuthLocation: () => HttpAuthLocation, + IniSectionType: () => IniSectionType, + RequestHandlerProtocol: () => RequestHandlerProtocol, + SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig }); -module.exports = __toCommonJS(index_exports); -__reExport(index_exports, __nccwpck_require__(21402), module.exports); +module.exports = __toCommonJS(src_exports); -// src/submodules/sts/STS.ts -var import_smithy_client6 = __nccwpck_require__(61411); +// src/auth/auth.ts +var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { + HttpAuthLocation2["HEADER"] = "header"; + HttpAuthLocation2["QUERY"] = "query"; + return HttpAuthLocation2; +})(HttpAuthLocation || {}); -// src/submodules/sts/commands/AssumeRoleCommand.ts -var import_middleware_endpoint = __nccwpck_require__(53152); -var import_middleware_serde = __nccwpck_require__(29514); -var import_smithy_client4 = __nccwpck_require__(61411); -var import_EndpointParameters = __nccwpck_require__(35486); +// src/auth/HttpApiKeyAuth.ts +var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { + HttpApiKeyAuthLocation2["HEADER"] = "header"; + HttpApiKeyAuthLocation2["QUERY"] = "query"; + return HttpApiKeyAuthLocation2; +})(HttpApiKeyAuthLocation || {}); -// src/submodules/sts/models/models_0.ts -var import_smithy_client2 = __nccwpck_require__(61411); +// src/endpoint.ts +var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { + EndpointURLScheme2["HTTP"] = "http"; + EndpointURLScheme2["HTTPS"] = "https"; + return EndpointURLScheme2; +})(EndpointURLScheme || {}); -// src/submodules/sts/models/STSServiceException.ts -var import_smithy_client = __nccwpck_require__(61411); -var STSServiceException = class _STSServiceException extends import_smithy_client.ServiceException { - static { - __name(this, "STSServiceException"); +// src/extensions/checksum.ts +var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { + AlgorithmId2["MD5"] = "md5"; + AlgorithmId2["CRC32"] = "crc32"; + AlgorithmId2["CRC32C"] = "crc32c"; + AlgorithmId2["SHA1"] = "sha1"; + AlgorithmId2["SHA256"] = "sha256"; + return AlgorithmId2; +})(AlgorithmId || {}); +var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== void 0) { + checksumAlgorithms.push({ + algorithmId: () => "sha256" /* SHA256 */, + checksumConstructor: () => runtimeConfig.sha256 + }); } - /** - * @internal - */ - constructor(options) { - super(options); - Object.setPrototypeOf(this, _STSServiceException.prototype); + if (runtimeConfig.md5 != void 0) { + checksumAlgorithms.push({ + algorithmId: () => "md5" /* MD5 */, + checksumConstructor: () => runtimeConfig.md5 + }); } -}; + return { + addChecksumAlgorithm(algo) { + checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return checksumAlgorithms; + } + }; +}, "getChecksumConfiguration"); +var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}, "resolveChecksumRuntimeConfig"); -// src/submodules/sts/models/models_0.ts -var CredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.SecretAccessKey && { SecretAccessKey: import_smithy_client2.SENSITIVE_STRING } -}), "CredentialsFilterSensitiveLog"); -var AssumeRoleResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } -}), "AssumeRoleResponseFilterSensitiveLog"); -var ExpiredTokenException = class _ExpiredTokenException extends STSServiceException { - static { - __name(this, "ExpiredTokenException"); - } - name = "ExpiredTokenException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ExpiredTokenException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ExpiredTokenException.prototype); +// src/extensions/defaultClientConfiguration.ts +var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return getChecksumConfiguration(runtimeConfig); +}, "getDefaultClientConfiguration"); +var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return resolveChecksumRuntimeConfig(config); +}, "resolveDefaultRuntimeConfig"); + +// src/http.ts +var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { + FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; + FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; + return FieldPosition2; +})(FieldPosition || {}); + +// src/middleware.ts +var SMITHY_CONTEXT_KEY = "__smithy_context"; + +// src/profile.ts +var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; +})(IniSectionType || {}); + +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 81983: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; -var MalformedPolicyDocumentException = class _MalformedPolicyDocumentException extends STSServiceException { - static { - __name(this, "MalformedPolicyDocumentException"); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + parseUrl: () => parseUrl +}); +module.exports = __toCommonJS(src_exports); +var import_querystring_parser = __nccwpck_require__(955); +var parseUrl = /* @__PURE__ */ __name((url) => { + if (typeof url === "string") { + return parseUrl(new URL(url)); } - name = "MalformedPolicyDocumentException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "MalformedPolicyDocumentException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _MalformedPolicyDocumentException.prototype); + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = (0, import_querystring_parser.parseQueryString)(search); } + return { + hostname, + port: port ? parseInt(port) : void 0, + protocol, + path: pathname, + query + }; +}, "parseUrl"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 17963: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(63718); +const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; +const fromBase64 = (input) => { + if ((input.length * 3) % 4 !== 0) { + throw new TypeError(`Incorrect padding on base64 string.`); + } + if (!BASE64_REGEX.exec(input)) { + throw new TypeError(`Invalid base64 string.`); + } + const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); }; -var PackedPolicyTooLargeException = class _PackedPolicyTooLargeException extends STSServiceException { - static { - __name(this, "PackedPolicyTooLargeException"); +exports.fromBase64 = fromBase64; + + +/***/ }), + +/***/ 26262: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - name = "PackedPolicyTooLargeException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "PackedPolicyTooLargeException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _PackedPolicyTooLargeException.prototype); + return to; +}; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(17963), module.exports); +__reExport(src_exports, __nccwpck_require__(26078), module.exports); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 26078: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(63718); +const util_utf8_1 = __nccwpck_require__(21038); +const toBase64 = (_input) => { + let input; + if (typeof _input === "string") { + input = (0, util_utf8_1.fromUtf8)(_input); + } + else { + input = _input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); + } + return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); +}; +exports.toBase64 = toBase64; + + +/***/ }), + +/***/ 63718: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; -var RegionDisabledException = class _RegionDisabledException extends STSServiceException { - static { - __name(this, "RegionDisabledException"); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromArrayBuffer: () => fromArrayBuffer, + fromString: () => fromString +}); +module.exports = __toCommonJS(src_exports); +var import_is_array_buffer = __nccwpck_require__(95697); +var import_buffer = __nccwpck_require__(20181); +var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { + if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); } - name = "RegionDisabledException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "RegionDisabledException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _RegionDisabledException.prototype); + return import_buffer.Buffer.from(input, offset, length); +}, "fromArrayBuffer"); +var fromString = /* @__PURE__ */ __name((input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); } + return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); +}, "fromString"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 27896: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); }; -var IDPRejectedClaimException = class _IDPRejectedClaimException extends STSServiceException { - static { - __name(this, "IDPRejectedClaimException"); - } - name = "IDPRejectedClaimException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "IDPRejectedClaimException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _IDPRejectedClaimException.prototype); +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; -var InvalidIdentityTokenException = class _InvalidIdentityTokenException extends STSServiceException { - static { - __name(this, "InvalidIdentityTokenException"); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromHex: () => fromHex, + toHex: () => toHex +}); +module.exports = __toCommonJS(src_exports); +var SHORT_TO_HEX = {}; +var HEX_TO_SHORT = {}; +for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; } - name = "InvalidIdentityTokenException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidIdentityTokenException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidIdentityTokenException.prototype); + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; +} +function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); } -}; -var AssumeRoleWithWebIdentityRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.WebIdentityToken && { WebIdentityToken: import_smithy_client2.SENSITIVE_STRING } -}), "AssumeRoleWithWebIdentityRequestFilterSensitiveLog"); -var AssumeRoleWithWebIdentityResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } -}), "AssumeRoleWithWebIdentityResponseFilterSensitiveLog"); -var IDPCommunicationErrorException = class _IDPCommunicationErrorException extends STSServiceException { - static { - __name(this, "IDPCommunicationErrorException"); + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; + } else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + } } - name = "IDPCommunicationErrorException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "IDPCommunicationErrorException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _IDPCommunicationErrorException.prototype); + return out; +} +__name(fromHex, "fromHex"); +function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; } -}; - -// src/submodules/sts/protocols/Aws_query.ts -var import_core = __nccwpck_require__(79191); -var import_protocol_http = __nccwpck_require__(5559); -var import_smithy_client3 = __nccwpck_require__(61411); -var se_AssumeRoleCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_AssumeRoleRequest(input, context), - [_A]: _AR, - [_V]: _ - }); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_AssumeRoleCommand"); -var se_AssumeRoleWithWebIdentityCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_AssumeRoleWithWebIdentityRequest(input, context), - [_A]: _ARWWI, - [_V]: _ - }); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_AssumeRoleWithWebIdentityCommand"); -var de_AssumeRoleCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core.parseXmlBody)(output.body, context); - let contents = {}; - contents = de_AssumeRoleResponse(data.AssumeRoleResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_AssumeRoleCommand"); -var de_AssumeRoleWithWebIdentityCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core.parseXmlBody)(output.body, context); - let contents = {}; - contents = de_AssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_AssumeRoleWithWebIdentityCommand"); -var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { - const parsedOutput = { - ...output, - body: await (0, import_core.parseXmlErrorBody)(output.body, context) - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ExpiredTokenException": - case "com.amazonaws.sts#ExpiredTokenException": - throw await de_ExpiredTokenExceptionRes(parsedOutput, context); - case "MalformedPolicyDocument": - case "com.amazonaws.sts#MalformedPolicyDocumentException": - throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); - case "PackedPolicyTooLarge": - case "com.amazonaws.sts#PackedPolicyTooLargeException": - throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); - case "RegionDisabledException": - case "com.amazonaws.sts#RegionDisabledException": - throw await de_RegionDisabledExceptionRes(parsedOutput, context); - case "IDPCommunicationError": - case "com.amazonaws.sts#IDPCommunicationErrorException": - throw await de_IDPCommunicationErrorExceptionRes(parsedOutput, context); - case "IDPRejectedClaim": - case "com.amazonaws.sts#IDPRejectedClaimException": - throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context); - case "InvalidIdentityToken": - case "com.amazonaws.sts#InvalidIdentityTokenException": - throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode - }); - } -}, "de_CommandError"); -var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_ExpiredTokenException(body.Error, context); - const exception = new ExpiredTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_ExpiredTokenExceptionRes"); -var de_IDPCommunicationErrorExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_IDPCommunicationErrorException(body.Error, context); - const exception = new IDPCommunicationErrorException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_IDPCommunicationErrorExceptionRes"); -var de_IDPRejectedClaimExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_IDPRejectedClaimException(body.Error, context); - const exception = new IDPRejectedClaimException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_IDPRejectedClaimExceptionRes"); -var de_InvalidIdentityTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_InvalidIdentityTokenException(body.Error, context); - const exception = new InvalidIdentityTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_InvalidIdentityTokenExceptionRes"); -var de_MalformedPolicyDocumentExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_MalformedPolicyDocumentException(body.Error, context); - const exception = new MalformedPolicyDocumentException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_MalformedPolicyDocumentExceptionRes"); -var de_PackedPolicyTooLargeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_PackedPolicyTooLargeException(body.Error, context); - const exception = new PackedPolicyTooLargeException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_PackedPolicyTooLargeExceptionRes"); -var de_RegionDisabledExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_RegionDisabledException(body.Error, context); - const exception = new RegionDisabledException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_RegionDisabledExceptionRes"); -var se_AssumeRoleRequest = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_RA] != null) { - entries[_RA] = input[_RA]; - } - if (input[_RSN] != null) { - entries[_RSN] = input[_RSN]; - } - if (input[_PA] != null) { - const memberEntries = se_policyDescriptorListType(input[_PA], context); - if (input[_PA]?.length === 0) { - entries.PolicyArns = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `PolicyArns.${key}`; - entries[loc] = value; - }); - } - if (input[_P] != null) { - entries[_P] = input[_P]; - } - if (input[_DS] != null) { - entries[_DS] = input[_DS]; - } - if (input[_T] != null) { - const memberEntries = se_tagListType(input[_T], context); - if (input[_T]?.length === 0) { - entries.Tags = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `Tags.${key}`; - entries[loc] = value; - }); - } - if (input[_TTK] != null) { - const memberEntries = se_tagKeyListType(input[_TTK], context); - if (input[_TTK]?.length === 0) { - entries.TransitiveTagKeys = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `TransitiveTagKeys.${key}`; - entries[loc] = value; - }); - } - if (input[_EI] != null) { - entries[_EI] = input[_EI]; - } - if (input[_SN] != null) { - entries[_SN] = input[_SN]; - } - if (input[_TC] != null) { - entries[_TC] = input[_TC]; - } - if (input[_SI] != null) { - entries[_SI] = input[_SI]; - } - if (input[_PC] != null) { - const memberEntries = se_ProvidedContextsListType(input[_PC], context); - if (input[_PC]?.length === 0) { - entries.ProvidedContexts = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `ProvidedContexts.${key}`; - entries[loc] = value; - }); - } - return entries; -}, "se_AssumeRoleRequest"); -var se_AssumeRoleWithWebIdentityRequest = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_RA] != null) { - entries[_RA] = input[_RA]; - } - if (input[_RSN] != null) { - entries[_RSN] = input[_RSN]; - } - if (input[_WIT] != null) { - entries[_WIT] = input[_WIT]; - } - if (input[_PI] != null) { - entries[_PI] = input[_PI]; - } - if (input[_PA] != null) { - const memberEntries = se_policyDescriptorListType(input[_PA], context); - if (input[_PA]?.length === 0) { - entries.PolicyArns = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `PolicyArns.${key}`; - entries[loc] = value; - }); - } - if (input[_P] != null) { - entries[_P] = input[_P]; - } - if (input[_DS] != null) { - entries[_DS] = input[_DS]; - } - return entries; -}, "se_AssumeRoleWithWebIdentityRequest"); -var se_policyDescriptorListType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - const memberEntries = se_PolicyDescriptorType(entry, context); - Object.entries(memberEntries).forEach(([key, value]) => { - entries[`member.${counter}.${key}`] = value; - }); - counter++; - } - return entries; -}, "se_policyDescriptorListType"); -var se_PolicyDescriptorType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_a] != null) { - entries[_a] = input[_a]; - } - return entries; -}, "se_PolicyDescriptorType"); -var se_ProvidedContext = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_PAr] != null) { - entries[_PAr] = input[_PAr]; - } - if (input[_CA] != null) { - entries[_CA] = input[_CA]; - } - return entries; -}, "se_ProvidedContext"); -var se_ProvidedContextsListType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - const memberEntries = se_ProvidedContext(entry, context); - Object.entries(memberEntries).forEach(([key, value]) => { - entries[`member.${counter}.${key}`] = value; - }); - counter++; - } - return entries; -}, "se_ProvidedContextsListType"); -var se_Tag = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_K] != null) { - entries[_K] = input[_K]; - } - if (input[_Va] != null) { - entries[_Va] = input[_Va]; - } - return entries; -}, "se_Tag"); -var se_tagKeyListType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - entries[`member.${counter}`] = entry; - counter++; - } - return entries; -}, "se_tagKeyListType"); -var se_tagListType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - const memberEntries = se_Tag(entry, context); - Object.entries(memberEntries).forEach(([key, value]) => { - entries[`member.${counter}.${key}`] = value; - }); - counter++; - } - return entries; -}, "se_tagListType"); -var de_AssumedRoleUser = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_ARI] != null) { - contents[_ARI] = (0, import_smithy_client3.expectString)(output[_ARI]); - } - if (output[_Ar] != null) { - contents[_Ar] = (0, import_smithy_client3.expectString)(output[_Ar]); - } - return contents; -}, "de_AssumedRoleUser"); -var de_AssumeRoleResponse = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_C] != null) { - contents[_C] = de_Credentials(output[_C], context); - } - if (output[_ARU] != null) { - contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); - } - if (output[_PPS] != null) { - contents[_PPS] = (0, import_smithy_client3.strictParseInt32)(output[_PPS]); - } - if (output[_SI] != null) { - contents[_SI] = (0, import_smithy_client3.expectString)(output[_SI]); - } - return contents; -}, "de_AssumeRoleResponse"); -var de_AssumeRoleWithWebIdentityResponse = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_C] != null) { - contents[_C] = de_Credentials(output[_C], context); - } - if (output[_SFWIT] != null) { - contents[_SFWIT] = (0, import_smithy_client3.expectString)(output[_SFWIT]); - } - if (output[_ARU] != null) { - contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); - } - if (output[_PPS] != null) { - contents[_PPS] = (0, import_smithy_client3.strictParseInt32)(output[_PPS]); - } - if (output[_Pr] != null) { - contents[_Pr] = (0, import_smithy_client3.expectString)(output[_Pr]); - } - if (output[_Au] != null) { - contents[_Au] = (0, import_smithy_client3.expectString)(output[_Au]); - } - if (output[_SI] != null) { - contents[_SI] = (0, import_smithy_client3.expectString)(output[_SI]); - } - return contents; -}, "de_AssumeRoleWithWebIdentityResponse"); -var de_Credentials = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_AKI] != null) { - contents[_AKI] = (0, import_smithy_client3.expectString)(output[_AKI]); - } - if (output[_SAK] != null) { - contents[_SAK] = (0, import_smithy_client3.expectString)(output[_SAK]); - } - if (output[_ST] != null) { - contents[_ST] = (0, import_smithy_client3.expectString)(output[_ST]); - } - if (output[_E] != null) { - contents[_E] = (0, import_smithy_client3.expectNonNull)((0, import_smithy_client3.parseRfc3339DateTimeWithOffset)(output[_E])); - } - return contents; -}, "de_Credentials"); -var de_ExpiredTokenException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_ExpiredTokenException"); -var de_IDPCommunicationErrorException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_IDPCommunicationErrorException"); -var de_IDPRejectedClaimException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_IDPRejectedClaimException"); -var de_InvalidIdentityTokenException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_InvalidIdentityTokenException"); -var de_MalformedPolicyDocumentException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_MalformedPolicyDocumentException"); -var de_PackedPolicyTooLargeException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_PackedPolicyTooLargeException"); -var de_RegionDisabledException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_RegionDisabledException"); -var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] -}), "deserializeMetadata"); -var throwDefaultError = (0, import_smithy_client3.withBaseException)(STSServiceException); -var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const contents = { - protocol, - hostname, - port, - method: "POST", - path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, - headers - }; - if (resolvedHostname !== void 0) { - contents.hostname = resolvedHostname; - } - if (body !== void 0) { - contents.body = body; - } - return new import_protocol_http.HttpRequest(contents); -}, "buildHttpRpcRequest"); -var SHARED_HEADERS = { - "content-type": "application/x-www-form-urlencoded" -}; -var _ = "2011-06-15"; -var _A = "Action"; -var _AKI = "AccessKeyId"; -var _AR = "AssumeRole"; -var _ARI = "AssumedRoleId"; -var _ARU = "AssumedRoleUser"; -var _ARWWI = "AssumeRoleWithWebIdentity"; -var _Ar = "Arn"; -var _Au = "Audience"; -var _C = "Credentials"; -var _CA = "ContextAssertion"; -var _DS = "DurationSeconds"; -var _E = "Expiration"; -var _EI = "ExternalId"; -var _K = "Key"; -var _P = "Policy"; -var _PA = "PolicyArns"; -var _PAr = "ProviderArn"; -var _PC = "ProvidedContexts"; -var _PI = "ProviderId"; -var _PPS = "PackedPolicySize"; -var _Pr = "Provider"; -var _RA = "RoleArn"; -var _RSN = "RoleSessionName"; -var _SAK = "SecretAccessKey"; -var _SFWIT = "SubjectFromWebIdentityToken"; -var _SI = "SourceIdentity"; -var _SN = "SerialNumber"; -var _ST = "SessionToken"; -var _T = "Tags"; -var _TC = "TokenCode"; -var _TTK = "TransitiveTagKeys"; -var _V = "Version"; -var _Va = "Value"; -var _WIT = "WebIdentityToken"; -var _a = "arn"; -var _m = "message"; -var buildFormUrlencodedString = /* @__PURE__ */ __name((formEntries) => Object.entries(formEntries).map(([key, value]) => (0, import_smithy_client3.extendedEncodeURIComponent)(key) + "=" + (0, import_smithy_client3.extendedEncodeURIComponent)(value)).join("&"), "buildFormUrlencodedString"); -var loadQueryErrorCode = /* @__PURE__ */ __name((output, data) => { - if (data.Error?.Code !== void 0) { - return data.Error.Code; - } - if (output.statusCode == 404) { - return "NotFound"; - } -}, "loadQueryErrorCode"); - -// src/submodules/sts/commands/AssumeRoleCommand.ts -var AssumeRoleCommand = class extends import_smithy_client4.Command.classBuilder().ep(import_EndpointParameters.commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AWSSecurityTokenServiceV20110615", "AssumeRole", {}).n("STSClient", "AssumeRoleCommand").f(void 0, AssumeRoleResponseFilterSensitiveLog).ser(se_AssumeRoleCommand).de(de_AssumeRoleCommand).build() { - static { - __name(this, "AssumeRoleCommand"); - } -}; - -// src/submodules/sts/commands/AssumeRoleWithWebIdentityCommand.ts -var import_middleware_endpoint2 = __nccwpck_require__(53152); -var import_middleware_serde2 = __nccwpck_require__(29514); -var import_smithy_client5 = __nccwpck_require__(61411); -var import_EndpointParameters2 = __nccwpck_require__(35486); -var AssumeRoleWithWebIdentityCommand = class extends import_smithy_client5.Command.classBuilder().ep(import_EndpointParameters2.commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithWebIdentity", {}).n("STSClient", "AssumeRoleWithWebIdentityCommand").f(AssumeRoleWithWebIdentityRequestFilterSensitiveLog, AssumeRoleWithWebIdentityResponseFilterSensitiveLog).ser(se_AssumeRoleWithWebIdentityCommand).de(de_AssumeRoleWithWebIdentityCommand).build() { - static { - __name(this, "AssumeRoleWithWebIdentityCommand"); - } -}; - -// src/submodules/sts/STS.ts -var import_STSClient = __nccwpck_require__(21402); -var commands = { - AssumeRoleCommand, - AssumeRoleWithWebIdentityCommand -}; -var STS = class extends import_STSClient.STSClient { - static { - __name(this, "STS"); - } -}; -(0, import_smithy_client6.createAggregatedClient)(commands, STS); - -// src/submodules/sts/index.ts -var import_EndpointParameters3 = __nccwpck_require__(35486); - -// src/submodules/sts/defaultStsRoleAssumers.ts -var import_client = __nccwpck_require__(78639); -var ASSUME_ROLE_DEFAULT_REGION = "us-east-1"; -var getAccountIdFromAssumedRoleUser = /* @__PURE__ */ __name((assumedRoleUser) => { - if (typeof assumedRoleUser?.Arn === "string") { - const arnComponents = assumedRoleUser.Arn.split(":"); - if (arnComponents.length > 4 && arnComponents[4] !== "") { - return arnComponents[4]; - } - } - return void 0; -}, "getAccountIdFromAssumedRoleUser"); -var resolveRegion = /* @__PURE__ */ __name(async (_region, _parentRegion, credentialProviderLogger) => { - const region = typeof _region === "function" ? await _region() : _region; - const parentRegion = typeof _parentRegion === "function" ? await _parentRegion() : _parentRegion; - credentialProviderLogger?.debug?.( - "@aws-sdk/client-sts::resolveRegion", - "accepting first of:", - `${region} (provider)`, - `${parentRegion} (parent client)`, - `${ASSUME_ROLE_DEFAULT_REGION} (STS default)` - ); - return region ?? parentRegion ?? ASSUME_ROLE_DEFAULT_REGION; -}, "resolveRegion"); -var getDefaultRoleAssumer = /* @__PURE__ */ __name((stsOptions, STSClient3) => { - let stsClient; - let closureSourceCreds; - return async (sourceCreds, params) => { - closureSourceCreds = sourceCreds; - if (!stsClient) { - const { - logger = stsOptions?.parentClientConfig?.logger, - region, - requestHandler = stsOptions?.parentClientConfig?.requestHandler, - credentialProviderLogger - } = stsOptions; - const resolvedRegion = await resolveRegion( - region, - stsOptions?.parentClientConfig?.region, - credentialProviderLogger - ); - const isCompatibleRequestHandler = !isH2(requestHandler); - stsClient = new STSClient3({ - profile: stsOptions?.parentClientConfig?.profile, - // A hack to make sts client uses the credential in current closure. - credentialDefaultProvider: /* @__PURE__ */ __name(() => async () => closureSourceCreds, "credentialDefaultProvider"), - region: resolvedRegion, - requestHandler: isCompatibleRequestHandler ? requestHandler : void 0, - logger - }); - } - const { Credentials: Credentials2, AssumedRoleUser: AssumedRoleUser2 } = await stsClient.send(new AssumeRoleCommand(params)); - if (!Credentials2 || !Credentials2.AccessKeyId || !Credentials2.SecretAccessKey) { - throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`); - } - const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser2); - const credentials = { - accessKeyId: Credentials2.AccessKeyId, - secretAccessKey: Credentials2.SecretAccessKey, - sessionToken: Credentials2.SessionToken, - expiration: Credentials2.Expiration, - // TODO(credentialScope): access normally when shape is updated. - ...Credentials2.CredentialScope && { credentialScope: Credentials2.CredentialScope }, - ...accountId && { accountId } - }; - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_STS_ASSUME_ROLE", "i"); - return credentials; - }; -}, "getDefaultRoleAssumer"); -var getDefaultRoleAssumerWithWebIdentity = /* @__PURE__ */ __name((stsOptions, STSClient3) => { - let stsClient; - return async (params) => { - if (!stsClient) { - const { - logger = stsOptions?.parentClientConfig?.logger, - region, - requestHandler = stsOptions?.parentClientConfig?.requestHandler, - credentialProviderLogger - } = stsOptions; - const resolvedRegion = await resolveRegion( - region, - stsOptions?.parentClientConfig?.region, - credentialProviderLogger - ); - const isCompatibleRequestHandler = !isH2(requestHandler); - stsClient = new STSClient3({ - profile: stsOptions?.parentClientConfig?.profile, - region: resolvedRegion, - requestHandler: isCompatibleRequestHandler ? requestHandler : void 0, - logger - }); - } - const { Credentials: Credentials2, AssumedRoleUser: AssumedRoleUser2 } = await stsClient.send(new AssumeRoleWithWebIdentityCommand(params)); - if (!Credentials2 || !Credentials2.AccessKeyId || !Credentials2.SecretAccessKey) { - throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`); - } - const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser2); - const credentials = { - accessKeyId: Credentials2.AccessKeyId, - secretAccessKey: Credentials2.SecretAccessKey, - sessionToken: Credentials2.SessionToken, - expiration: Credentials2.Expiration, - // TODO(credentialScope): access normally when shape is updated. - ...Credentials2.CredentialScope && { credentialScope: Credentials2.CredentialScope }, - ...accountId && { accountId } - }; - if (accountId) { - (0, import_client.setCredentialFeature)(credentials, "RESOLVED_ACCOUNT_ID", "T"); - } - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_STS_ASSUME_ROLE_WEB_ID", "k"); - return credentials; - }; -}, "getDefaultRoleAssumerWithWebIdentity"); -var isH2 = /* @__PURE__ */ __name((requestHandler) => { - return requestHandler?.metadata?.handlerProtocol === "h2"; -}, "isH2"); - -// src/submodules/sts/defaultRoleAssumers.ts -var import_STSClient2 = __nccwpck_require__(21402); -var getCustomizableStsClientCtor = /* @__PURE__ */ __name((baseCtor, customizations) => { - if (!customizations) return baseCtor; - else - return class CustomizableSTSClient extends baseCtor { - static { - __name(this, "CustomizableSTSClient"); - } - constructor(config) { - super(config); - for (const customization of customizations) { - this.middlewareStack.use(customization); - } - } - }; -}, "getCustomizableStsClientCtor"); -var getDefaultRoleAssumer2 = /* @__PURE__ */ __name((stsOptions = {}, stsPlugins) => getDefaultRoleAssumer(stsOptions, getCustomizableStsClientCtor(import_STSClient2.STSClient, stsPlugins)), "getDefaultRoleAssumer"); -var getDefaultRoleAssumerWithWebIdentity2 = /* @__PURE__ */ __name((stsOptions = {}, stsPlugins) => getDefaultRoleAssumerWithWebIdentity(stsOptions, getCustomizableStsClientCtor(import_STSClient2.STSClient, stsPlugins)), "getDefaultRoleAssumerWithWebIdentity"); -var decorateDefaultCredentialProvider = /* @__PURE__ */ __name((provider) => (input) => provider({ - roleAssumer: getDefaultRoleAssumer2(input), - roleAssumerWithWebIdentity: getDefaultRoleAssumerWithWebIdentity2(input), - ...input -}), "decorateDefaultCredentialProvider"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 20907: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const tslib_1 = __nccwpck_require__(61860); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(16098)); -const core_1 = __nccwpck_require__(79191); -const util_user_agent_node_1 = __nccwpck_require__(25195); -const config_resolver_1 = __nccwpck_require__(39316); -const core_2 = __nccwpck_require__(90475); -const hash_node_1 = __nccwpck_require__(5092); -const middleware_retry_1 = __nccwpck_require__(19618); -const node_config_provider_1 = __nccwpck_require__(44297); -const node_http_handler_1 = __nccwpck_require__(11176); -const util_body_length_node_1 = __nccwpck_require__(13638); -const util_retry_1 = __nccwpck_require__(15518); -const runtimeConfig_shared_1 = __nccwpck_require__(59096); -const smithy_client_1 = __nccwpck_require__(61411); -const util_defaults_mode_node_1 = __nccwpck_require__(15435); -const smithy_client_2 = __nccwpck_require__(61411); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); - (0, core_1.emitWarningIfUnsupportedVersion)(process.version); - const loaderConfig = { - profile: config?.profile, - logger: clientSharedValues.logger, - }; - return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4") || - (async (idProps) => await config.credentialDefaultProvider(idProps?.__config || {})()), - signer: new core_1.AwsSdkSigV4Signer(), - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner(), - }, - ], - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), - region: config?.region ?? - (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), - requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }, config), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; - - -/***/ }), - -/***/ 59096: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const core_1 = __nccwpck_require__(79191); -const core_2 = __nccwpck_require__(90475); -const smithy_client_1 = __nccwpck_require__(61411); -const url_parser_1 = __nccwpck_require__(81983); -const util_base64_1 = __nccwpck_require__(26262); -const util_utf8_1 = __nccwpck_require__(21038); -const httpAuthSchemeProvider_1 = __nccwpck_require__(52506); -const endpointResolver_1 = __nccwpck_require__(90692); -const getRuntimeConfig = (config) => { - return { - apiVersion: "2011-06-15", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - extensions: config?.extensions ?? [], - httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeProvider, - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), - signer: new core_1.AwsSdkSigV4Signer(), - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner(), - }, - ], - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "STS", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; - - -/***/ }), - -/***/ 85911: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveRuntimeExtensions = void 0; -const region_config_resolver_1 = __nccwpck_require__(2472); -const protocol_http_1 = __nccwpck_require__(5559); -const smithy_client_1 = __nccwpck_require__(61411); -const httpAuthExtensionConfiguration_1 = __nccwpck_require__(2749); -const resolveRuntimeExtensions = (runtimeConfig, extensions) => { - const extensionConfiguration = Object.assign((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig), (0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig), (0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig), (0, httpAuthExtensionConfiguration_1.getHttpAuthExtensionConfiguration)(runtimeConfig)); - extensions.forEach((extension) => extension.configure(extensionConfiguration)); - return Object.assign(runtimeConfig, (0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), (0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), (0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), (0, httpAuthExtensionConfiguration_1.resolveHttpAuthRuntimeConfig)(extensionConfiguration)); -}; -exports.resolveRuntimeExtensions = resolveRuntimeExtensions; - - -/***/ }), - -/***/ 2472: -/***/ ((module) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, - NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, - REGION_ENV_NAME: () => REGION_ENV_NAME, - REGION_INI_NAME: () => REGION_INI_NAME, - getAwsRegionExtensionConfiguration: () => getAwsRegionExtensionConfiguration, - resolveAwsRegionExtensionConfiguration: () => resolveAwsRegionExtensionConfiguration, - resolveRegionConfig: () => resolveRegionConfig -}); -module.exports = __toCommonJS(index_exports); - -// src/extensions/index.ts -var getAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - setRegion(region) { - runtimeConfig.region = region; - }, - region() { - return runtimeConfig.region; - } - }; -}, "getAwsRegionExtensionConfiguration"); -var resolveAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((awsRegionExtensionConfiguration) => { - return { - region: awsRegionExtensionConfiguration.region() - }; -}, "resolveAwsRegionExtensionConfiguration"); - -// src/regionConfig/config.ts -var REGION_ENV_NAME = "AWS_REGION"; -var REGION_INI_NAME = "region"; -var NODE_REGION_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => env[REGION_ENV_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[REGION_INI_NAME], "configFileSelector"), - default: /* @__PURE__ */ __name(() => { - throw new Error("Region is missing"); - }, "default") -}; -var NODE_REGION_CONFIG_FILE_OPTIONS = { - preferredFile: "credentials" -}; - -// src/regionConfig/isFipsRegion.ts -var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); - -// src/regionConfig/getRealRegion.ts -var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); - -// src/regionConfig/resolveRegionConfig.ts -var resolveRegionConfig = /* @__PURE__ */ __name((input) => { - const { region, useFipsEndpoint } = input; - if (!region) { - throw new Error("Region is missing"); - } - return Object.assign(input, { - region: /* @__PURE__ */ __name(async () => { - if (typeof region === "string") { - return getRealRegion(region); - } - const providedRegion = await region(); - return getRealRegion(providedRegion); - }, "region"), - useFipsEndpoint: /* @__PURE__ */ __name(async () => { - const providedRegion = typeof region === "string" ? region : await region(); - if (isFipsRegion(providedRegion)) { - return true; - } - return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); - }, "useFipsEndpoint") - }); -}, "resolveRegionConfig"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 14852: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromEnvSigningName: () => fromEnvSigningName, - fromSso: () => fromSso, - fromStatic: () => fromStatic, - nodeProvider: () => nodeProvider -}); -module.exports = __toCommonJS(index_exports); - -// src/fromEnvSigningName.ts -var import_client = __nccwpck_require__(78639); -var import_httpAuthSchemes = __nccwpck_require__(86202); -var import_property_provider = __nccwpck_require__(57745); -var fromEnvSigningName = /* @__PURE__ */ __name(({ logger, signingName } = {}) => async () => { - logger?.debug?.("@aws-sdk/token-providers - fromEnvSigningName"); - if (!signingName) { - throw new import_property_provider.TokenProviderError("Please pass 'signingName' to compute environment variable key", { logger }); - } - const bearerTokenKey = (0, import_httpAuthSchemes.getBearerTokenEnvKey)(signingName); - if (!(bearerTokenKey in process.env)) { - throw new import_property_provider.TokenProviderError(`Token not present in '${bearerTokenKey}' environment variable`, { logger }); - } - const token = { token: process.env[bearerTokenKey] }; - (0, import_client.setTokenFeature)(token, "BEARER_SERVICE_ENV_VARS", "3"); - return token; -}, "fromEnvSigningName"); - -// src/fromSso.ts - - - -// src/constants.ts -var EXPIRE_WINDOW_MS = 5 * 60 * 1e3; -var REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; - -// src/getSsoOidcClient.ts -var getSsoOidcClient = /* @__PURE__ */ __name(async (ssoRegion, init = {}) => { - const { SSOOIDCClient } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(19476))); - const ssoOidcClient = new SSOOIDCClient( - Object.assign({}, init.clientConfig ?? {}, { - region: ssoRegion ?? init.clientConfig?.region, - logger: init.clientConfig?.logger ?? init.parentClientConfig?.logger - }) - ); - return ssoOidcClient; -}, "getSsoOidcClient"); - -// src/getNewSsoOidcToken.ts -var getNewSsoOidcToken = /* @__PURE__ */ __name(async (ssoToken, ssoRegion, init = {}) => { - const { CreateTokenCommand } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(19476))); - const ssoOidcClient = await getSsoOidcClient(ssoRegion, init); - return ssoOidcClient.send( - new CreateTokenCommand({ - clientId: ssoToken.clientId, - clientSecret: ssoToken.clientSecret, - refreshToken: ssoToken.refreshToken, - grantType: "refresh_token" - }) - ); -}, "getNewSsoOidcToken"); - -// src/validateTokenExpiry.ts - -var validateTokenExpiry = /* @__PURE__ */ __name((token) => { - if (token.expiration && token.expiration.getTime() < Date.now()) { - throw new import_property_provider.TokenProviderError(`Token is expired. ${REFRESH_MESSAGE}`, false); - } -}, "validateTokenExpiry"); - -// src/validateTokenKey.ts - -var validateTokenKey = /* @__PURE__ */ __name((key, value, forRefresh = false) => { - if (typeof value === "undefined") { - throw new import_property_provider.TokenProviderError( - `Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${REFRESH_MESSAGE}`, - false - ); - } -}, "validateTokenKey"); - -// src/writeSSOTokenToFile.ts -var import_shared_ini_file_loader = __nccwpck_require__(80213); -var import_fs = __nccwpck_require__(79896); -var { writeFile } = import_fs.promises; -var writeSSOTokenToFile = /* @__PURE__ */ __name((id, ssoToken) => { - const tokenFilepath = (0, import_shared_ini_file_loader.getSSOTokenFilepath)(id); - const tokenString = JSON.stringify(ssoToken, null, 2); - return writeFile(tokenFilepath, tokenString); -}, "writeSSOTokenToFile"); - -// src/fromSso.ts -var lastRefreshAttemptTime = /* @__PURE__ */ new Date(0); -var fromSso = /* @__PURE__ */ __name((_init = {}) => async ({ callerClientConfig } = {}) => { - const init = { - ..._init, - parentClientConfig: { - ...callerClientConfig, - ..._init.parentClientConfig - } - }; - init.logger?.debug("@aws-sdk/token-providers - fromSso"); - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - const profileName = (0, import_shared_ini_file_loader.getProfileName)({ - profile: init.profile ?? callerClientConfig?.profile - }); - const profile = profiles[profileName]; - if (!profile) { - throw new import_property_provider.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); - } else if (!profile["sso_session"]) { - throw new import_property_provider.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); - } - const ssoSessionName = profile["sso_session"]; - const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); - const ssoSession = ssoSessions[ssoSessionName]; - if (!ssoSession) { - throw new import_property_provider.TokenProviderError( - `Sso session '${ssoSessionName}' could not be found in shared credentials file.`, - false - ); - } - for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { - if (!ssoSession[ssoSessionRequiredKey]) { - throw new import_property_provider.TokenProviderError( - `Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, - false - ); - } - } - const ssoStartUrl = ssoSession["sso_start_url"]; - const ssoRegion = ssoSession["sso_region"]; - let ssoToken; - try { - ssoToken = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoSessionName); - } catch (e) { - throw new import_property_provider.TokenProviderError( - `The SSO session token associated with profile=${profileName} was not found or is invalid. ${REFRESH_MESSAGE}`, - false - ); - } - validateTokenKey("accessToken", ssoToken.accessToken); - validateTokenKey("expiresAt", ssoToken.expiresAt); - const { accessToken, expiresAt } = ssoToken; - const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; - if (existingToken.expiration.getTime() - Date.now() > EXPIRE_WINDOW_MS) { - return existingToken; - } - if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1e3) { - validateTokenExpiry(existingToken); - return existingToken; - } - validateTokenKey("clientId", ssoToken.clientId, true); - validateTokenKey("clientSecret", ssoToken.clientSecret, true); - validateTokenKey("refreshToken", ssoToken.refreshToken, true); - try { - lastRefreshAttemptTime.setTime(Date.now()); - const newSsoOidcToken = await getNewSsoOidcToken(ssoToken, ssoRegion, init); - validateTokenKey("accessToken", newSsoOidcToken.accessToken); - validateTokenKey("expiresIn", newSsoOidcToken.expiresIn); - const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1e3); - try { - await writeSSOTokenToFile(ssoSessionName, { - ...ssoToken, - accessToken: newSsoOidcToken.accessToken, - expiresAt: newTokenExpiration.toISOString(), - refreshToken: newSsoOidcToken.refreshToken - }); - } catch (error) { - } - return { - token: newSsoOidcToken.accessToken, - expiration: newTokenExpiration - }; - } catch (error) { - validateTokenExpiry(existingToken); - return existingToken; - } -}, "fromSso"); - -// src/fromStatic.ts - -var fromStatic = /* @__PURE__ */ __name(({ token, logger }) => async () => { - logger?.debug("@aws-sdk/token-providers - fromStatic"); - if (!token || !token.token) { - throw new import_property_provider.TokenProviderError(`Please pass a valid token to fromStatic`, false); - } - return token; -}, "fromStatic"); - -// src/nodeProvider.ts - -var nodeProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider.memoize)( - (0, import_property_provider.chain)(fromSso(init), async () => { - throw new import_property_provider.TokenProviderError("Could not load token from any providers", false); - }), - (token) => token.expiration !== void 0 && token.expiration.getTime() - Date.now() < 3e5, - (token) => token.expiration !== void 0 -), "nodeProvider"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 11911: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - ConditionObject: () => import_util_endpoints.ConditionObject, - DeprecatedObject: () => import_util_endpoints.DeprecatedObject, - EndpointError: () => import_util_endpoints.EndpointError, - EndpointObject: () => import_util_endpoints.EndpointObject, - EndpointObjectHeaders: () => import_util_endpoints.EndpointObjectHeaders, - EndpointObjectProperties: () => import_util_endpoints.EndpointObjectProperties, - EndpointParams: () => import_util_endpoints.EndpointParams, - EndpointResolverOptions: () => import_util_endpoints.EndpointResolverOptions, - EndpointRuleObject: () => import_util_endpoints.EndpointRuleObject, - ErrorRuleObject: () => import_util_endpoints.ErrorRuleObject, - EvaluateOptions: () => import_util_endpoints.EvaluateOptions, - Expression: () => import_util_endpoints.Expression, - FunctionArgv: () => import_util_endpoints.FunctionArgv, - FunctionObject: () => import_util_endpoints.FunctionObject, - FunctionReturn: () => import_util_endpoints.FunctionReturn, - ParameterObject: () => import_util_endpoints.ParameterObject, - ReferenceObject: () => import_util_endpoints.ReferenceObject, - ReferenceRecord: () => import_util_endpoints.ReferenceRecord, - RuleSetObject: () => import_util_endpoints.RuleSetObject, - RuleSetRules: () => import_util_endpoints.RuleSetRules, - TreeRuleObject: () => import_util_endpoints.TreeRuleObject, - awsEndpointFunctions: () => awsEndpointFunctions, - getUserAgentPrefix: () => getUserAgentPrefix, - isIpAddress: () => import_util_endpoints.isIpAddress, - partition: () => partition, - resolveDefaultAwsRegionalEndpointsConfig: () => resolveDefaultAwsRegionalEndpointsConfig, - resolveEndpoint: () => import_util_endpoints.resolveEndpoint, - setPartitionInfo: () => setPartitionInfo, - toEndpointV1: () => toEndpointV1, - useDefaultPartitionInfo: () => useDefaultPartitionInfo -}); -module.exports = __toCommonJS(index_exports); - -// src/aws.ts - - -// src/lib/aws/isVirtualHostableS3Bucket.ts - - -// src/lib/isIpAddress.ts -var import_util_endpoints = __nccwpck_require__(79674); - -// src/lib/aws/isVirtualHostableS3Bucket.ts -var isVirtualHostableS3Bucket = /* @__PURE__ */ __name((value, allowSubDomains = false) => { - if (allowSubDomains) { - for (const label of value.split(".")) { - if (!isVirtualHostableS3Bucket(label)) { - return false; - } - } - return true; - } - if (!(0, import_util_endpoints.isValidHostLabel)(value)) { - return false; - } - if (value.length < 3 || value.length > 63) { - return false; - } - if (value !== value.toLowerCase()) { - return false; - } - if ((0, import_util_endpoints.isIpAddress)(value)) { - return false; - } - return true; -}, "isVirtualHostableS3Bucket"); - -// src/lib/aws/parseArn.ts -var ARN_DELIMITER = ":"; -var RESOURCE_DELIMITER = "/"; -var parseArn = /* @__PURE__ */ __name((value) => { - const segments = value.split(ARN_DELIMITER); - if (segments.length < 6) return null; - const [arn, partition2, service, region, accountId, ...resourcePath] = segments; - if (arn !== "arn" || partition2 === "" || service === "" || resourcePath.join(ARN_DELIMITER) === "") return null; - const resourceId = resourcePath.map((resource) => resource.split(RESOURCE_DELIMITER)).flat(); - return { - partition: partition2, - service, - region, - accountId, - resourceId - }; -}, "parseArn"); - -// src/lib/aws/partitions.json -var partitions_default = { - partitions: [{ - id: "aws", - outputs: { - dnsSuffix: "amazonaws.com", - dualStackDnsSuffix: "api.aws", - implicitGlobalRegion: "us-east-1", - name: "aws", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^(us|eu|ap|sa|ca|me|af|il|mx)\\-\\w+\\-\\d+$", - regions: { - "af-south-1": { - description: "Africa (Cape Town)" - }, - "ap-east-1": { - description: "Asia Pacific (Hong Kong)" - }, - "ap-east-2": { - description: "Asia Pacific (Taipei)" - }, - "ap-northeast-1": { - description: "Asia Pacific (Tokyo)" - }, - "ap-northeast-2": { - description: "Asia Pacific (Seoul)" - }, - "ap-northeast-3": { - description: "Asia Pacific (Osaka)" - }, - "ap-south-1": { - description: "Asia Pacific (Mumbai)" - }, - "ap-south-2": { - description: "Asia Pacific (Hyderabad)" - }, - "ap-southeast-1": { - description: "Asia Pacific (Singapore)" - }, - "ap-southeast-2": { - description: "Asia Pacific (Sydney)" - }, - "ap-southeast-3": { - description: "Asia Pacific (Jakarta)" - }, - "ap-southeast-4": { - description: "Asia Pacific (Melbourne)" - }, - "ap-southeast-5": { - description: "Asia Pacific (Malaysia)" - }, - "ap-southeast-7": { - description: "Asia Pacific (Thailand)" - }, - "aws-global": { - description: "AWS Standard global region" - }, - "ca-central-1": { - description: "Canada (Central)" - }, - "ca-west-1": { - description: "Canada West (Calgary)" - }, - "eu-central-1": { - description: "Europe (Frankfurt)" - }, - "eu-central-2": { - description: "Europe (Zurich)" - }, - "eu-north-1": { - description: "Europe (Stockholm)" - }, - "eu-south-1": { - description: "Europe (Milan)" - }, - "eu-south-2": { - description: "Europe (Spain)" - }, - "eu-west-1": { - description: "Europe (Ireland)" - }, - "eu-west-2": { - description: "Europe (London)" - }, - "eu-west-3": { - description: "Europe (Paris)" - }, - "il-central-1": { - description: "Israel (Tel Aviv)" - }, - "me-central-1": { - description: "Middle East (UAE)" - }, - "me-south-1": { - description: "Middle East (Bahrain)" - }, - "mx-central-1": { - description: "Mexico (Central)" - }, - "sa-east-1": { - description: "South America (Sao Paulo)" - }, - "us-east-1": { - description: "US East (N. Virginia)" - }, - "us-east-2": { - description: "US East (Ohio)" - }, - "us-west-1": { - description: "US West (N. California)" - }, - "us-west-2": { - description: "US West (Oregon)" - } - } - }, { - id: "aws-cn", - outputs: { - dnsSuffix: "amazonaws.com.cn", - dualStackDnsSuffix: "api.amazonwebservices.com.cn", - implicitGlobalRegion: "cn-northwest-1", - name: "aws-cn", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^cn\\-\\w+\\-\\d+$", - regions: { - "aws-cn-global": { - description: "AWS China global region" - }, - "cn-north-1": { - description: "China (Beijing)" - }, - "cn-northwest-1": { - description: "China (Ningxia)" - } - } - }, { - id: "aws-us-gov", - outputs: { - dnsSuffix: "amazonaws.com", - dualStackDnsSuffix: "api.aws", - implicitGlobalRegion: "us-gov-west-1", - name: "aws-us-gov", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^us\\-gov\\-\\w+\\-\\d+$", - regions: { - "aws-us-gov-global": { - description: "AWS GovCloud (US) global region" - }, - "us-gov-east-1": { - description: "AWS GovCloud (US-East)" - }, - "us-gov-west-1": { - description: "AWS GovCloud (US-West)" - } - } - }, { - id: "aws-iso", - outputs: { - dnsSuffix: "c2s.ic.gov", - dualStackDnsSuffix: "c2s.ic.gov", - implicitGlobalRegion: "us-iso-east-1", - name: "aws-iso", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-iso\\-\\w+\\-\\d+$", - regions: { - "aws-iso-global": { - description: "AWS ISO (US) global region" - }, - "us-iso-east-1": { - description: "US ISO East" - }, - "us-iso-west-1": { - description: "US ISO WEST" - } - } - }, { - id: "aws-iso-b", - outputs: { - dnsSuffix: "sc2s.sgov.gov", - dualStackDnsSuffix: "sc2s.sgov.gov", - implicitGlobalRegion: "us-isob-east-1", - name: "aws-iso-b", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-isob\\-\\w+\\-\\d+$", - regions: { - "aws-iso-b-global": { - description: "AWS ISOB (US) global region" - }, - "us-isob-east-1": { - description: "US ISOB East (Ohio)" - } - } - }, { - id: "aws-iso-e", - outputs: { - dnsSuffix: "cloud.adc-e.uk", - dualStackDnsSuffix: "cloud.adc-e.uk", - implicitGlobalRegion: "eu-isoe-west-1", - name: "aws-iso-e", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^eu\\-isoe\\-\\w+\\-\\d+$", - regions: { - "aws-iso-e-global": { - description: "AWS ISOE (Europe) global region" - }, - "eu-isoe-west-1": { - description: "EU ISOE West" - } - } - }, { - id: "aws-iso-f", - outputs: { - dnsSuffix: "csp.hci.ic.gov", - dualStackDnsSuffix: "csp.hci.ic.gov", - implicitGlobalRegion: "us-isof-south-1", - name: "aws-iso-f", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-isof\\-\\w+\\-\\d+$", - regions: { - "aws-iso-f-global": { - description: "AWS ISOF global region" - }, - "us-isof-east-1": { - description: "US ISOF EAST" - }, - "us-isof-south-1": { - description: "US ISOF SOUTH" - } - } - }, { - id: "aws-eusc", - outputs: { - dnsSuffix: "amazonaws.eu", - dualStackDnsSuffix: "amazonaws.eu", - implicitGlobalRegion: "eusc-de-east-1", - name: "aws-eusc", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^eusc\\-(de)\\-\\w+\\-\\d+$", - regions: { - "eusc-de-east-1": { - description: "EU (Germany)" - } - } - }], - version: "1.1" -}; - -// src/lib/aws/partition.ts -var selectedPartitionsInfo = partitions_default; -var selectedUserAgentPrefix = ""; -var partition = /* @__PURE__ */ __name((value) => { - const { partitions } = selectedPartitionsInfo; - for (const partition2 of partitions) { - const { regions, outputs } = partition2; - for (const [region, regionData] of Object.entries(regions)) { - if (region === value) { - return { - ...outputs, - ...regionData - }; - } - } - } - for (const partition2 of partitions) { - const { regionRegex, outputs } = partition2; - if (new RegExp(regionRegex).test(value)) { - return { - ...outputs - }; - } - } - const DEFAULT_PARTITION = partitions.find((partition2) => partition2.id === "aws"); - if (!DEFAULT_PARTITION) { - throw new Error( - "Provided region was not found in the partition array or regex, and default partition with id 'aws' doesn't exist." - ); - } - return { - ...DEFAULT_PARTITION.outputs - }; -}, "partition"); -var setPartitionInfo = /* @__PURE__ */ __name((partitionsInfo, userAgentPrefix = "") => { - selectedPartitionsInfo = partitionsInfo; - selectedUserAgentPrefix = userAgentPrefix; -}, "setPartitionInfo"); -var useDefaultPartitionInfo = /* @__PURE__ */ __name(() => { - setPartitionInfo(partitions_default, ""); -}, "useDefaultPartitionInfo"); -var getUserAgentPrefix = /* @__PURE__ */ __name(() => selectedUserAgentPrefix, "getUserAgentPrefix"); - -// src/aws.ts -var awsEndpointFunctions = { - isVirtualHostableS3Bucket, - parseArn, - partition -}; -import_util_endpoints.customEndpointFunctions.aws = awsEndpointFunctions; - -// src/resolveDefaultAwsRegionalEndpointsConfig.ts -var import_url_parser = __nccwpck_require__(81983); -var resolveDefaultAwsRegionalEndpointsConfig = /* @__PURE__ */ __name((input) => { - if (typeof input.endpointProvider !== "function") { - throw new Error("@aws-sdk/util-endpoint - endpointProvider and endpoint missing in config for this client."); - } - const { endpoint } = input; - if (endpoint === void 0) { - input.endpoint = async () => { - return toEndpointV1( - input.endpointProvider( - { - Region: typeof input.region === "function" ? await input.region() : input.region, - UseDualStack: typeof input.useDualstackEndpoint === "function" ? await input.useDualstackEndpoint() : input.useDualstackEndpoint, - UseFIPS: typeof input.useFipsEndpoint === "function" ? await input.useFipsEndpoint() : input.useFipsEndpoint, - Endpoint: void 0 - }, - { logger: input.logger } - ) - ); - }; - } - return input; -}, "resolveDefaultAwsRegionalEndpointsConfig"); -var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => (0, import_url_parser.parseUrl)(endpoint.url), "toEndpointV1"); - -// src/resolveEndpoint.ts - - -// src/types/EndpointError.ts - - -// src/types/EndpointRuleObject.ts - - -// src/types/ErrorRuleObject.ts - - -// src/types/RuleSetObject.ts - - -// src/types/TreeRuleObject.ts - - -// src/types/shared.ts - -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 25195: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - NODE_APP_ID_CONFIG_OPTIONS: () => NODE_APP_ID_CONFIG_OPTIONS, - UA_APP_ID_ENV_NAME: () => UA_APP_ID_ENV_NAME, - UA_APP_ID_INI_NAME: () => UA_APP_ID_INI_NAME, - createDefaultUserAgentProvider: () => createDefaultUserAgentProvider, - crtAvailability: () => crtAvailability, - defaultUserAgent: () => defaultUserAgent -}); -module.exports = __toCommonJS(index_exports); - -// src/defaultUserAgent.ts -var import_os = __nccwpck_require__(70857); -var import_process = __nccwpck_require__(932); - -// src/crt-availability.ts -var crtAvailability = { - isCrtAvailable: false -}; - -// src/is-crt-available.ts -var isCrtAvailable = /* @__PURE__ */ __name(() => { - if (crtAvailability.isCrtAvailable) { - return ["md/crt-avail"]; - } - return null; -}, "isCrtAvailable"); - -// src/defaultUserAgent.ts -var createDefaultUserAgentProvider = /* @__PURE__ */ __name(({ serviceId, clientVersion }) => { - return async (config) => { - const sections = [ - // sdk-metadata - ["aws-sdk-js", clientVersion], - // ua-metadata - ["ua", "2.1"], - // os-metadata - [`os/${(0, import_os.platform)()}`, (0, import_os.release)()], - // language-metadata - // ECMAScript edition doesn't matter in JS, so no version needed. - ["lang/js"], - ["md/nodejs", `${import_process.versions.node}`] - ]; - const crtAvailable = isCrtAvailable(); - if (crtAvailable) { - sections.push(crtAvailable); - } - if (serviceId) { - sections.push([`api/${serviceId}`, clientVersion]); - } - if (import_process.env.AWS_EXECUTION_ENV) { - sections.push([`exec-env/${import_process.env.AWS_EXECUTION_ENV}`]); - } - const appId = await config?.userAgentAppId?.(); - const resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; - return resolvedUserAgent; - }; -}, "createDefaultUserAgentProvider"); -var defaultUserAgent = createDefaultUserAgentProvider; - -// src/nodeAppIdConfigOptions.ts -var import_middleware_user_agent = __nccwpck_require__(58534); -var UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; -var UA_APP_ID_INI_NAME = "sdk_ua_app_id"; -var UA_APP_ID_INI_NAME_DEPRECATED = "sdk-ua-app-id"; -var NODE_APP_ID_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env2) => env2[UA_APP_ID_ENV_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[UA_APP_ID_INI_NAME] ?? profile[UA_APP_ID_INI_NAME_DEPRECATED], "configFileSelector"), - default: import_middleware_user_agent.DEFAULT_UA_APP_ID -}; -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 90475: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - DefaultIdentityProviderConfig: () => DefaultIdentityProviderConfig, - EXPIRATION_MS: () => EXPIRATION_MS, - HttpApiKeyAuthSigner: () => HttpApiKeyAuthSigner, - HttpBearerAuthSigner: () => HttpBearerAuthSigner, - NoAuthSigner: () => NoAuthSigner, - createIsIdentityExpiredFunction: () => createIsIdentityExpiredFunction, - createPaginator: () => createPaginator, - doesIdentityRequireRefresh: () => doesIdentityRequireRefresh, - getHttpAuthSchemeEndpointRuleSetPlugin: () => getHttpAuthSchemeEndpointRuleSetPlugin, - getHttpAuthSchemePlugin: () => getHttpAuthSchemePlugin, - getHttpSigningPlugin: () => getHttpSigningPlugin, - getSmithyContext: () => getSmithyContext, - httpAuthSchemeEndpointRuleSetMiddlewareOptions: () => httpAuthSchemeEndpointRuleSetMiddlewareOptions, - httpAuthSchemeMiddleware: () => httpAuthSchemeMiddleware, - httpAuthSchemeMiddlewareOptions: () => httpAuthSchemeMiddlewareOptions, - httpSigningMiddleware: () => httpSigningMiddleware, - httpSigningMiddlewareOptions: () => httpSigningMiddlewareOptions, - isIdentityExpired: () => isIdentityExpired, - memoizeIdentityProvider: () => memoizeIdentityProvider, - normalizeProvider: () => normalizeProvider, - requestBuilder: () => import_protocols.requestBuilder, - setFeature: () => setFeature -}); -module.exports = __toCommonJS(src_exports); - -// src/getSmithyContext.ts -var import_types = __nccwpck_require__(20873); -var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - -// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts -var import_util_middleware = __nccwpck_require__(25695); - -// src/middleware-http-auth-scheme/resolveAuthOptions.ts -var resolveAuthOptions = /* @__PURE__ */ __name((candidateAuthOptions, authSchemePreference) => { - if (!authSchemePreference || authSchemePreference.length === 0) { - return candidateAuthOptions; - } - const preferredAuthOptions = []; - for (const preferredSchemeName of authSchemePreference) { - for (const candidateAuthOption of candidateAuthOptions) { - const candidateAuthSchemeName = candidateAuthOption.schemeId.split("#")[1]; - if (candidateAuthSchemeName === preferredSchemeName) { - preferredAuthOptions.push(candidateAuthOption); - } - } - } - for (const candidateAuthOption of candidateAuthOptions) { - if (!preferredAuthOptions.find(({ schemeId }) => schemeId === candidateAuthOption.schemeId)) { - preferredAuthOptions.push(candidateAuthOption); - } - } - return preferredAuthOptions; -}, "resolveAuthOptions"); - -// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts -function convertHttpAuthSchemesToMap(httpAuthSchemes) { - const map = /* @__PURE__ */ new Map(); - for (const scheme of httpAuthSchemes) { - map.set(scheme.schemeId, scheme); - } - return map; -} -__name(convertHttpAuthSchemesToMap, "convertHttpAuthSchemesToMap"); -var httpAuthSchemeMiddleware = /* @__PURE__ */ __name((config, mwOptions) => (next, context) => async (args) => { - const options = config.httpAuthSchemeProvider( - await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input) - ); - const authSchemePreference = config.authSchemePreference ? await config.authSchemePreference() : []; - const resolvedOptions = resolveAuthOptions(options, authSchemePreference); - const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const failureReasons = []; - for (const option of resolvedOptions) { - const scheme = authSchemes.get(option.schemeId); - if (!scheme) { - failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` was not enabled for this service.`); - continue; - } - const identityProvider = scheme.identityProvider(await mwOptions.identityProviderConfigProvider(config)); - if (!identityProvider) { - failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` did not have an IdentityProvider configured.`); - continue; - } - const { identityProperties = {}, signingProperties = {} } = option.propertiesExtractor?.(config, context) || {}; - option.identityProperties = Object.assign(option.identityProperties || {}, identityProperties); - option.signingProperties = Object.assign(option.signingProperties || {}, signingProperties); - smithyContext.selectedHttpAuthScheme = { - httpAuthOption: option, - identity: await identityProvider(option.identityProperties), - signer: scheme.signer - }; - break; - } - if (!smithyContext.selectedHttpAuthScheme) { - throw new Error(failureReasons.join("\n")); - } - return next(args); -}, "httpAuthSchemeMiddleware"); - -// src/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.ts -var httpAuthSchemeEndpointRuleSetMiddlewareOptions = { - step: "serialize", - tags: ["HTTP_AUTH_SCHEME"], - name: "httpAuthSchemeMiddleware", - override: true, - relation: "before", - toMiddleware: "endpointV2Middleware" -}; -var getHttpAuthSchemeEndpointRuleSetPlugin = /* @__PURE__ */ __name((config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider -}) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo( - httpAuthSchemeMiddleware(config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider - }), - httpAuthSchemeEndpointRuleSetMiddlewareOptions - ); - } -}), "getHttpAuthSchemeEndpointRuleSetPlugin"); - -// src/middleware-http-auth-scheme/getHttpAuthSchemePlugin.ts -var import_middleware_serde = __nccwpck_require__(29514); -var httpAuthSchemeMiddlewareOptions = { - step: "serialize", - tags: ["HTTP_AUTH_SCHEME"], - name: "httpAuthSchemeMiddleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde.serializerMiddlewareOption.name -}; -var getHttpAuthSchemePlugin = /* @__PURE__ */ __name((config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider -}) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo( - httpAuthSchemeMiddleware(config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider - }), - httpAuthSchemeMiddlewareOptions - ); - } -}), "getHttpAuthSchemePlugin"); - -// src/middleware-http-signing/httpSigningMiddleware.ts -var import_protocol_http = __nccwpck_require__(5559); - -var defaultErrorHandler = /* @__PURE__ */ __name((signingProperties) => (error) => { - throw error; -}, "defaultErrorHandler"); -var defaultSuccessHandler = /* @__PURE__ */ __name((httpResponse, signingProperties) => { -}, "defaultSuccessHandler"); -var httpSigningMiddleware = /* @__PURE__ */ __name((config) => (next, context) => async (args) => { - if (!import_protocol_http.HttpRequest.isInstance(args.request)) { - return next(args); - } - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const scheme = smithyContext.selectedHttpAuthScheme; - if (!scheme) { - throw new Error(`No HttpAuthScheme was selected: unable to sign request`); - } - const { - httpAuthOption: { signingProperties = {} }, - identity, - signer - } = scheme; - const output = await next({ - ...args, - request: await signer.sign(args.request, identity, signingProperties) - }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); - (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); - return output; -}, "httpSigningMiddleware"); - -// src/middleware-http-signing/getHttpSigningMiddleware.ts -var httpSigningMiddlewareOptions = { - step: "finalizeRequest", - tags: ["HTTP_SIGNING"], - name: "httpSigningMiddleware", - aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], - override: true, - relation: "after", - toMiddleware: "retryMiddleware" -}; -var getHttpSigningPlugin = /* @__PURE__ */ __name((config) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); - } -}), "getHttpSigningPlugin"); - -// src/normalizeProvider.ts -var normalizeProvider = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; -}, "normalizeProvider"); - -// src/pagination/createPaginator.ts -var makePagedClientRequest = /* @__PURE__ */ __name(async (CommandCtor, client, input, withCommand = (_) => _, ...args) => { - let command = new CommandCtor(input); - command = withCommand(command) ?? command; - return await client.send(command, ...args); -}, "makePagedClientRequest"); -function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { - return /* @__PURE__ */ __name(async function* paginateOperation(config, input, ...additionalArguments) { - const _input = input; - let token = config.startingToken ?? _input[inputTokenName]; - let hasNext = true; - let page; - while (hasNext) { - _input[inputTokenName] = token; - if (pageSizeTokenName) { - _input[pageSizeTokenName] = _input[pageSizeTokenName] ?? config.pageSize; - } - if (config.client instanceof ClientCtor) { - page = await makePagedClientRequest( - CommandCtor, - config.client, - input, - config.withCommand, - ...additionalArguments - ); - } else { - throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); - } - yield page; - const prevToken = token; - token = get(page, outputTokenName); - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); - } - return void 0; - }, "paginateOperation"); -} -__name(createPaginator, "createPaginator"); -var get = /* @__PURE__ */ __name((fromObject, path) => { - let cursor = fromObject; - const pathComponents = path.split("."); - for (const step of pathComponents) { - if (!cursor || typeof cursor !== "object") { - return void 0; - } - cursor = cursor[step]; - } - return cursor; -}, "get"); - -// src/protocols/requestBuilder.ts -var import_protocols = __nccwpck_require__(50029); - -// src/setFeature.ts -function setFeature(context, feature, value) { - if (!context.__smithy_context) { - context.__smithy_context = { - features: {} - }; - } else if (!context.__smithy_context.features) { - context.__smithy_context.features = {}; - } - context.__smithy_context.features[feature] = value; -} -__name(setFeature, "setFeature"); - -// src/util-identity-and-auth/DefaultIdentityProviderConfig.ts -var DefaultIdentityProviderConfig = class { - /** - * Creates an IdentityProviderConfig with a record of scheme IDs to identity providers. - * - * @param config scheme IDs and identity providers to configure - */ - constructor(config) { - this.authSchemes = /* @__PURE__ */ new Map(); - for (const [key, value] of Object.entries(config)) { - if (value !== void 0) { - this.authSchemes.set(key, value); - } - } - } - static { - __name(this, "DefaultIdentityProviderConfig"); - } - getIdentityProvider(schemeId) { - return this.authSchemes.get(schemeId); - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.ts - - -var HttpApiKeyAuthSigner = class { - static { - __name(this, "HttpApiKeyAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - if (!signingProperties) { - throw new Error( - "request could not be signed with `apiKey` since the `name` and `in` signer properties are missing" - ); - } - if (!signingProperties.name) { - throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); - } - if (!signingProperties.in) { - throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); - } - if (!identity.apiKey) { - throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); - } - const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); - if (signingProperties.in === import_types.HttpApiKeyAuthLocation.QUERY) { - clonedRequest.query[signingProperties.name] = identity.apiKey; - } else if (signingProperties.in === import_types.HttpApiKeyAuthLocation.HEADER) { - clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; - } else { - throw new Error( - "request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`" - ); - } - return clonedRequest; - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.ts - -var HttpBearerAuthSigner = class { - static { - __name(this, "HttpBearerAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); - if (!identity.token) { - throw new Error("request could not be signed with `token` since the `token` is not defined"); - } - clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; - return clonedRequest; - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/noAuth.ts -var NoAuthSigner = class { - static { - __name(this, "NoAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - return httpRequest; - } -}; - -// src/util-identity-and-auth/memoizeIdentityProvider.ts -var createIsIdentityExpiredFunction = /* @__PURE__ */ __name((expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs, "createIsIdentityExpiredFunction"); -var EXPIRATION_MS = 3e5; -var isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); -var doesIdentityRequireRefresh = /* @__PURE__ */ __name((identity) => identity.expiration !== void 0, "doesIdentityRequireRefresh"); -var memoizeIdentityProvider = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - if (provider === void 0) { - return void 0; - } - const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async (options) => { - if (!pending) { - pending = normalizedProvider(options); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(options); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(options); - } - if (isConstant) { - return resolved; - } - if (!requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(options); - return resolved; - } - return resolved; - }; -}, "memoizeIdentityProvider"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 50029: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/protocols/index.ts -var protocols_exports = {}; -__export(protocols_exports, { - FromStringShapeDeserializer: () => FromStringShapeDeserializer, - HttpBindingProtocol: () => HttpBindingProtocol, - HttpInterceptingShapeDeserializer: () => HttpInterceptingShapeDeserializer, - HttpInterceptingShapeSerializer: () => HttpInterceptingShapeSerializer, - RequestBuilder: () => RequestBuilder, - RpcProtocol: () => RpcProtocol, - ToStringShapeSerializer: () => ToStringShapeSerializer, - collectBody: () => collectBody, - determineTimestampFormat: () => determineTimestampFormat, - extendedEncodeURIComponent: () => extendedEncodeURIComponent, - requestBuilder: () => requestBuilder, - resolvedPath: () => resolvedPath -}); -module.exports = __toCommonJS(protocols_exports); - -// src/submodules/protocols/collect-stream-body.ts -var import_util_stream = __nccwpck_require__(71975); -var collectBody = async (streamBody = new Uint8Array(), context) => { - if (streamBody instanceof Uint8Array) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); - } - if (!streamBody) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); - } - const fromContext = context.streamCollector(streamBody); - return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); -}; - -// src/submodules/protocols/extended-encode-uri-component.ts -function extendedEncodeURIComponent(str) { - return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { - return "%" + c.charCodeAt(0).toString(16).toUpperCase(); - }); -} - -// src/submodules/protocols/HttpBindingProtocol.ts -var import_schema2 = __nccwpck_require__(93247); -var import_protocol_http2 = __nccwpck_require__(5559); - -// src/submodules/protocols/HttpProtocol.ts -var import_schema = __nccwpck_require__(93247); -var import_serde = __nccwpck_require__(38669); -var import_protocol_http = __nccwpck_require__(5559); -var import_util_stream2 = __nccwpck_require__(71975); -var HttpProtocol = class { - constructor(options) { - this.options = options; - } - getRequestType() { - return import_protocol_http.HttpRequest; - } - getResponseType() { - return import_protocol_http.HttpResponse; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - this.serializer.setSerdeContext(serdeContext); - this.deserializer.setSerdeContext(serdeContext); - if (this.getPayloadCodec()) { - this.getPayloadCodec().setSerdeContext(serdeContext); - } - } - updateServiceEndpoint(request, endpoint) { - if ("url" in endpoint) { - request.protocol = endpoint.url.protocol; - request.hostname = endpoint.url.hostname; - request.port = endpoint.url.port ? Number(endpoint.url.port) : void 0; - request.path = endpoint.url.pathname; - request.fragment = endpoint.url.hash || void 0; - request.username = endpoint.url.username || void 0; - request.password = endpoint.url.password || void 0; - for (const [k, v] of endpoint.url.searchParams.entries()) { - if (!request.query) { - request.query = {}; - } - request.query[k] = v; - } - return request; - } else { - request.protocol = endpoint.protocol; - request.hostname = endpoint.hostname; - request.port = endpoint.port ? Number(endpoint.port) : void 0; - request.path = endpoint.path; - request.query = { - ...endpoint.query - }; - return request; - } - } - setHostPrefix(request, operationSchema, input) { - const operationNs = import_schema.NormalizedSchema.of(operationSchema); - const inputNs = import_schema.NormalizedSchema.of(operationSchema.input); - if (operationNs.getMergedTraits().endpoint) { - let hostPrefix = operationNs.getMergedTraits().endpoint?.[0]; - if (typeof hostPrefix === "string") { - const hostLabelInputs = [...inputNs.structIterator()].filter( - ([, member]) => member.getMergedTraits().hostLabel - ); - for (const [name] of hostLabelInputs) { - const replacement = input[name]; - if (typeof replacement !== "string") { - throw new Error(`@smithy/core/schema - ${name} in input must be a string as hostLabel.`); - } - hostPrefix = hostPrefix.replace(`{${name}}`, replacement); - } - request.hostname = hostPrefix + request.hostname; - } - } - } - deserializeMetadata(output) { - return { - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] - }; - } - async deserializeHttpMessage(schema, context, response, arg4, arg5) { - let dataObject; - if (arg4 instanceof Set) { - dataObject = arg5; - } else { - dataObject = arg4; - } - const deserializer = this.deserializer; - const ns = import_schema.NormalizedSchema.of(schema); - const nonHttpBindingMembers = []; - for (const [memberName, memberSchema] of ns.structIterator()) { - const memberTraits = memberSchema.getMemberTraits(); - if (memberTraits.httpPayload) { - const isStreaming = memberSchema.isStreaming(); - if (isStreaming) { - const isEventStream = memberSchema.isStructSchema(); - if (isEventStream) { - const context2 = this.serdeContext; - if (!context2.eventStreamMarshaller) { - throw new Error("@smithy/core - HttpProtocol: eventStreamMarshaller missing in serdeContext."); - } - const memberSchemas = memberSchema.getMemberSchemas(); - dataObject[memberName] = context2.eventStreamMarshaller.deserialize(response.body, async (event) => { - const unionMember = Object.keys(event).find((key) => { - return key !== "__type"; - }) ?? ""; - if (unionMember in memberSchemas) { - const eventStreamSchema = memberSchemas[unionMember]; - return { - [unionMember]: await deserializer.read(eventStreamSchema, event[unionMember].body) - }; - } else { - return { - $unknown: event - }; - } - }); - } else { - dataObject[memberName] = (0, import_util_stream2.sdkStreamMixin)(response.body); - } - } else if (response.body) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - dataObject[memberName] = await deserializer.read(memberSchema, bytes); - } - } - } else if (memberTraits.httpHeader) { - const key = String(memberTraits.httpHeader).toLowerCase(); - const value = response.headers[key]; - if (null != value) { - if (memberSchema.isListSchema()) { - const headerListValueSchema = memberSchema.getValueSchema(); - let sections; - if (headerListValueSchema.isTimestampSchema() && headerListValueSchema.getSchema() === import_schema.SCHEMA.TIMESTAMP_DEFAULT) { - sections = (0, import_serde.splitEvery)(value, ",", 2); - } else { - sections = (0, import_serde.splitHeader)(value); - } - const list = []; - for (const section of sections) { - list.push(await deserializer.read([headerListValueSchema, { httpHeader: key }], section.trim())); - } - dataObject[memberName] = list; - } else { - dataObject[memberName] = await deserializer.read(memberSchema, value); - } - } - } else if (memberTraits.httpPrefixHeaders !== void 0) { - dataObject[memberName] = {}; - for (const [header, value] of Object.entries(response.headers)) { - if (header.startsWith(memberTraits.httpPrefixHeaders)) { - dataObject[memberName][header.slice(memberTraits.httpPrefixHeaders.length)] = await deserializer.read( - [memberSchema.getValueSchema(), { httpHeader: header }], - value - ); - } - } - } else if (memberTraits.httpResponseCode) { - dataObject[memberName] = response.statusCode; - } else { - nonHttpBindingMembers.push(memberName); - } - } - return nonHttpBindingMembers; - } -}; - -// src/submodules/protocols/HttpBindingProtocol.ts -var HttpBindingProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, _input, context) { - const input = { - ..._input ?? {} - }; - const serializer = this.serializer; - const query = {}; - const headers = {}; - const endpoint = await context.endpoint(); - const ns = import_schema2.NormalizedSchema.of(operationSchema?.input); - const schema = ns.getSchema(); - let hasNonHttpBindingMember = false; - let payload; - const request = new import_protocol_http2.HttpRequest({ - protocol: "", - hostname: "", - port: void 0, - path: "", - fragment: void 0, - query, - headers, - body: void 0 - }); - if (endpoint) { - this.updateServiceEndpoint(request, endpoint); - this.setHostPrefix(request, operationSchema, input); - const opTraits = import_schema2.NormalizedSchema.translateTraits(operationSchema.traits); - if (opTraits.http) { - request.method = opTraits.http[0]; - const [path, search] = opTraits.http[1].split("?"); - if (request.path == "/") { - request.path = path; - } else { - request.path += path; - } - const traitSearchParams = new URLSearchParams(search ?? ""); - Object.assign(query, Object.fromEntries(traitSearchParams)); - } - } - for (const [memberName, memberNs] of ns.structIterator()) { - const memberTraits = memberNs.getMergedTraits() ?? {}; - const inputMemberValue = input[memberName]; - if (inputMemberValue == null) { - continue; - } - if (memberTraits.httpPayload) { - const isStreaming = memberNs.isStreaming(); - if (isStreaming) { - const isEventStream = memberNs.isStructSchema(); - if (isEventStream) { - throw new Error("serialization of event streams is not yet implemented"); - } else { - payload = inputMemberValue; - } - } else { - serializer.write(memberNs, inputMemberValue); - payload = serializer.flush(); - } - delete input[memberName]; - } else if (memberTraits.httpLabel) { - serializer.write(memberNs, inputMemberValue); - const replacement = serializer.flush(); - if (request.path.includes(`{${memberName}+}`)) { - request.path = request.path.replace( - `{${memberName}+}`, - replacement.split("/").map(extendedEncodeURIComponent).join("/") - ); - } else if (request.path.includes(`{${memberName}}`)) { - request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); - } - delete input[memberName]; - } else if (memberTraits.httpHeader) { - serializer.write(memberNs, inputMemberValue); - headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); - delete input[memberName]; - } else if (typeof memberTraits.httpPrefixHeaders === "string") { - for (const [key, val] of Object.entries(inputMemberValue)) { - const amalgam = memberTraits.httpPrefixHeaders + key; - serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); - headers[amalgam.toLowerCase()] = serializer.flush(); - } - delete input[memberName]; - } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { - this.serializeQuery(memberNs, inputMemberValue, query); - delete input[memberName]; - } else { - hasNonHttpBindingMember = true; - } - } - if (hasNonHttpBindingMember && input) { - serializer.write(schema, input); - payload = serializer.flush(); - } - request.headers = headers; - request.query = query; - request.body = payload; - return request; - } - serializeQuery(ns, data, query) { - const serializer = this.serializer; - const traits = ns.getMergedTraits(); - if (traits.httpQueryParams) { - for (const [key, val] of Object.entries(data)) { - if (!(key in query)) { - this.serializeQuery( - import_schema2.NormalizedSchema.of([ - ns.getValueSchema(), - { - // We pass on the traits to the sub-schema - // because we are still in the process of serializing the map itself. - ...traits, - httpQuery: key, - httpQueryParams: void 0 - } - ]), - val, - query - ); - } - } - return; - } - if (ns.isListSchema()) { - const sparse = !!ns.getMergedTraits().sparse; - const buffer = []; - for (const item of data) { - serializer.write([ns.getValueSchema(), traits], item); - const serializable = serializer.flush(); - if (sparse || serializable !== void 0) { - buffer.push(serializable); - } - } - query[traits.httpQuery] = buffer; - } else { - serializer.write([ns, traits], data); - query[traits.httpQuery] = serializer.flush(); - } - } - async deserializeResponse(operationSchema, context, response) { - const deserializer = this.deserializer; - const ns = import_schema2.NormalizedSchema.of(operationSchema.output); - const dataObject = {}; - if (response.statusCode >= 300) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(import_schema2.SCHEMA.DOCUMENT, bytes)); - } - await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); - throw new Error("@smithy/core/protocols - HTTP Protocol error handler failed to throw."); - } - for (const header in response.headers) { - const value = response.headers[header]; - delete response.headers[header]; - response.headers[header.toLowerCase()] = value; - } - const nonHttpBindingMembers = await this.deserializeHttpMessage(ns, context, response, dataObject); - if (nonHttpBindingMembers.length) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - const dataFromBody = await deserializer.read(ns, bytes); - for (const member of nonHttpBindingMembers) { - dataObject[member] = dataFromBody[member]; - } - } - } - const output = { - $metadata: this.deserializeMetadata(response), - ...dataObject - }; - return output; - } -}; - -// src/submodules/protocols/RpcProtocol.ts -var import_schema3 = __nccwpck_require__(93247); -var import_protocol_http3 = __nccwpck_require__(5559); -var RpcProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, input, context) { - const serializer = this.serializer; - const query = {}; - const headers = {}; - const endpoint = await context.endpoint(); - const ns = import_schema3.NormalizedSchema.of(operationSchema?.input); - const schema = ns.getSchema(); - let payload; - const request = new import_protocol_http3.HttpRequest({ - protocol: "", - hostname: "", - port: void 0, - path: "/", - fragment: void 0, - query, - headers, - body: void 0 - }); - if (endpoint) { - this.updateServiceEndpoint(request, endpoint); - this.setHostPrefix(request, operationSchema, input); - } - const _input = { - ...input - }; - if (input) { - serializer.write(schema, _input); - payload = serializer.flush(); - } - request.headers = headers; - request.query = query; - request.body = payload; - request.method = "POST"; - return request; - } - async deserializeResponse(operationSchema, context, response) { - const deserializer = this.deserializer; - const ns = import_schema3.NormalizedSchema.of(operationSchema.output); - const dataObject = {}; - if (response.statusCode >= 300) { - const bytes2 = await collectBody(response.body, context); - if (bytes2.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(import_schema3.SCHEMA.DOCUMENT, bytes2)); - } - await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); - throw new Error("@smithy/core/protocols - RPC Protocol error handler failed to throw."); - } - for (const header in response.headers) { - const value = response.headers[header]; - delete response.headers[header]; - response.headers[header.toLowerCase()] = value; - } - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(ns, bytes)); - } - const output = { - $metadata: this.deserializeMetadata(response), - ...dataObject - }; - return output; - } -}; - -// src/submodules/protocols/requestBuilder.ts -var import_protocol_http4 = __nccwpck_require__(5559); - -// src/submodules/protocols/resolve-path.ts -var resolvedPath = (resolvedPath2, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { - if (input != null && input[memberName] !== void 0) { - const labelValue = labelValueProvider(); - if (labelValue.length <= 0) { - throw new Error("Empty value provided for input HTTP label: " + memberName + "."); - } - resolvedPath2 = resolvedPath2.replace( - uriLabel, - isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) - ); - } else { - throw new Error("No value provided for input HTTP label: " + memberName + "."); - } - return resolvedPath2; -}; - -// src/submodules/protocols/requestBuilder.ts -function requestBuilder(input, context) { - return new RequestBuilder(input, context); -} -var RequestBuilder = class { - constructor(input, context) { - this.input = input; - this.context = context; - this.query = {}; - this.method = ""; - this.headers = {}; - this.path = ""; - this.body = null; - this.hostname = ""; - this.resolvePathStack = []; - } - async build() { - const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); - this.path = basePath; - for (const resolvePath of this.resolvePathStack) { - resolvePath(this.path); - } - return new import_protocol_http4.HttpRequest({ - protocol, - hostname: this.hostname || hostname, - port, - method: this.method, - path: this.path, - query: this.query, - body: this.body, - headers: this.headers - }); - } - /** - * Brevity setter for "hostname". - */ - hn(hostname) { - this.hostname = hostname; - return this; - } - /** - * Brevity initial builder for "basepath". - */ - bp(uriLabel) { - this.resolvePathStack.push((basePath) => { - this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; - }); - return this; - } - /** - * Brevity incremental builder for "path". - */ - p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { - this.resolvePathStack.push((path) => { - this.path = resolvedPath(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); - }); - return this; - } - /** - * Brevity setter for "headers". - */ - h(headers) { - this.headers = headers; - return this; - } - /** - * Brevity setter for "query". - */ - q(query) { - this.query = query; - return this; - } - /** - * Brevity setter for "body". - */ - b(body) { - this.body = body; - return this; - } - /** - * Brevity setter for "method". - */ - m(method) { - this.method = method; - return this; - } -}; - -// src/submodules/protocols/serde/FromStringShapeDeserializer.ts -var import_schema5 = __nccwpck_require__(93247); -var import_serde2 = __nccwpck_require__(38669); -var import_util_base64 = __nccwpck_require__(26262); -var import_util_utf8 = __nccwpck_require__(21038); - -// src/submodules/protocols/serde/determineTimestampFormat.ts -var import_schema4 = __nccwpck_require__(93247); -function determineTimestampFormat(ns, settings) { - if (settings.timestampFormat.useTrait) { - if (ns.isTimestampSchema() && (ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_DATE_TIME || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_EPOCH_SECONDS)) { - return ns.getSchema(); - } - } - const { httpLabel, httpPrefixHeaders, httpHeader, httpQuery } = ns.getMergedTraits(); - const bindingFormat = settings.httpBindings ? typeof httpPrefixHeaders === "string" || Boolean(httpHeader) ? import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE : Boolean(httpQuery) || Boolean(httpLabel) ? import_schema4.SCHEMA.TIMESTAMP_DATE_TIME : void 0 : void 0; - return bindingFormat ?? settings.timestampFormat.default; -} - -// src/submodules/protocols/serde/FromStringShapeDeserializer.ts -var FromStringShapeDeserializer = class { - constructor(settings) { - this.settings = settings; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } - read(_schema, data) { - const ns = import_schema5.NormalizedSchema.of(_schema); - if (ns.isListSchema()) { - return (0, import_serde2.splitHeader)(data).map((item) => this.read(ns.getValueSchema(), item)); - } - if (ns.isBlobSchema()) { - return (this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(data); - } - if (ns.isTimestampSchema()) { - const format = determineTimestampFormat(ns, this.settings); - switch (format) { - case import_schema5.SCHEMA.TIMESTAMP_DATE_TIME: - return (0, import_serde2.parseRfc3339DateTimeWithOffset)(data); - case import_schema5.SCHEMA.TIMESTAMP_HTTP_DATE: - return (0, import_serde2.parseRfc7231DateTime)(data); - case import_schema5.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - return (0, import_serde2.parseEpochTimestamp)(data); - default: - console.warn("Missing timestamp format, parsing value with Date constructor:", data); - return new Date(data); - } - } - if (ns.isStringSchema()) { - const mediaType = ns.getMergedTraits().mediaType; - let intermediateValue = data; - if (mediaType) { - if (ns.getMergedTraits().httpHeader) { - intermediateValue = this.base64ToUtf8(intermediateValue); - } - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - intermediateValue = import_serde2.LazyJsonString.from(intermediateValue); - } - return intermediateValue; - } - } - switch (true) { - case ns.isNumericSchema(): - return Number(data); - case ns.isBigIntegerSchema(): - return BigInt(data); - case ns.isBigDecimalSchema(): - return new import_serde2.NumericValue(data, "bigDecimal"); - case ns.isBooleanSchema(): - return String(data).toLowerCase() === "true"; - } - return data; - } - base64ToUtf8(base64String) { - return (this.serdeContext?.utf8Encoder ?? import_util_utf8.toUtf8)((this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(base64String)); - } -}; - -// src/submodules/protocols/serde/HttpInterceptingShapeDeserializer.ts -var import_schema6 = __nccwpck_require__(93247); -var import_util_utf82 = __nccwpck_require__(21038); -var HttpInterceptingShapeDeserializer = class { - constructor(codecDeserializer, codecSettings) { - this.codecDeserializer = codecDeserializer; - this.stringDeserializer = new FromStringShapeDeserializer(codecSettings); - } - setSerdeContext(serdeContext) { - this.stringDeserializer.setSerdeContext(serdeContext); - this.codecDeserializer.setSerdeContext(serdeContext); - this.serdeContext = serdeContext; - } - read(schema, data) { - const ns = import_schema6.NormalizedSchema.of(schema); - const traits = ns.getMergedTraits(); - const toString = this.serdeContext?.utf8Encoder ?? import_util_utf82.toUtf8; - if (traits.httpHeader || traits.httpResponseCode) { - return this.stringDeserializer.read(ns, toString(data)); - } - if (traits.httpPayload) { - if (ns.isBlobSchema()) { - const toBytes = this.serdeContext?.utf8Decoder ?? import_util_utf82.fromUtf8; - if (typeof data === "string") { - return toBytes(data); - } - return data; - } else if (ns.isStringSchema()) { - if ("byteLength" in data) { - return toString(data); - } - return data; - } - } - return this.codecDeserializer.read(ns, data); - } -}; - -// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts -var import_schema8 = __nccwpck_require__(93247); - -// src/submodules/protocols/serde/ToStringShapeSerializer.ts -var import_schema7 = __nccwpck_require__(93247); -var import_serde3 = __nccwpck_require__(38669); -var import_util_base642 = __nccwpck_require__(26262); -var ToStringShapeSerializer = class { - constructor(settings) { - this.settings = settings; - this.stringBuffer = ""; - this.serdeContext = void 0; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } - write(schema, value) { - const ns = import_schema7.NormalizedSchema.of(schema); - switch (typeof value) { - case "object": - if (value === null) { - this.stringBuffer = "null"; - return; - } - if (ns.isTimestampSchema()) { - if (!(value instanceof Date)) { - throw new Error( - `@smithy/core/protocols - received non-Date value ${value} when schema expected Date in ${ns.getName(true)}` - ); - } - const format = determineTimestampFormat(ns, this.settings); - switch (format) { - case import_schema7.SCHEMA.TIMESTAMP_DATE_TIME: - this.stringBuffer = value.toISOString().replace(".000Z", "Z"); - break; - case import_schema7.SCHEMA.TIMESTAMP_HTTP_DATE: - this.stringBuffer = (0, import_serde3.dateToUtcString)(value); - break; - case import_schema7.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - this.stringBuffer = String(value.getTime() / 1e3); - break; - default: - console.warn("Missing timestamp format, using epoch seconds", value); - this.stringBuffer = String(value.getTime() / 1e3); - } - return; - } - if (ns.isBlobSchema() && "byteLength" in value) { - this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(value); - return; - } - if (ns.isListSchema() && Array.isArray(value)) { - let buffer = ""; - for (const item of value) { - this.write([ns.getValueSchema(), ns.getMergedTraits()], item); - const headerItem = this.flush(); - const serialized = ns.getValueSchema().isTimestampSchema() ? headerItem : (0, import_serde3.quoteHeader)(headerItem); - if (buffer !== "") { - buffer += ", "; - } - buffer += serialized; - } - this.stringBuffer = buffer; - return; - } - this.stringBuffer = JSON.stringify(value, null, 2); - break; - case "string": - const mediaType = ns.getMergedTraits().mediaType; - let intermediateValue = value; - if (mediaType) { - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - intermediateValue = import_serde3.LazyJsonString.from(intermediateValue); - } - if (ns.getMergedTraits().httpHeader) { - this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(intermediateValue.toString()); - return; - } - } - this.stringBuffer = value; - break; - default: - this.stringBuffer = String(value); - } - } - flush() { - const buffer = this.stringBuffer; - this.stringBuffer = ""; - return buffer; - } -}; - -// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts -var HttpInterceptingShapeSerializer = class { - constructor(codecSerializer, codecSettings, stringSerializer = new ToStringShapeSerializer(codecSettings)) { - this.codecSerializer = codecSerializer; - this.stringSerializer = stringSerializer; - } - setSerdeContext(serdeContext) { - this.codecSerializer.setSerdeContext(serdeContext); - this.stringSerializer.setSerdeContext(serdeContext); - } - write(schema, value) { - const ns = import_schema8.NormalizedSchema.of(schema); - const traits = ns.getMergedTraits(); - if (traits.httpHeader || traits.httpLabel || traits.httpQuery) { - this.stringSerializer.write(ns, value); - this.buffer = this.stringSerializer.flush(); - return; - } - return this.codecSerializer.write(ns, value); - } - flush() { - if (this.buffer !== void 0) { - const buffer = this.buffer; - this.buffer = void 0; - return buffer; - } - return this.codecSerializer.flush(); - } -}; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 93247: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/schema/index.ts -var schema_exports = {}; -__export(schema_exports, { - ErrorSchema: () => ErrorSchema, - ListSchema: () => ListSchema, - MapSchema: () => MapSchema, - NormalizedSchema: () => NormalizedSchema, - OperationSchema: () => OperationSchema, - SCHEMA: () => SCHEMA, - Schema: () => Schema, - SimpleSchema: () => SimpleSchema, - StructureSchema: () => StructureSchema, - TypeRegistry: () => TypeRegistry, - deref: () => deref, - deserializerMiddlewareOption: () => deserializerMiddlewareOption, - error: () => error, - getSchemaSerdePlugin: () => getSchemaSerdePlugin, - list: () => list, - map: () => map, - op: () => op, - serializerMiddlewareOption: () => serializerMiddlewareOption, - sim: () => sim, - struct: () => struct -}); -module.exports = __toCommonJS(schema_exports); - -// src/submodules/schema/deref.ts -var deref = (schemaRef) => { - if (typeof schemaRef === "function") { - return schemaRef(); - } - return schemaRef; -}; - -// src/submodules/schema/middleware/schemaDeserializationMiddleware.ts -var import_protocol_http = __nccwpck_require__(5559); -var import_util_middleware = __nccwpck_require__(25695); -var schemaDeserializationMiddleware = (config) => (next, context) => async (args) => { - const { response } = await next(args); - const { operationSchema } = (0, import_util_middleware.getSmithyContext)(context); - try { - const parsed = await config.protocol.deserializeResponse( - operationSchema, - { - ...config, - ...context - }, - response - ); - return { - response, - output: parsed - }; - } catch (error2) { - Object.defineProperty(error2, "$response", { - value: response - }); - if (!("$metadata" in error2)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - try { - error2.message += "\n " + hint; - } catch (e) { - if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { - console.warn(hint); - } else { - context.logger?.warn?.(hint); - } - } - if (typeof error2.$responseBodyText !== "undefined") { - if (error2.$response) { - error2.$response.body = error2.$responseBodyText; - } - } - try { - if (import_protocol_http.HttpResponse.isInstance(response)) { - const { headers = {} } = response; - const headerEntries = Object.entries(headers); - error2.$metadata = { - httpStatusCode: response.statusCode, - requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), - extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), - cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) - }; - } - } catch (e) { - } - } - throw error2; - } -}; -var findHeader = (pattern, headers) => { - return (headers.find(([k]) => { - return k.match(pattern); - }) || [void 0, void 0])[1]; -}; - -// src/submodules/schema/middleware/schemaSerializationMiddleware.ts -var import_util_middleware2 = __nccwpck_require__(25695); -var schemaSerializationMiddleware = (config) => (next, context) => async (args) => { - const { operationSchema } = (0, import_util_middleware2.getSmithyContext)(context); - const endpoint = context.endpointV2?.url && config.urlParser ? async () => config.urlParser(context.endpointV2.url) : config.endpoint; - const request = await config.protocol.serializeRequest(operationSchema, args.input, { - ...config, - ...context, - endpoint - }); - return next({ - ...args, - request - }); -}; - -// src/submodules/schema/middleware/getSchemaSerdePlugin.ts -var deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true -}; -var serializerMiddlewareOption = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true -}; -function getSchemaSerdePlugin(config) { - return { - applyToStack: (commandStack) => { - commandStack.add(schemaSerializationMiddleware(config), serializerMiddlewareOption); - commandStack.add(schemaDeserializationMiddleware(config), deserializerMiddlewareOption); - config.protocol.setSerdeContext(config); - } - }; -} - -// src/submodules/schema/TypeRegistry.ts -var TypeRegistry = class _TypeRegistry { - constructor(namespace, schemas = /* @__PURE__ */ new Map()) { - this.namespace = namespace; - this.schemas = schemas; - } - static { - this.registries = /* @__PURE__ */ new Map(); - } - /** - * @param namespace - specifier. - * @returns the schema for that namespace, creating it if necessary. - */ - static for(namespace) { - if (!_TypeRegistry.registries.has(namespace)) { - _TypeRegistry.registries.set(namespace, new _TypeRegistry(namespace)); - } - return _TypeRegistry.registries.get(namespace); - } - /** - * Adds the given schema to a type registry with the same namespace. - * - * @param shapeId - to be registered. - * @param schema - to be registered. - */ - register(shapeId, schema) { - const qualifiedName = this.normalizeShapeId(shapeId); - const registry = _TypeRegistry.for(this.getNamespace(shapeId)); - registry.schemas.set(qualifiedName, schema); - } - /** - * @param shapeId - query. - * @returns the schema. - */ - getSchema(shapeId) { - const id = this.normalizeShapeId(shapeId); - if (!this.schemas.has(id)) { - throw new Error(`@smithy/core/schema - schema not found for ${id}`); - } - return this.schemas.get(id); - } - /** - * The smithy-typescript code generator generates a synthetic (i.e. unmodeled) base exception, - * because generated SDKs before the introduction of schemas have the notion of a ServiceBaseException, which - * is unique per service/model. - * - * This is generated under a unique prefix that is combined with the service namespace, and this - * method is used to retrieve it. - * - * The base exception synthetic schema is used when an error is returned by a service, but we cannot - * determine what existing schema to use to deserialize it. - * - * @returns the synthetic base exception of the service namespace associated with this registry instance. - */ - getBaseException() { - for (const [id, schema] of this.schemas.entries()) { - if (id.startsWith("smithy.ts.sdk.synthetic.") && id.endsWith("ServiceException")) { - return schema; - } - } - return void 0; - } - /** - * @param predicate - criterion. - * @returns a schema in this registry matching the predicate. - */ - find(predicate) { - return [...this.schemas.values()].find(predicate); - } - /** - * Unloads the current TypeRegistry. - */ - destroy() { - _TypeRegistry.registries.delete(this.namespace); - this.schemas.clear(); - } - normalizeShapeId(shapeId) { - if (shapeId.includes("#")) { - return shapeId; - } - return this.namespace + "#" + shapeId; - } - getNamespace(shapeId) { - return this.normalizeShapeId(shapeId).split("#")[0]; - } -}; - -// src/submodules/schema/schemas/Schema.ts -var Schema = class { - constructor(name, traits) { - this.name = name; - this.traits = traits; - } -}; - -// src/submodules/schema/schemas/ListSchema.ts -var ListSchema = class _ListSchema extends Schema { - constructor(name, traits, valueSchema) { - super(name, traits); - this.name = name; - this.traits = traits; - this.valueSchema = valueSchema; - this.symbol = _ListSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/core/schema::ListSchema"); - } - static [Symbol.hasInstance](lhs) { - const isPrototype = _ListSchema.prototype.isPrototypeOf(lhs); - if (!isPrototype && typeof lhs === "object" && lhs !== null) { - const list2 = lhs; - return list2.symbol === _ListSchema.symbol; - } - return isPrototype; - } -}; -function list(namespace, name, traits = {}, valueSchema) { - const schema = new ListSchema( - namespace + "#" + name, - traits, - typeof valueSchema === "function" ? valueSchema() : valueSchema - ); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/MapSchema.ts -var MapSchema = class _MapSchema extends Schema { - constructor(name, traits, keySchema, valueSchema) { - super(name, traits); - this.name = name; - this.traits = traits; - this.keySchema = keySchema; - this.valueSchema = valueSchema; - this.symbol = _MapSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/core/schema::MapSchema"); - } - static [Symbol.hasInstance](lhs) { - const isPrototype = _MapSchema.prototype.isPrototypeOf(lhs); - if (!isPrototype && typeof lhs === "object" && lhs !== null) { - const map2 = lhs; - return map2.symbol === _MapSchema.symbol; - } - return isPrototype; - } -}; -function map(namespace, name, traits = {}, keySchema, valueSchema) { - const schema = new MapSchema( - namespace + "#" + name, - traits, - keySchema, - typeof valueSchema === "function" ? valueSchema() : valueSchema - ); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/OperationSchema.ts -var OperationSchema = class extends Schema { - constructor(name, traits, input, output) { - super(name, traits); - this.name = name; - this.traits = traits; - this.input = input; - this.output = output; - } -}; -function op(namespace, name, traits = {}, input, output) { - const schema = new OperationSchema(namespace + "#" + name, traits, input, output); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/StructureSchema.ts -var StructureSchema = class _StructureSchema extends Schema { - constructor(name, traits, memberNames, memberList) { - super(name, traits); - this.name = name; - this.traits = traits; - this.memberNames = memberNames; - this.memberList = memberList; - this.symbol = _StructureSchema.symbol; - this.members = {}; - for (let i = 0; i < memberNames.length; ++i) { - this.members[memberNames[i]] = Array.isArray(memberList[i]) ? memberList[i] : [memberList[i], 0]; - } - } - static { - this.symbol = Symbol.for("@smithy/core/schema::StructureSchema"); - } - static [Symbol.hasInstance](lhs) { - const isPrototype = _StructureSchema.prototype.isPrototypeOf(lhs); - if (!isPrototype && typeof lhs === "object" && lhs !== null) { - const struct2 = lhs; - return struct2.symbol === _StructureSchema.symbol; - } - return isPrototype; - } -}; -function struct(namespace, name, traits, memberNames, memberList) { - const schema = new StructureSchema(namespace + "#" + name, traits, memberNames, memberList); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/ErrorSchema.ts -var ErrorSchema = class _ErrorSchema extends StructureSchema { - constructor(name, traits, memberNames, memberList, ctor) { - super(name, traits, memberNames, memberList); - this.name = name; - this.traits = traits; - this.memberNames = memberNames; - this.memberList = memberList; - this.ctor = ctor; - this.symbol = _ErrorSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/core/schema::ErrorSchema"); - } - static [Symbol.hasInstance](lhs) { - const isPrototype = _ErrorSchema.prototype.isPrototypeOf(lhs); - if (!isPrototype && typeof lhs === "object" && lhs !== null) { - const err = lhs; - return err.symbol === _ErrorSchema.symbol; - } - return isPrototype; - } -}; -function error(namespace, name, traits = {}, memberNames, memberList, ctor) { - const schema = new ErrorSchema(namespace + "#" + name, traits, memberNames, memberList, ctor); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/sentinels.ts -var SCHEMA = { - BLOB: 21, - // 21 - STREAMING_BLOB: 42, - // 42 - BOOLEAN: 2, - // 2 - STRING: 0, - // 0 - NUMERIC: 1, - // 1 - BIG_INTEGER: 17, - // 17 - BIG_DECIMAL: 19, - // 19 - DOCUMENT: 15, - // 15 - TIMESTAMP_DEFAULT: 4, - // 4 - TIMESTAMP_DATE_TIME: 5, - // 5 - TIMESTAMP_HTTP_DATE: 6, - // 6 - TIMESTAMP_EPOCH_SECONDS: 7, - // 7 - LIST_MODIFIER: 64, - // 64 - MAP_MODIFIER: 128 - // 128 -}; - -// src/submodules/schema/schemas/SimpleSchema.ts -var SimpleSchema = class _SimpleSchema extends Schema { - constructor(name, schemaRef, traits) { - super(name, traits); - this.name = name; - this.schemaRef = schemaRef; - this.traits = traits; - this.symbol = _SimpleSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/core/schema::SimpleSchema"); - } - static [Symbol.hasInstance](lhs) { - const isPrototype = _SimpleSchema.prototype.isPrototypeOf(lhs); - if (!isPrototype && typeof lhs === "object" && lhs !== null) { - const sim2 = lhs; - return sim2.symbol === _SimpleSchema.symbol; - } - return isPrototype; - } -}; -function sim(namespace, name, schemaRef, traits) { - const schema = new SimpleSchema(namespace + "#" + name, schemaRef, traits); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/NormalizedSchema.ts -var NormalizedSchema = class _NormalizedSchema { - /** - * @param ref - a polymorphic SchemaRef to be dereferenced/normalized. - * @param memberName - optional memberName if this NormalizedSchema should be considered a member schema. - */ - constructor(ref, memberName) { - this.ref = ref; - this.memberName = memberName; - this.symbol = _NormalizedSchema.symbol; - const traitStack = []; - let _ref = ref; - let schema = ref; - this._isMemberSchema = false; - while (Array.isArray(_ref)) { - traitStack.push(_ref[1]); - _ref = _ref[0]; - schema = deref(_ref); - this._isMemberSchema = true; - } - if (traitStack.length > 0) { - this.memberTraits = {}; - for (let i = traitStack.length - 1; i >= 0; --i) { - const traitSet = traitStack[i]; - Object.assign(this.memberTraits, _NormalizedSchema.translateTraits(traitSet)); - } - } else { - this.memberTraits = 0; - } - if (schema instanceof _NormalizedSchema) { - this.name = schema.name; - this.traits = schema.traits; - this._isMemberSchema = schema._isMemberSchema; - this.schema = schema.schema; - this.memberTraits = Object.assign({}, schema.getMemberTraits(), this.getMemberTraits()); - this.normalizedTraits = void 0; - this.ref = schema.ref; - this.memberName = memberName ?? schema.memberName; - return; - } - this.schema = deref(schema); - if (this.schema && typeof this.schema === "object") { - this.traits = this.schema?.traits ?? {}; - } else { - this.traits = 0; - } - this.name = (typeof this.schema === "object" ? this.schema?.name : void 0) ?? this.memberName ?? this.getSchemaName(); - if (this._isMemberSchema && !memberName) { - throw new Error( - `@smithy/core/schema - NormalizedSchema member schema ${this.getName( - true - )} must initialize with memberName argument.` - ); - } - } - static { - this.symbol = Symbol.for("@smithy/core/schema::NormalizedSchema"); - } - static [Symbol.hasInstance](lhs) { - const isPrototype = _NormalizedSchema.prototype.isPrototypeOf(lhs); - if (!isPrototype && typeof lhs === "object" && lhs !== null) { - const ns = lhs; - return ns.symbol === _NormalizedSchema.symbol; - } - return isPrototype; - } - /** - * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. - */ - static of(ref, memberName) { - if (ref instanceof _NormalizedSchema) { - return ref; - } - return new _NormalizedSchema(ref, memberName); - } - /** - * @param indicator - numeric indicator for preset trait combination. - * @returns equivalent trait object. - */ - static translateTraits(indicator) { - if (typeof indicator === "object") { - return indicator; - } - indicator = indicator | 0; - const traits = {}; - if ((indicator & 1) === 1) { - traits.httpLabel = 1; - } - if ((indicator >> 1 & 1) === 1) { - traits.idempotent = 1; - } - if ((indicator >> 2 & 1) === 1) { - traits.idempotencyToken = 1; - } - if ((indicator >> 3 & 1) === 1) { - traits.sensitive = 1; - } - if ((indicator >> 4 & 1) === 1) { - traits.httpPayload = 1; - } - if ((indicator >> 5 & 1) === 1) { - traits.httpResponseCode = 1; - } - if ((indicator >> 6 & 1) === 1) { - traits.httpQueryParams = 1; - } - return traits; - } - /** - * Creates a normalized member schema from the given schema and member name. - */ - static memberFrom(memberSchema, memberName) { - if (memberSchema instanceof _NormalizedSchema) { - memberSchema.memberName = memberName; - memberSchema._isMemberSchema = true; - return memberSchema; - } - return new _NormalizedSchema(memberSchema, memberName); - } - /** - * @returns the underlying non-normalized schema. - */ - getSchema() { - if (this.schema instanceof _NormalizedSchema) { - return this.schema = this.schema.getSchema(); - } - if (this.schema instanceof SimpleSchema) { - return deref(this.schema.schemaRef); - } - return deref(this.schema); - } - /** - * @param withNamespace - qualifies the name. - * @returns e.g. `MyShape` or `com.namespace#MyShape`. - */ - getName(withNamespace = false) { - if (!withNamespace) { - if (this.name && this.name.includes("#")) { - return this.name.split("#")[1]; - } - } - return this.name || void 0; - } - /** - * @returns the member name if the schema is a member schema. - * @throws Error when the schema isn't a member schema. - */ - getMemberName() { - if (!this.isMemberSchema()) { - throw new Error(`@smithy/core/schema - cannot get member name on non-member schema: ${this.getName(true)}`); - } - return this.memberName; - } - isMemberSchema() { - return this._isMemberSchema; - } - isUnitSchema() { - return this.getSchema() === "unit"; - } - /** - * boolean methods on this class help control flow in shape serialization and deserialization. - */ - isListSchema() { - const inner = this.getSchema(); - if (typeof inner === "number") { - return inner >= SCHEMA.LIST_MODIFIER && inner < SCHEMA.MAP_MODIFIER; - } - return inner instanceof ListSchema; - } - isMapSchema() { - const inner = this.getSchema(); - if (typeof inner === "number") { - return inner >= SCHEMA.MAP_MODIFIER && inner <= 255; - } - return inner instanceof MapSchema; - } - isDocumentSchema() { - return this.getSchema() === SCHEMA.DOCUMENT; - } - isStructSchema() { - const inner = this.getSchema(); - return inner !== null && typeof inner === "object" && "members" in inner || inner instanceof StructureSchema; - } - isBlobSchema() { - return this.getSchema() === SCHEMA.BLOB || this.getSchema() === SCHEMA.STREAMING_BLOB; - } - isTimestampSchema() { - const schema = this.getSchema(); - return typeof schema === "number" && schema >= SCHEMA.TIMESTAMP_DEFAULT && schema <= SCHEMA.TIMESTAMP_EPOCH_SECONDS; - } - isStringSchema() { - return this.getSchema() === SCHEMA.STRING; - } - isBooleanSchema() { - return this.getSchema() === SCHEMA.BOOLEAN; - } - isNumericSchema() { - return this.getSchema() === SCHEMA.NUMERIC; - } - isBigIntegerSchema() { - return this.getSchema() === SCHEMA.BIG_INTEGER; - } - isBigDecimalSchema() { - return this.getSchema() === SCHEMA.BIG_DECIMAL; - } - isStreaming() { - const streaming = !!this.getMergedTraits().streaming; - if (streaming) { - return true; - } - return this.getSchema() === SCHEMA.STREAMING_BLOB; - } - /** - * @returns own traits merged with member traits, where member traits of the same trait key take priority. - * This method is cached. - */ - getMergedTraits() { - if (this.normalizedTraits) { - return this.normalizedTraits; - } - this.normalizedTraits = { - ...this.getOwnTraits(), - ...this.getMemberTraits() - }; - return this.normalizedTraits; - } - /** - * @returns only the member traits. If the schema is not a member, this returns empty. - */ - getMemberTraits() { - return _NormalizedSchema.translateTraits(this.memberTraits); - } - /** - * @returns only the traits inherent to the shape or member target shape if this schema is a member. - * If there are any member traits they are excluded. - */ - getOwnTraits() { - return _NormalizedSchema.translateTraits(this.traits); - } - /** - * @returns the map's key's schema. Returns a dummy Document schema if this schema is a Document. - * - * @throws Error if the schema is not a Map or Document. - */ - getKeySchema() { - if (this.isDocumentSchema()) { - return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], "key"); - } - if (!this.isMapSchema()) { - throw new Error(`@smithy/core/schema - cannot get key schema for non-map schema: ${this.getName(true)}`); - } - const schema = this.getSchema(); - if (typeof schema === "number") { - return _NormalizedSchema.memberFrom([63 & schema, 0], "key"); - } - return _NormalizedSchema.memberFrom([schema.keySchema, 0], "key"); - } - /** - * @returns the schema of the map's value or list's member. - * Returns a dummy Document schema if this schema is a Document. - * - * @throws Error if the schema is not a Map, List, nor Document. - */ - getValueSchema() { - const schema = this.getSchema(); - if (typeof schema === "number") { - if (this.isMapSchema()) { - return _NormalizedSchema.memberFrom([63 & schema, 0], "value"); - } else if (this.isListSchema()) { - return _NormalizedSchema.memberFrom([63 & schema, 0], "member"); - } - } - if (schema && typeof schema === "object") { - if (this.isStructSchema()) { - throw new Error(`cannot call getValueSchema() with StructureSchema ${this.getName(true)}`); - } - const collection = schema; - if ("valueSchema" in collection) { - if (this.isMapSchema()) { - return _NormalizedSchema.memberFrom([collection.valueSchema, 0], "value"); - } else if (this.isListSchema()) { - return _NormalizedSchema.memberFrom([collection.valueSchema, 0], "member"); - } - } - } - if (this.isDocumentSchema()) { - return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], "value"); - } - throw new Error(`@smithy/core/schema - the schema ${this.getName(true)} does not have a value member.`); - } - /** - * @returns the NormalizedSchema for the given member name. The returned instance will return true for `isMemberSchema()` - * and will have the member name given. - * @param member - which member to retrieve and wrap. - * - * @throws Error if member does not exist or the schema is neither a document nor structure. - * Note that errors are assumed to be structures and unions are considered structures for these purposes. - */ - getMemberSchema(member) { - if (this.isStructSchema()) { - const struct2 = this.getSchema(); - if (!(member in struct2.members)) { - throw new Error( - `@smithy/core/schema - the schema ${this.getName(true)} does not have a member with name=${member}.` - ); - } - return _NormalizedSchema.memberFrom(struct2.members[member], member); - } - if (this.isDocumentSchema()) { - return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], member); - } - throw new Error(`@smithy/core/schema - the schema ${this.getName(true)} does not have members.`); - } - /** - * This can be used for checking the members as a hashmap. - * Prefer the structIterator method for iteration. - * - * This does NOT return list and map members, it is only for structures. - * - * @returns a map of member names to member schemas (normalized). - */ - getMemberSchemas() { - const { schema } = this; - const struct2 = schema; - if (!struct2 || typeof struct2 !== "object") { - return {}; - } - if ("members" in struct2) { - const buffer = {}; - for (const member of struct2.memberNames) { - buffer[member] = this.getMemberSchema(member); - } - return buffer; - } - return {}; - } - /** - * Allows iteration over members of a structure schema. - * Each yield is a pair of the member name and member schema. - * - * This avoids the overhead of calling Object.entries(ns.getMemberSchemas()). - */ - *structIterator() { - if (this.isUnitSchema()) { - return; - } - if (!this.isStructSchema()) { - throw new Error("@smithy/core/schema - cannot acquire structIterator on non-struct schema."); - } - const struct2 = this.getSchema(); - for (let i = 0; i < struct2.memberNames.length; ++i) { - yield [struct2.memberNames[i], _NormalizedSchema.memberFrom([struct2.memberList[i], 0], struct2.memberNames[i])]; - } - } - /** - * @returns a last-resort human-readable name for the schema if it has no other identifiers. - */ - getSchemaName() { - const schema = this.getSchema(); - if (typeof schema === "number") { - const _schema = 63 & schema; - const container = 192 & schema; - const type = Object.entries(SCHEMA).find(([, value]) => { - return value === _schema; - })?.[0] ?? "Unknown"; - switch (container) { - case SCHEMA.MAP_MODIFIER: - return `${type}Map`; - case SCHEMA.LIST_MODIFIER: - return `${type}List`; - case 0: - return type; - } - } - return "Unknown"; - } -}; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 38669: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/serde/index.ts -var serde_exports = {}; -__export(serde_exports, { - LazyJsonString: () => LazyJsonString, - NumericValue: () => NumericValue, - copyDocumentWithTransform: () => copyDocumentWithTransform, - dateToUtcString: () => dateToUtcString, - expectBoolean: () => expectBoolean, - expectByte: () => expectByte, - expectFloat32: () => expectFloat32, - expectInt: () => expectInt, - expectInt32: () => expectInt32, - expectLong: () => expectLong, - expectNonNull: () => expectNonNull, - expectNumber: () => expectNumber, - expectObject: () => expectObject, - expectShort: () => expectShort, - expectString: () => expectString, - expectUnion: () => expectUnion, - handleFloat: () => handleFloat, - limitedParseDouble: () => limitedParseDouble, - limitedParseFloat: () => limitedParseFloat, - limitedParseFloat32: () => limitedParseFloat32, - logger: () => logger, - nv: () => nv, - parseBoolean: () => parseBoolean, - parseEpochTimestamp: () => parseEpochTimestamp, - parseRfc3339DateTime: () => parseRfc3339DateTime, - parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, - parseRfc7231DateTime: () => parseRfc7231DateTime, - quoteHeader: () => quoteHeader, - splitEvery: () => splitEvery, - splitHeader: () => splitHeader, - strictParseByte: () => strictParseByte, - strictParseDouble: () => strictParseDouble, - strictParseFloat: () => strictParseFloat, - strictParseFloat32: () => strictParseFloat32, - strictParseInt: () => strictParseInt, - strictParseInt32: () => strictParseInt32, - strictParseLong: () => strictParseLong, - strictParseShort: () => strictParseShort -}); -module.exports = __toCommonJS(serde_exports); - -// src/submodules/serde/copyDocumentWithTransform.ts -var import_schema = __nccwpck_require__(93247); -var copyDocumentWithTransform = (source, schemaRef, transform = (_) => _) => { - const ns = import_schema.NormalizedSchema.of(schemaRef); - switch (typeof source) { - case "undefined": - case "boolean": - case "number": - case "string": - case "bigint": - case "symbol": - return transform(source, ns); - case "function": - case "object": - if (source === null) { - return transform(null, ns); - } - if (Array.isArray(source)) { - const newArray = new Array(source.length); - let i = 0; - for (const item of source) { - newArray[i++] = copyDocumentWithTransform(item, ns.getValueSchema(), transform); - } - return transform(newArray, ns); - } - if ("byteLength" in source) { - const newBytes = new Uint8Array(source.byteLength); - newBytes.set(source, 0); - return transform(newBytes, ns); - } - if (source instanceof Date) { - return transform(source, ns); - } - const newObject = {}; - if (ns.isMapSchema()) { - for (const key of Object.keys(source)) { - newObject[key] = copyDocumentWithTransform(source[key], ns.getValueSchema(), transform); - } - } else if (ns.isStructSchema()) { - for (const [key, memberSchema] of ns.structIterator()) { - newObject[key] = copyDocumentWithTransform(source[key], memberSchema, transform); - } - } else if (ns.isDocumentSchema()) { - for (const key of Object.keys(source)) { - newObject[key] = copyDocumentWithTransform(source[key], ns.getValueSchema(), transform); - } - } - return transform(newObject, ns); - default: - return transform(source, ns); - } -}; - -// src/submodules/serde/parse-utils.ts -var parseBoolean = (value) => { - switch (value) { - case "true": - return true; - case "false": - return false; - default: - throw new Error(`Unable to parse boolean value "${value}"`); - } -}; -var expectBoolean = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "number") { - if (value === 0 || value === 1) { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (value === 0) { - return false; - } - if (value === 1) { - return true; - } - } - if (typeof value === "string") { - const lower = value.toLowerCase(); - if (lower === "false" || lower === "true") { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (lower === "false") { - return false; - } - if (lower === "true") { - return true; - } - } - if (typeof value === "boolean") { - return value; - } - throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); -}; -var expectNumber = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - const parsed = parseFloat(value); - if (!Number.isNaN(parsed)) { - if (String(parsed) !== String(value)) { - logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); - } - return parsed; - } - } - if (typeof value === "number") { - return value; - } - throw new TypeError(`Expected number, got ${typeof value}: ${value}`); -}; -var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); -var expectFloat32 = (value) => { - const expected = expectNumber(value); - if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { - if (Math.abs(expected) > MAX_FLOAT) { - throw new TypeError(`Expected 32-bit float, got ${value}`); - } - } - return expected; -}; -var expectLong = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (Number.isInteger(value) && !Number.isNaN(value)) { - return value; - } - throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); -}; -var expectInt = expectLong; -var expectInt32 = (value) => expectSizedInt(value, 32); -var expectShort = (value) => expectSizedInt(value, 16); -var expectByte = (value) => expectSizedInt(value, 8); -var expectSizedInt = (value, size) => { - const expected = expectLong(value); - if (expected !== void 0 && castInt(expected, size) !== expected) { - throw new TypeError(`Expected ${size}-bit integer, got ${value}`); - } - return expected; -}; -var castInt = (value, size) => { - switch (size) { - case 32: - return Int32Array.of(value)[0]; - case 16: - return Int16Array.of(value)[0]; - case 8: - return Int8Array.of(value)[0]; - } -}; -var expectNonNull = (value, location) => { - if (value === null || value === void 0) { - if (location) { - throw new TypeError(`Expected a non-null value for ${location}`); - } - throw new TypeError("Expected a non-null value"); - } - return value; -}; -var expectObject = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "object" && !Array.isArray(value)) { - return value; - } - const receivedType = Array.isArray(value) ? "array" : typeof value; - throw new TypeError(`Expected object, got ${receivedType}: ${value}`); -}; -var expectString = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - return value; - } - if (["boolean", "number", "bigint"].includes(typeof value)) { - logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); - return String(value); - } - throw new TypeError(`Expected string, got ${typeof value}: ${value}`); -}; -var expectUnion = (value) => { - if (value === null || value === void 0) { - return void 0; - } - const asObject = expectObject(value); - const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); - if (setKeys.length === 0) { - throw new TypeError(`Unions must have exactly one non-null member. None were found.`); - } - if (setKeys.length > 1) { - throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); - } - return asObject; -}; -var strictParseDouble = (value) => { - if (typeof value == "string") { - return expectNumber(parseNumber(value)); - } - return expectNumber(value); -}; -var strictParseFloat = strictParseDouble; -var strictParseFloat32 = (value) => { - if (typeof value == "string") { - return expectFloat32(parseNumber(value)); - } - return expectFloat32(value); -}; -var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; -var parseNumber = (value) => { - const matches = value.match(NUMBER_REGEX); - if (matches === null || matches[0].length !== value.length) { - throw new TypeError(`Expected real number, got implicit NaN`); - } - return parseFloat(value); -}; -var limitedParseDouble = (value) => { - if (typeof value == "string") { - return parseFloatString(value); - } - return expectNumber(value); -}; -var handleFloat = limitedParseDouble; -var limitedParseFloat = limitedParseDouble; -var limitedParseFloat32 = (value) => { - if (typeof value == "string") { - return parseFloatString(value); - } - return expectFloat32(value); -}; -var parseFloatString = (value) => { - switch (value) { - case "NaN": - return NaN; - case "Infinity": - return Infinity; - case "-Infinity": - return -Infinity; - default: - throw new Error(`Unable to parse float value: ${value}`); - } -}; -var strictParseLong = (value) => { - if (typeof value === "string") { - return expectLong(parseNumber(value)); - } - return expectLong(value); -}; -var strictParseInt = strictParseLong; -var strictParseInt32 = (value) => { - if (typeof value === "string") { - return expectInt32(parseNumber(value)); - } - return expectInt32(value); -}; -var strictParseShort = (value) => { - if (typeof value === "string") { - return expectShort(parseNumber(value)); - } - return expectShort(value); -}; -var strictParseByte = (value) => { - if (typeof value === "string") { - return expectByte(parseNumber(value)); - } - return expectByte(value); -}; -var stackTraceWarning = (message) => { - return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); -}; -var logger = { - warn: console.warn -}; - -// src/submodules/serde/date-utils.ts -var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; -var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; -function dateToUtcString(date) { - const year = date.getUTCFullYear(); - const month = date.getUTCMonth(); - const dayOfWeek = date.getUTCDay(); - const dayOfMonthInt = date.getUTCDate(); - const hoursInt = date.getUTCHours(); - const minutesInt = date.getUTCMinutes(); - const secondsInt = date.getUTCSeconds(); - const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; - const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; - const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; - const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; - return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; -} -var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); -var parseRfc3339DateTime = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); -}; -var RFC3339_WITH_OFFSET = new RegExp( - /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ -); -var parseRfc3339DateTimeWithOffset = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339_WITH_OFFSET.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); - if (offsetStr.toUpperCase() != "Z") { - date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); - } - return date; -}; -var IMF_FIXDATE = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ -); -var RFC_850_DATE = new RegExp( - /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ -); -var ASC_TIME = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ -); -var parseRfc7231DateTime = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-7231 date-times must be expressed as strings"); - } - let match = IMF_FIXDATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr, "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); - } - match = RFC_850_DATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return adjustRfc850Year( - buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { - hours, - minutes, - seconds, - fractionalMilliseconds - }) - ); - } - match = ASC_TIME.exec(value); - if (match) { - const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr.trimLeft(), "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); - } - throw new TypeError("Invalid RFC-7231 date-time value"); -}; -var parseEpochTimestamp = (value) => { - if (value === null || value === void 0) { - return void 0; - } - let valueAsDouble; - if (typeof value === "number") { - valueAsDouble = value; - } else if (typeof value === "string") { - valueAsDouble = strictParseDouble(value); - } else if (typeof value === "object" && value.tag === 1) { - valueAsDouble = value.value; - } else { - throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); - } - if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { - throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); - } - return new Date(Math.round(valueAsDouble * 1e3)); -}; -var buildDate = (year, month, day, time) => { - const adjustedMonth = month - 1; - validateDayOfMonth(year, adjustedMonth, day); - return new Date( - Date.UTC( - year, - adjustedMonth, - day, - parseDateValue(time.hours, "hour", 0, 23), - parseDateValue(time.minutes, "minute", 0, 59), - // seconds can go up to 60 for leap seconds - parseDateValue(time.seconds, "seconds", 0, 60), - parseMilliseconds(time.fractionalMilliseconds) - ) - ); -}; -var parseTwoDigitYear = (value) => { - const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); - const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); - if (valueInThisCentury < thisYear) { - return valueInThisCentury + 100; - } - return valueInThisCentury; -}; -var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; -var adjustRfc850Year = (input) => { - if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { - return new Date( - Date.UTC( - input.getUTCFullYear() - 100, - input.getUTCMonth(), - input.getUTCDate(), - input.getUTCHours(), - input.getUTCMinutes(), - input.getUTCSeconds(), - input.getUTCMilliseconds() - ) - ); - } - return input; -}; -var parseMonthByShortName = (value) => { - const monthIdx = MONTHS.indexOf(value); - if (monthIdx < 0) { - throw new TypeError(`Invalid month: ${value}`); - } - return monthIdx + 1; -}; -var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; -var validateDayOfMonth = (year, month, day) => { - let maxDays = DAYS_IN_MONTH[month]; - if (month === 1 && isLeapYear(year)) { - maxDays = 29; - } - if (day > maxDays) { - throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); - } -}; -var isLeapYear = (year) => { - return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); -}; -var parseDateValue = (value, type, lower, upper) => { - const dateVal = strictParseByte(stripLeadingZeroes(value)); - if (dateVal < lower || dateVal > upper) { - throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); - } - return dateVal; -}; -var parseMilliseconds = (value) => { - if (value === null || value === void 0) { - return 0; - } - return strictParseFloat32("0." + value) * 1e3; -}; -var parseOffsetToMilliseconds = (value) => { - const directionStr = value[0]; - let direction = 1; - if (directionStr == "+") { - direction = 1; - } else if (directionStr == "-") { - direction = -1; - } else { - throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); - } - const hour = Number(value.substring(1, 3)); - const minute = Number(value.substring(4, 6)); - return direction * (hour * 60 + minute) * 60 * 1e3; -}; -var stripLeadingZeroes = (value) => { - let idx = 0; - while (idx < value.length - 1 && value.charAt(idx) === "0") { - idx++; - } - if (idx === 0) { - return value; - } - return value.slice(idx); -}; - -// src/submodules/serde/lazy-json.ts -var LazyJsonString = function LazyJsonString2(val) { - const str = Object.assign(new String(val), { - deserializeJSON() { - return JSON.parse(String(val)); - }, - toString() { - return String(val); - }, - toJSON() { - return String(val); - } - }); - return str; -}; -LazyJsonString.from = (object) => { - if (object && typeof object === "object" && (object instanceof LazyJsonString || "deserializeJSON" in object)) { - return object; - } else if (typeof object === "string" || Object.getPrototypeOf(object) === String.prototype) { - return LazyJsonString(String(object)); - } - return LazyJsonString(JSON.stringify(object)); -}; -LazyJsonString.fromObject = LazyJsonString.from; - -// src/submodules/serde/quote-header.ts -function quoteHeader(part) { - if (part.includes(",") || part.includes('"')) { - part = `"${part.replace(/"/g, '\\"')}"`; - } - return part; -} - -// src/submodules/serde/split-every.ts -function splitEvery(value, delimiter, numDelimiters) { - if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { - throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); - } - const segments = value.split(delimiter); - if (numDelimiters === 1) { - return segments; - } - const compoundSegments = []; - let currentSegment = ""; - for (let i = 0; i < segments.length; i++) { - if (currentSegment === "") { - currentSegment = segments[i]; - } else { - currentSegment += delimiter + segments[i]; - } - if ((i + 1) % numDelimiters === 0) { - compoundSegments.push(currentSegment); - currentSegment = ""; - } - } - if (currentSegment !== "") { - compoundSegments.push(currentSegment); - } - return compoundSegments; -} - -// src/submodules/serde/split-header.ts -var splitHeader = (value) => { - const z = value.length; - const values = []; - let withinQuotes = false; - let prevChar = void 0; - let anchor = 0; - for (let i = 0; i < z; ++i) { - const char = value[i]; - switch (char) { - case `"`: - if (prevChar !== "\\") { - withinQuotes = !withinQuotes; - } - break; - case ",": - if (!withinQuotes) { - values.push(value.slice(anchor, i)); - anchor = i + 1; - } - break; - default: - } - prevChar = char; - } - values.push(value.slice(anchor)); - return values.map((v) => { - v = v.trim(); - const z2 = v.length; - if (z2 < 2) { - return v; - } - if (v[0] === `"` && v[z2 - 1] === `"`) { - v = v.slice(1, z2 - 1); - } - return v.replace(/\\"/g, '"'); - }); -}; - -// src/submodules/serde/value/NumericValue.ts -var NumericValue = class _NumericValue { - constructor(string, type) { - this.string = string; - this.type = type; - let dot = 0; - for (let i = 0; i < string.length; ++i) { - const char = string.charCodeAt(i); - if (i === 0 && char === 45) { - continue; - } - if (char === 46) { - if (dot) { - throw new Error("@smithy/core/serde - NumericValue must contain at most one decimal point."); - } - dot = 1; - continue; - } - if (char < 48 || char > 57) { - throw new Error( - `@smithy/core/serde - NumericValue must only contain [0-9], at most one decimal point ".", and an optional negation prefix "-".` - ); - } - } - } - toString() { - return this.string; - } - static [Symbol.hasInstance](object) { - if (!object || typeof object !== "object") { - return false; - } - const _nv = object; - const prototypeMatch = _NumericValue.prototype.isPrototypeOf(object.constructor?.prototype); - if (prototypeMatch) { - return prototypeMatch; - } - if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name === "NumericValue") { - return true; - } - return prototypeMatch; - } -}; -function nv(input) { - return new NumericValue(String(input), "bigDecimal"); -} -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 8540: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - FetchHttpHandler: () => FetchHttpHandler, - keepAliveSupport: () => keepAliveSupport, - streamCollector: () => streamCollector -}); -module.exports = __toCommonJS(src_exports); - -// src/fetch-http-handler.ts -var import_protocol_http = __nccwpck_require__(5559); -var import_querystring_builder = __nccwpck_require__(75547); - -// src/create-request.ts -function createRequest(url, requestOptions) { - return new Request(url, requestOptions); -} -__name(createRequest, "createRequest"); - -// src/request-timeout.ts -function requestTimeout(timeoutInMs = 0) { - return new Promise((resolve, reject) => { - if (timeoutInMs) { - setTimeout(() => { - const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); - timeoutError.name = "TimeoutError"; - reject(timeoutError); - }, timeoutInMs); - } - }); -} -__name(requestTimeout, "requestTimeout"); - -// src/fetch-http-handler.ts -var keepAliveSupport = { - supported: void 0 -}; -var FetchHttpHandler = class _FetchHttpHandler { - static { - __name(this, "FetchHttpHandler"); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof instanceOrOptions?.handle === "function") { - return instanceOrOptions; - } - return new _FetchHttpHandler(instanceOrOptions); - } - constructor(options) { - if (typeof options === "function") { - this.configProvider = options().then((opts) => opts || {}); - } else { - this.config = options ?? {}; - this.configProvider = Promise.resolve(this.config); - } - if (keepAliveSupport.supported === void 0) { - keepAliveSupport.supported = Boolean( - typeof Request !== "undefined" && "keepalive" in createRequest("https://[::1]") - ); - } - } - destroy() { - } - async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { - if (!this.config) { - this.config = await this.configProvider; - } - const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; - const keepAlive = this.config.keepAlive === true; - const credentials = this.config.credentials; - if (abortSignal?.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - return Promise.reject(abortError); - } - let path = request.path; - const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - let auth = ""; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}@`; - } - const { port, method } = request; - const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; - const body = method === "GET" || method === "HEAD" ? void 0 : request.body; - const requestOptions = { - body, - headers: new Headers(request.headers), - method, - credentials - }; - if (this.config?.cache) { - requestOptions.cache = this.config.cache; - } - if (body) { - requestOptions.duplex = "half"; - } - if (typeof AbortController !== "undefined") { - requestOptions.signal = abortSignal; - } - if (keepAliveSupport.supported) { - requestOptions.keepalive = keepAlive; - } - if (typeof this.config.requestInit === "function") { - Object.assign(requestOptions, this.config.requestInit(request)); - } - let removeSignalEventListener = /* @__PURE__ */ __name(() => { - }, "removeSignalEventListener"); - const fetchRequest = createRequest(url, requestOptions); - const raceOfPromises = [ - fetch(fetchRequest).then((response) => { - const fetchHeaders = response.headers; - const transformedHeaders = {}; - for (const pair of fetchHeaders.entries()) { - transformedHeaders[pair[0]] = pair[1]; - } - const hasReadableStream = response.body != void 0; - if (!hasReadableStream) { - return response.blob().then((body2) => ({ - response: new import_protocol_http.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: body2 - }) - })); - } - return { - response: new import_protocol_http.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: response.body - }) - }; - }), - requestTimeout(requestTimeoutInMs) - ]; - if (abortSignal) { - raceOfPromises.push( - new Promise((resolve, reject) => { - const onAbort = /* @__PURE__ */ __name(() => { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); - } else { - abortSignal.onabort = onAbort; - } - }) - ); - } - return Promise.race(raceOfPromises).finally(removeSignalEventListener); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - config[key] = value; - return config; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } -}; - -// src/stream-collector.ts -var import_util_base64 = __nccwpck_require__(26262); -var streamCollector = /* @__PURE__ */ __name(async (stream) => { - if (typeof Blob === "function" && stream instanceof Blob || stream.constructor?.name === "Blob") { - if (Blob.prototype.arrayBuffer !== void 0) { - return new Uint8Array(await stream.arrayBuffer()); - } - return collectBlob(stream); - } - return collectStream(stream); -}, "streamCollector"); -async function collectBlob(blob) { - const base64 = await readToBase64(blob); - const arrayBuffer = (0, import_util_base64.fromBase64)(base64); - return new Uint8Array(arrayBuffer); -} -__name(collectBlob, "collectBlob"); -async function collectStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; - } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; - } - return collected; -} -__name(collectStream, "collectStream"); -function readToBase64(blob) { - return new Promise((resolve, reject) => { - const reader = new FileReader(); - reader.onloadend = () => { - if (reader.readyState !== 2) { - return reject(new Error("Reader aborted too early")); - } - const result = reader.result ?? ""; - const commaIndex = result.indexOf(","); - const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; - resolve(result.substring(dataOffset)); - }; - reader.onabort = () => reject(new Error("Read aborted")); - reader.onerror = () => reject(reader.error); - reader.readAsDataURL(blob); - }); -} -__name(readToBase64, "readToBase64"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 95697: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - isArrayBuffer: () => isArrayBuffer -}); -module.exports = __toCommonJS(src_exports); -var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 44412: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointFromConfig = void 0; -const node_config_provider_1 = __nccwpck_require__(44297); -const getEndpointUrlConfig_1 = __nccwpck_require__(83135); -const getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId !== null && serviceId !== void 0 ? serviceId : ""))(); -exports.getEndpointFromConfig = getEndpointFromConfig; - - -/***/ }), - -/***/ 83135: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointUrlConfig = void 0; -const shared_ini_file_loader_1 = __nccwpck_require__(80213); -const ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; -const CONFIG_ENDPOINT_URL = "endpoint_url"; -const getEndpointUrlConfig = (serviceId) => ({ - environmentVariableSelector: (env) => { - const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); - const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; - if (serviceEndpointUrl) - return serviceEndpointUrl; - const endpointUrl = env[ENV_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return undefined; - }, - configFileSelector: (profile, config) => { - if (config && profile.services) { - const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (servicesSection) { - const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); - const endpointUrl = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (endpointUrl) - return endpointUrl; - } - } - const endpointUrl = profile[CONFIG_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return undefined; - }, - default: undefined, -}); -exports.getEndpointUrlConfig = getEndpointUrlConfig; - - -/***/ }), - -/***/ 53152: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - endpointMiddleware: () => endpointMiddleware, - endpointMiddlewareOptions: () => endpointMiddlewareOptions, - getEndpointFromInstructions: () => getEndpointFromInstructions, - getEndpointPlugin: () => getEndpointPlugin, - resolveEndpointConfig: () => resolveEndpointConfig, - resolveEndpointRequiredConfig: () => resolveEndpointRequiredConfig, - resolveParams: () => resolveParams, - toEndpointV1: () => toEndpointV1 -}); -module.exports = __toCommonJS(src_exports); - -// src/service-customizations/s3.ts -var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { - const bucket = endpointParams?.Bucket || ""; - if (typeof endpointParams.Bucket === "string") { - endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); - } - if (isArnBucketName(bucket)) { - if (endpointParams.ForcePathStyle === true) { - throw new Error("Path-style addressing cannot be used with ARN buckets"); - } - } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { - endpointParams.ForcePathStyle = true; - } - if (endpointParams.DisableMultiRegionAccessPoints) { - endpointParams.disableMultiRegionAccessPoints = true; - endpointParams.DisableMRAP = true; - } - return endpointParams; -}, "resolveParamsForS3"); -var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; -var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; -var DOTS_PATTERN = /\.\./; -var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); -var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { - const [arn, partition, service, , , bucket] = bucketName.split(":"); - const isArn = arn === "arn" && bucketName.split(":").length >= 6; - const isValidArn = Boolean(isArn && partition && service && bucket); - if (isArn && !isValidArn) { - throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); - } - return isValidArn; -}, "isArnBucketName"); - -// src/adaptors/createConfigValueProvider.ts -var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { - const configProvider = /* @__PURE__ */ __name(async () => { - const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; - if (typeof configValue === "function") { - return configValue(); - } - return configValue; - }, "configProvider"); - if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = credentials?.credentialScope ?? credentials?.CredentialScope; - return configValue; - }; - } - if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = credentials?.accountId ?? credentials?.AccountId; - return configValue; - }; - } - if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { - return async () => { - if (config.isCustomEndpoint === false) { - return void 0; - } - const endpoint = await configProvider(); - if (endpoint && typeof endpoint === "object") { - if ("url" in endpoint) { - return endpoint.url.href; - } - if ("hostname" in endpoint) { - const { protocol, hostname, port, path } = endpoint; - return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; - } - } - return endpoint; - }; - } - return configProvider; -}, "createConfigValueProvider"); - -// src/adaptors/getEndpointFromInstructions.ts -var import_getEndpointFromConfig = __nccwpck_require__(44412); - -// src/adaptors/toEndpointV1.ts -var import_url_parser = __nccwpck_require__(81983); -var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { - if (typeof endpoint === "object") { - if ("url" in endpoint) { - return (0, import_url_parser.parseUrl)(endpoint.url); - } - return endpoint; - } - return (0, import_url_parser.parseUrl)(endpoint); -}, "toEndpointV1"); - -// src/adaptors/getEndpointFromInstructions.ts -var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { - if (!clientConfig.isCustomEndpoint) { - let endpointFromConfig; - if (clientConfig.serviceConfiguredEndpoint) { - endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); - } else { - endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId); - } - if (endpointFromConfig) { - clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); - clientConfig.isCustomEndpoint = true; - } - } - const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); - if (typeof clientConfig.endpointProvider !== "function") { - throw new Error("config.endpointProvider is not set."); - } - const endpoint = clientConfig.endpointProvider(endpointParams, context); - return endpoint; -}, "getEndpointFromInstructions"); -var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { - const endpointParams = {}; - const instructions = instructionsSupplier?.getEndpointParameterInstructions?.() || {}; - for (const [name, instruction] of Object.entries(instructions)) { - switch (instruction.type) { - case "staticContextParams": - endpointParams[name] = instruction.value; - break; - case "contextParams": - endpointParams[name] = commandInput[instruction.name]; - break; - case "clientContextParams": - case "builtInParams": - endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); - break; - case "operationContextParams": - endpointParams[name] = instruction.get(commandInput); - break; - default: - throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); - } - } - if (Object.keys(instructions).length === 0) { - Object.assign(endpointParams, clientConfig); - } - if (String(clientConfig.serviceId).toLowerCase() === "s3") { - await resolveParamsForS3(endpointParams); - } - return endpointParams; -}, "resolveParams"); - -// src/endpointMiddleware.ts -var import_core = __nccwpck_require__(90475); -var import_util_middleware = __nccwpck_require__(25695); -var endpointMiddleware = /* @__PURE__ */ __name(({ - config, - instructions -}) => { - return (next, context) => async (args) => { - if (config.isCustomEndpoint) { - (0, import_core.setFeature)(context, "ENDPOINT_OVERRIDE", "N"); - } - const endpoint = await getEndpointFromInstructions( - args.input, - { - getEndpointParameterInstructions() { - return instructions; - } - }, - { ...config }, - context - ); - context.endpointV2 = endpoint; - context.authSchemes = endpoint.properties?.authSchemes; - const authScheme = context.authSchemes?.[0]; - if (authScheme) { - context["signing_region"] = authScheme.signingRegion; - context["signing_service"] = authScheme.signingName; - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const httpAuthOption = smithyContext?.selectedHttpAuthScheme?.httpAuthOption; - if (httpAuthOption) { - httpAuthOption.signingProperties = Object.assign( - httpAuthOption.signingProperties || {}, - { - signing_region: authScheme.signingRegion, - signingRegion: authScheme.signingRegion, - signing_service: authScheme.signingName, - signingName: authScheme.signingName, - signingRegionSet: authScheme.signingRegionSet - }, - authScheme.properties - ); - } - } - return next({ - ...args - }); - }; -}, "endpointMiddleware"); - -// src/getEndpointPlugin.ts -var import_middleware_serde = __nccwpck_require__(29514); -var endpointMiddlewareOptions = { - step: "serialize", - tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], - name: "endpointV2Middleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde.serializerMiddlewareOption.name -}; -var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo( - endpointMiddleware({ - config, - instructions - }), - endpointMiddlewareOptions - ); - } -}), "getEndpointPlugin"); - -// src/resolveEndpointConfig.ts - -var import_getEndpointFromConfig2 = __nccwpck_require__(44412); -var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { - const tls = input.tls ?? true; - const { endpoint, useDualstackEndpoint, useFipsEndpoint } = input; - const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware.normalizeProvider)(endpoint)()) : void 0; - const isCustomEndpoint = !!endpoint; - const resolvedConfig = Object.assign(input, { - endpoint: customEndpointProvider, - tls, - isCustomEndpoint, - useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(useDualstackEndpoint ?? false), - useFipsEndpoint: (0, import_util_middleware.normalizeProvider)(useFipsEndpoint ?? false) - }); - let configuredEndpointPromise = void 0; - resolvedConfig.serviceConfiguredEndpoint = async () => { - if (input.serviceId && !configuredEndpointPromise) { - configuredEndpointPromise = (0, import_getEndpointFromConfig2.getEndpointFromConfig)(input.serviceId); - } - return configuredEndpointPromise; - }; - return resolvedConfig; -}, "resolveEndpointConfig"); - -// src/resolveEndpointRequiredConfig.ts -var resolveEndpointRequiredConfig = /* @__PURE__ */ __name((input) => { - const { endpoint } = input; - if (endpoint === void 0) { - input.endpoint = async () => { - throw new Error( - "@smithy/middleware-endpoint: (default endpointRuleSet) endpoint is not set - you must configure an endpoint." - ); - }; - } - return input; -}, "resolveEndpointRequiredConfig"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 29514: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - deserializerMiddleware: () => deserializerMiddleware, - deserializerMiddlewareOption: () => deserializerMiddlewareOption, - getSerdePlugin: () => getSerdePlugin, - serializerMiddleware: () => serializerMiddleware, - serializerMiddlewareOption: () => serializerMiddlewareOption -}); -module.exports = __toCommonJS(src_exports); - -// src/deserializerMiddleware.ts -var import_protocol_http = __nccwpck_require__(5559); -var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next, context) => async (args) => { - const { response } = await next(args); - try { - const parsed = await deserializer(response, options); - return { - response, - output: parsed - }; - } catch (error) { - Object.defineProperty(error, "$response", { - value: response - }); - if (!("$metadata" in error)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - try { - error.message += "\n " + hint; - } catch (e) { - if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { - console.warn(hint); - } else { - context.logger?.warn?.(hint); - } - } - if (typeof error.$responseBodyText !== "undefined") { - if (error.$response) { - error.$response.body = error.$responseBodyText; - } - } - try { - if (import_protocol_http.HttpResponse.isInstance(response)) { - const { headers = {} } = response; - const headerEntries = Object.entries(headers); - error.$metadata = { - httpStatusCode: response.statusCode, - requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), - extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), - cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) - }; - } - } catch (e) { - } - } - throw error; - } -}, "deserializerMiddleware"); -var findHeader = /* @__PURE__ */ __name((pattern, headers) => { - return (headers.find(([k]) => { - return k.match(pattern); - }) || [void 0, void 0])[1]; -}, "findHeader"); - -// src/serializerMiddleware.ts -var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { - const endpointConfig = options; - const endpoint = context.endpointV2?.url && endpointConfig.urlParser ? async () => endpointConfig.urlParser(context.endpointV2.url) : endpointConfig.endpoint; - if (!endpoint) { - throw new Error("No valid endpoint provider available."); - } - const request = await serializer(args.input, { ...options, endpoint }); - return next({ - ...args, - request - }); -}, "serializerMiddleware"); - -// src/serdePlugin.ts -var deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true -}; -var serializerMiddlewareOption = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true -}; -function getSerdePlugin(config, serializer, deserializer) { - return { - applyToStack: (commandStack) => { - commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); - commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption); - } - }; -} -__name(getSerdePlugin, "getSerdePlugin"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 44297: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - loadConfig: () => loadConfig -}); -module.exports = __toCommonJS(src_exports); - -// src/configLoader.ts - - -// src/fromEnv.ts -var import_property_provider = __nccwpck_require__(57745); - -// src/getSelectorName.ts -function getSelectorName(functionString) { - try { - const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); - constants.delete("CONFIG"); - constants.delete("CONFIG_PREFIX_SEPARATOR"); - constants.delete("ENV"); - return [...constants].join(", "); - } catch (e) { - return functionString; - } -} -__name(getSelectorName, "getSelectorName"); - -// src/fromEnv.ts -var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { - try { - const config = envVarSelector(process.env, options); - if (config === void 0) { - throw new Error(); - } - return config; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, - { logger: options?.logger } - ); - } -}, "fromEnv"); - -// src/fromSharedConfigFiles.ts - -var import_shared_ini_file_loader = __nccwpck_require__(80213); -var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, import_shared_ini_file_loader.getProfileName)(init); - const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; - try { - const cfgFile = preferredFile === "config" ? configFile : credentialsFile; - const configValue = configSelector(mergedProfile, cfgFile); - if (configValue === void 0) { - throw new Error(); - } - return configValue; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, - { logger: init.logger } - ); - } -}, "fromSharedConfigFiles"); - -// src/fromStatic.ts - -var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); -var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); - -// src/configLoader.ts -var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { - const { signingName, logger } = configuration; - const envOptions = { signingName, logger }; - return (0, import_property_provider.memoize)( - (0, import_property_provider.chain)( - fromEnv(environmentVariableSelector, envOptions), - fromSharedConfigFiles(configFileSelector, configuration), - fromStatic(defaultValue) - ) - ); -}, "loadConfig"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 11176: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, - NodeHttp2Handler: () => NodeHttp2Handler, - NodeHttpHandler: () => NodeHttpHandler, - streamCollector: () => streamCollector -}); -module.exports = __toCommonJS(src_exports); - -// src/node-http-handler.ts -var import_protocol_http = __nccwpck_require__(5559); -var import_querystring_builder = __nccwpck_require__(75547); -var import_http = __nccwpck_require__(58611); -var import_https = __nccwpck_require__(65692); - -// src/constants.ts -var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; - -// src/get-transformed-headers.ts -var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { - const transformedHeaders = {}; - for (const name of Object.keys(headers)) { - const headerValues = headers[name]; - transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; - } - return transformedHeaders; -}, "getTransformedHeaders"); - -// src/timing.ts -var timing = { - setTimeout: (cb, ms) => setTimeout(cb, ms), - clearTimeout: (timeoutId) => clearTimeout(timeoutId) -}; - -// src/set-connection-timeout.ts -var DEFER_EVENT_LISTENER_TIME = 1e3; -var setConnectionTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { - if (!timeoutInMs) { - return -1; - } - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeoutId = timing.setTimeout(() => { - request.destroy(); - reject( - Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { - name: "TimeoutError" - }) - ); - }, timeoutInMs - offset); - const doWithSocket = /* @__PURE__ */ __name((socket) => { - if (socket?.connecting) { - socket.on("connect", () => { - timing.clearTimeout(timeoutId); - }); - } else { - timing.clearTimeout(timeoutId); - } - }, "doWithSocket"); - if (request.socket) { - doWithSocket(request.socket); - } else { - request.on("socket", doWithSocket); - } - }, "registerTimeout"); - if (timeoutInMs < 2e3) { - registerTimeout(0); - return 0; - } - return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); -}, "setConnectionTimeout"); - -// src/set-socket-keep-alive.ts -var DEFER_EVENT_LISTENER_TIME2 = 3e3; -var setSocketKeepAlive = /* @__PURE__ */ __name((request, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { - if (keepAlive !== true) { - return -1; - } - const registerListener = /* @__PURE__ */ __name(() => { - if (request.socket) { - request.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - } else { - request.on("socket", (socket) => { - socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - }); - } - }, "registerListener"); - if (deferTimeMs === 0) { - registerListener(); - return 0; - } - return timing.setTimeout(registerListener, deferTimeMs); -}, "setSocketKeepAlive"); - -// src/set-socket-timeout.ts -var DEFER_EVENT_LISTENER_TIME3 = 3e3; -var setSocketTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = DEFAULT_REQUEST_TIMEOUT) => { - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeout = timeoutInMs - offset; - const onTimeout = /* @__PURE__ */ __name(() => { - request.destroy(); - reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); - }, "onTimeout"); - if (request.socket) { - request.socket.setTimeout(timeout, onTimeout); - request.on("close", () => request.socket?.removeListener("timeout", onTimeout)); - } else { - request.setTimeout(timeout, onTimeout); - } - }, "registerTimeout"); - if (0 < timeoutInMs && timeoutInMs < 6e3) { - registerTimeout(0); - return 0; - } - return timing.setTimeout( - registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), - DEFER_EVENT_LISTENER_TIME3 - ); -}, "setSocketTimeout"); - -// src/write-request-body.ts -var import_stream = __nccwpck_require__(2203); -var MIN_WAIT_TIME = 6e3; -async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { - const headers = request.headers ?? {}; - const expect = headers["Expect"] || headers["expect"]; - let timeoutId = -1; - let sendBody = true; - if (expect === "100-continue") { - sendBody = await Promise.race([ - new Promise((resolve) => { - timeoutId = Number(timing.setTimeout(() => resolve(true), Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); - }), - new Promise((resolve) => { - httpRequest.on("continue", () => { - timing.clearTimeout(timeoutId); - resolve(true); - }); - httpRequest.on("response", () => { - timing.clearTimeout(timeoutId); - resolve(false); - }); - httpRequest.on("error", () => { - timing.clearTimeout(timeoutId); - resolve(false); - }); - }) - ]); - } - if (sendBody) { - writeBody(httpRequest, request.body); - } -} -__name(writeRequestBody, "writeRequestBody"); -function writeBody(httpRequest, body) { - if (body instanceof import_stream.Readable) { - body.pipe(httpRequest); - return; - } - if (body) { - if (Buffer.isBuffer(body) || typeof body === "string") { - httpRequest.end(body); - return; - } - const uint8 = body; - if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { - httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); - return; - } - httpRequest.end(Buffer.from(body)); - return; - } - httpRequest.end(); -} -__name(writeBody, "writeBody"); - -// src/node-http-handler.ts -var DEFAULT_REQUEST_TIMEOUT = 0; -var NodeHttpHandler = class _NodeHttpHandler { - constructor(options) { - this.socketWarningTimestamp = 0; - // Node http handler is hard-coded to http/1.1: https://github.com/nodejs/node/blob/ff5664b83b89c55e4ab5d5f60068fb457f1f5872/lib/_http_server.js#L286 - this.metadata = { handlerProtocol: "http/1.1" }; - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((_options) => { - resolve(this.resolveDefaultConfig(_options)); - }).catch(reject); - } else { - resolve(this.resolveDefaultConfig(options)); - } - }); - } - static { - __name(this, "NodeHttpHandler"); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof instanceOrOptions?.handle === "function") { - return instanceOrOptions; - } - return new _NodeHttpHandler(instanceOrOptions); - } - /** - * @internal - * - * @param agent - http(s) agent in use by the NodeHttpHandler instance. - * @param socketWarningTimestamp - last socket usage check timestamp. - * @param logger - channel for the warning. - * @returns timestamp of last emitted warning. - */ - static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { - const { sockets, requests, maxSockets } = agent; - if (typeof maxSockets !== "number" || maxSockets === Infinity) { - return socketWarningTimestamp; - } - const interval = 15e3; - if (Date.now() - interval < socketWarningTimestamp) { - return socketWarningTimestamp; - } - if (sockets && requests) { - for (const origin in sockets) { - const socketsInUse = sockets[origin]?.length ?? 0; - const requestsEnqueued = requests[origin]?.length ?? 0; - if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { - logger?.warn?.( - `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. -See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html -or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` - ); - return Date.now(); - } - } - } - return socketWarningTimestamp; - } - resolveDefaultConfig(options) { - const { requestTimeout, connectionTimeout, socketTimeout, socketAcquisitionWarningTimeout, httpAgent, httpsAgent } = options || {}; - const keepAlive = true; - const maxSockets = 50; - return { - connectionTimeout, - requestTimeout: requestTimeout ?? socketTimeout, - socketAcquisitionWarningTimeout, - httpAgent: (() => { - if (httpAgent instanceof import_http.Agent || typeof httpAgent?.destroy === "function") { - return httpAgent; - } - return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); - })(), - httpsAgent: (() => { - if (httpsAgent instanceof import_https.Agent || typeof httpsAgent?.destroy === "function") { - return httpsAgent; - } - return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); - })(), - logger: console - }; - } - destroy() { - this.config?.httpAgent?.destroy(); - this.config?.httpsAgent?.destroy(); - } - async handle(request, { abortSignal, requestTimeout } = {}) { - if (!this.config) { - this.config = await this.configProvider; - } - return new Promise((_resolve, _reject) => { - let writeRequestBodyPromise = void 0; - const timeouts = []; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(timing.clearTimeout); - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(timing.clearTimeout); - _reject(arg); - }, "reject"); - if (!this.config) { - throw new Error("Node HTTP request handler config is not resolved"); - } - if (abortSignal?.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const isSSL = request.protocol === "https:"; - const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; - timeouts.push( - timing.setTimeout( - () => { - this.socketWarningTimestamp = _NodeHttpHandler.checkSocketUsage( - agent, - this.socketWarningTimestamp, - this.config.logger - ); - }, - this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) - ) - ); - const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); - let auth = void 0; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}`; - } - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - let hostname = request.hostname ?? ""; - if (hostname[0] === "[" && hostname.endsWith("]")) { - hostname = request.hostname.slice(1, -1); - } else { - hostname = request.hostname; - } - const nodeHttpsOptions = { - headers: request.headers, - host: hostname, - method: request.method, - path, - port: request.port, - agent, - auth - }; - const requestFunc = isSSL ? import_https.request : import_http.request; - const req = requestFunc(nodeHttpsOptions, (res) => { - const httpResponse = new import_protocol_http.HttpResponse({ - statusCode: res.statusCode || -1, - reason: res.statusMessage, - headers: getTransformedHeaders(res.headers), - body: res - }); - resolve({ response: httpResponse }); - }); - req.on("error", (err) => { - if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { - reject(Object.assign(err, { name: "TimeoutError" })); - } else { - reject(err); - } - }); - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.destroy(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; - } - } - const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; - timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); - const httpAgent = nodeHttpsOptions.agent; - if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { - timeouts.push( - setSocketKeepAlive(req, { - // @ts-expect-error keepAlive is not public on httpAgent. - keepAlive: httpAgent.keepAlive, - // @ts-expect-error keepAliveMsecs is not public on httpAgent. - keepAliveMsecs: httpAgent.keepAliveMsecs - }) - ); - } - writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { - timeouts.forEach(timing.clearTimeout); - return _reject(e); - }); - }); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } -}; - -// src/node-http2-handler.ts - - -var import_http22 = __nccwpck_require__(85675); - -// src/node-http2-connection-manager.ts -var import_http2 = __toESM(__nccwpck_require__(85675)); - -// src/node-http2-connection-pool.ts -var NodeHttp2ConnectionPool = class { - constructor(sessions) { - this.sessions = []; - this.sessions = sessions ?? []; - } - static { - __name(this, "NodeHttp2ConnectionPool"); - } - poll() { - if (this.sessions.length > 0) { - return this.sessions.shift(); - } - } - offerLast(session) { - this.sessions.push(session); - } - contains(session) { - return this.sessions.includes(session); - } - remove(session) { - this.sessions = this.sessions.filter((s) => s !== session); - } - [Symbol.iterator]() { - return this.sessions[Symbol.iterator](); - } - destroy(connection) { - for (const session of this.sessions) { - if (session === connection) { - if (!session.destroyed) { - session.destroy(); - } - } - } - } -}; - -// src/node-http2-connection-manager.ts -var NodeHttp2ConnectionManager = class { - constructor(config) { - this.sessionCache = /* @__PURE__ */ new Map(); - this.config = config; - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrency must be greater than zero."); - } - } - static { - __name(this, "NodeHttp2ConnectionManager"); - } - lease(requestContext, connectionConfiguration) { - const url = this.getUrlString(requestContext); - const existingPool = this.sessionCache.get(url); - if (existingPool) { - const existingSession = existingPool.poll(); - if (existingSession && !this.config.disableConcurrency) { - return existingSession; - } - } - const session = import_http2.default.connect(url); - if (this.config.maxConcurrency) { - session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { - if (err) { - throw new Error( - "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() - ); - } - }); - } - session.unref(); - const destroySessionCb = /* @__PURE__ */ __name(() => { - session.destroy(); - this.deleteSession(url, session); - }, "destroySessionCb"); - session.on("goaway", destroySessionCb); - session.on("error", destroySessionCb); - session.on("frameError", destroySessionCb); - session.on("close", () => this.deleteSession(url, session)); - if (connectionConfiguration.requestTimeout) { - session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); - } - const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); - connectionPool.offerLast(session); - this.sessionCache.set(url, connectionPool); - return session; - } - /** - * Delete a session from the connection pool. - * @param authority The authority of the session to delete. - * @param session The session to delete. - */ - deleteSession(authority, session) { - const existingConnectionPool = this.sessionCache.get(authority); - if (!existingConnectionPool) { - return; - } - if (!existingConnectionPool.contains(session)) { - return; - } - existingConnectionPool.remove(session); - this.sessionCache.set(authority, existingConnectionPool); - } - release(requestContext, session) { - const cacheKey = this.getUrlString(requestContext); - this.sessionCache.get(cacheKey)?.offerLast(session); - } - destroy() { - for (const [key, connectionPool] of this.sessionCache) { - for (const session of connectionPool) { - if (!session.destroyed) { - session.destroy(); - } - connectionPool.remove(session); - } - this.sessionCache.delete(key); - } - } - setMaxConcurrentStreams(maxConcurrentStreams) { - if (maxConcurrentStreams && maxConcurrentStreams <= 0) { - throw new RangeError("maxConcurrentStreams must be greater than zero."); - } - this.config.maxConcurrency = maxConcurrentStreams; - } - setDisableConcurrentStreams(disableConcurrentStreams) { - this.config.disableConcurrency = disableConcurrentStreams; - } - getUrlString(request) { - return request.destination.toString(); - } -}; - -// src/node-http2-handler.ts -var NodeHttp2Handler = class _NodeHttp2Handler { - constructor(options) { - this.metadata = { handlerProtocol: "h2" }; - this.connectionManager = new NodeHttp2ConnectionManager({}); - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((opts) => { - resolve(opts || {}); - }).catch(reject); - } else { - resolve(options || {}); - } - }); - } - static { - __name(this, "NodeHttp2Handler"); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof instanceOrOptions?.handle === "function") { - return instanceOrOptions; - } - return new _NodeHttp2Handler(instanceOrOptions); - } - destroy() { - this.connectionManager.destroy(); - } - async handle(request, { abortSignal, requestTimeout } = {}) { - if (!this.config) { - this.config = await this.configProvider; - this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); - if (this.config.maxConcurrentStreams) { - this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); - } - } - const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; - const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; - return new Promise((_resolve, _reject) => { - let fulfilled = false; - let writeRequestBodyPromise = void 0; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _reject(arg); - }, "reject"); - if (abortSignal?.aborted) { - fulfilled = true; - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const { hostname, method, port, protocol, query } = request; - let auth = ""; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}@`; - } - const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; - const requestContext = { destination: new URL(authority) }; - const session = this.connectionManager.lease(requestContext, { - requestTimeout: this.config?.sessionTimeout, - disableConcurrentStreams: disableConcurrentStreams || false - }); - const rejectWithDestroy = /* @__PURE__ */ __name((err) => { - if (disableConcurrentStreams) { - this.destroySession(session); - } - fulfilled = true; - reject(err); - }, "rejectWithDestroy"); - const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - const req = session.request({ - ...request.headers, - [import_http22.constants.HTTP2_HEADER_PATH]: path, - [import_http22.constants.HTTP2_HEADER_METHOD]: method - }); - session.ref(); - req.on("response", (headers) => { - const httpResponse = new import_protocol_http.HttpResponse({ - statusCode: headers[":status"] || -1, - headers: getTransformedHeaders(headers), - body: req - }); - fulfilled = true; - resolve({ response: httpResponse }); - if (disableConcurrentStreams) { - session.close(); - this.connectionManager.deleteSession(authority, session); - } - }); - if (effectiveRequestTimeout) { - req.setTimeout(effectiveRequestTimeout, () => { - req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); - timeoutError.name = "TimeoutError"; - rejectWithDestroy(timeoutError); - }); - } - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.close(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - rejectWithDestroy(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; - } - } - req.on("frameError", (type, code, id) => { - rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); - }); - req.on("error", rejectWithDestroy); - req.on("aborted", () => { - rejectWithDestroy( - new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) - ); - }); - req.on("close", () => { - session.unref(); - if (disableConcurrentStreams) { - session.destroy(); - } - if (!fulfilled) { - rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); - } - }); - writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); - }); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } - /** - * Destroys a session. - * @param session - the session to destroy. - */ - destroySession(session) { - if (!session.destroyed) { - session.destroy(); - } - } -}; - -// src/stream-collector/collector.ts - -var Collector = class extends import_stream.Writable { - constructor() { - super(...arguments); - this.bufferedBytes = []; - } - static { - __name(this, "Collector"); - } - _write(chunk, encoding, callback) { - this.bufferedBytes.push(chunk); - callback(); - } -}; - -// src/stream-collector/index.ts -var streamCollector = /* @__PURE__ */ __name((stream) => { - if (isReadableStreamInstance(stream)) { - return collectReadableStream(stream); - } - return new Promise((resolve, reject) => { - const collector = new Collector(); - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function() { - const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); - resolve(bytes); - }); - }); -}, "streamCollector"); -var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); -async function collectReadableStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; - } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; - } - return collected; -} -__name(collectReadableStream, "collectReadableStream"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 57745: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize -}); -module.exports = __toCommonJS(src_exports); - -// src/ProviderError.ts -var ProviderError = class _ProviderError extends Error { - constructor(message, options = true) { - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; - } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError.prototype); - logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); - } - static { - __name(this, "ProviderError"); - } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); - } -}; - -// src/CredentialsProviderError.ts -var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError.prototype); - } - static { - __name(this, "CredentialsProviderError"); - } -}; - -// src/TokenProviderError.ts -var TokenProviderError = class _TokenProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError.prototype); - } - static { - __name(this, "TokenProviderError"); - } -}; - -// src/chain.ts -var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError("No providers in chain"); - } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err?.tryNextLink) { - continue; - } - throw err; - } - } - throw lastProviderError; -}, "chain"); - -// src/fromStatic.ts -var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); - -// src/memoize.ts -var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - if (isConstant) { - return resolved; - } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; - } - return resolved; - }; -}, "memoize"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 5559: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - Field: () => Field, - Fields: () => Fields, - HttpRequest: () => HttpRequest, - HttpResponse: () => HttpResponse, - IHttpRequest: () => import_types.HttpRequest, - getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, - isValidHostname: () => isValidHostname, - resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig -}); -module.exports = __toCommonJS(src_exports); - -// src/extensions/httpExtensionConfiguration.ts -var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - setHttpHandler(handler) { - runtimeConfig.httpHandler = handler; - }, - httpHandler() { - return runtimeConfig.httpHandler; - }, - updateHttpClientConfig(key, value) { - runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); - }, - httpHandlerConfigs() { - return runtimeConfig.httpHandler.httpHandlerConfigs(); - } - }; -}, "getHttpHandlerExtensionConfiguration"); -var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { - return { - httpHandler: httpHandlerExtensionConfiguration.httpHandler() - }; -}, "resolveHttpHandlerRuntimeConfig"); - -// src/Field.ts -var import_types = __nccwpck_require__(20873); -var Field = class { - static { - __name(this, "Field"); - } - constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - /** - * Appends a value to the field. - * - * @param value The value to append. - */ - add(value) { - this.values.push(value); - } - /** - * Overwrite existing field values. - * - * @param values The new field values. - */ - set(values) { - this.values = values; - } - /** - * Remove all matching entries from list. - * - * @param value Value to remove. - */ - remove(value) { - this.values = this.values.filter((v) => v !== value); - } - /** - * Get comma-delimited string. - * - * @returns String representation of {@link Field}. - */ - toString() { - return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); - } - /** - * Get string values as a list - * - * @returns Values in {@link Field} as a list. - */ - get() { - return this.values; - } -}; - -// src/Fields.ts -var Fields = class { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - static { - __name(this, "Fields"); - } - /** - * Set entry for a {@link Field} name. The `name` - * attribute will be used to key the collection. - * - * @param field The {@link Field} to set. - */ - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - /** - * Retrieve {@link Field} entry by name. - * - * @param name The name of the {@link Field} entry - * to retrieve - * @returns The {@link Field} if it exists. - */ - getField(name) { - return this.entries[name.toLowerCase()]; - } - /** - * Delete entry from collection. - * - * @param name Name of the entry to delete. - */ - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - /** - * Helper function for retrieving specific types of fields. - * Used to grab all headers or all trailers. - * - * @param kind {@link FieldPosition} of entries to retrieve. - * @returns The {@link Field} entries with the specified - * {@link FieldPosition}. - */ - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } -}; - -// src/httpRequest.ts - -var HttpRequest = class _HttpRequest { - static { - __name(this, "HttpRequest"); - } - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; - this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; - } - /** - * Note: this does not deep-clone the body. - */ - static clone(request) { - const cloned = new _HttpRequest({ - ...request, - headers: { ...request.headers } - }); - if (cloned.query) { - cloned.query = cloneQuery(cloned.query); - } - return cloned; - } - /** - * This method only actually asserts that request is the interface {@link IHttpRequest}, - * and not necessarily this concrete class. Left in place for API stability. - * - * Do not call instance methods on the input of this function, and - * do not assume it has the HttpRequest prototype. - */ - static isInstance(request) { - if (!request) { - return false; - } - const req = request; - return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; - } - /** - * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call - * this method because {@link HttpRequest.isInstance} incorrectly - * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). - */ - clone() { - return _HttpRequest.clone(this); - } -}; -function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param - }; - }, {}); -} -__name(cloneQuery, "cloneQuery"); - -// src/httpResponse.ts -var HttpResponse = class { - static { - __name(this, "HttpResponse"); - } - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; - } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; - } -}; - -// src/isValidHostname.ts -function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); -} -__name(isValidHostname, "isValidHostname"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 75547: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - buildQueryString: () => buildQueryString -}); -module.exports = __toCommonJS(src_exports); -var import_util_uri_escape = __nccwpck_require__(5821); -function buildQueryString(query) { - const parts = []; - for (let key of Object.keys(query).sort()) { - const value = query[key]; - key = (0, import_util_uri_escape.escapeUri)(key); - if (Array.isArray(value)) { - for (let i = 0, iLen = value.length; i < iLen; i++) { - parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); - } - } else { - let qsEntry = key; - if (value || typeof value === "string") { - qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; - } - parts.push(qsEntry); - } - } - return parts.join("&"); -} -__name(buildQueryString, "buildQueryString"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 955: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - parseQueryString: () => parseQueryString -}); -module.exports = __toCommonJS(src_exports); -function parseQueryString(querystring) { - const query = {}; - querystring = querystring.replace(/^\?/, ""); - if (querystring) { - for (const pair of querystring.split("&")) { - let [key, value = null] = pair.split("="); - key = decodeURIComponent(key); - if (value) { - value = decodeURIComponent(value); - } - if (!(key in query)) { - query[key] = value; - } else if (Array.isArray(query[key])) { - query[key].push(value); - } else { - query[key] = [query[key], value]; - } - } - } - return query; -} -__name(parseQueryString, "parseQueryString"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 93715: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getHomeDir = void 0; -const os_1 = __nccwpck_require__(70857); -const path_1 = __nccwpck_require__(16928); -const homeDirCache = {}; -const getHomeDirCacheKey = () => { - if (process && process.geteuid) { - return `${process.geteuid()}`; - } - return "DEFAULT"; -}; -const getHomeDir = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - const homeDirCacheKey = getHomeDirCacheKey(); - if (!homeDirCache[homeDirCacheKey]) - homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); - return homeDirCache[homeDirCacheKey]; -}; -exports.getHomeDir = getHomeDir; - - -/***/ }), - -/***/ 28224: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFilepath = void 0; -const crypto_1 = __nccwpck_require__(76982); -const path_1 = __nccwpck_require__(16928); -const getHomeDir_1 = __nccwpck_require__(93715); -const getSSOTokenFilepath = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); -}; -exports.getSSOTokenFilepath = getSSOTokenFilepath; - - -/***/ }), - -/***/ 54375: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFromFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const getSSOTokenFilepath_1 = __nccwpck_require__(28224); -const { readFile } = fs_1.promises; -const getSSOTokenFromFile = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); -}; -exports.getSSOTokenFromFile = getSSOTokenFromFile; - - -/***/ }), - -/***/ 80213: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - getProfileName: () => getProfileName, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles -}); -module.exports = __toCommonJS(src_exports); -__reExport(src_exports, __nccwpck_require__(93715), module.exports); - -// src/getProfileName.ts -var ENV_PROFILE = "AWS_PROFILE"; -var DEFAULT_PROFILE = "default"; -var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); - -// src/index.ts -__reExport(src_exports, __nccwpck_require__(28224), module.exports); -__reExport(src_exports, __nccwpck_require__(54375), module.exports); - -// src/loadSharedConfigFiles.ts - - -// src/getConfigData.ts -var import_types = __nccwpck_require__(20873); -var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; - } - return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); -}).reduce( - (acc, [key, value]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; - acc[updatedKey] = value; - return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } - } -), "getConfigData"); - -// src/getConfigFilepath.ts -var import_path = __nccwpck_require__(16928); -var import_getHomeDir = __nccwpck_require__(93715); -var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; -var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); - -// src/getCredentialsFilepath.ts - -var import_getHomeDir2 = __nccwpck_require__(93715); -var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; -var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); - -// src/loadSharedConfigFiles.ts -var import_getHomeDir3 = __nccwpck_require__(93715); - -// src/parseIni.ts - -var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; -var profileNameBlockList = ["__proto__", "profile __proto__"]; -var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); - } - } else { - currentSection = sectionName; - } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); - } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; - } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; - } - } - } - } - return map; -}, "parseIni"); - -// src/loadSharedConfigFiles.ts -var import_slurpFile = __nccwpck_require__(96231); -var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var CONFIG_PREFIX_SEPARATOR = "."; -var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); - } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); - } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; -}, "loadSharedConfigFiles"); - -// src/getSsoSessionData.ts - -var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); - -// src/loadSsoSessionData.ts -var import_slurpFile2 = __nccwpck_require__(96231); -var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); - -// src/mergeConfigFiles.ts -var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); - } else { - merged[key] = values; - } - } - } - return merged; -}, "mergeConfigFiles"); - -// src/parseKnownFiles.ts -var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); -}, "parseKnownFiles"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 96231: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.slurpFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const { readFile } = fs_1.promises; -const filePromisesHash = {}; -const slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); - } - return filePromisesHash[path]; -}; -exports.slurpFile = slurpFile; - - -/***/ }), - -/***/ 20873: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - AlgorithmId: () => AlgorithmId, - EndpointURLScheme: () => EndpointURLScheme, - FieldPosition: () => FieldPosition, - HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, - HttpAuthLocation: () => HttpAuthLocation, - IniSectionType: () => IniSectionType, - RequestHandlerProtocol: () => RequestHandlerProtocol, - SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig -}); -module.exports = __toCommonJS(src_exports); - -// src/auth/auth.ts -var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { - HttpAuthLocation2["HEADER"] = "header"; - HttpAuthLocation2["QUERY"] = "query"; - return HttpAuthLocation2; -})(HttpAuthLocation || {}); - -// src/auth/HttpApiKeyAuth.ts -var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { - HttpApiKeyAuthLocation2["HEADER"] = "header"; - HttpApiKeyAuthLocation2["QUERY"] = "query"; - return HttpApiKeyAuthLocation2; -})(HttpApiKeyAuthLocation || {}); - -// src/endpoint.ts -var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { - EndpointURLScheme2["HTTP"] = "http"; - EndpointURLScheme2["HTTPS"] = "https"; - return EndpointURLScheme2; -})(EndpointURLScheme || {}); - -// src/extensions/checksum.ts -var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { - AlgorithmId2["MD5"] = "md5"; - AlgorithmId2["CRC32"] = "crc32"; - AlgorithmId2["CRC32C"] = "crc32c"; - AlgorithmId2["SHA1"] = "sha1"; - AlgorithmId2["SHA256"] = "sha256"; - return AlgorithmId2; -})(AlgorithmId || {}); -var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const checksumAlgorithms = []; - if (runtimeConfig.sha256 !== void 0) { - checksumAlgorithms.push({ - algorithmId: () => "sha256" /* SHA256 */, - checksumConstructor: () => runtimeConfig.sha256 - }); - } - if (runtimeConfig.md5 != void 0) { - checksumAlgorithms.push({ - algorithmId: () => "md5" /* MD5 */, - checksumConstructor: () => runtimeConfig.md5 - }); - } - return { - addChecksumAlgorithm(algo) { - checksumAlgorithms.push(algo); - }, - checksumAlgorithms() { - return checksumAlgorithms; - } - }; -}, "getChecksumConfiguration"); -var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { - const runtimeConfig = {}; - clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { - runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); - }); - return runtimeConfig; -}, "resolveChecksumRuntimeConfig"); - -// src/extensions/defaultClientConfiguration.ts -var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return getChecksumConfiguration(runtimeConfig); -}, "getDefaultClientConfiguration"); -var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return resolveChecksumRuntimeConfig(config); -}, "resolveDefaultRuntimeConfig"); - -// src/http.ts -var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { - FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; - FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; - return FieldPosition2; -})(FieldPosition || {}); - -// src/middleware.ts -var SMITHY_CONTEXT_KEY = "__smithy_context"; - -// src/profile.ts -var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { - IniSectionType2["PROFILE"] = "profile"; - IniSectionType2["SSO_SESSION"] = "sso-session"; - IniSectionType2["SERVICES"] = "services"; - return IniSectionType2; -})(IniSectionType || {}); - -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 81983: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - parseUrl: () => parseUrl -}); -module.exports = __toCommonJS(src_exports); -var import_querystring_parser = __nccwpck_require__(955); -var parseUrl = /* @__PURE__ */ __name((url) => { - if (typeof url === "string") { - return parseUrl(new URL(url)); - } - const { hostname, pathname, port, protocol, search } = url; - let query; - if (search) { - query = (0, import_querystring_parser.parseQueryString)(search); - } - return { - hostname, - port: port ? parseInt(port) : void 0, - protocol, - path: pathname, - query - }; -}, "parseUrl"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 17963: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromBase64 = void 0; -const util_buffer_from_1 = __nccwpck_require__(63718); -const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; -const fromBase64 = (input) => { - if ((input.length * 3) % 4 !== 0) { - throw new TypeError(`Incorrect padding on base64 string.`); - } - if (!BASE64_REGEX.exec(input)) { - throw new TypeError(`Invalid base64 string.`); - } - const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); - return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); -}; -exports.fromBase64 = fromBase64; - - -/***/ }), - -/***/ 26262: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -module.exports = __toCommonJS(src_exports); -__reExport(src_exports, __nccwpck_require__(17963), module.exports); -__reExport(src_exports, __nccwpck_require__(26078), module.exports); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 26078: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toBase64 = void 0; -const util_buffer_from_1 = __nccwpck_require__(63718); -const util_utf8_1 = __nccwpck_require__(21038); -const toBase64 = (_input) => { - let input; - if (typeof _input === "string") { - input = (0, util_utf8_1.fromUtf8)(_input); - } - else { - input = _input; - } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); - } - return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); -}; -exports.toBase64 = toBase64; - - -/***/ }), - -/***/ 60103: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - calculateBodyLength: () => calculateBodyLength -}); -module.exports = __toCommonJS(src_exports); - -// src/calculateBodyLength.ts -var TEXT_ENCODER = typeof TextEncoder == "function" ? new TextEncoder() : null; -var calculateBodyLength = /* @__PURE__ */ __name((body) => { - if (typeof body === "string") { - if (TEXT_ENCODER) { - return TEXT_ENCODER.encode(body).byteLength; - } - let len = body.length; - for (let i = len - 1; i >= 0; i--) { - const code = body.charCodeAt(i); - if (code > 127 && code <= 2047) - len++; - else if (code > 2047 && code <= 65535) - len += 2; - if (code >= 56320 && code <= 57343) - i--; - } - return len; - } else if (typeof body.byteLength === "number") { - return body.byteLength; - } else if (typeof body.size === "number") { - return body.size; - } - throw new Error(`Body Length computation failed for ${body}`); -}, "calculateBodyLength"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 63718: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - fromArrayBuffer: () => fromArrayBuffer, - fromString: () => fromString -}); -module.exports = __toCommonJS(src_exports); -var import_is_array_buffer = __nccwpck_require__(95697); -var import_buffer = __nccwpck_require__(20181); -var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { - if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { - throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); - } - return import_buffer.Buffer.from(input, offset, length); -}, "fromArrayBuffer"); -var fromString = /* @__PURE__ */ __name((input, encoding) => { - if (typeof input !== "string") { - throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); - } - return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); -}, "fromString"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 27896: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - fromHex: () => fromHex, - toHex: () => toHex -}); -module.exports = __toCommonJS(src_exports); -var SHORT_TO_HEX = {}; -var HEX_TO_SHORT = {}; -for (let i = 0; i < 256; i++) { - let encodedByte = i.toString(16).toLowerCase(); - if (encodedByte.length === 1) { - encodedByte = `0${encodedByte}`; - } - SHORT_TO_HEX[i] = encodedByte; - HEX_TO_SHORT[encodedByte] = i; -} -function fromHex(encoded) { - if (encoded.length % 2 !== 0) { - throw new Error("Hex encoded strings must have an even number length"); - } - const out = new Uint8Array(encoded.length / 2); - for (let i = 0; i < encoded.length; i += 2) { - const encodedByte = encoded.slice(i, i + 2).toLowerCase(); - if (encodedByte in HEX_TO_SHORT) { - out[i / 2] = HEX_TO_SHORT[encodedByte]; - } else { - throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); - } - } - return out; -} -__name(fromHex, "fromHex"); -function toHex(bytes) { - let out = ""; - for (let i = 0; i < bytes.byteLength; i++) { - out += SHORT_TO_HEX[bytes[i]]; - } - return out; -} -__name(toHex, "toHex"); -// Annotate the CommonJS export names for ESM import in node: + return out; +} +__name(toHex, "toHex"); +// Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -25035,7 +16900,9 @@ __export(index_exports, { DeleteTaskDefinitionsCommand: () => DeleteTaskDefinitionsCommand, DeleteTaskSetCommand: () => DeleteTaskSetCommand, DeploymentControllerType: () => DeploymentControllerType, + DeploymentLifecycleHookStage: () => DeploymentLifecycleHookStage, DeploymentRolloutState: () => DeploymentRolloutState, + DeploymentStrategy: () => DeploymentStrategy, DeregisterContainerInstanceCommand: () => DeregisterContainerInstanceCommand, DeregisterTaskDefinitionCommand: () => DeregisterTaskDefinitionCommand, DescribeCapacityProvidersCommand: () => DescribeCapacityProvidersCommand, @@ -25112,6 +16979,7 @@ __export(index_exports, { SchedulingStrategy: () => SchedulingStrategy, Scope: () => Scope, ServerException: () => ServerException, + ServiceDeploymentLifecycleStage: () => ServiceDeploymentLifecycleStage, ServiceDeploymentNotFoundException: () => ServiceDeploymentNotFoundException, ServiceDeploymentRollbackMonitorsStatus: () => ServiceDeploymentRollbackMonitorsStatus, ServiceDeploymentStatus: () => ServiceDeploymentStatus, @@ -25539,6 +17407,19 @@ var AvailabilityZoneRebalancing = { DISABLED: "DISABLED", ENABLED: "ENABLED" }; +var DeploymentLifecycleHookStage = { + POST_PRODUCTION_TRAFFIC_SHIFT: "POST_PRODUCTION_TRAFFIC_SHIFT", + POST_SCALE_UP: "POST_SCALE_UP", + POST_TEST_TRAFFIC_SHIFT: "POST_TEST_TRAFFIC_SHIFT", + PRE_SCALE_UP: "PRE_SCALE_UP", + PRODUCTION_TRAFFIC_SHIFT: "PRODUCTION_TRAFFIC_SHIFT", + RECONCILE_SERVICE: "RECONCILE_SERVICE", + TEST_TRAFFIC_SHIFT: "TEST_TRAFFIC_SHIFT" +}; +var DeploymentStrategy = { + BLUE_GREEN: "BLUE_GREEN", + ROLLING: "ROLLING" +}; var DeploymentControllerType = { CODE_DEPLOY: "CODE_DEPLOY", ECS: "ECS", @@ -25941,6 +17822,18 @@ var ServiceDeploymentRollbackMonitorsStatus = { MONITORING_COMPLETE: "MONITORING_COMPLETE", TRIGGERED: "TRIGGERED" }; +var ServiceDeploymentLifecycleStage = { + BAKE_TIME: "BAKE_TIME", + CLEAN_UP: "CLEAN_UP", + POST_PRODUCTION_TRAFFIC_SHIFT: "POST_PRODUCTION_TRAFFIC_SHIFT", + POST_SCALE_UP: "POST_SCALE_UP", + POST_TEST_TRAFFIC_SHIFT: "POST_TEST_TRAFFIC_SHIFT", + PRE_SCALE_UP: "PRE_SCALE_UP", + PRODUCTION_TRAFFIC_SHIFT: "PRODUCTION_TRAFFIC_SHIFT", + RECONCILE_SERVICE: "RECONCILE_SERVICE", + SCALE_UP: "SCALE_UP", + TEST_TRAFFIC_SHIFT: "TEST_TRAFFIC_SHIFT" +}; var ServiceDeploymentStatus = { IN_PROGRESS: "IN_PROGRESS", PENDING: "PENDING", @@ -28098,6 +19991,7 @@ var de_ServiceDeployment = /* @__PURE__ */ __name((output, context) => { deploymentCircuitBreaker: import_smithy_client._json, deploymentConfiguration: import_smithy_client._json, finishedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "finishedAt"), + lifecycleStage: import_smithy_client.expectString, rollback: /* @__PURE__ */ __name((_) => de_Rollback(_, context), "rollback"), serviceArn: import_smithy_client.expectString, serviceDeploymentArn: import_smithy_client.expectString, @@ -28161,6 +20055,7 @@ var de_ServiceRevision = /* @__PURE__ */ __name((output, context) => { networkConfiguration: import_smithy_client._json, platformFamily: import_smithy_client.expectString, platformVersion: import_smithy_client.expectString, + resolvedConfiguration: import_smithy_client._json, serviceArn: import_smithy_client.expectString, serviceConnectConfiguration: import_smithy_client._json, serviceRegistries: import_smithy_client._json, @@ -30398,7 +22293,10 @@ var HttpProtocol = class { // src/submodules/protocols/HttpBindingProtocol.ts var HttpBindingProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, input, context) { + async serializeRequest(operationSchema, _input, context) { + const input = { + ..._input ?? {} + }; const serializer = this.serializer; const query = {}; const headers = {}; @@ -30433,16 +22331,12 @@ var HttpBindingProtocol = class extends HttpProtocol { Object.assign(query, Object.fromEntries(traitSearchParams)); } } - const _input = { - ...input - }; - for (const memberName of Object.keys(_input)) { - const memberNs = ns.getMemberSchema(memberName); - if (memberNs === void 0) { + for (const [memberName, memberNs] of ns.structIterator()) { + const memberTraits = memberNs.getMergedTraits() ?? {}; + const inputMemberValue = input[memberName]; + if (inputMemberValue == null) { continue; } - const memberTraits = memberNs.getMergedTraits(); - const inputMember = _input[memberName]; if (memberTraits.httpPayload) { const isStreaming = memberNs.isStreaming(); if (isStreaming) { @@ -30450,14 +22344,15 @@ var HttpBindingProtocol = class extends HttpProtocol { if (isEventStream) { throw new Error("serialization of event streams is not yet implemented"); } else { - payload = inputMember; + payload = inputMemberValue; } } else { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); payload = serializer.flush(); } + delete input[memberName]; } else if (memberTraits.httpLabel) { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); const replacement = serializer.flush(); if (request.path.includes(`{${memberName}+}`)) { request.path = request.path.replace( @@ -30467,27 +22362,27 @@ var HttpBindingProtocol = class extends HttpProtocol { } else if (request.path.includes(`{${memberName}}`)) { request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); } - delete _input[memberName]; + delete input[memberName]; } else if (memberTraits.httpHeader) { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); - delete _input[memberName]; + delete input[memberName]; } else if (typeof memberTraits.httpPrefixHeaders === "string") { - for (const [key, val] of Object.entries(inputMember)) { + for (const [key, val] of Object.entries(inputMemberValue)) { const amalgam = memberTraits.httpPrefixHeaders + key; serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); headers[amalgam.toLowerCase()] = serializer.flush(); } - delete _input[memberName]; + delete input[memberName]; } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { - this.serializeQuery(memberNs, inputMember, query); - delete _input[memberName]; + this.serializeQuery(memberNs, inputMemberValue, query); + delete input[memberName]; } else { hasNonHttpBindingMember = true; } } if (hasNonHttpBindingMember && input) { - serializer.write(schema, _input); + serializer.write(schema, input); payload = serializer.flush(); } request.headers = headers; @@ -31244,12 +23139,24 @@ var Schema = class { }; // src/submodules/schema/schemas/ListSchema.ts -var ListSchema = class extends Schema { +var ListSchema = class _ListSchema extends Schema { constructor(name, traits, valueSchema) { super(name, traits); this.name = name; this.traits = traits; this.valueSchema = valueSchema; + this.symbol = _ListSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::ListSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _ListSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const list2 = lhs; + return list2.symbol === _ListSchema.symbol; + } + return isPrototype; } }; function list(namespace, name, traits = {}, valueSchema) { @@ -31263,13 +23170,25 @@ function list(namespace, name, traits = {}, valueSchema) { } // src/submodules/schema/schemas/MapSchema.ts -var MapSchema = class extends Schema { +var MapSchema = class _MapSchema extends Schema { constructor(name, traits, keySchema, valueSchema) { super(name, traits); this.name = name; this.traits = traits; this.keySchema = keySchema; this.valueSchema = valueSchema; + this.symbol = _MapSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::MapSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _MapSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const map2 = lhs; + return map2.symbol === _MapSchema.symbol; + } + return isPrototype; } }; function map(namespace, name, traits = {}, keySchema, valueSchema) { @@ -31300,18 +23219,30 @@ function op(namespace, name, traits = {}, input, output) { } // src/submodules/schema/schemas/StructureSchema.ts -var StructureSchema = class extends Schema { +var StructureSchema = class _StructureSchema extends Schema { constructor(name, traits, memberNames, memberList) { super(name, traits); this.name = name; this.traits = traits; this.memberNames = memberNames; this.memberList = memberList; + this.symbol = _StructureSchema.symbol; this.members = {}; for (let i = 0; i < memberNames.length; ++i) { this.members[memberNames[i]] = Array.isArray(memberList[i]) ? memberList[i] : [memberList[i], 0]; } } + static { + this.symbol = Symbol.for("@smithy/core/schema::StructureSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _StructureSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const struct2 = lhs; + return struct2.symbol === _StructureSchema.symbol; + } + return isPrototype; + } }; function struct(namespace, name, traits, memberNames, memberList) { const schema = new StructureSchema(namespace + "#" + name, traits, memberNames, memberList); @@ -31320,7 +23251,7 @@ function struct(namespace, name, traits, memberNames, memberList) { } // src/submodules/schema/schemas/ErrorSchema.ts -var ErrorSchema = class extends StructureSchema { +var ErrorSchema = class _ErrorSchema extends StructureSchema { constructor(name, traits, memberNames, memberList, ctor) { super(name, traits, memberNames, memberList); this.name = name; @@ -31328,6 +23259,18 @@ var ErrorSchema = class extends StructureSchema { this.memberNames = memberNames; this.memberList = memberList; this.ctor = ctor; + this.symbol = _ErrorSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::ErrorSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _ErrorSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const err = lhs; + return err.symbol === _ErrorSchema.symbol; + } + return isPrototype; } }; function error(namespace, name, traits = {}, memberNames, memberList, ctor) { @@ -31369,12 +23312,24 @@ var SCHEMA = { }; // src/submodules/schema/schemas/SimpleSchema.ts -var SimpleSchema = class extends Schema { +var SimpleSchema = class _SimpleSchema extends Schema { constructor(name, schemaRef, traits) { super(name, traits); this.name = name; this.schemaRef = schemaRef; this.traits = traits; + this.symbol = _SimpleSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::SimpleSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _SimpleSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const sim2 = lhs; + return sim2.symbol === _SimpleSchema.symbol; + } + return isPrototype; } }; function sim(namespace, name, schemaRef, traits) { @@ -31392,6 +23347,7 @@ var NormalizedSchema = class _NormalizedSchema { constructor(ref, memberName) { this.ref = ref; this.memberName = memberName; + this.symbol = _NormalizedSchema.symbol; const traitStack = []; let _ref = ref; let schema = ref; @@ -31431,10 +23387,23 @@ var NormalizedSchema = class _NormalizedSchema { this.name = (typeof this.schema === "object" ? this.schema?.name : void 0) ?? this.memberName ?? this.getSchemaName(); if (this._isMemberSchema && !memberName) { throw new Error( - `@smithy/core/schema - NormalizedSchema member schema ${this.getName(true)} must initialize with memberName argument.` + `@smithy/core/schema - NormalizedSchema member schema ${this.getName( + true + )} must initialize with memberName argument.` ); } } + static { + this.symbol = Symbol.for("@smithy/core/schema::NormalizedSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _NormalizedSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const ns = lhs; + return ns.symbol === _NormalizedSchema.symbol; + } + return isPrototype; + } /** * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. */ @@ -32424,7 +24393,7 @@ var splitHeader = (value) => { }; // src/submodules/serde/value/NumericValue.ts -var NumericValue = class { +var NumericValue = class _NumericValue { constructor(string, type) { this.string = string; this.type = type; @@ -32451,15 +24420,19 @@ var NumericValue = class { toString() { return this.string; } - [Symbol.hasInstance](object) { + static [Symbol.hasInstance](object) { if (!object || typeof object !== "object") { return false; } const _nv = object; + const prototypeMatch = _NumericValue.prototype.isPrototypeOf(object.constructor?.prototype); + if (prototypeMatch) { + return prototypeMatch; + } if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name === "NumericValue") { return true; } - return false; + return prototypeMatch; } }; function nv(input) { @@ -32559,11 +24532,11 @@ var FetchHttpHandler = class _FetchHttpHandler { } destroy() { } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { if (!this.config) { this.config = await this.configProvider; } - const requestTimeoutInMs = this.config.requestTimeout; + const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; const keepAlive = this.config.keepAlive === true; const credentials = this.config.credentials; if (abortSignal?.aborted) { @@ -32927,6 +24900,9 @@ var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndp } if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { return async () => { + if (config.isCustomEndpoint === false) { + return void 0; + } const endpoint = await configProvider(); if (endpoint && typeof endpoint === "object") { if ("url" in endpoint) { @@ -32960,7 +24936,7 @@ var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { // src/adaptors/getEndpointFromInstructions.ts var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { - if (!clientConfig.endpoint) { + if (!clientConfig.isCustomEndpoint) { let endpointFromConfig; if (clientConfig.serviceConfiguredEndpoint) { endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); @@ -32969,6 +24945,7 @@ var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, in } if (endpointFromConfig) { clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); + clientConfig.isCustomEndpoint = true; } } const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); @@ -33017,7 +24994,7 @@ var endpointMiddleware = /* @__PURE__ */ __name(({ instructions }) => { return (next, context) => async (args) => { - if (config.endpoint) { + if (config.isCustomEndpoint) { (0, import_core.setFeature)(context, "ENDPOINT_OVERRIDE", "N"); } const endpoint = await getEndpointFromInstructions( @@ -33667,7 +25644,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf this.config?.httpAgent?.destroy(); this.config?.httpsAgent?.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; } @@ -33768,8 +25745,9 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf abortSignal.onabort = onAbort; } } + const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); + timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); const httpAgent = nodeHttpsOptions.agent; if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { timeouts.push( @@ -33781,7 +25759,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf }) ); } - writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { timeouts.forEach(timing.clearTimeout); return _reject(e); }); @@ -33970,7 +25948,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { destroy() { this.connectionManager.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); @@ -33978,7 +25956,8 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); } } - const { requestTimeout, disableConcurrentStreams } = this.config; + const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; + const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; return new Promise((_resolve, _reject) => { let fulfilled = false; let writeRequestBodyPromise = void 0; @@ -34044,10 +26023,10 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.deleteSession(authority, session); } }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { + if (effectiveRequestTimeout) { + req.setTimeout(effectiveRequestTimeout, () => { req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); timeoutError.name = "TimeoutError"; rejectWithDestroy(timeoutError); }); @@ -34085,7 +26064,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); } }); - writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); }); } updateHttpClientConfig(key, value) { @@ -37889,7 +29868,10 @@ var HttpProtocol = class { // src/submodules/protocols/HttpBindingProtocol.ts var HttpBindingProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, input, context) { + async serializeRequest(operationSchema, _input, context) { + const input = { + ..._input ?? {} + }; const serializer = this.serializer; const query = {}; const headers = {}; @@ -37924,16 +29906,12 @@ var HttpBindingProtocol = class extends HttpProtocol { Object.assign(query, Object.fromEntries(traitSearchParams)); } } - const _input = { - ...input - }; - for (const memberName of Object.keys(_input)) { - const memberNs = ns.getMemberSchema(memberName); - if (memberNs === void 0) { + for (const [memberName, memberNs] of ns.structIterator()) { + const memberTraits = memberNs.getMergedTraits() ?? {}; + const inputMemberValue = input[memberName]; + if (inputMemberValue == null) { continue; } - const memberTraits = memberNs.getMergedTraits(); - const inputMember = _input[memberName]; if (memberTraits.httpPayload) { const isStreaming = memberNs.isStreaming(); if (isStreaming) { @@ -37941,14 +29919,15 @@ var HttpBindingProtocol = class extends HttpProtocol { if (isEventStream) { throw new Error("serialization of event streams is not yet implemented"); } else { - payload = inputMember; + payload = inputMemberValue; } } else { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); payload = serializer.flush(); } + delete input[memberName]; } else if (memberTraits.httpLabel) { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); const replacement = serializer.flush(); if (request.path.includes(`{${memberName}+}`)) { request.path = request.path.replace( @@ -37958,27 +29937,27 @@ var HttpBindingProtocol = class extends HttpProtocol { } else if (request.path.includes(`{${memberName}}`)) { request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); } - delete _input[memberName]; + delete input[memberName]; } else if (memberTraits.httpHeader) { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); - delete _input[memberName]; + delete input[memberName]; } else if (typeof memberTraits.httpPrefixHeaders === "string") { - for (const [key, val] of Object.entries(inputMember)) { + for (const [key, val] of Object.entries(inputMemberValue)) { const amalgam = memberTraits.httpPrefixHeaders + key; serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); headers[amalgam.toLowerCase()] = serializer.flush(); } - delete _input[memberName]; + delete input[memberName]; } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { - this.serializeQuery(memberNs, inputMember, query); - delete _input[memberName]; + this.serializeQuery(memberNs, inputMemberValue, query); + delete input[memberName]; } else { hasNonHttpBindingMember = true; } } if (hasNonHttpBindingMember && input) { - serializer.write(schema, _input); + serializer.write(schema, input); payload = serializer.flush(); } request.headers = headers; @@ -38735,12 +30714,24 @@ var Schema = class { }; // src/submodules/schema/schemas/ListSchema.ts -var ListSchema = class extends Schema { +var ListSchema = class _ListSchema extends Schema { constructor(name, traits, valueSchema) { super(name, traits); this.name = name; this.traits = traits; this.valueSchema = valueSchema; + this.symbol = _ListSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::ListSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _ListSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const list2 = lhs; + return list2.symbol === _ListSchema.symbol; + } + return isPrototype; } }; function list(namespace, name, traits = {}, valueSchema) { @@ -38754,13 +30745,25 @@ function list(namespace, name, traits = {}, valueSchema) { } // src/submodules/schema/schemas/MapSchema.ts -var MapSchema = class extends Schema { +var MapSchema = class _MapSchema extends Schema { constructor(name, traits, keySchema, valueSchema) { super(name, traits); this.name = name; this.traits = traits; this.keySchema = keySchema; this.valueSchema = valueSchema; + this.symbol = _MapSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::MapSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _MapSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const map2 = lhs; + return map2.symbol === _MapSchema.symbol; + } + return isPrototype; } }; function map(namespace, name, traits = {}, keySchema, valueSchema) { @@ -38791,18 +30794,30 @@ function op(namespace, name, traits = {}, input, output) { } // src/submodules/schema/schemas/StructureSchema.ts -var StructureSchema = class extends Schema { +var StructureSchema = class _StructureSchema extends Schema { constructor(name, traits, memberNames, memberList) { super(name, traits); this.name = name; this.traits = traits; this.memberNames = memberNames; this.memberList = memberList; + this.symbol = _StructureSchema.symbol; this.members = {}; for (let i = 0; i < memberNames.length; ++i) { this.members[memberNames[i]] = Array.isArray(memberList[i]) ? memberList[i] : [memberList[i], 0]; } } + static { + this.symbol = Symbol.for("@smithy/core/schema::StructureSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _StructureSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const struct2 = lhs; + return struct2.symbol === _StructureSchema.symbol; + } + return isPrototype; + } }; function struct(namespace, name, traits, memberNames, memberList) { const schema = new StructureSchema(namespace + "#" + name, traits, memberNames, memberList); @@ -38811,7 +30826,7 @@ function struct(namespace, name, traits, memberNames, memberList) { } // src/submodules/schema/schemas/ErrorSchema.ts -var ErrorSchema = class extends StructureSchema { +var ErrorSchema = class _ErrorSchema extends StructureSchema { constructor(name, traits, memberNames, memberList, ctor) { super(name, traits, memberNames, memberList); this.name = name; @@ -38819,6 +30834,18 @@ var ErrorSchema = class extends StructureSchema { this.memberNames = memberNames; this.memberList = memberList; this.ctor = ctor; + this.symbol = _ErrorSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::ErrorSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _ErrorSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const err = lhs; + return err.symbol === _ErrorSchema.symbol; + } + return isPrototype; } }; function error(namespace, name, traits = {}, memberNames, memberList, ctor) { @@ -38860,12 +30887,24 @@ var SCHEMA = { }; // src/submodules/schema/schemas/SimpleSchema.ts -var SimpleSchema = class extends Schema { +var SimpleSchema = class _SimpleSchema extends Schema { constructor(name, schemaRef, traits) { super(name, traits); this.name = name; this.schemaRef = schemaRef; this.traits = traits; + this.symbol = _SimpleSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::SimpleSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _SimpleSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const sim2 = lhs; + return sim2.symbol === _SimpleSchema.symbol; + } + return isPrototype; } }; function sim(namespace, name, schemaRef, traits) { @@ -38883,6 +30922,7 @@ var NormalizedSchema = class _NormalizedSchema { constructor(ref, memberName) { this.ref = ref; this.memberName = memberName; + this.symbol = _NormalizedSchema.symbol; const traitStack = []; let _ref = ref; let schema = ref; @@ -38922,10 +30962,23 @@ var NormalizedSchema = class _NormalizedSchema { this.name = (typeof this.schema === "object" ? this.schema?.name : void 0) ?? this.memberName ?? this.getSchemaName(); if (this._isMemberSchema && !memberName) { throw new Error( - `@smithy/core/schema - NormalizedSchema member schema ${this.getName(true)} must initialize with memberName argument.` + `@smithy/core/schema - NormalizedSchema member schema ${this.getName( + true + )} must initialize with memberName argument.` ); } } + static { + this.symbol = Symbol.for("@smithy/core/schema::NormalizedSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _NormalizedSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const ns = lhs; + return ns.symbol === _NormalizedSchema.symbol; + } + return isPrototype; + } /** * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. */ @@ -39915,7 +31968,7 @@ var splitHeader = (value) => { }; // src/submodules/serde/value/NumericValue.ts -var NumericValue = class { +var NumericValue = class _NumericValue { constructor(string, type) { this.string = string; this.type = type; @@ -39942,15 +31995,19 @@ var NumericValue = class { toString() { return this.string; } - [Symbol.hasInstance](object) { + static [Symbol.hasInstance](object) { if (!object || typeof object !== "object") { return false; } const _nv = object; + const prototypeMatch = _NumericValue.prototype.isPrototypeOf(object.constructor?.prototype); + if (prototypeMatch) { + return prototypeMatch; + } if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name === "NumericValue") { return true; } - return false; + return prototypeMatch; } }; function nv(input) { @@ -40050,11 +32107,11 @@ var FetchHttpHandler = class _FetchHttpHandler { } destroy() { } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { if (!this.config) { this.config = await this.configProvider; } - const requestTimeoutInMs = this.config.requestTimeout; + const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; const keepAlive = this.config.keepAlive === true; const credentials = this.config.credentials; if (abortSignal?.aborted) { @@ -40418,6 +32475,9 @@ var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndp } if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { return async () => { + if (config.isCustomEndpoint === false) { + return void 0; + } const endpoint = await configProvider(); if (endpoint && typeof endpoint === "object") { if ("url" in endpoint) { @@ -40451,7 +32511,7 @@ var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { // src/adaptors/getEndpointFromInstructions.ts var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { - if (!clientConfig.endpoint) { + if (!clientConfig.isCustomEndpoint) { let endpointFromConfig; if (clientConfig.serviceConfiguredEndpoint) { endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); @@ -40460,6 +32520,7 @@ var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, in } if (endpointFromConfig) { clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); + clientConfig.isCustomEndpoint = true; } } const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); @@ -40508,7 +32569,7 @@ var endpointMiddleware = /* @__PURE__ */ __name(({ instructions }) => { return (next, context) => async (args) => { - if (config.endpoint) { + if (config.isCustomEndpoint) { (0, import_core.setFeature)(context, "ENDPOINT_OVERRIDE", "N"); } const endpoint = await getEndpointFromInstructions( @@ -41158,7 +33219,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf this.config?.httpAgent?.destroy(); this.config?.httpsAgent?.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; } @@ -41259,8 +33320,9 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf abortSignal.onabort = onAbort; } } + const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); + timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); const httpAgent = nodeHttpsOptions.agent; if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { timeouts.push( @@ -41272,7 +33334,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf }) ); } - writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { timeouts.forEach(timing.clearTimeout); return _reject(e); }); @@ -41461,7 +33523,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { destroy() { this.connectionManager.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); @@ -41469,7 +33531,8 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); } } - const { requestTimeout, disableConcurrentStreams } = this.config; + const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; + const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; return new Promise((_resolve, _reject) => { let fulfilled = false; let writeRequestBodyPromise = void 0; @@ -41535,10 +33598,10 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.deleteSession(authority, session); } }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { + if (effectiveRequestTimeout) { + req.setTimeout(effectiveRequestTimeout, () => { req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); timeoutError.name = "TimeoutError"; rejectWithDestroy(timeoutError); }); @@ -41576,7 +33639,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); } }); - writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); }); } updateHttpClientConfig(key, value) { @@ -43918,6 +35981,7 @@ __export(index_exports, { emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, setCredentialFeature: () => setCredentialFeature, setFeature: () => setFeature, + setTokenFeature: () => setTokenFeature, state: () => state }); module.exports = __toCommonJS(index_exports); @@ -43963,6 +36027,16 @@ function setFeature(context, feature, value) { context.__aws_sdk_context.features[feature] = value; } __name(setFeature, "setFeature"); + +// src/submodules/client/setTokenFeature.ts +function setTokenFeature(token, feature, value) { + if (!token.$source) { + token.$source = {}; + } + token.$source[feature] = value; + return token; +} +__name(setTokenFeature, "setTokenFeature"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -45106,7 +37180,7 @@ var import_protocols3 = __nccwpck_require__(97332); var import_schema5 = __nccwpck_require__(79724); var import_smithy_client3 = __nccwpck_require__(61411); var import_util_utf8 = __nccwpck_require__(60791); -var import_fast_xml_parser = __nccwpck_require__(39741); +var import_fast_xml_parser = __nccwpck_require__(50591); var XmlShapeDeserializer = class extends SerdeContextConfig { constructor(settings) { super(); @@ -45150,9 +37224,8 @@ var XmlShapeDeserializer = class extends SerdeContextConfig { readSchema(_schema, value) { const ns = import_schema5.NormalizedSchema.of(_schema); const traits = ns.getMergedTraits(); - const schema = ns.getSchema(); if (ns.isListSchema() && !Array.isArray(value)) { - return this.readSchema(schema, [value]); + return this.readSchema(ns, [value]); } if (value == null) { return value; @@ -45208,14 +37281,14 @@ var XmlShapeDeserializer = class extends SerdeContextConfig { return value; } throw new Error(`@aws-sdk/core/protocols - xml deserializer unhandled schema type for ${ns.getName(true)}`); - } else { - if (ns.isListSchema()) { - return []; - } else if (ns.isMapSchema() || ns.isStructSchema()) { - return {}; - } - return this.stringDeserializer.read(ns, value); } + if (ns.isListSchema()) { + return []; + } + if (ns.isMapSchema() || ns.isStructSchema()) { + return {}; + } + return this.stringDeserializer.read(ns, value); } parseXml(xml) { if (xml.length) { @@ -45582,7 +37655,7 @@ var import_util_body_length_browser4 = __nccwpck_require__(24192); // src/submodules/protocols/xml/parseXmlBody.ts var import_smithy_client5 = __nccwpck_require__(61411); -var import_fast_xml_parser2 = __nccwpck_require__(39741); +var import_fast_xml_parser2 = __nccwpck_require__(50591); var parseXmlBody = /* @__PURE__ */ __name((streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { if (encoded.length) { const parser = new import_fast_xml_parser2.XMLParser({ @@ -46721,7 +38794,10 @@ var HttpProtocol = class { // src/submodules/protocols/HttpBindingProtocol.ts var HttpBindingProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, input, context) { + async serializeRequest(operationSchema, _input, context) { + const input = { + ..._input ?? {} + }; const serializer = this.serializer; const query = {}; const headers = {}; @@ -46756,16 +38832,12 @@ var HttpBindingProtocol = class extends HttpProtocol { Object.assign(query, Object.fromEntries(traitSearchParams)); } } - const _input = { - ...input - }; - for (const memberName of Object.keys(_input)) { - const memberNs = ns.getMemberSchema(memberName); - if (memberNs === void 0) { + for (const [memberName, memberNs] of ns.structIterator()) { + const memberTraits = memberNs.getMergedTraits() ?? {}; + const inputMemberValue = input[memberName]; + if (inputMemberValue == null) { continue; } - const memberTraits = memberNs.getMergedTraits(); - const inputMember = _input[memberName]; if (memberTraits.httpPayload) { const isStreaming = memberNs.isStreaming(); if (isStreaming) { @@ -46773,14 +38845,15 @@ var HttpBindingProtocol = class extends HttpProtocol { if (isEventStream) { throw new Error("serialization of event streams is not yet implemented"); } else { - payload = inputMember; + payload = inputMemberValue; } } else { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); payload = serializer.flush(); } + delete input[memberName]; } else if (memberTraits.httpLabel) { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); const replacement = serializer.flush(); if (request.path.includes(`{${memberName}+}`)) { request.path = request.path.replace( @@ -46790,27 +38863,27 @@ var HttpBindingProtocol = class extends HttpProtocol { } else if (request.path.includes(`{${memberName}}`)) { request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); } - delete _input[memberName]; + delete input[memberName]; } else if (memberTraits.httpHeader) { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); - delete _input[memberName]; + delete input[memberName]; } else if (typeof memberTraits.httpPrefixHeaders === "string") { - for (const [key, val] of Object.entries(inputMember)) { + for (const [key, val] of Object.entries(inputMemberValue)) { const amalgam = memberTraits.httpPrefixHeaders + key; serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); headers[amalgam.toLowerCase()] = serializer.flush(); } - delete _input[memberName]; + delete input[memberName]; } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { - this.serializeQuery(memberNs, inputMember, query); - delete _input[memberName]; + this.serializeQuery(memberNs, inputMemberValue, query); + delete input[memberName]; } else { hasNonHttpBindingMember = true; } } if (hasNonHttpBindingMember && input) { - serializer.write(schema, _input); + serializer.write(schema, input); payload = serializer.flush(); } request.headers = headers; @@ -47567,12 +39640,24 @@ var Schema = class { }; // src/submodules/schema/schemas/ListSchema.ts -var ListSchema = class extends Schema { +var ListSchema = class _ListSchema extends Schema { constructor(name, traits, valueSchema) { super(name, traits); this.name = name; this.traits = traits; this.valueSchema = valueSchema; + this.symbol = _ListSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::ListSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _ListSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const list2 = lhs; + return list2.symbol === _ListSchema.symbol; + } + return isPrototype; } }; function list(namespace, name, traits = {}, valueSchema) { @@ -47586,13 +39671,25 @@ function list(namespace, name, traits = {}, valueSchema) { } // src/submodules/schema/schemas/MapSchema.ts -var MapSchema = class extends Schema { +var MapSchema = class _MapSchema extends Schema { constructor(name, traits, keySchema, valueSchema) { super(name, traits); this.name = name; this.traits = traits; this.keySchema = keySchema; this.valueSchema = valueSchema; + this.symbol = _MapSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::MapSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _MapSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const map2 = lhs; + return map2.symbol === _MapSchema.symbol; + } + return isPrototype; } }; function map(namespace, name, traits = {}, keySchema, valueSchema) { @@ -47623,18 +39720,30 @@ function op(namespace, name, traits = {}, input, output) { } // src/submodules/schema/schemas/StructureSchema.ts -var StructureSchema = class extends Schema { +var StructureSchema = class _StructureSchema extends Schema { constructor(name, traits, memberNames, memberList) { super(name, traits); this.name = name; this.traits = traits; this.memberNames = memberNames; this.memberList = memberList; + this.symbol = _StructureSchema.symbol; this.members = {}; for (let i = 0; i < memberNames.length; ++i) { this.members[memberNames[i]] = Array.isArray(memberList[i]) ? memberList[i] : [memberList[i], 0]; } } + static { + this.symbol = Symbol.for("@smithy/core/schema::StructureSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _StructureSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const struct2 = lhs; + return struct2.symbol === _StructureSchema.symbol; + } + return isPrototype; + } }; function struct(namespace, name, traits, memberNames, memberList) { const schema = new StructureSchema(namespace + "#" + name, traits, memberNames, memberList); @@ -47643,7 +39752,7 @@ function struct(namespace, name, traits, memberNames, memberList) { } // src/submodules/schema/schemas/ErrorSchema.ts -var ErrorSchema = class extends StructureSchema { +var ErrorSchema = class _ErrorSchema extends StructureSchema { constructor(name, traits, memberNames, memberList, ctor) { super(name, traits, memberNames, memberList); this.name = name; @@ -47651,6 +39760,18 @@ var ErrorSchema = class extends StructureSchema { this.memberNames = memberNames; this.memberList = memberList; this.ctor = ctor; + this.symbol = _ErrorSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::ErrorSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _ErrorSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const err = lhs; + return err.symbol === _ErrorSchema.symbol; + } + return isPrototype; } }; function error(namespace, name, traits = {}, memberNames, memberList, ctor) { @@ -47692,12 +39813,24 @@ var SCHEMA = { }; // src/submodules/schema/schemas/SimpleSchema.ts -var SimpleSchema = class extends Schema { +var SimpleSchema = class _SimpleSchema extends Schema { constructor(name, schemaRef, traits) { super(name, traits); this.name = name; this.schemaRef = schemaRef; this.traits = traits; + this.symbol = _SimpleSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::SimpleSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _SimpleSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const sim2 = lhs; + return sim2.symbol === _SimpleSchema.symbol; + } + return isPrototype; } }; function sim(namespace, name, schemaRef, traits) { @@ -47715,6 +39848,7 @@ var NormalizedSchema = class _NormalizedSchema { constructor(ref, memberName) { this.ref = ref; this.memberName = memberName; + this.symbol = _NormalizedSchema.symbol; const traitStack = []; let _ref = ref; let schema = ref; @@ -47754,10 +39888,23 @@ var NormalizedSchema = class _NormalizedSchema { this.name = (typeof this.schema === "object" ? this.schema?.name : void 0) ?? this.memberName ?? this.getSchemaName(); if (this._isMemberSchema && !memberName) { throw new Error( - `@smithy/core/schema - NormalizedSchema member schema ${this.getName(true)} must initialize with memberName argument.` + `@smithy/core/schema - NormalizedSchema member schema ${this.getName( + true + )} must initialize with memberName argument.` ); } } + static { + this.symbol = Symbol.for("@smithy/core/schema::NormalizedSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _NormalizedSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const ns = lhs; + return ns.symbol === _NormalizedSchema.symbol; + } + return isPrototype; + } /** * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. */ @@ -48747,7 +40894,7 @@ var splitHeader = (value) => { }; // src/submodules/serde/value/NumericValue.ts -var NumericValue = class { +var NumericValue = class _NumericValue { constructor(string, type) { this.string = string; this.type = type; @@ -48774,15 +40921,19 @@ var NumericValue = class { toString() { return this.string; } - [Symbol.hasInstance](object) { + static [Symbol.hasInstance](object) { if (!object || typeof object !== "object") { return false; } const _nv = object; + const prototypeMatch = _NumericValue.prototype.isPrototypeOf(object.constructor?.prototype); + if (prototypeMatch) { + return prototypeMatch; + } if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name === "NumericValue") { return true; } - return false; + return prototypeMatch; } }; function nv(input) { @@ -48882,11 +41033,11 @@ var FetchHttpHandler = class _FetchHttpHandler { } destroy() { } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { if (!this.config) { this.config = await this.configProvider; } - const requestTimeoutInMs = this.config.requestTimeout; + const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; const keepAlive = this.config.keepAlive === true; const credentials = this.config.credentials; if (abortSignal?.aborted) { @@ -49526,7 +41677,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf this.config?.httpAgent?.destroy(); this.config?.httpsAgent?.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; } @@ -49627,8 +41778,9 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf abortSignal.onabort = onAbort; } } + const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); + timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); const httpAgent = nodeHttpsOptions.agent; if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { timeouts.push( @@ -49640,7 +41792,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf }) ); } - writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { timeouts.forEach(timing.clearTimeout); return _reject(e); }); @@ -49829,7 +41981,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { destroy() { this.connectionManager.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); @@ -49837,7 +41989,8 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); } } - const { requestTimeout, disableConcurrentStreams } = this.config; + const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; + const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; return new Promise((_resolve, _reject) => { let fulfilled = false; let writeRequestBodyPromise = void 0; @@ -49903,10 +42056,10 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.deleteSession(authority, session); } }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { + if (effectiveRequestTimeout) { + req.setTimeout(effectiveRequestTimeout, () => { req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); timeoutError.name = "TimeoutError"; rejectWithDestroy(timeoutError); }); @@ -49944,7 +42097,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); } }); - writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); }); } updateHttpClientConfig(key, value) { @@ -52458,11 +44611,11 @@ var FetchHttpHandler = class _FetchHttpHandler { } destroy() { } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { if (!this.config) { this.config = await this.configProvider; } - const requestTimeoutInMs = this.config.requestTimeout; + const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; const keepAlive = this.config.keepAlive === true; const credentials = this.config.credentials; if (abortSignal?.aborted) { @@ -52972,7 +45125,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf this.config?.httpAgent?.destroy(); this.config?.httpsAgent?.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; } @@ -53073,8 +45226,9 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf abortSignal.onabort = onAbort; } } + const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); + timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); const httpAgent = nodeHttpsOptions.agent; if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { timeouts.push( @@ -53086,7 +45240,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf }) ); } - writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { timeouts.forEach(timing.clearTimeout); return _reject(e); }); @@ -53275,7 +45429,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { destroy() { this.connectionManager.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); @@ -53283,7 +45437,8 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); } } - const { requestTimeout, disableConcurrentStreams } = this.config; + const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; + const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; return new Promise((_resolve, _reject) => { let fulfilled = false; let writeRequestBodyPromise = void 0; @@ -53349,10 +45504,10 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.deleteSession(authority, session); } }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { + if (effectiveRequestTimeout) { + req.setTimeout(effectiveRequestTimeout, () => { req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); timeoutError.name = "TimeoutError"; rejectWithDestroy(timeoutError); }); @@ -53390,7 +45545,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); } }); - writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); }); } updateHttpClientConfig(key, value) { @@ -60704,7 +52859,10 @@ var HttpProtocol = class { // src/submodules/protocols/HttpBindingProtocol.ts var HttpBindingProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, input, context) { + async serializeRequest(operationSchema, _input, context) { + const input = { + ..._input ?? {} + }; const serializer = this.serializer; const query = {}; const headers = {}; @@ -60739,16 +52897,12 @@ var HttpBindingProtocol = class extends HttpProtocol { Object.assign(query, Object.fromEntries(traitSearchParams)); } } - const _input = { - ...input - }; - for (const memberName of Object.keys(_input)) { - const memberNs = ns.getMemberSchema(memberName); - if (memberNs === void 0) { + for (const [memberName, memberNs] of ns.structIterator()) { + const memberTraits = memberNs.getMergedTraits() ?? {}; + const inputMemberValue = input[memberName]; + if (inputMemberValue == null) { continue; } - const memberTraits = memberNs.getMergedTraits(); - const inputMember = _input[memberName]; if (memberTraits.httpPayload) { const isStreaming = memberNs.isStreaming(); if (isStreaming) { @@ -60756,14 +52910,15 @@ var HttpBindingProtocol = class extends HttpProtocol { if (isEventStream) { throw new Error("serialization of event streams is not yet implemented"); } else { - payload = inputMember; + payload = inputMemberValue; } } else { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); payload = serializer.flush(); } + delete input[memberName]; } else if (memberTraits.httpLabel) { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); const replacement = serializer.flush(); if (request.path.includes(`{${memberName}+}`)) { request.path = request.path.replace( @@ -60773,27 +52928,27 @@ var HttpBindingProtocol = class extends HttpProtocol { } else if (request.path.includes(`{${memberName}}`)) { request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); } - delete _input[memberName]; + delete input[memberName]; } else if (memberTraits.httpHeader) { - serializer.write(memberNs, inputMember); + serializer.write(memberNs, inputMemberValue); headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); - delete _input[memberName]; + delete input[memberName]; } else if (typeof memberTraits.httpPrefixHeaders === "string") { - for (const [key, val] of Object.entries(inputMember)) { + for (const [key, val] of Object.entries(inputMemberValue)) { const amalgam = memberTraits.httpPrefixHeaders + key; serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); headers[amalgam.toLowerCase()] = serializer.flush(); } - delete _input[memberName]; + delete input[memberName]; } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { - this.serializeQuery(memberNs, inputMember, query); - delete _input[memberName]; + this.serializeQuery(memberNs, inputMemberValue, query); + delete input[memberName]; } else { hasNonHttpBindingMember = true; } } if (hasNonHttpBindingMember && input) { - serializer.write(schema, _input); + serializer.write(schema, input); payload = serializer.flush(); } request.headers = headers; @@ -61550,12 +53705,24 @@ var Schema = class { }; // src/submodules/schema/schemas/ListSchema.ts -var ListSchema = class extends Schema { +var ListSchema = class _ListSchema extends Schema { constructor(name, traits, valueSchema) { super(name, traits); this.name = name; this.traits = traits; this.valueSchema = valueSchema; + this.symbol = _ListSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::ListSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _ListSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const list2 = lhs; + return list2.symbol === _ListSchema.symbol; + } + return isPrototype; } }; function list(namespace, name, traits = {}, valueSchema) { @@ -61569,13 +53736,25 @@ function list(namespace, name, traits = {}, valueSchema) { } // src/submodules/schema/schemas/MapSchema.ts -var MapSchema = class extends Schema { +var MapSchema = class _MapSchema extends Schema { constructor(name, traits, keySchema, valueSchema) { super(name, traits); this.name = name; this.traits = traits; this.keySchema = keySchema; this.valueSchema = valueSchema; + this.symbol = _MapSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::MapSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _MapSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const map2 = lhs; + return map2.symbol === _MapSchema.symbol; + } + return isPrototype; } }; function map(namespace, name, traits = {}, keySchema, valueSchema) { @@ -61606,18 +53785,30 @@ function op(namespace, name, traits = {}, input, output) { } // src/submodules/schema/schemas/StructureSchema.ts -var StructureSchema = class extends Schema { +var StructureSchema = class _StructureSchema extends Schema { constructor(name, traits, memberNames, memberList) { super(name, traits); this.name = name; this.traits = traits; this.memberNames = memberNames; this.memberList = memberList; + this.symbol = _StructureSchema.symbol; this.members = {}; for (let i = 0; i < memberNames.length; ++i) { this.members[memberNames[i]] = Array.isArray(memberList[i]) ? memberList[i] : [memberList[i], 0]; } } + static { + this.symbol = Symbol.for("@smithy/core/schema::StructureSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _StructureSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const struct2 = lhs; + return struct2.symbol === _StructureSchema.symbol; + } + return isPrototype; + } }; function struct(namespace, name, traits, memberNames, memberList) { const schema = new StructureSchema(namespace + "#" + name, traits, memberNames, memberList); @@ -61626,7 +53817,7 @@ function struct(namespace, name, traits, memberNames, memberList) { } // src/submodules/schema/schemas/ErrorSchema.ts -var ErrorSchema = class extends StructureSchema { +var ErrorSchema = class _ErrorSchema extends StructureSchema { constructor(name, traits, memberNames, memberList, ctor) { super(name, traits, memberNames, memberList); this.name = name; @@ -61634,6 +53825,18 @@ var ErrorSchema = class extends StructureSchema { this.memberNames = memberNames; this.memberList = memberList; this.ctor = ctor; + this.symbol = _ErrorSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::ErrorSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _ErrorSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const err = lhs; + return err.symbol === _ErrorSchema.symbol; + } + return isPrototype; } }; function error(namespace, name, traits = {}, memberNames, memberList, ctor) { @@ -61675,12 +53878,24 @@ var SCHEMA = { }; // src/submodules/schema/schemas/SimpleSchema.ts -var SimpleSchema = class extends Schema { +var SimpleSchema = class _SimpleSchema extends Schema { constructor(name, schemaRef, traits) { super(name, traits); this.name = name; this.schemaRef = schemaRef; this.traits = traits; + this.symbol = _SimpleSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::SimpleSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _SimpleSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const sim2 = lhs; + return sim2.symbol === _SimpleSchema.symbol; + } + return isPrototype; } }; function sim(namespace, name, schemaRef, traits) { @@ -61698,6 +53913,7 @@ var NormalizedSchema = class _NormalizedSchema { constructor(ref, memberName) { this.ref = ref; this.memberName = memberName; + this.symbol = _NormalizedSchema.symbol; const traitStack = []; let _ref = ref; let schema = ref; @@ -61737,10 +53953,23 @@ var NormalizedSchema = class _NormalizedSchema { this.name = (typeof this.schema === "object" ? this.schema?.name : void 0) ?? this.memberName ?? this.getSchemaName(); if (this._isMemberSchema && !memberName) { throw new Error( - `@smithy/core/schema - NormalizedSchema member schema ${this.getName(true)} must initialize with memberName argument.` + `@smithy/core/schema - NormalizedSchema member schema ${this.getName( + true + )} must initialize with memberName argument.` ); } } + static { + this.symbol = Symbol.for("@smithy/core/schema::NormalizedSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _NormalizedSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const ns = lhs; + return ns.symbol === _NormalizedSchema.symbol; + } + return isPrototype; + } /** * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. */ @@ -62730,7 +54959,7 @@ var splitHeader = (value) => { }; // src/submodules/serde/value/NumericValue.ts -var NumericValue = class { +var NumericValue = class _NumericValue { constructor(string, type) { this.string = string; this.type = type; @@ -62757,15 +54986,19 @@ var NumericValue = class { toString() { return this.string; } - [Symbol.hasInstance](object) { + static [Symbol.hasInstance](object) { if (!object || typeof object !== "object") { return false; } const _nv = object; + const prototypeMatch = _NumericValue.prototype.isPrototypeOf(object.constructor?.prototype); + if (prototypeMatch) { + return prototypeMatch; + } if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name === "NumericValue") { return true; } - return false; + return prototypeMatch; } }; function nv(input) { @@ -62865,11 +55098,11 @@ var FetchHttpHandler = class _FetchHttpHandler { } destroy() { } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { if (!this.config) { this.config = await this.configProvider; } - const requestTimeoutInMs = this.config.requestTimeout; + const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; const keepAlive = this.config.keepAlive === true; const credentials = this.config.credentials; if (abortSignal?.aborted) { @@ -63509,7 +55742,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf this.config?.httpAgent?.destroy(); this.config?.httpsAgent?.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; } @@ -63610,8 +55843,9 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf abortSignal.onabort = onAbort; } } + const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); + timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); const httpAgent = nodeHttpsOptions.agent; if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { timeouts.push( @@ -63623,7 +55857,7 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf }) ); } - writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { timeouts.forEach(timing.clearTimeout); return _reject(e); }); @@ -63812,7 +56046,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { destroy() { this.connectionManager.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout } = {}) { if (!this.config) { this.config = await this.configProvider; this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); @@ -63820,7 +56054,8 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); } } - const { requestTimeout, disableConcurrentStreams } = this.config; + const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; + const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; return new Promise((_resolve, _reject) => { let fulfilled = false; let writeRequestBodyPromise = void 0; @@ -63886,10 +56121,10 @@ var NodeHttp2Handler = class _NodeHttp2Handler { this.connectionManager.deleteSession(authority, session); } }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { + if (effectiveRequestTimeout) { + req.setTimeout(effectiveRequestTimeout, () => { req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); timeoutError.name = "TimeoutError"; rejectWithDestroy(timeoutError); }); @@ -63927,7 +56162,7 @@ var NodeHttp2Handler = class _NodeHttp2Handler { rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); } }); - writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); }); } updateHttpClientConfig(key, value) { @@ -68098,1224 +60333,400 @@ __export(src_exports, { isIdentityExpired: () => isIdentityExpired, memoizeIdentityProvider: () => memoizeIdentityProvider, normalizeProvider: () => normalizeProvider, - requestBuilder: () => import_protocols.requestBuilder, - setFeature: () => setFeature -}); -module.exports = __toCommonJS(src_exports); - -// src/getSmithyContext.ts -var import_types = __nccwpck_require__(65165); -var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - -// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts -var import_util_middleware = __nccwpck_require__(99755); - -// src/middleware-http-auth-scheme/resolveAuthOptions.ts -var resolveAuthOptions = /* @__PURE__ */ __name((candidateAuthOptions, authSchemePreference) => { - if (!authSchemePreference || authSchemePreference.length === 0) { - return candidateAuthOptions; - } - const preferredAuthOptions = []; - for (const preferredSchemeName of authSchemePreference) { - for (const candidateAuthOption of candidateAuthOptions) { - const candidateAuthSchemeName = candidateAuthOption.schemeId.split("#")[1]; - if (candidateAuthSchemeName === preferredSchemeName) { - preferredAuthOptions.push(candidateAuthOption); - } - } - } - for (const candidateAuthOption of candidateAuthOptions) { - if (!preferredAuthOptions.find(({ schemeId }) => schemeId === candidateAuthOption.schemeId)) { - preferredAuthOptions.push(candidateAuthOption); - } - } - return preferredAuthOptions; -}, "resolveAuthOptions"); - -// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts -function convertHttpAuthSchemesToMap(httpAuthSchemes) { - const map = /* @__PURE__ */ new Map(); - for (const scheme of httpAuthSchemes) { - map.set(scheme.schemeId, scheme); - } - return map; -} -__name(convertHttpAuthSchemesToMap, "convertHttpAuthSchemesToMap"); -var httpAuthSchemeMiddleware = /* @__PURE__ */ __name((config, mwOptions) => (next, context) => async (args) => { - const options = config.httpAuthSchemeProvider( - await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input) - ); - const authSchemePreference = config.authSchemePreference ? await config.authSchemePreference() : []; - const resolvedOptions = resolveAuthOptions(options, authSchemePreference); - const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const failureReasons = []; - for (const option of resolvedOptions) { - const scheme = authSchemes.get(option.schemeId); - if (!scheme) { - failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` was not enabled for this service.`); - continue; - } - const identityProvider = scheme.identityProvider(await mwOptions.identityProviderConfigProvider(config)); - if (!identityProvider) { - failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` did not have an IdentityProvider configured.`); - continue; - } - const { identityProperties = {}, signingProperties = {} } = option.propertiesExtractor?.(config, context) || {}; - option.identityProperties = Object.assign(option.identityProperties || {}, identityProperties); - option.signingProperties = Object.assign(option.signingProperties || {}, signingProperties); - smithyContext.selectedHttpAuthScheme = { - httpAuthOption: option, - identity: await identityProvider(option.identityProperties), - signer: scheme.signer - }; - break; - } - if (!smithyContext.selectedHttpAuthScheme) { - throw new Error(failureReasons.join("\n")); - } - return next(args); -}, "httpAuthSchemeMiddleware"); - -// src/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.ts -var httpAuthSchemeEndpointRuleSetMiddlewareOptions = { - step: "serialize", - tags: ["HTTP_AUTH_SCHEME"], - name: "httpAuthSchemeMiddleware", - override: true, - relation: "before", - toMiddleware: "endpointV2Middleware" -}; -var getHttpAuthSchemeEndpointRuleSetPlugin = /* @__PURE__ */ __name((config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider -}) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo( - httpAuthSchemeMiddleware(config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider - }), - httpAuthSchemeEndpointRuleSetMiddlewareOptions - ); - } -}), "getHttpAuthSchemeEndpointRuleSetPlugin"); - -// src/middleware-http-auth-scheme/getHttpAuthSchemePlugin.ts -var import_middleware_serde = __nccwpck_require__(62654); -var httpAuthSchemeMiddlewareOptions = { - step: "serialize", - tags: ["HTTP_AUTH_SCHEME"], - name: "httpAuthSchemeMiddleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde.serializerMiddlewareOption.name -}; -var getHttpAuthSchemePlugin = /* @__PURE__ */ __name((config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider -}) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo( - httpAuthSchemeMiddleware(config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider - }), - httpAuthSchemeMiddlewareOptions - ); - } -}), "getHttpAuthSchemePlugin"); - -// src/middleware-http-signing/httpSigningMiddleware.ts -var import_protocol_http = __nccwpck_require__(20843); - -var defaultErrorHandler = /* @__PURE__ */ __name((signingProperties) => (error) => { - throw error; -}, "defaultErrorHandler"); -var defaultSuccessHandler = /* @__PURE__ */ __name((httpResponse, signingProperties) => { -}, "defaultSuccessHandler"); -var httpSigningMiddleware = /* @__PURE__ */ __name((config) => (next, context) => async (args) => { - if (!import_protocol_http.HttpRequest.isInstance(args.request)) { - return next(args); - } - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const scheme = smithyContext.selectedHttpAuthScheme; - if (!scheme) { - throw new Error(`No HttpAuthScheme was selected: unable to sign request`); - } - const { - httpAuthOption: { signingProperties = {} }, - identity, - signer - } = scheme; - const output = await next({ - ...args, - request: await signer.sign(args.request, identity, signingProperties) - }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); - (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); - return output; -}, "httpSigningMiddleware"); - -// src/middleware-http-signing/getHttpSigningMiddleware.ts -var httpSigningMiddlewareOptions = { - step: "finalizeRequest", - tags: ["HTTP_SIGNING"], - name: "httpSigningMiddleware", - aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], - override: true, - relation: "after", - toMiddleware: "retryMiddleware" -}; -var getHttpSigningPlugin = /* @__PURE__ */ __name((config) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); - } -}), "getHttpSigningPlugin"); - -// src/normalizeProvider.ts -var normalizeProvider = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; -}, "normalizeProvider"); - -// src/pagination/createPaginator.ts -var makePagedClientRequest = /* @__PURE__ */ __name(async (CommandCtor, client, input, withCommand = (_) => _, ...args) => { - let command = new CommandCtor(input); - command = withCommand(command) ?? command; - return await client.send(command, ...args); -}, "makePagedClientRequest"); -function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { - return /* @__PURE__ */ __name(async function* paginateOperation(config, input, ...additionalArguments) { - const _input = input; - let token = config.startingToken ?? _input[inputTokenName]; - let hasNext = true; - let page; - while (hasNext) { - _input[inputTokenName] = token; - if (pageSizeTokenName) { - _input[pageSizeTokenName] = _input[pageSizeTokenName] ?? config.pageSize; - } - if (config.client instanceof ClientCtor) { - page = await makePagedClientRequest( - CommandCtor, - config.client, - input, - config.withCommand, - ...additionalArguments - ); - } else { - throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); - } - yield page; - const prevToken = token; - token = get(page, outputTokenName); - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); - } - return void 0; - }, "paginateOperation"); -} -__name(createPaginator, "createPaginator"); -var get = /* @__PURE__ */ __name((fromObject, path) => { - let cursor = fromObject; - const pathComponents = path.split("."); - for (const step of pathComponents) { - if (!cursor || typeof cursor !== "object") { - return void 0; - } - cursor = cursor[step]; - } - return cursor; -}, "get"); - -// src/protocols/requestBuilder.ts -var import_protocols = __nccwpck_require__(14097); - -// src/setFeature.ts -function setFeature(context, feature, value) { - if (!context.__smithy_context) { - context.__smithy_context = { - features: {} - }; - } else if (!context.__smithy_context.features) { - context.__smithy_context.features = {}; - } - context.__smithy_context.features[feature] = value; -} -__name(setFeature, "setFeature"); - -// src/util-identity-and-auth/DefaultIdentityProviderConfig.ts -var DefaultIdentityProviderConfig = class { - /** - * Creates an IdentityProviderConfig with a record of scheme IDs to identity providers. - * - * @param config scheme IDs and identity providers to configure - */ - constructor(config) { - this.authSchemes = /* @__PURE__ */ new Map(); - for (const [key, value] of Object.entries(config)) { - if (value !== void 0) { - this.authSchemes.set(key, value); - } - } - } - static { - __name(this, "DefaultIdentityProviderConfig"); - } - getIdentityProvider(schemeId) { - return this.authSchemes.get(schemeId); - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.ts - - -var HttpApiKeyAuthSigner = class { - static { - __name(this, "HttpApiKeyAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - if (!signingProperties) { - throw new Error( - "request could not be signed with `apiKey` since the `name` and `in` signer properties are missing" - ); - } - if (!signingProperties.name) { - throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); - } - if (!signingProperties.in) { - throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); - } - if (!identity.apiKey) { - throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); - } - const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); - if (signingProperties.in === import_types.HttpApiKeyAuthLocation.QUERY) { - clonedRequest.query[signingProperties.name] = identity.apiKey; - } else if (signingProperties.in === import_types.HttpApiKeyAuthLocation.HEADER) { - clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; - } else { - throw new Error( - "request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`" - ); - } - return clonedRequest; - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.ts - -var HttpBearerAuthSigner = class { - static { - __name(this, "HttpBearerAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); - if (!identity.token) { - throw new Error("request could not be signed with `token` since the `token` is not defined"); - } - clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; - return clonedRequest; - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/noAuth.ts -var NoAuthSigner = class { - static { - __name(this, "NoAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - return httpRequest; - } -}; - -// src/util-identity-and-auth/memoizeIdentityProvider.ts -var createIsIdentityExpiredFunction = /* @__PURE__ */ __name((expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs, "createIsIdentityExpiredFunction"); -var EXPIRATION_MS = 3e5; -var isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); -var doesIdentityRequireRefresh = /* @__PURE__ */ __name((identity) => identity.expiration !== void 0, "doesIdentityRequireRefresh"); -var memoizeIdentityProvider = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - if (provider === void 0) { - return void 0; - } - const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async (options) => { - if (!pending) { - pending = normalizedProvider(options); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(options); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(options); - } - if (isConstant) { - return resolved; - } - if (!requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(options); - return resolved; - } - return resolved; - }; -}, "memoizeIdentityProvider"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 14097: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/protocols/index.ts -var protocols_exports = {}; -__export(protocols_exports, { - FromStringShapeDeserializer: () => FromStringShapeDeserializer, - HttpBindingProtocol: () => HttpBindingProtocol, - HttpInterceptingShapeDeserializer: () => HttpInterceptingShapeDeserializer, - HttpInterceptingShapeSerializer: () => HttpInterceptingShapeSerializer, - RequestBuilder: () => RequestBuilder, - RpcProtocol: () => RpcProtocol, - ToStringShapeSerializer: () => ToStringShapeSerializer, - collectBody: () => collectBody, - determineTimestampFormat: () => determineTimestampFormat, - extendedEncodeURIComponent: () => extendedEncodeURIComponent, - requestBuilder: () => requestBuilder, - resolvedPath: () => resolvedPath + requestBuilder: () => import_protocols.requestBuilder, + setFeature: () => setFeature }); -module.exports = __toCommonJS(protocols_exports); - -// src/submodules/protocols/collect-stream-body.ts -var import_util_stream = __nccwpck_require__(64691); -var collectBody = async (streamBody = new Uint8Array(), context) => { - if (streamBody instanceof Uint8Array) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); - } - if (!streamBody) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); - } - const fromContext = context.streamCollector(streamBody); - return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); -}; +module.exports = __toCommonJS(src_exports); -// src/submodules/protocols/extended-encode-uri-component.ts -function extendedEncodeURIComponent(str) { - return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { - return "%" + c.charCodeAt(0).toString(16).toUpperCase(); - }); -} +// src/getSmithyContext.ts +var import_types = __nccwpck_require__(65165); +var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); -// src/submodules/protocols/HttpBindingProtocol.ts -var import_schema2 = __nccwpck_require__(67635); -var import_protocol_http2 = __nccwpck_require__(20843); +// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts +var import_util_middleware = __nccwpck_require__(99755); -// src/submodules/protocols/HttpProtocol.ts -var import_schema = __nccwpck_require__(67635); -var import_serde = __nccwpck_require__(65409); -var import_protocol_http = __nccwpck_require__(20843); -var import_util_stream2 = __nccwpck_require__(64691); -var HttpProtocol = class { - constructor(options) { - this.options = options; - } - getRequestType() { - return import_protocol_http.HttpRequest; - } - getResponseType() { - return import_protocol_http.HttpResponse; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - this.serializer.setSerdeContext(serdeContext); - this.deserializer.setSerdeContext(serdeContext); - if (this.getPayloadCodec()) { - this.getPayloadCodec().setSerdeContext(serdeContext); - } - } - updateServiceEndpoint(request, endpoint) { - if ("url" in endpoint) { - request.protocol = endpoint.url.protocol; - request.hostname = endpoint.url.hostname; - request.port = endpoint.url.port ? Number(endpoint.url.port) : void 0; - request.path = endpoint.url.pathname; - request.fragment = endpoint.url.hash || void 0; - request.username = endpoint.url.username || void 0; - request.password = endpoint.url.password || void 0; - for (const [k, v] of endpoint.url.searchParams.entries()) { - if (!request.query) { - request.query = {}; - } - request.query[k] = v; - } - return request; - } else { - request.protocol = endpoint.protocol; - request.hostname = endpoint.hostname; - request.port = endpoint.port ? Number(endpoint.port) : void 0; - request.path = endpoint.path; - request.query = { - ...endpoint.query - }; - return request; - } +// src/middleware-http-auth-scheme/resolveAuthOptions.ts +var resolveAuthOptions = /* @__PURE__ */ __name((candidateAuthOptions, authSchemePreference) => { + if (!authSchemePreference || authSchemePreference.length === 0) { + return candidateAuthOptions; } - setHostPrefix(request, operationSchema, input) { - const operationNs = import_schema.NormalizedSchema.of(operationSchema); - const inputNs = import_schema.NormalizedSchema.of(operationSchema.input); - if (operationNs.getMergedTraits().endpoint) { - let hostPrefix = operationNs.getMergedTraits().endpoint?.[0]; - if (typeof hostPrefix === "string") { - const hostLabelInputs = [...inputNs.structIterator()].filter( - ([, member]) => member.getMergedTraits().hostLabel - ); - for (const [name] of hostLabelInputs) { - const replacement = input[name]; - if (typeof replacement !== "string") { - throw new Error(`@smithy/core/schema - ${name} in input must be a string as hostLabel.`); - } - hostPrefix = hostPrefix.replace(`{${name}}`, replacement); - } - request.hostname = hostPrefix + request.hostname; + const preferredAuthOptions = []; + for (const preferredSchemeName of authSchemePreference) { + for (const candidateAuthOption of candidateAuthOptions) { + const candidateAuthSchemeName = candidateAuthOption.schemeId.split("#")[1]; + if (candidateAuthSchemeName === preferredSchemeName) { + preferredAuthOptions.push(candidateAuthOption); } } } - deserializeMetadata(output) { - return { - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] - }; - } - async deserializeHttpMessage(schema, context, response, arg4, arg5) { - let dataObject; - if (arg4 instanceof Set) { - dataObject = arg5; - } else { - dataObject = arg4; - } - const deserializer = this.deserializer; - const ns = import_schema.NormalizedSchema.of(schema); - const nonHttpBindingMembers = []; - for (const [memberName, memberSchema] of ns.structIterator()) { - const memberTraits = memberSchema.getMemberTraits(); - if (memberTraits.httpPayload) { - const isStreaming = memberSchema.isStreaming(); - if (isStreaming) { - const isEventStream = memberSchema.isStructSchema(); - if (isEventStream) { - const context2 = this.serdeContext; - if (!context2.eventStreamMarshaller) { - throw new Error("@smithy/core - HttpProtocol: eventStreamMarshaller missing in serdeContext."); - } - const memberSchemas = memberSchema.getMemberSchemas(); - dataObject[memberName] = context2.eventStreamMarshaller.deserialize(response.body, async (event) => { - const unionMember = Object.keys(event).find((key) => { - return key !== "__type"; - }) ?? ""; - if (unionMember in memberSchemas) { - const eventStreamSchema = memberSchemas[unionMember]; - return { - [unionMember]: await deserializer.read(eventStreamSchema, event[unionMember].body) - }; - } else { - return { - $unknown: event - }; - } - }); - } else { - dataObject[memberName] = (0, import_util_stream2.sdkStreamMixin)(response.body); - } - } else if (response.body) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - dataObject[memberName] = await deserializer.read(memberSchema, bytes); - } - } - } else if (memberTraits.httpHeader) { - const key = String(memberTraits.httpHeader).toLowerCase(); - const value = response.headers[key]; - if (null != value) { - if (memberSchema.isListSchema()) { - const headerListValueSchema = memberSchema.getValueSchema(); - let sections; - if (headerListValueSchema.isTimestampSchema() && headerListValueSchema.getSchema() === import_schema.SCHEMA.TIMESTAMP_DEFAULT) { - sections = (0, import_serde.splitEvery)(value, ",", 2); - } else { - sections = (0, import_serde.splitHeader)(value); - } - const list = []; - for (const section of sections) { - list.push(await deserializer.read([headerListValueSchema, { httpHeader: key }], section.trim())); - } - dataObject[memberName] = list; - } else { - dataObject[memberName] = await deserializer.read(memberSchema, value); - } - } - } else if (memberTraits.httpPrefixHeaders !== void 0) { - dataObject[memberName] = {}; - for (const [header, value] of Object.entries(response.headers)) { - if (header.startsWith(memberTraits.httpPrefixHeaders)) { - dataObject[memberName][header.slice(memberTraits.httpPrefixHeaders.length)] = await deserializer.read( - [memberSchema.getValueSchema(), { httpHeader: header }], - value - ); - } - } - } else if (memberTraits.httpResponseCode) { - dataObject[memberName] = response.statusCode; - } else { - nonHttpBindingMembers.push(memberName); - } + for (const candidateAuthOption of candidateAuthOptions) { + if (!preferredAuthOptions.find(({ schemeId }) => schemeId === candidateAuthOption.schemeId)) { + preferredAuthOptions.push(candidateAuthOption); } - return nonHttpBindingMembers; } -}; + return preferredAuthOptions; +}, "resolveAuthOptions"); -// src/submodules/protocols/HttpBindingProtocol.ts -var HttpBindingProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, input, context) { - const serializer = this.serializer; - const query = {}; - const headers = {}; - const endpoint = await context.endpoint(); - const ns = import_schema2.NormalizedSchema.of(operationSchema?.input); - const schema = ns.getSchema(); - let hasNonHttpBindingMember = false; - let payload; - const request = new import_protocol_http2.HttpRequest({ - protocol: "", - hostname: "", - port: void 0, - path: "", - fragment: void 0, - query, - headers, - body: void 0 - }); - if (endpoint) { - this.updateServiceEndpoint(request, endpoint); - this.setHostPrefix(request, operationSchema, input); - const opTraits = import_schema2.NormalizedSchema.translateTraits(operationSchema.traits); - if (opTraits.http) { - request.method = opTraits.http[0]; - const [path, search] = opTraits.http[1].split("?"); - if (request.path == "/") { - request.path = path; - } else { - request.path += path; - } - const traitSearchParams = new URLSearchParams(search ?? ""); - Object.assign(query, Object.fromEntries(traitSearchParams)); - } - } - const _input = { - ...input - }; - for (const memberName of Object.keys(_input)) { - const memberNs = ns.getMemberSchema(memberName); - if (memberNs === void 0) { - continue; - } - const memberTraits = memberNs.getMergedTraits(); - const inputMember = _input[memberName]; - if (memberTraits.httpPayload) { - const isStreaming = memberNs.isStreaming(); - if (isStreaming) { - const isEventStream = memberNs.isStructSchema(); - if (isEventStream) { - throw new Error("serialization of event streams is not yet implemented"); - } else { - payload = inputMember; - } - } else { - serializer.write(memberNs, inputMember); - payload = serializer.flush(); - } - } else if (memberTraits.httpLabel) { - serializer.write(memberNs, inputMember); - const replacement = serializer.flush(); - if (request.path.includes(`{${memberName}+}`)) { - request.path = request.path.replace( - `{${memberName}+}`, - replacement.split("/").map(extendedEncodeURIComponent).join("/") - ); - } else if (request.path.includes(`{${memberName}}`)) { - request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); - } - delete _input[memberName]; - } else if (memberTraits.httpHeader) { - serializer.write(memberNs, inputMember); - headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); - delete _input[memberName]; - } else if (typeof memberTraits.httpPrefixHeaders === "string") { - for (const [key, val] of Object.entries(inputMember)) { - const amalgam = memberTraits.httpPrefixHeaders + key; - serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); - headers[amalgam.toLowerCase()] = serializer.flush(); - } - delete _input[memberName]; - } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { - this.serializeQuery(memberNs, inputMember, query); - delete _input[memberName]; - } else { - hasNonHttpBindingMember = true; - } - } - if (hasNonHttpBindingMember && input) { - serializer.write(schema, _input); - payload = serializer.flush(); - } - request.headers = headers; - request.query = query; - request.body = payload; - return request; - } - serializeQuery(ns, data, query) { - const serializer = this.serializer; - const traits = ns.getMergedTraits(); - if (traits.httpQueryParams) { - for (const [key, val] of Object.entries(data)) { - if (!(key in query)) { - this.serializeQuery( - import_schema2.NormalizedSchema.of([ - ns.getValueSchema(), - { - // We pass on the traits to the sub-schema - // because we are still in the process of serializing the map itself. - ...traits, - httpQuery: key, - httpQueryParams: void 0 - } - ]), - val, - query - ); - } - } - return; - } - if (ns.isListSchema()) { - const sparse = !!ns.getMergedTraits().sparse; - const buffer = []; - for (const item of data) { - serializer.write([ns.getValueSchema(), traits], item); - const serializable = serializer.flush(); - if (sparse || serializable !== void 0) { - buffer.push(serializable); - } - } - query[traits.httpQuery] = buffer; - } else { - serializer.write([ns, traits], data); - query[traits.httpQuery] = serializer.flush(); - } +// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts +function convertHttpAuthSchemesToMap(httpAuthSchemes) { + const map = /* @__PURE__ */ new Map(); + for (const scheme of httpAuthSchemes) { + map.set(scheme.schemeId, scheme); } - async deserializeResponse(operationSchema, context, response) { - const deserializer = this.deserializer; - const ns = import_schema2.NormalizedSchema.of(operationSchema.output); - const dataObject = {}; - if (response.statusCode >= 300) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(import_schema2.SCHEMA.DOCUMENT, bytes)); - } - await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); - throw new Error("@smithy/core/protocols - HTTP Protocol error handler failed to throw."); - } - for (const header in response.headers) { - const value = response.headers[header]; - delete response.headers[header]; - response.headers[header.toLowerCase()] = value; + return map; +} +__name(convertHttpAuthSchemesToMap, "convertHttpAuthSchemesToMap"); +var httpAuthSchemeMiddleware = /* @__PURE__ */ __name((config, mwOptions) => (next, context) => async (args) => { + const options = config.httpAuthSchemeProvider( + await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input) + ); + const authSchemePreference = config.authSchemePreference ? await config.authSchemePreference() : []; + const resolvedOptions = resolveAuthOptions(options, authSchemePreference); + const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const failureReasons = []; + for (const option of resolvedOptions) { + const scheme = authSchemes.get(option.schemeId); + if (!scheme) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` was not enabled for this service.`); + continue; } - const nonHttpBindingMembers = await this.deserializeHttpMessage(ns, context, response, dataObject); - if (nonHttpBindingMembers.length) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - const dataFromBody = await deserializer.read(ns, bytes); - for (const member of nonHttpBindingMembers) { - dataObject[member] = dataFromBody[member]; - } - } + const identityProvider = scheme.identityProvider(await mwOptions.identityProviderConfigProvider(config)); + if (!identityProvider) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` did not have an IdentityProvider configured.`); + continue; } - const output = { - $metadata: this.deserializeMetadata(response), - ...dataObject + const { identityProperties = {}, signingProperties = {} } = option.propertiesExtractor?.(config, context) || {}; + option.identityProperties = Object.assign(option.identityProperties || {}, identityProperties); + option.signingProperties = Object.assign(option.signingProperties || {}, signingProperties); + smithyContext.selectedHttpAuthScheme = { + httpAuthOption: option, + identity: await identityProvider(option.identityProperties), + signer: scheme.signer }; - return output; + break; + } + if (!smithyContext.selectedHttpAuthScheme) { + throw new Error(failureReasons.join("\n")); } + return next(args); +}, "httpAuthSchemeMiddleware"); + +// src/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.ts +var httpAuthSchemeEndpointRuleSetMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: "endpointV2Middleware" }; +var getHttpAuthSchemeEndpointRuleSetPlugin = /* @__PURE__ */ __name((config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider +}) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), + httpAuthSchemeEndpointRuleSetMiddlewareOptions + ); + } +}), "getHttpAuthSchemeEndpointRuleSetPlugin"); -// src/submodules/protocols/RpcProtocol.ts -var import_schema3 = __nccwpck_require__(67635); -var import_protocol_http3 = __nccwpck_require__(20843); -var RpcProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, input, context) { - const serializer = this.serializer; - const query = {}; - const headers = {}; - const endpoint = await context.endpoint(); - const ns = import_schema3.NormalizedSchema.of(operationSchema?.input); - const schema = ns.getSchema(); - let payload; - const request = new import_protocol_http3.HttpRequest({ - protocol: "", - hostname: "", - port: void 0, - path: "/", - fragment: void 0, - query, - headers, - body: void 0 - }); - if (endpoint) { - this.updateServiceEndpoint(request, endpoint); - this.setHostPrefix(request, operationSchema, input); - } - const _input = { - ...input - }; - if (input) { - serializer.write(schema, _input); - payload = serializer.flush(); - } - request.headers = headers; - request.query = query; - request.body = payload; - request.method = "POST"; - return request; +// src/middleware-http-auth-scheme/getHttpAuthSchemePlugin.ts +var import_middleware_serde = __nccwpck_require__(62654); +var httpAuthSchemeMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde.serializerMiddlewareOption.name +}; +var getHttpAuthSchemePlugin = /* @__PURE__ */ __name((config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider +}) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), + httpAuthSchemeMiddlewareOptions + ); } - async deserializeResponse(operationSchema, context, response) { - const deserializer = this.deserializer; - const ns = import_schema3.NormalizedSchema.of(operationSchema.output); - const dataObject = {}; - if (response.statusCode >= 300) { - const bytes2 = await collectBody(response.body, context); - if (bytes2.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(import_schema3.SCHEMA.DOCUMENT, bytes2)); - } - await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); - throw new Error("@smithy/core/protocols - RPC Protocol error handler failed to throw."); - } - for (const header in response.headers) { - const value = response.headers[header]; - delete response.headers[header]; - response.headers[header.toLowerCase()] = value; - } - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(ns, bytes)); - } - const output = { - $metadata: this.deserializeMetadata(response), - ...dataObject - }; - return output; +}), "getHttpAuthSchemePlugin"); + +// src/middleware-http-signing/httpSigningMiddleware.ts +var import_protocol_http = __nccwpck_require__(20843); + +var defaultErrorHandler = /* @__PURE__ */ __name((signingProperties) => (error) => { + throw error; +}, "defaultErrorHandler"); +var defaultSuccessHandler = /* @__PURE__ */ __name((httpResponse, signingProperties) => { +}, "defaultSuccessHandler"); +var httpSigningMiddleware = /* @__PURE__ */ __name((config) => (next, context) => async (args) => { + if (!import_protocol_http.HttpRequest.isInstance(args.request)) { + return next(args); + } + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const scheme = smithyContext.selectedHttpAuthScheme; + if (!scheme) { + throw new Error(`No HttpAuthScheme was selected: unable to sign request`); } + const { + httpAuthOption: { signingProperties = {} }, + identity, + signer + } = scheme; + const output = await next({ + ...args, + request: await signer.sign(args.request, identity, signingProperties) + }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); + (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); + return output; +}, "httpSigningMiddleware"); + +// src/middleware-http-signing/getHttpSigningMiddleware.ts +var httpSigningMiddlewareOptions = { + step: "finalizeRequest", + tags: ["HTTP_SIGNING"], + name: "httpSigningMiddleware", + aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], + override: true, + relation: "after", + toMiddleware: "retryMiddleware" }; +var getHttpSigningPlugin = /* @__PURE__ */ __name((config) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); + } +}), "getHttpSigningPlugin"); -// src/submodules/protocols/requestBuilder.ts -var import_protocol_http4 = __nccwpck_require__(20843); +// src/normalizeProvider.ts +var normalizeProvider = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}, "normalizeProvider"); -// src/submodules/protocols/resolve-path.ts -var resolvedPath = (resolvedPath2, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { - if (input != null && input[memberName] !== void 0) { - const labelValue = labelValueProvider(); - if (labelValue.length <= 0) { - throw new Error("Empty value provided for input HTTP label: " + memberName + "."); +// src/pagination/createPaginator.ts +var makePagedClientRequest = /* @__PURE__ */ __name(async (CommandCtor, client, input, withCommand = (_) => _, ...args) => { + let command = new CommandCtor(input); + command = withCommand(command) ?? command; + return await client.send(command, ...args); +}, "makePagedClientRequest"); +function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { + return /* @__PURE__ */ __name(async function* paginateOperation(config, input, ...additionalArguments) { + const _input = input; + let token = config.startingToken ?? _input[inputTokenName]; + let hasNext = true; + let page; + while (hasNext) { + _input[inputTokenName] = token; + if (pageSizeTokenName) { + _input[pageSizeTokenName] = _input[pageSizeTokenName] ?? config.pageSize; + } + if (config.client instanceof ClientCtor) { + page = await makePagedClientRequest( + CommandCtor, + config.client, + input, + config.withCommand, + ...additionalArguments + ); + } else { + throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); + } + yield page; + const prevToken = token; + token = get(page, outputTokenName); + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); } - resolvedPath2 = resolvedPath2.replace( - uriLabel, - isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) - ); - } else { - throw new Error("No value provided for input HTTP label: " + memberName + "."); - } - return resolvedPath2; -}; - -// src/submodules/protocols/requestBuilder.ts -function requestBuilder(input, context) { - return new RequestBuilder(input, context); + return void 0; + }, "paginateOperation"); } -var RequestBuilder = class { - constructor(input, context) { - this.input = input; - this.context = context; - this.query = {}; - this.method = ""; - this.headers = {}; - this.path = ""; - this.body = null; - this.hostname = ""; - this.resolvePathStack = []; - } - async build() { - const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); - this.path = basePath; - for (const resolvePath of this.resolvePathStack) { - resolvePath(this.path); +__name(createPaginator, "createPaginator"); +var get = /* @__PURE__ */ __name((fromObject, path) => { + let cursor = fromObject; + const pathComponents = path.split("."); + for (const step of pathComponents) { + if (!cursor || typeof cursor !== "object") { + return void 0; } - return new import_protocol_http4.HttpRequest({ - protocol, - hostname: this.hostname || hostname, - port, - method: this.method, - path: this.path, - query: this.query, - body: this.body, - headers: this.headers - }); - } - /** - * Brevity setter for "hostname". - */ - hn(hostname) { - this.hostname = hostname; - return this; - } - /** - * Brevity initial builder for "basepath". - */ - bp(uriLabel) { - this.resolvePathStack.push((basePath) => { - this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; - }); - return this; - } - /** - * Brevity incremental builder for "path". - */ - p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { - this.resolvePathStack.push((path) => { - this.path = resolvedPath(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); - }); - return this; + cursor = cursor[step]; } - /** - * Brevity setter for "headers". - */ - h(headers) { - this.headers = headers; - return this; + return cursor; +}, "get"); + +// src/protocols/requestBuilder.ts +var import_protocols = __nccwpck_require__(14097); + +// src/setFeature.ts +function setFeature(context, feature, value) { + if (!context.__smithy_context) { + context.__smithy_context = { + features: {} + }; + } else if (!context.__smithy_context.features) { + context.__smithy_context.features = {}; } + context.__smithy_context.features[feature] = value; +} +__name(setFeature, "setFeature"); + +// src/util-identity-and-auth/DefaultIdentityProviderConfig.ts +var DefaultIdentityProviderConfig = class { /** - * Brevity setter for "query". + * Creates an IdentityProviderConfig with a record of scheme IDs to identity providers. + * + * @param config scheme IDs and identity providers to configure */ - q(query) { - this.query = query; - return this; + constructor(config) { + this.authSchemes = /* @__PURE__ */ new Map(); + for (const [key, value] of Object.entries(config)) { + if (value !== void 0) { + this.authSchemes.set(key, value); + } + } } - /** - * Brevity setter for "body". - */ - b(body) { - this.body = body; - return this; + static { + __name(this, "DefaultIdentityProviderConfig"); } - /** - * Brevity setter for "method". - */ - m(method) { - this.method = method; - return this; + getIdentityProvider(schemeId) { + return this.authSchemes.get(schemeId); } }; -// src/submodules/protocols/serde/FromStringShapeDeserializer.ts -var import_schema5 = __nccwpck_require__(67635); -var import_serde2 = __nccwpck_require__(65409); -var import_util_base64 = __nccwpck_require__(72722); -var import_util_utf8 = __nccwpck_require__(46090); +// src/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.ts -// src/submodules/protocols/serde/determineTimestampFormat.ts -var import_schema4 = __nccwpck_require__(67635); -function determineTimestampFormat(ns, settings) { - if (settings.timestampFormat.useTrait) { - if (ns.isTimestampSchema() && (ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_DATE_TIME || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_EPOCH_SECONDS)) { - return ns.getSchema(); - } - } - const { httpLabel, httpPrefixHeaders, httpHeader, httpQuery } = ns.getMergedTraits(); - const bindingFormat = settings.httpBindings ? typeof httpPrefixHeaders === "string" || Boolean(httpHeader) ? import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE : Boolean(httpQuery) || Boolean(httpLabel) ? import_schema4.SCHEMA.TIMESTAMP_DATE_TIME : void 0 : void 0; - return bindingFormat ?? settings.timestampFormat.default; -} -// src/submodules/protocols/serde/FromStringShapeDeserializer.ts -var FromStringShapeDeserializer = class { - constructor(settings) { - this.settings = settings; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; +var HttpApiKeyAuthSigner = class { + static { + __name(this, "HttpApiKeyAuthSigner"); } - read(_schema, data) { - const ns = import_schema5.NormalizedSchema.of(_schema); - if (ns.isListSchema()) { - return (0, import_serde2.splitHeader)(data).map((item) => this.read(ns.getValueSchema(), item)); + async sign(httpRequest, identity, signingProperties) { + if (!signingProperties) { + throw new Error( + "request could not be signed with `apiKey` since the `name` and `in` signer properties are missing" + ); } - if (ns.isBlobSchema()) { - return (this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(data); + if (!signingProperties.name) { + throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); } - if (ns.isTimestampSchema()) { - const format = determineTimestampFormat(ns, this.settings); - switch (format) { - case import_schema5.SCHEMA.TIMESTAMP_DATE_TIME: - return (0, import_serde2.parseRfc3339DateTimeWithOffset)(data); - case import_schema5.SCHEMA.TIMESTAMP_HTTP_DATE: - return (0, import_serde2.parseRfc7231DateTime)(data); - case import_schema5.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - return (0, import_serde2.parseEpochTimestamp)(data); - default: - console.warn("Missing timestamp format, parsing value with Date constructor:", data); - return new Date(data); - } + if (!signingProperties.in) { + throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); } - if (ns.isStringSchema()) { - const mediaType = ns.getMergedTraits().mediaType; - let intermediateValue = data; - if (mediaType) { - if (ns.getMergedTraits().httpHeader) { - intermediateValue = this.base64ToUtf8(intermediateValue); - } - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - intermediateValue = import_serde2.LazyJsonString.from(intermediateValue); - } - return intermediateValue; - } + if (!identity.apiKey) { + throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); } - switch (true) { - case ns.isNumericSchema(): - return Number(data); - case ns.isBigIntegerSchema(): - return BigInt(data); - case ns.isBigDecimalSchema(): - return new import_serde2.NumericValue(data, "bigDecimal"); - case ns.isBooleanSchema(): - return String(data).toLowerCase() === "true"; + const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); + if (signingProperties.in === import_types.HttpApiKeyAuthLocation.QUERY) { + clonedRequest.query[signingProperties.name] = identity.apiKey; + } else if (signingProperties.in === import_types.HttpApiKeyAuthLocation.HEADER) { + clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; + } else { + throw new Error( + "request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`" + ); } - return data; - } - base64ToUtf8(base64String) { - return (this.serdeContext?.utf8Encoder ?? import_util_utf8.toUtf8)((this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(base64String)); + return clonedRequest; } }; -// src/submodules/protocols/serde/HttpInterceptingShapeDeserializer.ts -var import_schema6 = __nccwpck_require__(67635); -var import_util_utf82 = __nccwpck_require__(46090); -var HttpInterceptingShapeDeserializer = class { - constructor(codecDeserializer, codecSettings) { - this.codecDeserializer = codecDeserializer; - this.stringDeserializer = new FromStringShapeDeserializer(codecSettings); - } - setSerdeContext(serdeContext) { - this.stringDeserializer.setSerdeContext(serdeContext); - this.codecDeserializer.setSerdeContext(serdeContext); - this.serdeContext = serdeContext; +// src/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.ts + +var HttpBearerAuthSigner = class { + static { + __name(this, "HttpBearerAuthSigner"); } - read(schema, data) { - const ns = import_schema6.NormalizedSchema.of(schema); - const traits = ns.getMergedTraits(); - const toString = this.serdeContext?.utf8Encoder ?? import_util_utf82.toUtf8; - if (traits.httpHeader || traits.httpResponseCode) { - return this.stringDeserializer.read(ns, toString(data)); - } - if (traits.httpPayload) { - if (ns.isBlobSchema()) { - const toBytes = this.serdeContext?.utf8Decoder ?? import_util_utf82.fromUtf8; - if (typeof data === "string") { - return toBytes(data); - } - return data; - } else if (ns.isStringSchema()) { - if ("byteLength" in data) { - return toString(data); - } - return data; - } + async sign(httpRequest, identity, signingProperties) { + const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); + if (!identity.token) { + throw new Error("request could not be signed with `token` since the `token` is not defined"); } - return this.codecDeserializer.read(ns, data); + clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; + return clonedRequest; } }; -// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts -var import_schema8 = __nccwpck_require__(67635); - -// src/submodules/protocols/serde/ToStringShapeSerializer.ts -var import_schema7 = __nccwpck_require__(67635); -var import_serde3 = __nccwpck_require__(65409); -var import_util_base642 = __nccwpck_require__(72722); -var ToStringShapeSerializer = class { - constructor(settings) { - this.settings = settings; - this.stringBuffer = ""; - this.serdeContext = void 0; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } - write(schema, value) { - const ns = import_schema7.NormalizedSchema.of(schema); - switch (typeof value) { - case "object": - if (value === null) { - this.stringBuffer = "null"; - return; - } - if (ns.isTimestampSchema()) { - if (!(value instanceof Date)) { - throw new Error( - `@smithy/core/protocols - received non-Date value ${value} when schema expected Date in ${ns.getName(true)}` - ); - } - const format = determineTimestampFormat(ns, this.settings); - switch (format) { - case import_schema7.SCHEMA.TIMESTAMP_DATE_TIME: - this.stringBuffer = value.toISOString().replace(".000Z", "Z"); - break; - case import_schema7.SCHEMA.TIMESTAMP_HTTP_DATE: - this.stringBuffer = (0, import_serde3.dateToUtcString)(value); - break; - case import_schema7.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - this.stringBuffer = String(value.getTime() / 1e3); - break; - default: - console.warn("Missing timestamp format, using epoch seconds", value); - this.stringBuffer = String(value.getTime() / 1e3); - } - return; - } - if (ns.isBlobSchema() && "byteLength" in value) { - this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(value); - return; - } - if (ns.isListSchema() && Array.isArray(value)) { - let buffer = ""; - for (const item of value) { - this.write([ns.getValueSchema(), ns.getMergedTraits()], item); - const headerItem = this.flush(); - const serialized = ns.getValueSchema().isTimestampSchema() ? headerItem : (0, import_serde3.quoteHeader)(headerItem); - if (buffer !== "") { - buffer += ", "; - } - buffer += serialized; - } - this.stringBuffer = buffer; - return; - } - this.stringBuffer = JSON.stringify(value, null, 2); - break; - case "string": - const mediaType = ns.getMergedTraits().mediaType; - let intermediateValue = value; - if (mediaType) { - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - intermediateValue = import_serde3.LazyJsonString.from(intermediateValue); - } - if (ns.getMergedTraits().httpHeader) { - this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(intermediateValue.toString()); - return; - } - } - this.stringBuffer = value; - break; - default: - this.stringBuffer = String(value); - } +// src/util-identity-and-auth/httpAuthSchemes/noAuth.ts +var NoAuthSigner = class { + static { + __name(this, "NoAuthSigner"); } - flush() { - const buffer = this.stringBuffer; - this.stringBuffer = ""; - return buffer; + async sign(httpRequest, identity, signingProperties) { + return httpRequest; } }; -// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts -var HttpInterceptingShapeSerializer = class { - constructor(codecSerializer, codecSettings, stringSerializer = new ToStringShapeSerializer(codecSettings)) { - this.codecSerializer = codecSerializer; - this.stringSerializer = stringSerializer; - } - setSerdeContext(serdeContext) { - this.codecSerializer.setSerdeContext(serdeContext); - this.stringSerializer.setSerdeContext(serdeContext); +// src/util-identity-and-auth/memoizeIdentityProvider.ts +var createIsIdentityExpiredFunction = /* @__PURE__ */ __name((expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs, "createIsIdentityExpiredFunction"); +var EXPIRATION_MS = 3e5; +var isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); +var doesIdentityRequireRefresh = /* @__PURE__ */ __name((identity) => identity.expiration !== void 0, "doesIdentityRequireRefresh"); +var memoizeIdentityProvider = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + if (provider === void 0) { + return void 0; } - write(schema, value) { - const ns = import_schema8.NormalizedSchema.of(schema); - const traits = ns.getMergedTraits(); - if (traits.httpHeader || traits.httpLabel || traits.httpQuery) { - this.stringSerializer.write(ns, value); - this.buffer = this.stringSerializer.flush(); - return; + const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async (options) => { + if (!pending) { + pending = normalizedProvider(options); } - return this.codecSerializer.write(ns, value); + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + return resolved; + }; } - flush() { - if (this.buffer !== void 0) { - const buffer = this.buffer; - this.buffer = void 0; - return buffer; + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + if (isConstant) { + return resolved; + } + if (!requiresRefresh(resolved)) { + isConstant = true; + return resolved; } - return this.codecSerializer.flush(); - } -}; + if (isExpired(resolved)) { + await coalesceProvider(options); + return resolved; + } + return resolved; + }; +}, "memoizeIdentityProvider"); // Annotate the CommonJS export names for ESM import in node: + 0 && (0); + /***/ }), -/***/ 67635: +/***/ 14097: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -69336,1834 +60747,1650 @@ var __copyProps = (to, from, except, desc) => { }; var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/schema/index.ts -var schema_exports = {}; -__export(schema_exports, { - ErrorSchema: () => ErrorSchema, - ListSchema: () => ListSchema, - MapSchema: () => MapSchema, - NormalizedSchema: () => NormalizedSchema, - OperationSchema: () => OperationSchema, - SCHEMA: () => SCHEMA, - Schema: () => Schema, - SimpleSchema: () => SimpleSchema, - StructureSchema: () => StructureSchema, - TypeRegistry: () => TypeRegistry, - deref: () => deref, - deserializerMiddlewareOption: () => deserializerMiddlewareOption, - error: () => error, - getSchemaSerdePlugin: () => getSchemaSerdePlugin, - list: () => list, - map: () => map, - op: () => op, - serializerMiddlewareOption: () => serializerMiddlewareOption, - sim: () => sim, - struct: () => struct +// src/submodules/protocols/index.ts +var protocols_exports = {}; +__export(protocols_exports, { + FromStringShapeDeserializer: () => FromStringShapeDeserializer, + HttpBindingProtocol: () => HttpBindingProtocol, + HttpInterceptingShapeDeserializer: () => HttpInterceptingShapeDeserializer, + HttpInterceptingShapeSerializer: () => HttpInterceptingShapeSerializer, + RequestBuilder: () => RequestBuilder, + RpcProtocol: () => RpcProtocol, + ToStringShapeSerializer: () => ToStringShapeSerializer, + collectBody: () => collectBody, + determineTimestampFormat: () => determineTimestampFormat, + extendedEncodeURIComponent: () => extendedEncodeURIComponent, + requestBuilder: () => requestBuilder, + resolvedPath: () => resolvedPath }); -module.exports = __toCommonJS(schema_exports); +module.exports = __toCommonJS(protocols_exports); -// src/submodules/schema/deref.ts -var deref = (schemaRef) => { - if (typeof schemaRef === "function") { - return schemaRef(); +// src/submodules/protocols/collect-stream-body.ts +var import_util_stream = __nccwpck_require__(64691); +var collectBody = async (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); } - return schemaRef; -}; - -// src/submodules/schema/middleware/schemaDeserializationMiddleware.ts -var import_protocol_http = __nccwpck_require__(20843); -var import_util_middleware = __nccwpck_require__(99755); -var schemaDeserializationMiddleware = (config) => (next, context) => async (args) => { - const { response } = await next(args); - const { operationSchema } = (0, import_util_middleware.getSmithyContext)(context); - try { - const parsed = await config.protocol.deserializeResponse( - operationSchema, - { - ...config, - ...context - }, - response - ); - return { - response, - output: parsed - }; - } catch (error2) { - Object.defineProperty(error2, "$response", { - value: response - }); - if (!("$metadata" in error2)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - try { - error2.message += "\n " + hint; - } catch (e) { - if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { - console.warn(hint); - } else { - context.logger?.warn?.(hint); - } - } - if (typeof error2.$responseBodyText !== "undefined") { - if (error2.$response) { - error2.$response.body = error2.$responseBodyText; - } - } - try { - if (import_protocol_http.HttpResponse.isInstance(response)) { - const { headers = {} } = response; - const headerEntries = Object.entries(headers); - error2.$metadata = { - httpStatusCode: response.statusCode, - requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), - extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), - cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) - }; - } - } catch (e) { - } - } - throw error2; + if (!streamBody) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); } -}; -var findHeader = (pattern, headers) => { - return (headers.find(([k]) => { - return k.match(pattern); - }) || [void 0, void 0])[1]; + const fromContext = context.streamCollector(streamBody); + return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); }; -// src/submodules/schema/middleware/schemaSerializationMiddleware.ts -var import_util_middleware2 = __nccwpck_require__(99755); -var schemaSerializationMiddleware = (config) => (next, context) => async (args) => { - const { operationSchema } = (0, import_util_middleware2.getSmithyContext)(context); - const endpoint = context.endpointV2?.url && config.urlParser ? async () => config.urlParser(context.endpointV2.url) : config.endpoint; - const request = await config.protocol.serializeRequest(operationSchema, args.input, { - ...config, - ...context, - endpoint - }); - return next({ - ...args, - request +// src/submodules/protocols/extended-encode-uri-component.ts +function extendedEncodeURIComponent(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); }); -}; - -// src/submodules/schema/middleware/getSchemaSerdePlugin.ts -var deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true -}; -var serializerMiddlewareOption = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true -}; -function getSchemaSerdePlugin(config) { - return { - applyToStack: (commandStack) => { - commandStack.add(schemaSerializationMiddleware(config), serializerMiddlewareOption); - commandStack.add(schemaDeserializationMiddleware(config), deserializerMiddlewareOption); - config.protocol.setSerdeContext(config); - } - }; } -// src/submodules/schema/TypeRegistry.ts -var TypeRegistry = class _TypeRegistry { - constructor(namespace, schemas = /* @__PURE__ */ new Map()) { - this.namespace = namespace; - this.schemas = schemas; - } - static { - this.registries = /* @__PURE__ */ new Map(); +// src/submodules/protocols/HttpBindingProtocol.ts +var import_schema2 = __nccwpck_require__(67635); +var import_protocol_http2 = __nccwpck_require__(20843); + +// src/submodules/protocols/HttpProtocol.ts +var import_schema = __nccwpck_require__(67635); +var import_serde = __nccwpck_require__(65409); +var import_protocol_http = __nccwpck_require__(20843); +var import_util_stream2 = __nccwpck_require__(64691); +var HttpProtocol = class { + constructor(options) { + this.options = options; } - /** - * @param namespace - specifier. - * @returns the schema for that namespace, creating it if necessary. - */ - static for(namespace) { - if (!_TypeRegistry.registries.has(namespace)) { - _TypeRegistry.registries.set(namespace, new _TypeRegistry(namespace)); - } - return _TypeRegistry.registries.get(namespace); + getRequestType() { + return import_protocol_http.HttpRequest; } - /** - * Adds the given schema to a type registry with the same namespace. - * - * @param shapeId - to be registered. - * @param schema - to be registered. - */ - register(shapeId, schema) { - const qualifiedName = this.normalizeShapeId(shapeId); - const registry = _TypeRegistry.for(this.getNamespace(shapeId)); - registry.schemas.set(qualifiedName, schema); + getResponseType() { + return import_protocol_http.HttpResponse; } - /** - * @param shapeId - query. - * @returns the schema. - */ - getSchema(shapeId) { - const id = this.normalizeShapeId(shapeId); - if (!this.schemas.has(id)) { - throw new Error(`@smithy/core/schema - schema not found for ${id}`); + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; + this.serializer.setSerdeContext(serdeContext); + this.deserializer.setSerdeContext(serdeContext); + if (this.getPayloadCodec()) { + this.getPayloadCodec().setSerdeContext(serdeContext); } - return this.schemas.get(id); } - /** - * The smithy-typescript code generator generates a synthetic (i.e. unmodeled) base exception, - * because generated SDKs before the introduction of schemas have the notion of a ServiceBaseException, which - * is unique per service/model. - * - * This is generated under a unique prefix that is combined with the service namespace, and this - * method is used to retrieve it. - * - * The base exception synthetic schema is used when an error is returned by a service, but we cannot - * determine what existing schema to use to deserialize it. - * - * @returns the synthetic base exception of the service namespace associated with this registry instance. - */ - getBaseException() { - for (const [id, schema] of this.schemas.entries()) { - if (id.startsWith("smithy.ts.sdk.synthetic.") && id.endsWith("ServiceException")) { - return schema; + updateServiceEndpoint(request, endpoint) { + if ("url" in endpoint) { + request.protocol = endpoint.url.protocol; + request.hostname = endpoint.url.hostname; + request.port = endpoint.url.port ? Number(endpoint.url.port) : void 0; + request.path = endpoint.url.pathname; + request.fragment = endpoint.url.hash || void 0; + request.username = endpoint.url.username || void 0; + request.password = endpoint.url.password || void 0; + for (const [k, v] of endpoint.url.searchParams.entries()) { + if (!request.query) { + request.query = {}; + } + request.query[k] = v; } + return request; + } else { + request.protocol = endpoint.protocol; + request.hostname = endpoint.hostname; + request.port = endpoint.port ? Number(endpoint.port) : void 0; + request.path = endpoint.path; + request.query = { + ...endpoint.query + }; + return request; } - return void 0; - } - /** - * @param predicate - criterion. - * @returns a schema in this registry matching the predicate. - */ - find(predicate) { - return [...this.schemas.values()].find(predicate); - } - /** - * Unloads the current TypeRegistry. - */ - destroy() { - _TypeRegistry.registries.delete(this.namespace); - this.schemas.clear(); } - normalizeShapeId(shapeId) { - if (shapeId.includes("#")) { - return shapeId; + setHostPrefix(request, operationSchema, input) { + const operationNs = import_schema.NormalizedSchema.of(operationSchema); + const inputNs = import_schema.NormalizedSchema.of(operationSchema.input); + if (operationNs.getMergedTraits().endpoint) { + let hostPrefix = operationNs.getMergedTraits().endpoint?.[0]; + if (typeof hostPrefix === "string") { + const hostLabelInputs = [...inputNs.structIterator()].filter( + ([, member]) => member.getMergedTraits().hostLabel + ); + for (const [name] of hostLabelInputs) { + const replacement = input[name]; + if (typeof replacement !== "string") { + throw new Error(`@smithy/core/schema - ${name} in input must be a string as hostLabel.`); + } + hostPrefix = hostPrefix.replace(`{${name}}`, replacement); + } + request.hostname = hostPrefix + request.hostname; + } } - return this.namespace + "#" + shapeId; - } - getNamespace(shapeId) { - return this.normalizeShapeId(shapeId).split("#")[0]; - } -}; - -// src/submodules/schema/schemas/Schema.ts -var Schema = class { - constructor(name, traits) { - this.name = name; - this.traits = traits; - } -}; - -// src/submodules/schema/schemas/ListSchema.ts -var ListSchema = class extends Schema { - constructor(name, traits, valueSchema) { - super(name, traits); - this.name = name; - this.traits = traits; - this.valueSchema = valueSchema; - } -}; -function list(namespace, name, traits = {}, valueSchema) { - const schema = new ListSchema( - namespace + "#" + name, - traits, - typeof valueSchema === "function" ? valueSchema() : valueSchema - ); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/MapSchema.ts -var MapSchema = class extends Schema { - constructor(name, traits, keySchema, valueSchema) { - super(name, traits); - this.name = name; - this.traits = traits; - this.keySchema = keySchema; - this.valueSchema = valueSchema; } -}; -function map(namespace, name, traits = {}, keySchema, valueSchema) { - const schema = new MapSchema( - namespace + "#" + name, - traits, - keySchema, - typeof valueSchema === "function" ? valueSchema() : valueSchema - ); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/OperationSchema.ts -var OperationSchema = class extends Schema { - constructor(name, traits, input, output) { - super(name, traits); - this.name = name; - this.traits = traits; - this.input = input; - this.output = output; + deserializeMetadata(output) { + return { + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }; } -}; -function op(namespace, name, traits = {}, input, output) { - const schema = new OperationSchema(namespace + "#" + name, traits, input, output); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/StructureSchema.ts -var StructureSchema = class extends Schema { - constructor(name, traits, memberNames, memberList) { - super(name, traits); - this.name = name; - this.traits = traits; - this.memberNames = memberNames; - this.memberList = memberList; - this.members = {}; - for (let i = 0; i < memberNames.length; ++i) { - this.members[memberNames[i]] = Array.isArray(memberList[i]) ? memberList[i] : [memberList[i], 0]; + async deserializeHttpMessage(schema, context, response, arg4, arg5) { + let dataObject; + if (arg4 instanceof Set) { + dataObject = arg5; + } else { + dataObject = arg4; } + const deserializer = this.deserializer; + const ns = import_schema.NormalizedSchema.of(schema); + const nonHttpBindingMembers = []; + for (const [memberName, memberSchema] of ns.structIterator()) { + const memberTraits = memberSchema.getMemberTraits(); + if (memberTraits.httpPayload) { + const isStreaming = memberSchema.isStreaming(); + if (isStreaming) { + const isEventStream = memberSchema.isStructSchema(); + if (isEventStream) { + const context2 = this.serdeContext; + if (!context2.eventStreamMarshaller) { + throw new Error("@smithy/core - HttpProtocol: eventStreamMarshaller missing in serdeContext."); + } + const memberSchemas = memberSchema.getMemberSchemas(); + dataObject[memberName] = context2.eventStreamMarshaller.deserialize(response.body, async (event) => { + const unionMember = Object.keys(event).find((key) => { + return key !== "__type"; + }) ?? ""; + if (unionMember in memberSchemas) { + const eventStreamSchema = memberSchemas[unionMember]; + return { + [unionMember]: await deserializer.read(eventStreamSchema, event[unionMember].body) + }; + } else { + return { + $unknown: event + }; + } + }); + } else { + dataObject[memberName] = (0, import_util_stream2.sdkStreamMixin)(response.body); + } + } else if (response.body) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + dataObject[memberName] = await deserializer.read(memberSchema, bytes); + } + } + } else if (memberTraits.httpHeader) { + const key = String(memberTraits.httpHeader).toLowerCase(); + const value = response.headers[key]; + if (null != value) { + if (memberSchema.isListSchema()) { + const headerListValueSchema = memberSchema.getValueSchema(); + let sections; + if (headerListValueSchema.isTimestampSchema() && headerListValueSchema.getSchema() === import_schema.SCHEMA.TIMESTAMP_DEFAULT) { + sections = (0, import_serde.splitEvery)(value, ",", 2); + } else { + sections = (0, import_serde.splitHeader)(value); + } + const list = []; + for (const section of sections) { + list.push(await deserializer.read([headerListValueSchema, { httpHeader: key }], section.trim())); + } + dataObject[memberName] = list; + } else { + dataObject[memberName] = await deserializer.read(memberSchema, value); + } + } + } else if (memberTraits.httpPrefixHeaders !== void 0) { + dataObject[memberName] = {}; + for (const [header, value] of Object.entries(response.headers)) { + if (header.startsWith(memberTraits.httpPrefixHeaders)) { + dataObject[memberName][header.slice(memberTraits.httpPrefixHeaders.length)] = await deserializer.read( + [memberSchema.getValueSchema(), { httpHeader: header }], + value + ); + } + } + } else if (memberTraits.httpResponseCode) { + dataObject[memberName] = response.statusCode; + } else { + nonHttpBindingMembers.push(memberName); + } + } + return nonHttpBindingMembers; } }; -function struct(namespace, name, traits, memberNames, memberList) { - const schema = new StructureSchema(namespace + "#" + name, traits, memberNames, memberList); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/ErrorSchema.ts -var ErrorSchema = class extends StructureSchema { - constructor(name, traits, memberNames, memberList, ctor) { - super(name, traits, memberNames, memberList); - this.name = name; - this.traits = traits; - this.memberNames = memberNames; - this.memberList = memberList; - this.ctor = ctor; - } -}; -function error(namespace, name, traits = {}, memberNames, memberList, ctor) { - const schema = new ErrorSchema(namespace + "#" + name, traits, memberNames, memberList, ctor); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} - -// src/submodules/schema/schemas/sentinels.ts -var SCHEMA = { - BLOB: 21, - // 21 - STREAMING_BLOB: 42, - // 42 - BOOLEAN: 2, - // 2 - STRING: 0, - // 0 - NUMERIC: 1, - // 1 - BIG_INTEGER: 17, - // 17 - BIG_DECIMAL: 19, - // 19 - DOCUMENT: 15, - // 15 - TIMESTAMP_DEFAULT: 4, - // 4 - TIMESTAMP_DATE_TIME: 5, - // 5 - TIMESTAMP_HTTP_DATE: 6, - // 6 - TIMESTAMP_EPOCH_SECONDS: 7, - // 7 - LIST_MODIFIER: 64, - // 64 - MAP_MODIFIER: 128 - // 128 -}; - -// src/submodules/schema/schemas/SimpleSchema.ts -var SimpleSchema = class extends Schema { - constructor(name, schemaRef, traits) { - super(name, traits); - this.name = name; - this.schemaRef = schemaRef; - this.traits = traits; - } -}; -function sim(namespace, name, schemaRef, traits) { - const schema = new SimpleSchema(namespace + "#" + name, schemaRef, traits); - TypeRegistry.for(namespace).register(name, schema); - return schema; -} -// src/submodules/schema/schemas/NormalizedSchema.ts -var NormalizedSchema = class _NormalizedSchema { - /** - * @param ref - a polymorphic SchemaRef to be dereferenced/normalized. - * @param memberName - optional memberName if this NormalizedSchema should be considered a member schema. - */ - constructor(ref, memberName) { - this.ref = ref; - this.memberName = memberName; - const traitStack = []; - let _ref = ref; - let schema = ref; - this._isMemberSchema = false; - while (Array.isArray(_ref)) { - traitStack.push(_ref[1]); - _ref = _ref[0]; - schema = deref(_ref); - this._isMemberSchema = true; +// src/submodules/protocols/HttpBindingProtocol.ts +var HttpBindingProtocol = class extends HttpProtocol { + async serializeRequest(operationSchema, _input, context) { + const input = { + ..._input ?? {} + }; + const serializer = this.serializer; + const query = {}; + const headers = {}; + const endpoint = await context.endpoint(); + const ns = import_schema2.NormalizedSchema.of(operationSchema?.input); + const schema = ns.getSchema(); + let hasNonHttpBindingMember = false; + let payload; + const request = new import_protocol_http2.HttpRequest({ + protocol: "", + hostname: "", + port: void 0, + path: "", + fragment: void 0, + query, + headers, + body: void 0 + }); + if (endpoint) { + this.updateServiceEndpoint(request, endpoint); + this.setHostPrefix(request, operationSchema, input); + const opTraits = import_schema2.NormalizedSchema.translateTraits(operationSchema.traits); + if (opTraits.http) { + request.method = opTraits.http[0]; + const [path, search] = opTraits.http[1].split("?"); + if (request.path == "/") { + request.path = path; + } else { + request.path += path; + } + const traitSearchParams = new URLSearchParams(search ?? ""); + Object.assign(query, Object.fromEntries(traitSearchParams)); + } } - if (traitStack.length > 0) { - this.memberTraits = {}; - for (let i = traitStack.length - 1; i >= 0; --i) { - const traitSet = traitStack[i]; - Object.assign(this.memberTraits, _NormalizedSchema.translateTraits(traitSet)); + for (const [memberName, memberNs] of ns.structIterator()) { + const memberTraits = memberNs.getMergedTraits() ?? {}; + const inputMemberValue = input[memberName]; + if (inputMemberValue == null) { + continue; + } + if (memberTraits.httpPayload) { + const isStreaming = memberNs.isStreaming(); + if (isStreaming) { + const isEventStream = memberNs.isStructSchema(); + if (isEventStream) { + throw new Error("serialization of event streams is not yet implemented"); + } else { + payload = inputMemberValue; + } + } else { + serializer.write(memberNs, inputMemberValue); + payload = serializer.flush(); + } + delete input[memberName]; + } else if (memberTraits.httpLabel) { + serializer.write(memberNs, inputMemberValue); + const replacement = serializer.flush(); + if (request.path.includes(`{${memberName}+}`)) { + request.path = request.path.replace( + `{${memberName}+}`, + replacement.split("/").map(extendedEncodeURIComponent).join("/") + ); + } else if (request.path.includes(`{${memberName}}`)) { + request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); + } + delete input[memberName]; + } else if (memberTraits.httpHeader) { + serializer.write(memberNs, inputMemberValue); + headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); + delete input[memberName]; + } else if (typeof memberTraits.httpPrefixHeaders === "string") { + for (const [key, val] of Object.entries(inputMemberValue)) { + const amalgam = memberTraits.httpPrefixHeaders + key; + serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); + headers[amalgam.toLowerCase()] = serializer.flush(); + } + delete input[memberName]; + } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { + this.serializeQuery(memberNs, inputMemberValue, query); + delete input[memberName]; + } else { + hasNonHttpBindingMember = true; } - } else { - this.memberTraits = 0; } - if (schema instanceof _NormalizedSchema) { - this.name = schema.name; - this.traits = schema.traits; - this._isMemberSchema = schema._isMemberSchema; - this.schema = schema.schema; - this.memberTraits = Object.assign({}, schema.getMemberTraits(), this.getMemberTraits()); - this.normalizedTraits = void 0; - this.ref = schema.ref; - this.memberName = memberName ?? schema.memberName; + if (hasNonHttpBindingMember && input) { + serializer.write(schema, input); + payload = serializer.flush(); + } + request.headers = headers; + request.query = query; + request.body = payload; + return request; + } + serializeQuery(ns, data, query) { + const serializer = this.serializer; + const traits = ns.getMergedTraits(); + if (traits.httpQueryParams) { + for (const [key, val] of Object.entries(data)) { + if (!(key in query)) { + this.serializeQuery( + import_schema2.NormalizedSchema.of([ + ns.getValueSchema(), + { + // We pass on the traits to the sub-schema + // because we are still in the process of serializing the map itself. + ...traits, + httpQuery: key, + httpQueryParams: void 0 + } + ]), + val, + query + ); + } + } return; } - this.schema = deref(schema); - if (this.schema && typeof this.schema === "object") { - this.traits = this.schema?.traits ?? {}; + if (ns.isListSchema()) { + const sparse = !!ns.getMergedTraits().sparse; + const buffer = []; + for (const item of data) { + serializer.write([ns.getValueSchema(), traits], item); + const serializable = serializer.flush(); + if (sparse || serializable !== void 0) { + buffer.push(serializable); + } + } + query[traits.httpQuery] = buffer; } else { - this.traits = 0; - } - this.name = (typeof this.schema === "object" ? this.schema?.name : void 0) ?? this.memberName ?? this.getSchemaName(); - if (this._isMemberSchema && !memberName) { - throw new Error( - `@smithy/core/schema - NormalizedSchema member schema ${this.getName(true)} must initialize with memberName argument.` - ); - } - } - /** - * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. - */ - static of(ref, memberName) { - if (ref instanceof _NormalizedSchema) { - return ref; + serializer.write([ns, traits], data); + query[traits.httpQuery] = serializer.flush(); } - return new _NormalizedSchema(ref, memberName); } - /** - * @param indicator - numeric indicator for preset trait combination. - * @returns equivalent trait object. - */ - static translateTraits(indicator) { - if (typeof indicator === "object") { - return indicator; - } - indicator = indicator | 0; - const traits = {}; - if ((indicator & 1) === 1) { - traits.httpLabel = 1; - } - if ((indicator >> 1 & 1) === 1) { - traits.idempotent = 1; - } - if ((indicator >> 2 & 1) === 1) { - traits.idempotencyToken = 1; - } - if ((indicator >> 3 & 1) === 1) { - traits.sensitive = 1; - } - if ((indicator >> 4 & 1) === 1) { - traits.httpPayload = 1; - } - if ((indicator >> 5 & 1) === 1) { - traits.httpResponseCode = 1; + async deserializeResponse(operationSchema, context, response) { + const deserializer = this.deserializer; + const ns = import_schema2.NormalizedSchema.of(operationSchema.output); + const dataObject = {}; + if (response.statusCode >= 300) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(import_schema2.SCHEMA.DOCUMENT, bytes)); + } + await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); + throw new Error("@smithy/core/protocols - HTTP Protocol error handler failed to throw."); } - if ((indicator >> 6 & 1) === 1) { - traits.httpQueryParams = 1; + for (const header in response.headers) { + const value = response.headers[header]; + delete response.headers[header]; + response.headers[header.toLowerCase()] = value; } - return traits; - } - /** - * Creates a normalized member schema from the given schema and member name. - */ - static memberFrom(memberSchema, memberName) { - if (memberSchema instanceof _NormalizedSchema) { - memberSchema.memberName = memberName; - memberSchema._isMemberSchema = true; - return memberSchema; + const nonHttpBindingMembers = await this.deserializeHttpMessage(ns, context, response, dataObject); + if (nonHttpBindingMembers.length) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + const dataFromBody = await deserializer.read(ns, bytes); + for (const member of nonHttpBindingMembers) { + dataObject[member] = dataFromBody[member]; + } + } } - return new _NormalizedSchema(memberSchema, memberName); + const output = { + $metadata: this.deserializeMetadata(response), + ...dataObject + }; + return output; } - /** - * @returns the underlying non-normalized schema. - */ - getSchema() { - if (this.schema instanceof _NormalizedSchema) { - return this.schema = this.schema.getSchema(); +}; + +// src/submodules/protocols/RpcProtocol.ts +var import_schema3 = __nccwpck_require__(67635); +var import_protocol_http3 = __nccwpck_require__(20843); +var RpcProtocol = class extends HttpProtocol { + async serializeRequest(operationSchema, input, context) { + const serializer = this.serializer; + const query = {}; + const headers = {}; + const endpoint = await context.endpoint(); + const ns = import_schema3.NormalizedSchema.of(operationSchema?.input); + const schema = ns.getSchema(); + let payload; + const request = new import_protocol_http3.HttpRequest({ + protocol: "", + hostname: "", + port: void 0, + path: "/", + fragment: void 0, + query, + headers, + body: void 0 + }); + if (endpoint) { + this.updateServiceEndpoint(request, endpoint); + this.setHostPrefix(request, operationSchema, input); } - if (this.schema instanceof SimpleSchema) { - return deref(this.schema.schemaRef); + const _input = { + ...input + }; + if (input) { + serializer.write(schema, _input); + payload = serializer.flush(); } - return deref(this.schema); + request.headers = headers; + request.query = query; + request.body = payload; + request.method = "POST"; + return request; } - /** - * @param withNamespace - qualifies the name. - * @returns e.g. `MyShape` or `com.namespace#MyShape`. - */ - getName(withNamespace = false) { - if (!withNamespace) { - if (this.name && this.name.includes("#")) { - return this.name.split("#")[1]; + async deserializeResponse(operationSchema, context, response) { + const deserializer = this.deserializer; + const ns = import_schema3.NormalizedSchema.of(operationSchema.output); + const dataObject = {}; + if (response.statusCode >= 300) { + const bytes2 = await collectBody(response.body, context); + if (bytes2.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(import_schema3.SCHEMA.DOCUMENT, bytes2)); } + await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); + throw new Error("@smithy/core/protocols - RPC Protocol error handler failed to throw."); } - return this.name || void 0; - } - /** - * @returns the member name if the schema is a member schema. - * @throws Error when the schema isn't a member schema. - */ - getMemberName() { - if (!this.isMemberSchema()) { - throw new Error(`@smithy/core/schema - cannot get member name on non-member schema: ${this.getName(true)}`); + for (const header in response.headers) { + const value = response.headers[header]; + delete response.headers[header]; + response.headers[header.toLowerCase()] = value; } - return this.memberName; - } - isMemberSchema() { - return this._isMemberSchema; - } - isUnitSchema() { - return this.getSchema() === "unit"; - } - /** - * boolean methods on this class help control flow in shape serialization and deserialization. - */ - isListSchema() { - const inner = this.getSchema(); - if (typeof inner === "number") { - return inner >= SCHEMA.LIST_MODIFIER && inner < SCHEMA.MAP_MODIFIER; + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(ns, bytes)); } - return inner instanceof ListSchema; + const output = { + $metadata: this.deserializeMetadata(response), + ...dataObject + }; + return output; } - isMapSchema() { - const inner = this.getSchema(); - if (typeof inner === "number") { - return inner >= SCHEMA.MAP_MODIFIER && inner <= 255; +}; + +// src/submodules/protocols/requestBuilder.ts +var import_protocol_http4 = __nccwpck_require__(20843); + +// src/submodules/protocols/resolve-path.ts +var resolvedPath = (resolvedPath2, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== void 0) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); } - return inner instanceof MapSchema; - } - isDocumentSchema() { - return this.getSchema() === SCHEMA.DOCUMENT; - } - isStructSchema() { - const inner = this.getSchema(); - return inner !== null && typeof inner === "object" && "members" in inner || inner instanceof StructureSchema; - } - isBlobSchema() { - return this.getSchema() === SCHEMA.BLOB || this.getSchema() === SCHEMA.STREAMING_BLOB; - } - isTimestampSchema() { - const schema = this.getSchema(); - return typeof schema === "number" && schema >= SCHEMA.TIMESTAMP_DEFAULT && schema <= SCHEMA.TIMESTAMP_EPOCH_SECONDS; - } - isStringSchema() { - return this.getSchema() === SCHEMA.STRING; - } - isBooleanSchema() { - return this.getSchema() === SCHEMA.BOOLEAN; - } - isNumericSchema() { - return this.getSchema() === SCHEMA.NUMERIC; - } - isBigIntegerSchema() { - return this.getSchema() === SCHEMA.BIG_INTEGER; - } - isBigDecimalSchema() { - return this.getSchema() === SCHEMA.BIG_DECIMAL; + resolvedPath2 = resolvedPath2.replace( + uriLabel, + isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) + ); + } else { + throw new Error("No value provided for input HTTP label: " + memberName + "."); } - isStreaming() { - const streaming = !!this.getMergedTraits().streaming; - if (streaming) { - return true; - } - return this.getSchema() === SCHEMA.STREAMING_BLOB; + return resolvedPath2; +}; + +// src/submodules/protocols/requestBuilder.ts +function requestBuilder(input, context) { + return new RequestBuilder(input, context); +} +var RequestBuilder = class { + constructor(input, context) { + this.input = input; + this.context = context; + this.query = {}; + this.method = ""; + this.headers = {}; + this.path = ""; + this.body = null; + this.hostname = ""; + this.resolvePathStack = []; } - /** - * @returns own traits merged with member traits, where member traits of the same trait key take priority. - * This method is cached. - */ - getMergedTraits() { - if (this.normalizedTraits) { - return this.normalizedTraits; + async build() { + const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); + this.path = basePath; + for (const resolvePath of this.resolvePathStack) { + resolvePath(this.path); } - this.normalizedTraits = { - ...this.getOwnTraits(), - ...this.getMemberTraits() - }; - return this.normalizedTraits; - } - /** - * @returns only the member traits. If the schema is not a member, this returns empty. - */ - getMemberTraits() { - return _NormalizedSchema.translateTraits(this.memberTraits); - } - /** - * @returns only the traits inherent to the shape or member target shape if this schema is a member. - * If there are any member traits they are excluded. - */ - getOwnTraits() { - return _NormalizedSchema.translateTraits(this.traits); + return new import_protocol_http4.HttpRequest({ + protocol, + hostname: this.hostname || hostname, + port, + method: this.method, + path: this.path, + query: this.query, + body: this.body, + headers: this.headers + }); } /** - * @returns the map's key's schema. Returns a dummy Document schema if this schema is a Document. - * - * @throws Error if the schema is not a Map or Document. - */ - getKeySchema() { - if (this.isDocumentSchema()) { - return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], "key"); - } - if (!this.isMapSchema()) { - throw new Error(`@smithy/core/schema - cannot get key schema for non-map schema: ${this.getName(true)}`); - } - const schema = this.getSchema(); - if (typeof schema === "number") { - return _NormalizedSchema.memberFrom([63 & schema, 0], "key"); - } - return _NormalizedSchema.memberFrom([schema.keySchema, 0], "key"); + * Brevity setter for "hostname". + */ + hn(hostname) { + this.hostname = hostname; + return this; } /** - * @returns the schema of the map's value or list's member. - * Returns a dummy Document schema if this schema is a Document. - * - * @throws Error if the schema is not a Map, List, nor Document. + * Brevity initial builder for "basepath". */ - getValueSchema() { - const schema = this.getSchema(); - if (typeof schema === "number") { - if (this.isMapSchema()) { - return _NormalizedSchema.memberFrom([63 & schema, 0], "value"); - } else if (this.isListSchema()) { - return _NormalizedSchema.memberFrom([63 & schema, 0], "member"); - } - } - if (schema && typeof schema === "object") { - if (this.isStructSchema()) { - throw new Error(`cannot call getValueSchema() with StructureSchema ${this.getName(true)}`); - } - const collection = schema; - if ("valueSchema" in collection) { - if (this.isMapSchema()) { - return _NormalizedSchema.memberFrom([collection.valueSchema, 0], "value"); - } else if (this.isListSchema()) { - return _NormalizedSchema.memberFrom([collection.valueSchema, 0], "member"); - } - } - } - if (this.isDocumentSchema()) { - return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], "value"); - } - throw new Error(`@smithy/core/schema - the schema ${this.getName(true)} does not have a value member.`); + bp(uriLabel) { + this.resolvePathStack.push((basePath) => { + this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; + }); + return this; } /** - * @returns the NormalizedSchema for the given member name. The returned instance will return true for `isMemberSchema()` - * and will have the member name given. - * @param member - which member to retrieve and wrap. - * - * @throws Error if member does not exist or the schema is neither a document nor structure. - * Note that errors are assumed to be structures and unions are considered structures for these purposes. + * Brevity incremental builder for "path". */ - getMemberSchema(member) { - if (this.isStructSchema()) { - const struct2 = this.getSchema(); - if (!(member in struct2.members)) { - throw new Error( - `@smithy/core/schema - the schema ${this.getName(true)} does not have a member with name=${member}.` - ); - } - return _NormalizedSchema.memberFrom(struct2.members[member], member); - } - if (this.isDocumentSchema()) { - return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], member); - } - throw new Error(`@smithy/core/schema - the schema ${this.getName(true)} does not have members.`); + p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { + this.resolvePathStack.push((path) => { + this.path = resolvedPath(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); + }); + return this; } /** - * This can be used for checking the members as a hashmap. - * Prefer the structIterator method for iteration. - * - * This does NOT return list and map members, it is only for structures. - * - * @returns a map of member names to member schemas (normalized). + * Brevity setter for "headers". */ - getMemberSchemas() { - const { schema } = this; - const struct2 = schema; - if (!struct2 || typeof struct2 !== "object") { - return {}; - } - if ("members" in struct2) { - const buffer = {}; - for (const member of struct2.memberNames) { - buffer[member] = this.getMemberSchema(member); - } - return buffer; - } - return {}; + h(headers) { + this.headers = headers; + return this; } /** - * Allows iteration over members of a structure schema. - * Each yield is a pair of the member name and member schema. - * - * This avoids the overhead of calling Object.entries(ns.getMemberSchemas()). + * Brevity setter for "query". */ - *structIterator() { - if (this.isUnitSchema()) { - return; - } - if (!this.isStructSchema()) { - throw new Error("@smithy/core/schema - cannot acquire structIterator on non-struct schema."); - } - const struct2 = this.getSchema(); - for (let i = 0; i < struct2.memberNames.length; ++i) { - yield [struct2.memberNames[i], _NormalizedSchema.memberFrom([struct2.memberList[i], 0], struct2.memberNames[i])]; - } + q(query) { + this.query = query; + return this; } /** - * @returns a last-resort human-readable name for the schema if it has no other identifiers. + * Brevity setter for "body". */ - getSchemaName() { - const schema = this.getSchema(); - if (typeof schema === "number") { - const _schema = 63 & schema; - const container = 192 & schema; - const type = Object.entries(SCHEMA).find(([, value]) => { - return value === _schema; - })?.[0] ?? "Unknown"; - switch (container) { - case SCHEMA.MAP_MODIFIER: - return `${type}Map`; - case SCHEMA.LIST_MODIFIER: - return `${type}List`; - case 0: - return type; - } - } - return "Unknown"; + b(body) { + this.body = body; + return this; } -}; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 65409: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + /** + * Brevity setter for "method". + */ + m(method) { + this.method = method; + return this; } - return to; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/serde/index.ts -var serde_exports = {}; -__export(serde_exports, { - LazyJsonString: () => LazyJsonString, - NumericValue: () => NumericValue, - copyDocumentWithTransform: () => copyDocumentWithTransform, - dateToUtcString: () => dateToUtcString, - expectBoolean: () => expectBoolean, - expectByte: () => expectByte, - expectFloat32: () => expectFloat32, - expectInt: () => expectInt, - expectInt32: () => expectInt32, - expectLong: () => expectLong, - expectNonNull: () => expectNonNull, - expectNumber: () => expectNumber, - expectObject: () => expectObject, - expectShort: () => expectShort, - expectString: () => expectString, - expectUnion: () => expectUnion, - handleFloat: () => handleFloat, - limitedParseDouble: () => limitedParseDouble, - limitedParseFloat: () => limitedParseFloat, - limitedParseFloat32: () => limitedParseFloat32, - logger: () => logger, - nv: () => nv, - parseBoolean: () => parseBoolean, - parseEpochTimestamp: () => parseEpochTimestamp, - parseRfc3339DateTime: () => parseRfc3339DateTime, - parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, - parseRfc7231DateTime: () => parseRfc7231DateTime, - quoteHeader: () => quoteHeader, - splitEvery: () => splitEvery, - splitHeader: () => splitHeader, - strictParseByte: () => strictParseByte, - strictParseDouble: () => strictParseDouble, - strictParseFloat: () => strictParseFloat, - strictParseFloat32: () => strictParseFloat32, - strictParseInt: () => strictParseInt, - strictParseInt32: () => strictParseInt32, - strictParseLong: () => strictParseLong, - strictParseShort: () => strictParseShort -}); -module.exports = __toCommonJS(serde_exports); +// src/submodules/protocols/serde/FromStringShapeDeserializer.ts +var import_schema5 = __nccwpck_require__(67635); +var import_serde2 = __nccwpck_require__(65409); +var import_util_base64 = __nccwpck_require__(72722); +var import_util_utf8 = __nccwpck_require__(46090); -// src/submodules/serde/copyDocumentWithTransform.ts -var import_schema = __nccwpck_require__(67635); -var copyDocumentWithTransform = (source, schemaRef, transform = (_) => _) => { - const ns = import_schema.NormalizedSchema.of(schemaRef); - switch (typeof source) { - case "undefined": - case "boolean": - case "number": - case "string": - case "bigint": - case "symbol": - return transform(source, ns); - case "function": - case "object": - if (source === null) { - return transform(null, ns); - } - if (Array.isArray(source)) { - const newArray = new Array(source.length); - let i = 0; - for (const item of source) { - newArray[i++] = copyDocumentWithTransform(item, ns.getValueSchema(), transform); - } - return transform(newArray, ns); - } - if ("byteLength" in source) { - const newBytes = new Uint8Array(source.byteLength); - newBytes.set(source, 0); - return transform(newBytes, ns); - } - if (source instanceof Date) { - return transform(source, ns); - } - const newObject = {}; - if (ns.isMapSchema()) { - for (const key of Object.keys(source)) { - newObject[key] = copyDocumentWithTransform(source[key], ns.getValueSchema(), transform); - } - } else if (ns.isStructSchema()) { - for (const [key, memberSchema] of ns.structIterator()) { - newObject[key] = copyDocumentWithTransform(source[key], memberSchema, transform); - } - } else if (ns.isDocumentSchema()) { - for (const key of Object.keys(source)) { - newObject[key] = copyDocumentWithTransform(source[key], ns.getValueSchema(), transform); - } - } - return transform(newObject, ns); - default: - return transform(source, ns); +// src/submodules/protocols/serde/determineTimestampFormat.ts +var import_schema4 = __nccwpck_require__(67635); +function determineTimestampFormat(ns, settings) { + if (settings.timestampFormat.useTrait) { + if (ns.isTimestampSchema() && (ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_DATE_TIME || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_EPOCH_SECONDS)) { + return ns.getSchema(); + } } -}; + const { httpLabel, httpPrefixHeaders, httpHeader, httpQuery } = ns.getMergedTraits(); + const bindingFormat = settings.httpBindings ? typeof httpPrefixHeaders === "string" || Boolean(httpHeader) ? import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE : Boolean(httpQuery) || Boolean(httpLabel) ? import_schema4.SCHEMA.TIMESTAMP_DATE_TIME : void 0 : void 0; + return bindingFormat ?? settings.timestampFormat.default; +} -// src/submodules/serde/parse-utils.ts -var parseBoolean = (value) => { - switch (value) { - case "true": - return true; - case "false": - return false; - default: - throw new Error(`Unable to parse boolean value "${value}"`); +// src/submodules/protocols/serde/FromStringShapeDeserializer.ts +var FromStringShapeDeserializer = class { + constructor(settings) { + this.settings = settings; } -}; -var expectBoolean = (value) => { - if (value === null || value === void 0) { - return void 0; + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; } - if (typeof value === "number") { - if (value === 0 || value === 1) { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (value === 0) { - return false; + read(_schema, data) { + const ns = import_schema5.NormalizedSchema.of(_schema); + if (ns.isListSchema()) { + return (0, import_serde2.splitHeader)(data).map((item) => this.read(ns.getValueSchema(), item)); } - if (value === 1) { - return true; + if (ns.isBlobSchema()) { + return (this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(data); } - } - if (typeof value === "string") { - const lower = value.toLowerCase(); - if (lower === "false" || lower === "true") { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + if (ns.isTimestampSchema()) { + const format = determineTimestampFormat(ns, this.settings); + switch (format) { + case import_schema5.SCHEMA.TIMESTAMP_DATE_TIME: + return (0, import_serde2.parseRfc3339DateTimeWithOffset)(data); + case import_schema5.SCHEMA.TIMESTAMP_HTTP_DATE: + return (0, import_serde2.parseRfc7231DateTime)(data); + case import_schema5.SCHEMA.TIMESTAMP_EPOCH_SECONDS: + return (0, import_serde2.parseEpochTimestamp)(data); + default: + console.warn("Missing timestamp format, parsing value with Date constructor:", data); + return new Date(data); + } } - if (lower === "false") { - return false; + if (ns.isStringSchema()) { + const mediaType = ns.getMergedTraits().mediaType; + let intermediateValue = data; + if (mediaType) { + if (ns.getMergedTraits().httpHeader) { + intermediateValue = this.base64ToUtf8(intermediateValue); + } + const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); + if (isJson) { + intermediateValue = import_serde2.LazyJsonString.from(intermediateValue); + } + return intermediateValue; + } } - if (lower === "true") { - return true; + switch (true) { + case ns.isNumericSchema(): + return Number(data); + case ns.isBigIntegerSchema(): + return BigInt(data); + case ns.isBigDecimalSchema(): + return new import_serde2.NumericValue(data, "bigDecimal"); + case ns.isBooleanSchema(): + return String(data).toLowerCase() === "true"; } + return data; } - if (typeof value === "boolean") { - return value; + base64ToUtf8(base64String) { + return (this.serdeContext?.utf8Encoder ?? import_util_utf8.toUtf8)((this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(base64String)); } - throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); }; -var expectNumber = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - const parsed = parseFloat(value); - if (!Number.isNaN(parsed)) { - if (String(parsed) !== String(value)) { - logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); - } - return parsed; - } + +// src/submodules/protocols/serde/HttpInterceptingShapeDeserializer.ts +var import_schema6 = __nccwpck_require__(67635); +var import_util_utf82 = __nccwpck_require__(46090); +var HttpInterceptingShapeDeserializer = class { + constructor(codecDeserializer, codecSettings) { + this.codecDeserializer = codecDeserializer; + this.stringDeserializer = new FromStringShapeDeserializer(codecSettings); } - if (typeof value === "number") { - return value; + setSerdeContext(serdeContext) { + this.stringDeserializer.setSerdeContext(serdeContext); + this.codecDeserializer.setSerdeContext(serdeContext); + this.serdeContext = serdeContext; } - throw new TypeError(`Expected number, got ${typeof value}: ${value}`); -}; -var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); -var expectFloat32 = (value) => { - const expected = expectNumber(value); - if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { - if (Math.abs(expected) > MAX_FLOAT) { - throw new TypeError(`Expected 32-bit float, got ${value}`); + read(schema, data) { + const ns = import_schema6.NormalizedSchema.of(schema); + const traits = ns.getMergedTraits(); + const toString = this.serdeContext?.utf8Encoder ?? import_util_utf82.toUtf8; + if (traits.httpHeader || traits.httpResponseCode) { + return this.stringDeserializer.read(ns, toString(data)); } + if (traits.httpPayload) { + if (ns.isBlobSchema()) { + const toBytes = this.serdeContext?.utf8Decoder ?? import_util_utf82.fromUtf8; + if (typeof data === "string") { + return toBytes(data); + } + return data; + } else if (ns.isStringSchema()) { + if ("byteLength" in data) { + return toString(data); + } + return data; + } + } + return this.codecDeserializer.read(ns, data); } - return expected; -}; -var expectLong = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (Number.isInteger(value) && !Number.isNaN(value)) { - return value; - } - throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); }; -var expectInt = expectLong; -var expectInt32 = (value) => expectSizedInt(value, 32); -var expectShort = (value) => expectSizedInt(value, 16); -var expectByte = (value) => expectSizedInt(value, 8); -var expectSizedInt = (value, size) => { - const expected = expectLong(value); - if (expected !== void 0 && castInt(expected, size) !== expected) { - throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + +// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts +var import_schema8 = __nccwpck_require__(67635); + +// src/submodules/protocols/serde/ToStringShapeSerializer.ts +var import_schema7 = __nccwpck_require__(67635); +var import_serde3 = __nccwpck_require__(65409); +var import_util_base642 = __nccwpck_require__(72722); +var ToStringShapeSerializer = class { + constructor(settings) { + this.settings = settings; + this.stringBuffer = ""; + this.serdeContext = void 0; } - return expected; -}; -var castInt = (value, size) => { - switch (size) { - case 32: - return Int32Array.of(value)[0]; - case 16: - return Int16Array.of(value)[0]; - case 8: - return Int8Array.of(value)[0]; + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; } -}; -var expectNonNull = (value, location) => { - if (value === null || value === void 0) { - if (location) { - throw new TypeError(`Expected a non-null value for ${location}`); + write(schema, value) { + const ns = import_schema7.NormalizedSchema.of(schema); + switch (typeof value) { + case "object": + if (value === null) { + this.stringBuffer = "null"; + return; + } + if (ns.isTimestampSchema()) { + if (!(value instanceof Date)) { + throw new Error( + `@smithy/core/protocols - received non-Date value ${value} when schema expected Date in ${ns.getName(true)}` + ); + } + const format = determineTimestampFormat(ns, this.settings); + switch (format) { + case import_schema7.SCHEMA.TIMESTAMP_DATE_TIME: + this.stringBuffer = value.toISOString().replace(".000Z", "Z"); + break; + case import_schema7.SCHEMA.TIMESTAMP_HTTP_DATE: + this.stringBuffer = (0, import_serde3.dateToUtcString)(value); + break; + case import_schema7.SCHEMA.TIMESTAMP_EPOCH_SECONDS: + this.stringBuffer = String(value.getTime() / 1e3); + break; + default: + console.warn("Missing timestamp format, using epoch seconds", value); + this.stringBuffer = String(value.getTime() / 1e3); + } + return; + } + if (ns.isBlobSchema() && "byteLength" in value) { + this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(value); + return; + } + if (ns.isListSchema() && Array.isArray(value)) { + let buffer = ""; + for (const item of value) { + this.write([ns.getValueSchema(), ns.getMergedTraits()], item); + const headerItem = this.flush(); + const serialized = ns.getValueSchema().isTimestampSchema() ? headerItem : (0, import_serde3.quoteHeader)(headerItem); + if (buffer !== "") { + buffer += ", "; + } + buffer += serialized; + } + this.stringBuffer = buffer; + return; + } + this.stringBuffer = JSON.stringify(value, null, 2); + break; + case "string": + const mediaType = ns.getMergedTraits().mediaType; + let intermediateValue = value; + if (mediaType) { + const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); + if (isJson) { + intermediateValue = import_serde3.LazyJsonString.from(intermediateValue); + } + if (ns.getMergedTraits().httpHeader) { + this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(intermediateValue.toString()); + return; + } + } + this.stringBuffer = value; + break; + default: + this.stringBuffer = String(value); } - throw new TypeError("Expected a non-null value"); - } - return value; -}; -var expectObject = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "object" && !Array.isArray(value)) { - return value; - } - const receivedType = Array.isArray(value) ? "array" : typeof value; - throw new TypeError(`Expected object, got ${receivedType}: ${value}`); -}; -var expectString = (value) => { - if (value === null || value === void 0) { - return void 0; } - if (typeof value === "string") { - return value; - } - if (["boolean", "number", "bigint"].includes(typeof value)) { - logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); - return String(value); - } - throw new TypeError(`Expected string, got ${typeof value}: ${value}`); -}; -var expectUnion = (value) => { - if (value === null || value === void 0) { - return void 0; - } - const asObject = expectObject(value); - const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); - if (setKeys.length === 0) { - throw new TypeError(`Unions must have exactly one non-null member. None were found.`); - } - if (setKeys.length > 1) { - throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); - } - return asObject; -}; -var strictParseDouble = (value) => { - if (typeof value == "string") { - return expectNumber(parseNumber(value)); - } - return expectNumber(value); -}; -var strictParseFloat = strictParseDouble; -var strictParseFloat32 = (value) => { - if (typeof value == "string") { - return expectFloat32(parseNumber(value)); + flush() { + const buffer = this.stringBuffer; + this.stringBuffer = ""; + return buffer; } - return expectFloat32(value); }; -var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; -var parseNumber = (value) => { - const matches = value.match(NUMBER_REGEX); - if (matches === null || matches[0].length !== value.length) { - throw new TypeError(`Expected real number, got implicit NaN`); + +// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts +var HttpInterceptingShapeSerializer = class { + constructor(codecSerializer, codecSettings, stringSerializer = new ToStringShapeSerializer(codecSettings)) { + this.codecSerializer = codecSerializer; + this.stringSerializer = stringSerializer; } - return parseFloat(value); -}; -var limitedParseDouble = (value) => { - if (typeof value == "string") { - return parseFloatString(value); + setSerdeContext(serdeContext) { + this.codecSerializer.setSerdeContext(serdeContext); + this.stringSerializer.setSerdeContext(serdeContext); } - return expectNumber(value); -}; -var handleFloat = limitedParseDouble; -var limitedParseFloat = limitedParseDouble; -var limitedParseFloat32 = (value) => { - if (typeof value == "string") { - return parseFloatString(value); + write(schema, value) { + const ns = import_schema8.NormalizedSchema.of(schema); + const traits = ns.getMergedTraits(); + if (traits.httpHeader || traits.httpLabel || traits.httpQuery) { + this.stringSerializer.write(ns, value); + this.buffer = this.stringSerializer.flush(); + return; + } + return this.codecSerializer.write(ns, value); } - return expectFloat32(value); -}; -var parseFloatString = (value) => { - switch (value) { - case "NaN": - return NaN; - case "Infinity": - return Infinity; - case "-Infinity": - return -Infinity; - default: - throw new Error(`Unable to parse float value: ${value}`); + flush() { + if (this.buffer !== void 0) { + const buffer = this.buffer; + this.buffer = void 0; + return buffer; + } + return this.codecSerializer.flush(); } }; -var strictParseLong = (value) => { - if (typeof value === "string") { - return expectLong(parseNumber(value)); - } - return expectLong(value); +// Annotate the CommonJS export names for ESM import in node: +0 && (0); + + +/***/ }), + +/***/ 67635: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); }; -var strictParseInt = strictParseLong; -var strictParseInt32 = (value) => { - if (typeof value === "string") { - return expectInt32(parseNumber(value)); +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - return expectInt32(value); + return to; }; -var strictParseShort = (value) => { - if (typeof value === "string") { - return expectShort(parseNumber(value)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/submodules/schema/index.ts +var schema_exports = {}; +__export(schema_exports, { + ErrorSchema: () => ErrorSchema, + ListSchema: () => ListSchema, + MapSchema: () => MapSchema, + NormalizedSchema: () => NormalizedSchema, + OperationSchema: () => OperationSchema, + SCHEMA: () => SCHEMA, + Schema: () => Schema, + SimpleSchema: () => SimpleSchema, + StructureSchema: () => StructureSchema, + TypeRegistry: () => TypeRegistry, + deref: () => deref, + deserializerMiddlewareOption: () => deserializerMiddlewareOption, + error: () => error, + getSchemaSerdePlugin: () => getSchemaSerdePlugin, + list: () => list, + map: () => map, + op: () => op, + serializerMiddlewareOption: () => serializerMiddlewareOption, + sim: () => sim, + struct: () => struct +}); +module.exports = __toCommonJS(schema_exports); + +// src/submodules/schema/deref.ts +var deref = (schemaRef) => { + if (typeof schemaRef === "function") { + return schemaRef(); } - return expectShort(value); + return schemaRef; }; -var strictParseByte = (value) => { - if (typeof value === "string") { - return expectByte(parseNumber(value)); + +// src/submodules/schema/middleware/schemaDeserializationMiddleware.ts +var import_protocol_http = __nccwpck_require__(20843); +var import_util_middleware = __nccwpck_require__(99755); +var schemaDeserializationMiddleware = (config) => (next, context) => async (args) => { + const { response } = await next(args); + const { operationSchema } = (0, import_util_middleware.getSmithyContext)(context); + try { + const parsed = await config.protocol.deserializeResponse( + operationSchema, + { + ...config, + ...context + }, + response + ); + return { + response, + output: parsed + }; + } catch (error2) { + Object.defineProperty(error2, "$response", { + value: response + }); + if (!("$metadata" in error2)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + try { + error2.message += "\n " + hint; + } catch (e) { + if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { + console.warn(hint); + } else { + context.logger?.warn?.(hint); + } + } + if (typeof error2.$responseBodyText !== "undefined") { + if (error2.$response) { + error2.$response.body = error2.$responseBodyText; + } + } + try { + if (import_protocol_http.HttpResponse.isInstance(response)) { + const { headers = {} } = response; + const headerEntries = Object.entries(headers); + error2.$metadata = { + httpStatusCode: response.statusCode, + requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), + extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), + cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) + }; + } + } catch (e) { + } + } + throw error2; } - return expectByte(value); }; -var stackTraceWarning = (message) => { - return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); -}; -var logger = { - warn: console.warn +var findHeader = (pattern, headers) => { + return (headers.find(([k]) => { + return k.match(pattern); + }) || [void 0, void 0])[1]; }; -// src/submodules/serde/date-utils.ts -var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; -var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; -function dateToUtcString(date) { - const year = date.getUTCFullYear(); - const month = date.getUTCMonth(); - const dayOfWeek = date.getUTCDay(); - const dayOfMonthInt = date.getUTCDate(); - const hoursInt = date.getUTCHours(); - const minutesInt = date.getUTCMinutes(); - const secondsInt = date.getUTCSeconds(); - const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; - const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; - const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; - const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; - return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; -} -var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); -var parseRfc3339DateTime = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); +// src/submodules/schema/middleware/schemaSerializationMiddleware.ts +var import_util_middleware2 = __nccwpck_require__(99755); +var schemaSerializationMiddleware = (config) => (next, context) => async (args) => { + const { operationSchema } = (0, import_util_middleware2.getSmithyContext)(context); + const endpoint = context.endpointV2?.url && config.urlParser ? async () => config.urlParser(context.endpointV2.url) : config.endpoint; + const request = await config.protocol.serializeRequest(operationSchema, args.input, { + ...config, + ...context, + endpoint + }); + return next({ + ...args, + request + }); }; -var RFC3339_WITH_OFFSET = new RegExp( - /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ -); -var parseRfc3339DateTimeWithOffset = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339_WITH_OFFSET.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); - if (offsetStr.toUpperCase() != "Z") { - date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); - } - return date; + +// src/submodules/schema/middleware/getSchemaSerdePlugin.ts +var deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true }; -var IMF_FIXDATE = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ -); -var RFC_850_DATE = new RegExp( - /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ -); -var ASC_TIME = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ -); -var parseRfc7231DateTime = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-7231 date-times must be expressed as strings"); - } - let match = IMF_FIXDATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr, "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); - } - match = RFC_850_DATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return adjustRfc850Year( - buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { - hours, - minutes, - seconds, - fractionalMilliseconds - }) - ); - } - match = ASC_TIME.exec(value); - if (match) { - const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr.trimLeft(), "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); - } - throw new TypeError("Invalid RFC-7231 date-time value"); +var serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true }; -var parseEpochTimestamp = (value) => { - if (value === null || value === void 0) { - return void 0; +function getSchemaSerdePlugin(config) { + return { + applyToStack: (commandStack) => { + commandStack.add(schemaSerializationMiddleware(config), serializerMiddlewareOption); + commandStack.add(schemaDeserializationMiddleware(config), deserializerMiddlewareOption); + config.protocol.setSerdeContext(config); + } + }; +} + +// src/submodules/schema/TypeRegistry.ts +var TypeRegistry = class _TypeRegistry { + constructor(namespace, schemas = /* @__PURE__ */ new Map()) { + this.namespace = namespace; + this.schemas = schemas; } - let valueAsDouble; - if (typeof value === "number") { - valueAsDouble = value; - } else if (typeof value === "string") { - valueAsDouble = strictParseDouble(value); - } else if (typeof value === "object" && value.tag === 1) { - valueAsDouble = value.value; - } else { - throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + static { + this.registries = /* @__PURE__ */ new Map(); } - if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { - throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); + /** + * @param namespace - specifier. + * @returns the schema for that namespace, creating it if necessary. + */ + static for(namespace) { + if (!_TypeRegistry.registries.has(namespace)) { + _TypeRegistry.registries.set(namespace, new _TypeRegistry(namespace)); + } + return _TypeRegistry.registries.get(namespace); } - return new Date(Math.round(valueAsDouble * 1e3)); -}; -var buildDate = (year, month, day, time) => { - const adjustedMonth = month - 1; - validateDayOfMonth(year, adjustedMonth, day); - return new Date( - Date.UTC( - year, - adjustedMonth, - day, - parseDateValue(time.hours, "hour", 0, 23), - parseDateValue(time.minutes, "minute", 0, 59), - // seconds can go up to 60 for leap seconds - parseDateValue(time.seconds, "seconds", 0, 60), - parseMilliseconds(time.fractionalMilliseconds) - ) - ); -}; -var parseTwoDigitYear = (value) => { - const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); - const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); - if (valueInThisCentury < thisYear) { - return valueInThisCentury + 100; + /** + * Adds the given schema to a type registry with the same namespace. + * + * @param shapeId - to be registered. + * @param schema - to be registered. + */ + register(shapeId, schema) { + const qualifiedName = this.normalizeShapeId(shapeId); + const registry = _TypeRegistry.for(this.getNamespace(shapeId)); + registry.schemas.set(qualifiedName, schema); } - return valueInThisCentury; -}; -var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; -var adjustRfc850Year = (input) => { - if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { - return new Date( - Date.UTC( - input.getUTCFullYear() - 100, - input.getUTCMonth(), - input.getUTCDate(), - input.getUTCHours(), - input.getUTCMinutes(), - input.getUTCSeconds(), - input.getUTCMilliseconds() - ) - ); + /** + * @param shapeId - query. + * @returns the schema. + */ + getSchema(shapeId) { + const id = this.normalizeShapeId(shapeId); + if (!this.schemas.has(id)) { + throw new Error(`@smithy/core/schema - schema not found for ${id}`); + } + return this.schemas.get(id); } - return input; -}; -var parseMonthByShortName = (value) => { - const monthIdx = MONTHS.indexOf(value); - if (monthIdx < 0) { - throw new TypeError(`Invalid month: ${value}`); + /** + * The smithy-typescript code generator generates a synthetic (i.e. unmodeled) base exception, + * because generated SDKs before the introduction of schemas have the notion of a ServiceBaseException, which + * is unique per service/model. + * + * This is generated under a unique prefix that is combined with the service namespace, and this + * method is used to retrieve it. + * + * The base exception synthetic schema is used when an error is returned by a service, but we cannot + * determine what existing schema to use to deserialize it. + * + * @returns the synthetic base exception of the service namespace associated with this registry instance. + */ + getBaseException() { + for (const [id, schema] of this.schemas.entries()) { + if (id.startsWith("smithy.ts.sdk.synthetic.") && id.endsWith("ServiceException")) { + return schema; + } + } + return void 0; } - return monthIdx + 1; -}; -var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; -var validateDayOfMonth = (year, month, day) => { - let maxDays = DAYS_IN_MONTH[month]; - if (month === 1 && isLeapYear(year)) { - maxDays = 29; + /** + * @param predicate - criterion. + * @returns a schema in this registry matching the predicate. + */ + find(predicate) { + return [...this.schemas.values()].find(predicate); } - if (day > maxDays) { - throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); + /** + * Unloads the current TypeRegistry. + */ + destroy() { + _TypeRegistry.registries.delete(this.namespace); + this.schemas.clear(); } -}; -var isLeapYear = (year) => { - return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); -}; -var parseDateValue = (value, type, lower, upper) => { - const dateVal = strictParseByte(stripLeadingZeroes(value)); - if (dateVal < lower || dateVal > upper) { - throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + normalizeShapeId(shapeId) { + if (shapeId.includes("#")) { + return shapeId; + } + return this.namespace + "#" + shapeId; } - return dateVal; -}; -var parseMilliseconds = (value) => { - if (value === null || value === void 0) { - return 0; + getNamespace(shapeId) { + return this.normalizeShapeId(shapeId).split("#")[0]; } - return strictParseFloat32("0." + value) * 1e3; }; -var parseOffsetToMilliseconds = (value) => { - const directionStr = value[0]; - let direction = 1; - if (directionStr == "+") { - direction = 1; - } else if (directionStr == "-") { - direction = -1; - } else { - throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + +// src/submodules/schema/schemas/Schema.ts +var Schema = class { + constructor(name, traits) { + this.name = name; + this.traits = traits; } - const hour = Number(value.substring(1, 3)); - const minute = Number(value.substring(4, 6)); - return direction * (hour * 60 + minute) * 60 * 1e3; }; -var stripLeadingZeroes = (value) => { - let idx = 0; - while (idx < value.length - 1 && value.charAt(idx) === "0") { - idx++; + +// src/submodules/schema/schemas/ListSchema.ts +var ListSchema = class _ListSchema extends Schema { + constructor(name, traits, valueSchema) { + super(name, traits); + this.name = name; + this.traits = traits; + this.valueSchema = valueSchema; + this.symbol = _ListSchema.symbol; } - if (idx === 0) { - return value; + static { + this.symbol = Symbol.for("@smithy/core/schema::ListSchema"); } - return value.slice(idx); -}; - -// src/submodules/serde/lazy-json.ts -var LazyJsonString = function LazyJsonString2(val) { - const str = Object.assign(new String(val), { - deserializeJSON() { - return JSON.parse(String(val)); - }, - toString() { - return String(val); - }, - toJSON() { - return String(val); + static [Symbol.hasInstance](lhs) { + const isPrototype = _ListSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const list2 = lhs; + return list2.symbol === _ListSchema.symbol; } - }); - return str; -}; -LazyJsonString.from = (object) => { - if (object && typeof object === "object" && (object instanceof LazyJsonString || "deserializeJSON" in object)) { - return object; - } else if (typeof object === "string" || Object.getPrototypeOf(object) === String.prototype) { - return LazyJsonString(String(object)); + return isPrototype; } - return LazyJsonString(JSON.stringify(object)); }; -LazyJsonString.fromObject = LazyJsonString.from; - -// src/submodules/serde/quote-header.ts -function quoteHeader(part) { - if (part.includes(",") || part.includes('"')) { - part = `"${part.replace(/"/g, '\\"')}"`; - } - return part; +function list(namespace, name, traits = {}, valueSchema) { + const schema = new ListSchema( + namespace + "#" + name, + traits, + typeof valueSchema === "function" ? valueSchema() : valueSchema + ); + TypeRegistry.for(namespace).register(name, schema); + return schema; } -// src/submodules/serde/split-every.ts -function splitEvery(value, delimiter, numDelimiters) { - if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { - throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); +// src/submodules/schema/schemas/MapSchema.ts +var MapSchema = class _MapSchema extends Schema { + constructor(name, traits, keySchema, valueSchema) { + super(name, traits); + this.name = name; + this.traits = traits; + this.keySchema = keySchema; + this.valueSchema = valueSchema; + this.symbol = _MapSchema.symbol; } - const segments = value.split(delimiter); - if (numDelimiters === 1) { - return segments; + static { + this.symbol = Symbol.for("@smithy/core/schema::MapSchema"); } - const compoundSegments = []; - let currentSegment = ""; - for (let i = 0; i < segments.length; i++) { - if (currentSegment === "") { - currentSegment = segments[i]; - } else { - currentSegment += delimiter + segments[i]; - } - if ((i + 1) % numDelimiters === 0) { - compoundSegments.push(currentSegment); - currentSegment = ""; + static [Symbol.hasInstance](lhs) { + const isPrototype = _MapSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const map2 = lhs; + return map2.symbol === _MapSchema.symbol; } + return isPrototype; } - if (currentSegment !== "") { - compoundSegments.push(currentSegment); +}; +function map(namespace, name, traits = {}, keySchema, valueSchema) { + const schema = new MapSchema( + namespace + "#" + name, + traits, + keySchema, + typeof valueSchema === "function" ? valueSchema() : valueSchema + ); + TypeRegistry.for(namespace).register(name, schema); + return schema; +} + +// src/submodules/schema/schemas/OperationSchema.ts +var OperationSchema = class extends Schema { + constructor(name, traits, input, output) { + super(name, traits); + this.name = name; + this.traits = traits; + this.input = input; + this.output = output; } - return compoundSegments; +}; +function op(namespace, name, traits = {}, input, output) { + const schema = new OperationSchema(namespace + "#" + name, traits, input, output); + TypeRegistry.for(namespace).register(name, schema); + return schema; } -// src/submodules/serde/split-header.ts -var splitHeader = (value) => { - const z = value.length; - const values = []; - let withinQuotes = false; - let prevChar = void 0; - let anchor = 0; - for (let i = 0; i < z; ++i) { - const char = value[i]; - switch (char) { - case `"`: - if (prevChar !== "\\") { - withinQuotes = !withinQuotes; - } - break; - case ",": - if (!withinQuotes) { - values.push(value.slice(anchor, i)); - anchor = i + 1; - } - break; - default: +// src/submodules/schema/schemas/StructureSchema.ts +var StructureSchema = class _StructureSchema extends Schema { + constructor(name, traits, memberNames, memberList) { + super(name, traits); + this.name = name; + this.traits = traits; + this.memberNames = memberNames; + this.memberList = memberList; + this.symbol = _StructureSchema.symbol; + this.members = {}; + for (let i = 0; i < memberNames.length; ++i) { + this.members[memberNames[i]] = Array.isArray(memberList[i]) ? memberList[i] : [memberList[i], 0]; } - prevChar = char; } - values.push(value.slice(anchor)); - return values.map((v) => { - v = v.trim(); - const z2 = v.length; - if (z2 < 2) { - return v; - } - if (v[0] === `"` && v[z2 - 1] === `"`) { - v = v.slice(1, z2 - 1); + static { + this.symbol = Symbol.for("@smithy/core/schema::StructureSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _StructureSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const struct2 = lhs; + return struct2.symbol === _StructureSchema.symbol; } - return v.replace(/\\"/g, '"'); - }); + return isPrototype; + } }; +function struct(namespace, name, traits, memberNames, memberList) { + const schema = new StructureSchema(namespace + "#" + name, traits, memberNames, memberList); + TypeRegistry.for(namespace).register(name, schema); + return schema; +} -// src/submodules/serde/value/NumericValue.ts -var NumericValue = class { - constructor(string, type) { - this.string = string; - this.type = type; - let dot = 0; - for (let i = 0; i < string.length; ++i) { - const char = string.charCodeAt(i); - if (i === 0 && char === 45) { - continue; - } - if (char === 46) { - if (dot) { - throw new Error("@smithy/core/serde - NumericValue must contain at most one decimal point."); - } - dot = 1; - continue; - } - if (char < 48 || char > 57) { - throw new Error( - `@smithy/core/serde - NumericValue must only contain [0-9], at most one decimal point ".", and an optional negation prefix "-".` - ); - } - } +// src/submodules/schema/schemas/ErrorSchema.ts +var ErrorSchema = class _ErrorSchema extends StructureSchema { + constructor(name, traits, memberNames, memberList, ctor) { + super(name, traits, memberNames, memberList); + this.name = name; + this.traits = traits; + this.memberNames = memberNames; + this.memberList = memberList; + this.ctor = ctor; + this.symbol = _ErrorSchema.symbol; } - toString() { - return this.string; + static { + this.symbol = Symbol.for("@smithy/core/schema::ErrorSchema"); } - [Symbol.hasInstance](object) { - if (!object || typeof object !== "object") { - return false; - } - const _nv = object; - if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name === "NumericValue") { - return true; + static [Symbol.hasInstance](lhs) { + const isPrototype = _ErrorSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const err = lhs; + return err.symbol === _ErrorSchema.symbol; } - return false; + return isPrototype; } }; -function nv(input) { - return new NumericValue(String(input), "bigDecimal"); +function error(namespace, name, traits = {}, memberNames, memberList, ctor) { + const schema = new ErrorSchema(namespace + "#" + name, traits, memberNames, memberList, ctor); + TypeRegistry.for(namespace).register(name, schema); + return schema; } -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 9136: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +// src/submodules/schema/schemas/sentinels.ts +var SCHEMA = { + BLOB: 21, + // 21 + STREAMING_BLOB: 42, + // 42 + BOOLEAN: 2, + // 2 + STRING: 0, + // 0 + NUMERIC: 1, + // 1 + BIG_INTEGER: 17, + // 17 + BIG_DECIMAL: 19, + // 19 + DOCUMENT: 15, + // 15 + TIMESTAMP_DEFAULT: 4, + // 4 + TIMESTAMP_DATE_TIME: 5, + // 5 + TIMESTAMP_HTTP_DATE: 6, + // 6 + TIMESTAMP_EPOCH_SECONDS: 7, + // 7 + LIST_MODIFIER: 64, + // 64 + MAP_MODIFIER: 128 + // 128 }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + +// src/submodules/schema/schemas/SimpleSchema.ts +var SimpleSchema = class _SimpleSchema extends Schema { + constructor(name, schemaRef, traits) { + super(name, traits); + this.name = name; + this.schemaRef = schemaRef; + this.traits = traits; + this.symbol = _SimpleSchema.symbol; + } + static { + this.symbol = Symbol.for("@smithy/core/schema::SimpleSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _SimpleSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const sim2 = lhs; + return sim2.symbol === _SimpleSchema.symbol; + } + return isPrototype; } - return to; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - FetchHttpHandler: () => FetchHttpHandler, - keepAliveSupport: () => keepAliveSupport, - streamCollector: () => streamCollector -}); -module.exports = __toCommonJS(src_exports); - -// src/fetch-http-handler.ts -var import_protocol_http = __nccwpck_require__(20843); -var import_querystring_builder = __nccwpck_require__(14959); - -// src/create-request.ts -function createRequest(url, requestOptions) { - return new Request(url, requestOptions); +function sim(namespace, name, schemaRef, traits) { + const schema = new SimpleSchema(namespace + "#" + name, schemaRef, traits); + TypeRegistry.for(namespace).register(name, schema); + return schema; } -__name(createRequest, "createRequest"); -// src/request-timeout.ts -function requestTimeout(timeoutInMs = 0) { - return new Promise((resolve, reject) => { - if (timeoutInMs) { - setTimeout(() => { - const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); - timeoutError.name = "TimeoutError"; - reject(timeoutError); - }, timeoutInMs); +// src/submodules/schema/schemas/NormalizedSchema.ts +var NormalizedSchema = class _NormalizedSchema { + /** + * @param ref - a polymorphic SchemaRef to be dereferenced/normalized. + * @param memberName - optional memberName if this NormalizedSchema should be considered a member schema. + */ + constructor(ref, memberName) { + this.ref = ref; + this.memberName = memberName; + this.symbol = _NormalizedSchema.symbol; + const traitStack = []; + let _ref = ref; + let schema = ref; + this._isMemberSchema = false; + while (Array.isArray(_ref)) { + traitStack.push(_ref[1]); + _ref = _ref[0]; + schema = deref(_ref); + this._isMemberSchema = true; + } + if (traitStack.length > 0) { + this.memberTraits = {}; + for (let i = traitStack.length - 1; i >= 0; --i) { + const traitSet = traitStack[i]; + Object.assign(this.memberTraits, _NormalizedSchema.translateTraits(traitSet)); + } + } else { + this.memberTraits = 0; + } + if (schema instanceof _NormalizedSchema) { + this.name = schema.name; + this.traits = schema.traits; + this._isMemberSchema = schema._isMemberSchema; + this.schema = schema.schema; + this.memberTraits = Object.assign({}, schema.getMemberTraits(), this.getMemberTraits()); + this.normalizedTraits = void 0; + this.ref = schema.ref; + this.memberName = memberName ?? schema.memberName; + return; + } + this.schema = deref(schema); + if (this.schema && typeof this.schema === "object") { + this.traits = this.schema?.traits ?? {}; + } else { + this.traits = 0; + } + this.name = (typeof this.schema === "object" ? this.schema?.name : void 0) ?? this.memberName ?? this.getSchemaName(); + if (this._isMemberSchema && !memberName) { + throw new Error( + `@smithy/core/schema - NormalizedSchema member schema ${this.getName( + true + )} must initialize with memberName argument.` + ); + } + } + static { + this.symbol = Symbol.for("@smithy/core/schema::NormalizedSchema"); + } + static [Symbol.hasInstance](lhs) { + const isPrototype = _NormalizedSchema.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const ns = lhs; + return ns.symbol === _NormalizedSchema.symbol; + } + return isPrototype; + } + /** + * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. + */ + static of(ref, memberName) { + if (ref instanceof _NormalizedSchema) { + return ref; + } + return new _NormalizedSchema(ref, memberName); + } + /** + * @param indicator - numeric indicator for preset trait combination. + * @returns equivalent trait object. + */ + static translateTraits(indicator) { + if (typeof indicator === "object") { + return indicator; + } + indicator = indicator | 0; + const traits = {}; + if ((indicator & 1) === 1) { + traits.httpLabel = 1; + } + if ((indicator >> 1 & 1) === 1) { + traits.idempotent = 1; + } + if ((indicator >> 2 & 1) === 1) { + traits.idempotencyToken = 1; + } + if ((indicator >> 3 & 1) === 1) { + traits.sensitive = 1; + } + if ((indicator >> 4 & 1) === 1) { + traits.httpPayload = 1; + } + if ((indicator >> 5 & 1) === 1) { + traits.httpResponseCode = 1; } - }); -} -__name(requestTimeout, "requestTimeout"); - -// src/fetch-http-handler.ts -var keepAliveSupport = { - supported: void 0 -}; -var FetchHttpHandler = class _FetchHttpHandler { - static { - __name(this, "FetchHttpHandler"); + if ((indicator >> 6 & 1) === 1) { + traits.httpQueryParams = 1; + } + return traits; } /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. + * Creates a normalized member schema from the given schema and member name. */ - static create(instanceOrOptions) { - if (typeof instanceOrOptions?.handle === "function") { - return instanceOrOptions; + static memberFrom(memberSchema, memberName) { + if (memberSchema instanceof _NormalizedSchema) { + memberSchema.memberName = memberName; + memberSchema._isMemberSchema = true; + return memberSchema; } - return new _FetchHttpHandler(instanceOrOptions); + return new _NormalizedSchema(memberSchema, memberName); } - constructor(options) { - if (typeof options === "function") { - this.configProvider = options().then((opts) => opts || {}); - } else { - this.config = options ?? {}; - this.configProvider = Promise.resolve(this.config); + /** + * @returns the underlying non-normalized schema. + */ + getSchema() { + if (this.schema instanceof _NormalizedSchema) { + return this.schema = this.schema.getSchema(); } - if (keepAliveSupport.supported === void 0) { - keepAliveSupport.supported = Boolean( - typeof Request !== "undefined" && "keepalive" in createRequest("https://[::1]") - ); + if (this.schema instanceof SimpleSchema) { + return deref(this.schema.schemaRef); } + return deref(this.schema); } - destroy() { + /** + * @param withNamespace - qualifies the name. + * @returns e.g. `MyShape` or `com.namespace#MyShape`. + */ + getName(withNamespace = false) { + if (!withNamespace) { + if (this.name && this.name.includes("#")) { + return this.name.split("#")[1]; + } + } + return this.name || void 0; } - async handle(request, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; + /** + * @returns the member name if the schema is a member schema. + * @throws Error when the schema isn't a member schema. + */ + getMemberName() { + if (!this.isMemberSchema()) { + throw new Error(`@smithy/core/schema - cannot get member name on non-member schema: ${this.getName(true)}`); } - const requestTimeoutInMs = this.config.requestTimeout; - const keepAlive = this.config.keepAlive === true; - const credentials = this.config.credentials; - if (abortSignal?.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - return Promise.reject(abortError); + return this.memberName; + } + isMemberSchema() { + return this._isMemberSchema; + } + isUnitSchema() { + return this.getSchema() === "unit"; + } + /** + * boolean methods on this class help control flow in shape serialization and deserialization. + */ + isListSchema() { + const inner = this.getSchema(); + if (typeof inner === "number") { + return inner >= SCHEMA.LIST_MODIFIER && inner < SCHEMA.MAP_MODIFIER; } - let path = request.path; - const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); - if (queryString) { - path += `?${queryString}`; + return inner instanceof ListSchema; + } + isMapSchema() { + const inner = this.getSchema(); + if (typeof inner === "number") { + return inner >= SCHEMA.MAP_MODIFIER && inner <= 255; } - if (request.fragment) { - path += `#${request.fragment}`; + return inner instanceof MapSchema; + } + isDocumentSchema() { + return this.getSchema() === SCHEMA.DOCUMENT; + } + isStructSchema() { + const inner = this.getSchema(); + return inner !== null && typeof inner === "object" && "members" in inner || inner instanceof StructureSchema; + } + isBlobSchema() { + return this.getSchema() === SCHEMA.BLOB || this.getSchema() === SCHEMA.STREAMING_BLOB; + } + isTimestampSchema() { + const schema = this.getSchema(); + return typeof schema === "number" && schema >= SCHEMA.TIMESTAMP_DEFAULT && schema <= SCHEMA.TIMESTAMP_EPOCH_SECONDS; + } + isStringSchema() { + return this.getSchema() === SCHEMA.STRING; + } + isBooleanSchema() { + return this.getSchema() === SCHEMA.BOOLEAN; + } + isNumericSchema() { + return this.getSchema() === SCHEMA.NUMERIC; + } + isBigIntegerSchema() { + return this.getSchema() === SCHEMA.BIG_INTEGER; + } + isBigDecimalSchema() { + return this.getSchema() === SCHEMA.BIG_DECIMAL; + } + isStreaming() { + const streaming = !!this.getMergedTraits().streaming; + if (streaming) { + return true; } - let auth = ""; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}@`; + return this.getSchema() === SCHEMA.STREAMING_BLOB; + } + /** + * @returns own traits merged with member traits, where member traits of the same trait key take priority. + * This method is cached. + */ + getMergedTraits() { + if (this.normalizedTraits) { + return this.normalizedTraits; } - const { port, method } = request; - const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; - const body = method === "GET" || method === "HEAD" ? void 0 : request.body; - const requestOptions = { - body, - headers: new Headers(request.headers), - method, - credentials + this.normalizedTraits = { + ...this.getOwnTraits(), + ...this.getMemberTraits() }; - if (this.config?.cache) { - requestOptions.cache = this.config.cache; - } - if (body) { - requestOptions.duplex = "half"; + return this.normalizedTraits; + } + /** + * @returns only the member traits. If the schema is not a member, this returns empty. + */ + getMemberTraits() { + return _NormalizedSchema.translateTraits(this.memberTraits); + } + /** + * @returns only the traits inherent to the shape or member target shape if this schema is a member. + * If there are any member traits they are excluded. + */ + getOwnTraits() { + return _NormalizedSchema.translateTraits(this.traits); + } + /** + * @returns the map's key's schema. Returns a dummy Document schema if this schema is a Document. + * + * @throws Error if the schema is not a Map or Document. + */ + getKeySchema() { + if (this.isDocumentSchema()) { + return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], "key"); } - if (typeof AbortController !== "undefined") { - requestOptions.signal = abortSignal; + if (!this.isMapSchema()) { + throw new Error(`@smithy/core/schema - cannot get key schema for non-map schema: ${this.getName(true)}`); } - if (keepAliveSupport.supported) { - requestOptions.keepalive = keepAlive; + const schema = this.getSchema(); + if (typeof schema === "number") { + return _NormalizedSchema.memberFrom([63 & schema, 0], "key"); } - if (typeof this.config.requestInit === "function") { - Object.assign(requestOptions, this.config.requestInit(request)); + return _NormalizedSchema.memberFrom([schema.keySchema, 0], "key"); + } + /** + * @returns the schema of the map's value or list's member. + * Returns a dummy Document schema if this schema is a Document. + * + * @throws Error if the schema is not a Map, List, nor Document. + */ + getValueSchema() { + const schema = this.getSchema(); + if (typeof schema === "number") { + if (this.isMapSchema()) { + return _NormalizedSchema.memberFrom([63 & schema, 0], "value"); + } else if (this.isListSchema()) { + return _NormalizedSchema.memberFrom([63 & schema, 0], "member"); + } } - let removeSignalEventListener = /* @__PURE__ */ __name(() => { - }, "removeSignalEventListener"); - const fetchRequest = createRequest(url, requestOptions); - const raceOfPromises = [ - fetch(fetchRequest).then((response) => { - const fetchHeaders = response.headers; - const transformedHeaders = {}; - for (const pair of fetchHeaders.entries()) { - transformedHeaders[pair[0]] = pair[1]; - } - const hasReadableStream = response.body != void 0; - if (!hasReadableStream) { - return response.blob().then((body2) => ({ - response: new import_protocol_http.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: body2 - }) - })); + if (schema && typeof schema === "object") { + if (this.isStructSchema()) { + throw new Error(`cannot call getValueSchema() with StructureSchema ${this.getName(true)}`); + } + const collection = schema; + if ("valueSchema" in collection) { + if (this.isMapSchema()) { + return _NormalizedSchema.memberFrom([collection.valueSchema, 0], "value"); + } else if (this.isListSchema()) { + return _NormalizedSchema.memberFrom([collection.valueSchema, 0], "member"); } - return { - response: new import_protocol_http.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: response.body - }) - }; - }), - requestTimeout(requestTimeoutInMs) - ]; - if (abortSignal) { - raceOfPromises.push( - new Promise((resolve, reject) => { - const onAbort = /* @__PURE__ */ __name(() => { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); - } else { - abortSignal.onabort = onAbort; - } - }) - ); + } } - return Promise.race(raceOfPromises).finally(removeSignalEventListener); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - config[key] = value; - return config; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } -}; - -// src/stream-collector.ts -var import_util_base64 = __nccwpck_require__(72722); -var streamCollector = /* @__PURE__ */ __name(async (stream) => { - if (typeof Blob === "function" && stream instanceof Blob || stream.constructor?.name === "Blob") { - if (Blob.prototype.arrayBuffer !== void 0) { - return new Uint8Array(await stream.arrayBuffer()); + if (this.isDocumentSchema()) { + return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], "value"); } - return collectBlob(stream); + throw new Error(`@smithy/core/schema - the schema ${this.getName(true)} does not have a value member.`); } - return collectStream(stream); -}, "streamCollector"); -async function collectBlob(blob) { - const base64 = await readToBase64(blob); - const arrayBuffer = (0, import_util_base64.fromBase64)(base64); - return new Uint8Array(arrayBuffer); -} -__name(collectBlob, "collectBlob"); -async function collectStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; + /** + * @returns the NormalizedSchema for the given member name. The returned instance will return true for `isMemberSchema()` + * and will have the member name given. + * @param member - which member to retrieve and wrap. + * + * @throws Error if member does not exist or the schema is neither a document nor structure. + * Note that errors are assumed to be structures and unions are considered structures for these purposes. + */ + getMemberSchema(member) { + if (this.isStructSchema()) { + const struct2 = this.getSchema(); + if (!(member in struct2.members)) { + throw new Error( + `@smithy/core/schema - the schema ${this.getName(true)} does not have a member with name=${member}.` + ); + } + return _NormalizedSchema.memberFrom(struct2.members[member], member); } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; + if (this.isDocumentSchema()) { + return _NormalizedSchema.memberFrom([SCHEMA.DOCUMENT, 0], member); + } + throw new Error(`@smithy/core/schema - the schema ${this.getName(true)} does not have members.`); } - return collected; -} -__name(collectStream, "collectStream"); -function readToBase64(blob) { - return new Promise((resolve, reject) => { - const reader = new FileReader(); - reader.onloadend = () => { - if (reader.readyState !== 2) { - return reject(new Error("Reader aborted too early")); + /** + * This can be used for checking the members as a hashmap. + * Prefer the structIterator method for iteration. + * + * This does NOT return list and map members, it is only for structures. + * + * @returns a map of member names to member schemas (normalized). + */ + getMemberSchemas() { + const { schema } = this; + const struct2 = schema; + if (!struct2 || typeof struct2 !== "object") { + return {}; + } + if ("members" in struct2) { + const buffer = {}; + for (const member of struct2.memberNames) { + buffer[member] = this.getMemberSchema(member); } - const result = reader.result ?? ""; - const commaIndex = result.indexOf(","); - const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; - resolve(result.substring(dataOffset)); - }; - reader.onabort = () => reject(new Error("Read aborted")); - reader.onerror = () => reject(reader.error); - reader.readAsDataURL(blob); - }); -} -__name(readToBase64, "readToBase64"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 21109: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + return buffer; + } + return {}; } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - isArrayBuffer: () => isArrayBuffer -}); -module.exports = __toCommonJS(src_exports); -var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 14272: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointFromConfig = void 0; -const node_config_provider_1 = __nccwpck_require__(62021); -const getEndpointUrlConfig_1 = __nccwpck_require__(53219); -const getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId !== null && serviceId !== void 0 ? serviceId : ""))(); -exports.getEndpointFromConfig = getEndpointFromConfig; - - -/***/ }), - -/***/ 53219: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointUrlConfig = void 0; -const shared_ini_file_loader_1 = __nccwpck_require__(30489); -const ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; -const CONFIG_ENDPOINT_URL = "endpoint_url"; -const getEndpointUrlConfig = (serviceId) => ({ - environmentVariableSelector: (env) => { - const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); - const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; - if (serviceEndpointUrl) - return serviceEndpointUrl; - const endpointUrl = env[ENV_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return undefined; - }, - configFileSelector: (profile, config) => { - if (config && profile.services) { - const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (servicesSection) { - const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); - const endpointUrl = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (endpointUrl) - return endpointUrl; - } - } - const endpointUrl = profile[CONFIG_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return undefined; - }, - default: undefined, -}); -exports.getEndpointUrlConfig = getEndpointUrlConfig; + /** + * Allows iteration over members of a structure schema. + * Each yield is a pair of the member name and member schema. + * + * This avoids the overhead of calling Object.entries(ns.getMemberSchemas()). + */ + *structIterator() { + if (this.isUnitSchema()) { + return; + } + if (!this.isStructSchema()) { + throw new Error("@smithy/core/schema - cannot acquire structIterator on non-struct schema."); + } + const struct2 = this.getSchema(); + for (let i = 0; i < struct2.memberNames.length; ++i) { + yield [struct2.memberNames[i], _NormalizedSchema.memberFrom([struct2.memberList[i], 0], struct2.memberNames[i])]; + } + } + /** + * @returns a last-resort human-readable name for the schema if it has no other identifiers. + */ + getSchemaName() { + const schema = this.getSchema(); + if (typeof schema === "number") { + const _schema = 63 & schema; + const container = 192 & schema; + const type = Object.entries(SCHEMA).find(([, value]) => { + return value === _schema; + })?.[0] ?? "Unknown"; + switch (container) { + case SCHEMA.MAP_MODIFIER: + return `${type}Map`; + case SCHEMA.LIST_MODIFIER: + return `${type}List`; + case 0: + return type; + } + } + return "Unknown"; + } +}; +// Annotate the CommonJS export names for ESM import in node: +0 && (0); /***/ }), -/***/ 42628: +/***/ 65409: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { for (var name in all) __defProp(target, name, { get: all[name], enumerable: true }); @@ -71178,528 +62405,714 @@ var __copyProps = (to, from, except, desc) => { }; var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var src_exports = {}; -__export(src_exports, { - endpointMiddleware: () => endpointMiddleware, - endpointMiddlewareOptions: () => endpointMiddlewareOptions, - getEndpointFromInstructions: () => getEndpointFromInstructions, - getEndpointPlugin: () => getEndpointPlugin, - resolveEndpointConfig: () => resolveEndpointConfig, - resolveEndpointRequiredConfig: () => resolveEndpointRequiredConfig, - resolveParams: () => resolveParams, - toEndpointV1: () => toEndpointV1 +// src/submodules/serde/index.ts +var serde_exports = {}; +__export(serde_exports, { + LazyJsonString: () => LazyJsonString, + NumericValue: () => NumericValue, + copyDocumentWithTransform: () => copyDocumentWithTransform, + dateToUtcString: () => dateToUtcString, + expectBoolean: () => expectBoolean, + expectByte: () => expectByte, + expectFloat32: () => expectFloat32, + expectInt: () => expectInt, + expectInt32: () => expectInt32, + expectLong: () => expectLong, + expectNonNull: () => expectNonNull, + expectNumber: () => expectNumber, + expectObject: () => expectObject, + expectShort: () => expectShort, + expectString: () => expectString, + expectUnion: () => expectUnion, + handleFloat: () => handleFloat, + limitedParseDouble: () => limitedParseDouble, + limitedParseFloat: () => limitedParseFloat, + limitedParseFloat32: () => limitedParseFloat32, + logger: () => logger, + nv: () => nv, + parseBoolean: () => parseBoolean, + parseEpochTimestamp: () => parseEpochTimestamp, + parseRfc3339DateTime: () => parseRfc3339DateTime, + parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, + parseRfc7231DateTime: () => parseRfc7231DateTime, + quoteHeader: () => quoteHeader, + splitEvery: () => splitEvery, + splitHeader: () => splitHeader, + strictParseByte: () => strictParseByte, + strictParseDouble: () => strictParseDouble, + strictParseFloat: () => strictParseFloat, + strictParseFloat32: () => strictParseFloat32, + strictParseInt: () => strictParseInt, + strictParseInt32: () => strictParseInt32, + strictParseLong: () => strictParseLong, + strictParseShort: () => strictParseShort }); -module.exports = __toCommonJS(src_exports); +module.exports = __toCommonJS(serde_exports); -// src/service-customizations/s3.ts -var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { - const bucket = endpointParams?.Bucket || ""; - if (typeof endpointParams.Bucket === "string") { - endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); +// src/submodules/serde/copyDocumentWithTransform.ts +var import_schema = __nccwpck_require__(67635); +var copyDocumentWithTransform = (source, schemaRef, transform = (_) => _) => { + const ns = import_schema.NormalizedSchema.of(schemaRef); + switch (typeof source) { + case "undefined": + case "boolean": + case "number": + case "string": + case "bigint": + case "symbol": + return transform(source, ns); + case "function": + case "object": + if (source === null) { + return transform(null, ns); + } + if (Array.isArray(source)) { + const newArray = new Array(source.length); + let i = 0; + for (const item of source) { + newArray[i++] = copyDocumentWithTransform(item, ns.getValueSchema(), transform); + } + return transform(newArray, ns); + } + if ("byteLength" in source) { + const newBytes = new Uint8Array(source.byteLength); + newBytes.set(source, 0); + return transform(newBytes, ns); + } + if (source instanceof Date) { + return transform(source, ns); + } + const newObject = {}; + if (ns.isMapSchema()) { + for (const key of Object.keys(source)) { + newObject[key] = copyDocumentWithTransform(source[key], ns.getValueSchema(), transform); + } + } else if (ns.isStructSchema()) { + for (const [key, memberSchema] of ns.structIterator()) { + newObject[key] = copyDocumentWithTransform(source[key], memberSchema, transform); + } + } else if (ns.isDocumentSchema()) { + for (const key of Object.keys(source)) { + newObject[key] = copyDocumentWithTransform(source[key], ns.getValueSchema(), transform); + } + } + return transform(newObject, ns); + default: + return transform(source, ns); } - if (isArnBucketName(bucket)) { - if (endpointParams.ForcePathStyle === true) { - throw new Error("Path-style addressing cannot be used with ARN buckets"); - } - } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { - endpointParams.ForcePathStyle = true; +}; + +// src/submodules/serde/parse-utils.ts +var parseBoolean = (value) => { + switch (value) { + case "true": + return true; + case "false": + return false; + default: + throw new Error(`Unable to parse boolean value "${value}"`); } - if (endpointParams.DisableMultiRegionAccessPoints) { - endpointParams.disableMultiRegionAccessPoints = true; - endpointParams.DisableMRAP = true; +}; +var expectBoolean = (value) => { + if (value === null || value === void 0) { + return void 0; } - return endpointParams; -}, "resolveParamsForS3"); -var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; -var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; -var DOTS_PATTERN = /\.\./; -var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); -var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { - const [arn, partition, service, , , bucket] = bucketName.split(":"); - const isArn = arn === "arn" && bucketName.split(":").length >= 6; - const isValidArn = Boolean(isArn && partition && service && bucket); - if (isArn && !isValidArn) { - throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); + if (typeof value === "number") { + if (value === 0 || value === 1) { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (value === 0) { + return false; + } + if (value === 1) { + return true; + } } - return isValidArn; -}, "isArnBucketName"); - -// src/adaptors/createConfigValueProvider.ts -var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { - const configProvider = /* @__PURE__ */ __name(async () => { - const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; - if (typeof configValue === "function") { - return configValue(); + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (lower === "false") { + return false; + } + if (lower === "true") { + return true; } - return configValue; - }, "configProvider"); - if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = credentials?.credentialScope ?? credentials?.CredentialScope; - return configValue; - }; } - if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = credentials?.accountId ?? credentials?.AccountId; - return configValue; - }; + if (typeof value === "boolean") { + return value; } - if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { - return async () => { - const endpoint = await configProvider(); - if (endpoint && typeof endpoint === "object") { - if ("url" in endpoint) { - return endpoint.url.href; - } - if ("hostname" in endpoint) { - const { protocol, hostname, port, path } = endpoint; - return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; - } + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); +}; +var expectNumber = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); } - return endpoint; - }; + return parsed; + } } - return configProvider; -}, "createConfigValueProvider"); - -// src/adaptors/getEndpointFromInstructions.ts -var import_getEndpointFromConfig = __nccwpck_require__(14272); - -// src/adaptors/toEndpointV1.ts -var import_url_parser = __nccwpck_require__(60043); -var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { - if (typeof endpoint === "object") { - if ("url" in endpoint) { - return (0, import_url_parser.parseUrl)(endpoint.url); + if (typeof value === "number") { + return value; + } + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); +}; +var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); +var expectFloat32 = (value) => { + const expected = expectNumber(value); + if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); } - return endpoint; } - return (0, import_url_parser.parseUrl)(endpoint); -}, "toEndpointV1"); - -// src/adaptors/getEndpointFromInstructions.ts -var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { - if (!clientConfig.endpoint) { - let endpointFromConfig; - if (clientConfig.serviceConfiguredEndpoint) { - endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); - } else { - endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId); - } - if (endpointFromConfig) { - clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); - } + return expected; +}; +var expectLong = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); +}; +var expectInt = expectLong; +var expectInt32 = (value) => expectSizedInt(value, 32); +var expectShort = (value) => expectSizedInt(value, 16); +var expectByte = (value) => expectSizedInt(value, 8); +var expectSizedInt = (value, size) => { + const expected = expectLong(value); + if (expected !== void 0 && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; +}; +var castInt = (value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } +}; +var expectNonNull = (value, location) => { + if (value === null || value === void 0) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); + } + throw new TypeError("Expected a non-null value"); + } + return value; +}; +var expectObject = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); +}; +var expectString = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); +}; +var expectUnion = (value) => { + if (value === null || value === void 0) { + return void 0; + } + const asObject = expectObject(value); + const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); + } + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); + } + return asObject; +}; +var strictParseDouble = (value) => { + if (typeof value == "string") { + return expectNumber(parseNumber(value)); + } + return expectNumber(value); +}; +var strictParseFloat = strictParseDouble; +var strictParseFloat32 = (value) => { + if (typeof value == "string") { + return expectFloat32(parseNumber(value)); + } + return expectFloat32(value); +}; +var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; +var parseNumber = (value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); + } + return parseFloat(value); +}; +var limitedParseDouble = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectNumber(value); +}; +var handleFloat = limitedParseDouble; +var limitedParseFloat = limitedParseDouble; +var limitedParseFloat32 = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectFloat32(value); +}; +var parseFloatString = (value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); + } +}; +var strictParseLong = (value) => { + if (typeof value === "string") { + return expectLong(parseNumber(value)); + } + return expectLong(value); +}; +var strictParseInt = strictParseLong; +var strictParseInt32 = (value) => { + if (typeof value === "string") { + return expectInt32(parseNumber(value)); + } + return expectInt32(value); +}; +var strictParseShort = (value) => { + if (typeof value === "string") { + return expectShort(parseNumber(value)); + } + return expectShort(value); +}; +var strictParseByte = (value) => { + if (typeof value === "string") { + return expectByte(parseNumber(value)); + } + return expectByte(value); +}; +var stackTraceWarning = (message) => { + return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); +}; +var logger = { + warn: console.warn +}; + +// src/submodules/serde/date-utils.ts +var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; +var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; +function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; +} +var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); +var parseRfc3339DateTime = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); +}; +var RFC3339_WITH_OFFSET = new RegExp( + /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ +); +var parseRfc3339DateTimeWithOffset = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339_WITH_OFFSET.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + if (offsetStr.toUpperCase() != "Z") { + date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); + } + return date; +}; +var IMF_FIXDATE = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ +); +var RFC_850_DATE = new RegExp( + /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ +); +var ASC_TIME = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ +); +var parseRfc7231DateTime = (value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); + } + let match = IMF_FIXDATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr, "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + match = RFC_850_DATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year( + buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds + }) + ); + } + match = ASC_TIME.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr.trimLeft(), "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); } - const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); - if (typeof clientConfig.endpointProvider !== "function") { - throw new Error("config.endpointProvider is not set."); + throw new TypeError("Invalid RFC-7231 date-time value"); +}; +var parseEpochTimestamp = (value) => { + if (value === null || value === void 0) { + return void 0; } - const endpoint = clientConfig.endpointProvider(endpointParams, context); - return endpoint; -}, "getEndpointFromInstructions"); -var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { - const endpointParams = {}; - const instructions = instructionsSupplier?.getEndpointParameterInstructions?.() || {}; - for (const [name, instruction] of Object.entries(instructions)) { - switch (instruction.type) { - case "staticContextParams": - endpointParams[name] = instruction.value; - break; - case "contextParams": - endpointParams[name] = commandInput[instruction.name]; - break; - case "clientContextParams": - case "builtInParams": - endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); - break; - case "operationContextParams": - endpointParams[name] = instruction.get(commandInput); - break; - default: - throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); - } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } else if (typeof value === "string") { + valueAsDouble = strictParseDouble(value); + } else if (typeof value === "object" && value.tag === 1) { + valueAsDouble = value.value; + } else { + throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); } - if (Object.keys(instructions).length === 0) { - Object.assign(endpointParams, clientConfig); + if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { + throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); } - if (String(clientConfig.serviceId).toLowerCase() === "s3") { - await resolveParamsForS3(endpointParams); + return new Date(Math.round(valueAsDouble * 1e3)); +}; +var buildDate = (year, month, day, time) => { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date( + Date.UTC( + year, + adjustedMonth, + day, + parseDateValue(time.hours, "hour", 0, 23), + parseDateValue(time.minutes, "minute", 0, 59), + // seconds can go up to 60 for leap seconds + parseDateValue(time.seconds, "seconds", 0, 60), + parseMilliseconds(time.fractionalMilliseconds) + ) + ); +}; +var parseTwoDigitYear = (value) => { + const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; } - return endpointParams; -}, "resolveParams"); - -// src/endpointMiddleware.ts -var import_core = __nccwpck_require__(22743); -var import_util_middleware = __nccwpck_require__(99755); -var endpointMiddleware = /* @__PURE__ */ __name(({ - config, - instructions -}) => { - return (next, context) => async (args) => { - if (config.endpoint) { - (0, import_core.setFeature)(context, "ENDPOINT_OVERRIDE", "N"); - } - const endpoint = await getEndpointFromInstructions( - args.input, - { - getEndpointParameterInstructions() { - return instructions; - } - }, - { ...config }, - context - ); - context.endpointV2 = endpoint; - context.authSchemes = endpoint.properties?.authSchemes; - const authScheme = context.authSchemes?.[0]; - if (authScheme) { - context["signing_region"] = authScheme.signingRegion; - context["signing_service"] = authScheme.signingName; - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const httpAuthOption = smithyContext?.selectedHttpAuthScheme?.httpAuthOption; - if (httpAuthOption) { - httpAuthOption.signingProperties = Object.assign( - httpAuthOption.signingProperties || {}, - { - signing_region: authScheme.signingRegion, - signingRegion: authScheme.signingRegion, - signing_service: authScheme.signingName, - signingName: authScheme.signingName, - signingRegionSet: authScheme.signingRegionSet - }, - authScheme.properties - ); - } - } - return next({ - ...args - }); - }; -}, "endpointMiddleware"); - -// src/getEndpointPlugin.ts -var import_middleware_serde = __nccwpck_require__(62654); -var endpointMiddlewareOptions = { - step: "serialize", - tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], - name: "endpointV2Middleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde.serializerMiddlewareOption.name + return valueInThisCentury; }; -var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo( - endpointMiddleware({ - config, - instructions - }), - endpointMiddlewareOptions +var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; +var adjustRfc850Year = (input) => { + if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date( + Date.UTC( + input.getUTCFullYear() - 100, + input.getUTCMonth(), + input.getUTCDate(), + input.getUTCHours(), + input.getUTCMinutes(), + input.getUTCSeconds(), + input.getUTCMilliseconds() + ) ); } -}), "getEndpointPlugin"); - -// src/resolveEndpointConfig.ts - -var import_getEndpointFromConfig2 = __nccwpck_require__(14272); -var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { - const tls = input.tls ?? true; - const { endpoint, useDualstackEndpoint, useFipsEndpoint } = input; - const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware.normalizeProvider)(endpoint)()) : void 0; - const isCustomEndpoint = !!endpoint; - const resolvedConfig = Object.assign(input, { - endpoint: customEndpointProvider, - tls, - isCustomEndpoint, - useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(useDualstackEndpoint ?? false), - useFipsEndpoint: (0, import_util_middleware.normalizeProvider)(useFipsEndpoint ?? false) - }); - let configuredEndpointPromise = void 0; - resolvedConfig.serviceConfiguredEndpoint = async () => { - if (input.serviceId && !configuredEndpointPromise) { - configuredEndpointPromise = (0, import_getEndpointFromConfig2.getEndpointFromConfig)(input.serviceId); - } - return configuredEndpointPromise; - }; - return resolvedConfig; -}, "resolveEndpointConfig"); - -// src/resolveEndpointRequiredConfig.ts -var resolveEndpointRequiredConfig = /* @__PURE__ */ __name((input) => { - const { endpoint } = input; - if (endpoint === void 0) { - input.endpoint = async () => { - throw new Error( - "@smithy/middleware-endpoint: (default endpointRuleSet) endpoint is not set - you must configure an endpoint." - ); - }; - } return input; -}, "resolveEndpointRequiredConfig"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 62654: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +var parseMonthByShortName = (value) => { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); } - return to; + return monthIdx + 1; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - deserializerMiddleware: () => deserializerMiddleware, - deserializerMiddlewareOption: () => deserializerMiddlewareOption, - getSerdePlugin: () => getSerdePlugin, - serializerMiddleware: () => serializerMiddleware, - serializerMiddlewareOption: () => serializerMiddlewareOption -}); -module.exports = __toCommonJS(src_exports); - -// src/deserializerMiddleware.ts -var import_protocol_http = __nccwpck_require__(20843); -var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next, context) => async (args) => { - const { response } = await next(args); - try { - const parsed = await deserializer(response, options); - return { - response, - output: parsed - }; - } catch (error) { - Object.defineProperty(error, "$response", { - value: response - }); - if (!("$metadata" in error)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - try { - error.message += "\n " + hint; - } catch (e) { - if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { - console.warn(hint); - } else { - context.logger?.warn?.(hint); - } - } - if (typeof error.$responseBodyText !== "undefined") { - if (error.$response) { - error.$response.body = error.$responseBodyText; - } - } - try { - if (import_protocol_http.HttpResponse.isInstance(response)) { - const { headers = {} } = response; - const headerEntries = Object.entries(headers); - error.$metadata = { - httpStatusCode: response.statusCode, - requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), - extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), - cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) - }; - } - } catch (e) { - } - } - throw error; +var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; +var validateDayOfMonth = (year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; } -}, "deserializerMiddleware"); -var findHeader = /* @__PURE__ */ __name((pattern, headers) => { - return (headers.find(([k]) => { - return k.match(pattern); - }) || [void 0, void 0])[1]; -}, "findHeader"); - -// src/serializerMiddleware.ts -var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { - const endpointConfig = options; - const endpoint = context.endpointV2?.url && endpointConfig.urlParser ? async () => endpointConfig.urlParser(context.endpointV2.url) : endpointConfig.endpoint; - if (!endpoint) { - throw new Error("No valid endpoint provider available."); + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); } - const request = await serializer(args.input, { ...options, endpoint }); - return next({ - ...args, - request - }); -}, "serializerMiddleware"); - -// src/serdePlugin.ts -var deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true }; -var serializerMiddlewareOption = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true +var isLeapYear = (year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); }; -function getSerdePlugin(config, serializer, deserializer) { - return { - applyToStack: (commandStack) => { - commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); - commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption); - } - }; -} -__name(getSerdePlugin, "getSerdePlugin"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 62021: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +var parseDateValue = (value, type, lower, upper) => { + const dateVal = strictParseByte(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + } + return dateVal; }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +var parseMilliseconds = (value) => { + if (value === null || value === void 0) { + return 0; } - return to; + return strictParseFloat32("0." + value) * 1e3; +}; +var parseOffsetToMilliseconds = (value) => { + const directionStr = value[0]; + let direction = 1; + if (directionStr == "+") { + direction = 1; + } else if (directionStr == "-") { + direction = -1; + } else { + throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + } + const hour = Number(value.substring(1, 3)); + const minute = Number(value.substring(4, 6)); + return direction * (hour * 60 + minute) * 60 * 1e3; +}; +var stripLeadingZeroes = (value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; + } + if (idx === 0) { + return value; + } + return value.slice(idx); }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - loadConfig: () => loadConfig -}); -module.exports = __toCommonJS(src_exports); -// src/configLoader.ts +// src/submodules/serde/lazy-json.ts +var LazyJsonString = function LazyJsonString2(val) { + const str = Object.assign(new String(val), { + deserializeJSON() { + return JSON.parse(String(val)); + }, + toString() { + return String(val); + }, + toJSON() { + return String(val); + } + }); + return str; +}; +LazyJsonString.from = (object) => { + if (object && typeof object === "object" && (object instanceof LazyJsonString || "deserializeJSON" in object)) { + return object; + } else if (typeof object === "string" || Object.getPrototypeOf(object) === String.prototype) { + return LazyJsonString(String(object)); + } + return LazyJsonString(JSON.stringify(object)); +}; +LazyJsonString.fromObject = LazyJsonString.from; +// src/submodules/serde/quote-header.ts +function quoteHeader(part) { + if (part.includes(",") || part.includes('"')) { + part = `"${part.replace(/"/g, '\\"')}"`; + } + return part; +} -// src/fromEnv.ts -var import_property_provider = __nccwpck_require__(64181); +// src/submodules/serde/split-every.ts +function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); + } + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; + } + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; + } else { + currentSegment += delimiter + segments[i]; + } + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; + } + } + if (currentSegment !== "") { + compoundSegments.push(currentSegment); + } + return compoundSegments; +} -// src/getSelectorName.ts -function getSelectorName(functionString) { - try { - const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); - constants.delete("CONFIG"); - constants.delete("CONFIG_PREFIX_SEPARATOR"); - constants.delete("ENV"); - return [...constants].join(", "); - } catch (e) { - return functionString; +// src/submodules/serde/split-header.ts +var splitHeader = (value) => { + const z = value.length; + const values = []; + let withinQuotes = false; + let prevChar = void 0; + let anchor = 0; + for (let i = 0; i < z; ++i) { + const char = value[i]; + switch (char) { + case `"`: + if (prevChar !== "\\") { + withinQuotes = !withinQuotes; + } + break; + case ",": + if (!withinQuotes) { + values.push(value.slice(anchor, i)); + anchor = i + 1; + } + break; + default: + } + prevChar = char; } -} -__name(getSelectorName, "getSelectorName"); + values.push(value.slice(anchor)); + return values.map((v) => { + v = v.trim(); + const z2 = v.length; + if (z2 < 2) { + return v; + } + if (v[0] === `"` && v[z2 - 1] === `"`) { + v = v.slice(1, z2 - 1); + } + return v.replace(/\\"/g, '"'); + }); +}; -// src/fromEnv.ts -var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { - try { - const config = envVarSelector(process.env, options); - if (config === void 0) { - throw new Error(); +// src/submodules/serde/value/NumericValue.ts +var NumericValue = class _NumericValue { + constructor(string, type) { + this.string = string; + this.type = type; + let dot = 0; + for (let i = 0; i < string.length; ++i) { + const char = string.charCodeAt(i); + if (i === 0 && char === 45) { + continue; + } + if (char === 46) { + if (dot) { + throw new Error("@smithy/core/serde - NumericValue must contain at most one decimal point."); + } + dot = 1; + continue; + } + if (char < 48 || char > 57) { + throw new Error( + `@smithy/core/serde - NumericValue must only contain [0-9], at most one decimal point ".", and an optional negation prefix "-".` + ); + } } - return config; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, - { logger: options?.logger } - ); } -}, "fromEnv"); - -// src/fromSharedConfigFiles.ts - -var import_shared_ini_file_loader = __nccwpck_require__(30489); -var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, import_shared_ini_file_loader.getProfileName)(init); - const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; - try { - const cfgFile = preferredFile === "config" ? configFile : credentialsFile; - const configValue = configSelector(mergedProfile, cfgFile); - if (configValue === void 0) { - throw new Error(); + toString() { + return this.string; + } + static [Symbol.hasInstance](object) { + if (!object || typeof object !== "object") { + return false; } - return configValue; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, - { logger: init.logger } - ); + const _nv = object; + const prototypeMatch = _NumericValue.prototype.isPrototypeOf(object.constructor?.prototype); + if (prototypeMatch) { + return prototypeMatch; + } + if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name === "NumericValue") { + return true; + } + return prototypeMatch; } -}, "fromSharedConfigFiles"); - -// src/fromStatic.ts - -var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); -var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); - -// src/configLoader.ts -var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { - const { signingName, logger } = configuration; - const envOptions = { signingName, logger }; - return (0, import_property_provider.memoize)( - (0, import_property_provider.chain)( - fromEnv(environmentVariableSelector, envOptions), - fromSharedConfigFiles(configFileSelector, configuration), - fromStatic(defaultValue) - ) - ); -}, "loadConfig"); +}; +function nv(input) { + return new NumericValue(String(input), "bigDecimal"); +} // Annotate the CommonJS export names for ESM import in node: - 0 && (0); - /***/ }), -/***/ 82764: +/***/ 9136: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var __create = Object.create; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { @@ -71714,211 +63127,48 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, - NodeHttp2Handler: () => NodeHttp2Handler, - NodeHttpHandler: () => NodeHttpHandler, + FetchHttpHandler: () => FetchHttpHandler, + keepAliveSupport: () => keepAliveSupport, streamCollector: () => streamCollector }); module.exports = __toCommonJS(src_exports); -// src/node-http-handler.ts +// src/fetch-http-handler.ts var import_protocol_http = __nccwpck_require__(20843); var import_querystring_builder = __nccwpck_require__(14959); -var import_http = __nccwpck_require__(58611); -var import_https = __nccwpck_require__(65692); - -// src/constants.ts -var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; - -// src/get-transformed-headers.ts -var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { - const transformedHeaders = {}; - for (const name of Object.keys(headers)) { - const headerValues = headers[name]; - transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; - } - return transformedHeaders; -}, "getTransformedHeaders"); - -// src/timing.ts -var timing = { - setTimeout: (cb, ms) => setTimeout(cb, ms), - clearTimeout: (timeoutId) => clearTimeout(timeoutId) -}; - -// src/set-connection-timeout.ts -var DEFER_EVENT_LISTENER_TIME = 1e3; -var setConnectionTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { - if (!timeoutInMs) { - return -1; - } - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeoutId = timing.setTimeout(() => { - request.destroy(); - reject( - Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { - name: "TimeoutError" - }) - ); - }, timeoutInMs - offset); - const doWithSocket = /* @__PURE__ */ __name((socket) => { - if (socket?.connecting) { - socket.on("connect", () => { - timing.clearTimeout(timeoutId); - }); - } else { - timing.clearTimeout(timeoutId); - } - }, "doWithSocket"); - if (request.socket) { - doWithSocket(request.socket); - } else { - request.on("socket", doWithSocket); - } - }, "registerTimeout"); - if (timeoutInMs < 2e3) { - registerTimeout(0); - return 0; - } - return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); -}, "setConnectionTimeout"); - -// src/set-socket-keep-alive.ts -var DEFER_EVENT_LISTENER_TIME2 = 3e3; -var setSocketKeepAlive = /* @__PURE__ */ __name((request, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { - if (keepAlive !== true) { - return -1; - } - const registerListener = /* @__PURE__ */ __name(() => { - if (request.socket) { - request.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - } else { - request.on("socket", (socket) => { - socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - }); - } - }, "registerListener"); - if (deferTimeMs === 0) { - registerListener(); - return 0; - } - return timing.setTimeout(registerListener, deferTimeMs); -}, "setSocketKeepAlive"); - -// src/set-socket-timeout.ts -var DEFER_EVENT_LISTENER_TIME3 = 3e3; -var setSocketTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = DEFAULT_REQUEST_TIMEOUT) => { - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeout = timeoutInMs - offset; - const onTimeout = /* @__PURE__ */ __name(() => { - request.destroy(); - reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); - }, "onTimeout"); - if (request.socket) { - request.socket.setTimeout(timeout, onTimeout); - request.on("close", () => request.socket?.removeListener("timeout", onTimeout)); - } else { - request.setTimeout(timeout, onTimeout); - } - }, "registerTimeout"); - if (0 < timeoutInMs && timeoutInMs < 6e3) { - registerTimeout(0); - return 0; - } - return timing.setTimeout( - registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), - DEFER_EVENT_LISTENER_TIME3 - ); -}, "setSocketTimeout"); -// src/write-request-body.ts -var import_stream = __nccwpck_require__(2203); -var MIN_WAIT_TIME = 6e3; -async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { - const headers = request.headers ?? {}; - const expect = headers["Expect"] || headers["expect"]; - let timeoutId = -1; - let sendBody = true; - if (expect === "100-continue") { - sendBody = await Promise.race([ - new Promise((resolve) => { - timeoutId = Number(timing.setTimeout(() => resolve(true), Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); - }), - new Promise((resolve) => { - httpRequest.on("continue", () => { - timing.clearTimeout(timeoutId); - resolve(true); - }); - httpRequest.on("response", () => { - timing.clearTimeout(timeoutId); - resolve(false); - }); - httpRequest.on("error", () => { - timing.clearTimeout(timeoutId); - resolve(false); - }); - }) - ]); - } - if (sendBody) { - writeBody(httpRequest, request.body); - } +// src/create-request.ts +function createRequest(url, requestOptions) { + return new Request(url, requestOptions); } -__name(writeRequestBody, "writeRequestBody"); -function writeBody(httpRequest, body) { - if (body instanceof import_stream.Readable) { - body.pipe(httpRequest); - return; - } - if (body) { - if (Buffer.isBuffer(body) || typeof body === "string") { - httpRequest.end(body); - return; - } - const uint8 = body; - if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { - httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); - return; +__name(createRequest, "createRequest"); + +// src/request-timeout.ts +function requestTimeout(timeoutInMs = 0) { + return new Promise((resolve, reject) => { + if (timeoutInMs) { + setTimeout(() => { + const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); + timeoutError.name = "TimeoutError"; + reject(timeoutError); + }, timeoutInMs); } - httpRequest.end(Buffer.from(body)); - return; - } - httpRequest.end(); + }); } -__name(writeBody, "writeBody"); +__name(requestTimeout, "requestTimeout"); -// src/node-http-handler.ts -var DEFAULT_REQUEST_TIMEOUT = 0; -var NodeHttpHandler = class _NodeHttpHandler { - constructor(options) { - this.socketWarningTimestamp = 0; - // Node http handler is hard-coded to http/1.1: https://github.com/nodejs/node/blob/ff5664b83b89c55e4ab5d5f60068fb457f1f5872/lib/_http_server.js#L286 - this.metadata = { handlerProtocol: "http/1.1" }; - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((_options) => { - resolve(this.resolveDefaultConfig(_options)); - }).catch(reject); - } else { - resolve(this.resolveDefaultConfig(options)); - } - }); - } +// src/fetch-http-handler.ts +var keepAliveSupport = { + supported: void 0 +}; +var FetchHttpHandler = class _FetchHttpHandler { static { - __name(this, "NodeHttpHandler"); + __name(this, "FetchHttpHandler"); } /** * @returns the input if it is an HttpHandler of any class, @@ -71928,195 +63178,130 @@ var NodeHttpHandler = class _NodeHttpHandler { if (typeof instanceOrOptions?.handle === "function") { return instanceOrOptions; } - return new _NodeHttpHandler(instanceOrOptions); + return new _FetchHttpHandler(instanceOrOptions); } - /** - * @internal - * - * @param agent - http(s) agent in use by the NodeHttpHandler instance. - * @param socketWarningTimestamp - last socket usage check timestamp. - * @param logger - channel for the warning. - * @returns timestamp of last emitted warning. - */ - static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { - const { sockets, requests, maxSockets } = agent; - if (typeof maxSockets !== "number" || maxSockets === Infinity) { - return socketWarningTimestamp; - } - const interval = 15e3; - if (Date.now() - interval < socketWarningTimestamp) { - return socketWarningTimestamp; + constructor(options) { + if (typeof options === "function") { + this.configProvider = options().then((opts) => opts || {}); + } else { + this.config = options ?? {}; + this.configProvider = Promise.resolve(this.config); } - if (sockets && requests) { - for (const origin in sockets) { - const socketsInUse = sockets[origin]?.length ?? 0; - const requestsEnqueued = requests[origin]?.length ?? 0; - if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { - logger?.warn?.( - `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. -See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html -or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` - ); - return Date.now(); - } - } + if (keepAliveSupport.supported === void 0) { + keepAliveSupport.supported = Boolean( + typeof Request !== "undefined" && "keepalive" in createRequest("https://[::1]") + ); } - return socketWarningTimestamp; - } - resolveDefaultConfig(options) { - const { requestTimeout, connectionTimeout, socketTimeout, socketAcquisitionWarningTimeout, httpAgent, httpsAgent } = options || {}; - const keepAlive = true; - const maxSockets = 50; - return { - connectionTimeout, - requestTimeout: requestTimeout ?? socketTimeout, - socketAcquisitionWarningTimeout, - httpAgent: (() => { - if (httpAgent instanceof import_http.Agent || typeof httpAgent?.destroy === "function") { - return httpAgent; - } - return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); - })(), - httpsAgent: (() => { - if (httpsAgent instanceof import_https.Agent || typeof httpsAgent?.destroy === "function") { - return httpsAgent; - } - return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); - })(), - logger: console - }; } destroy() { - this.config?.httpAgent?.destroy(); - this.config?.httpsAgent?.destroy(); } - async handle(request, { abortSignal } = {}) { + async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { if (!this.config) { this.config = await this.configProvider; } - return new Promise((_resolve, _reject) => { - let writeRequestBodyPromise = void 0; - const timeouts = []; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(timing.clearTimeout); - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(timing.clearTimeout); - _reject(arg); - }, "reject"); - if (!this.config) { - throw new Error("Node HTTP request handler config is not resolved"); - } - if (abortSignal?.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const isSSL = request.protocol === "https:"; - const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; - timeouts.push( - timing.setTimeout( - () => { - this.socketWarningTimestamp = _NodeHttpHandler.checkSocketUsage( - agent, - this.socketWarningTimestamp, - this.config.logger - ); - }, - this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) - ) - ); - const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); - let auth = void 0; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}`; - } - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - let hostname = request.hostname ?? ""; - if (hostname[0] === "[" && hostname.endsWith("]")) { - hostname = request.hostname.slice(1, -1); - } else { - hostname = request.hostname; - } - const nodeHttpsOptions = { - headers: request.headers, - host: hostname, - method: request.method, - path, - port: request.port, - agent, - auth - }; - const requestFunc = isSSL ? import_https.request : import_http.request; - const req = requestFunc(nodeHttpsOptions, (res) => { - const httpResponse = new import_protocol_http.HttpResponse({ - statusCode: res.statusCode || -1, - reason: res.statusMessage, - headers: getTransformedHeaders(res.headers), - body: res - }); - resolve({ response: httpResponse }); - }); - req.on("error", (err) => { - if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { - reject(Object.assign(err, { name: "TimeoutError" })); - } else { - reject(err); + const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; + const keepAlive = this.config.keepAlive === true; + const credentials = this.config.credentials; + if (abortSignal?.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + return Promise.reject(abortError); + } + let path = request.path; + const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const { port, method } = request; + const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; + const body = method === "GET" || method === "HEAD" ? void 0 : request.body; + const requestOptions = { + body, + headers: new Headers(request.headers), + method, + credentials + }; + if (this.config?.cache) { + requestOptions.cache = this.config.cache; + } + if (body) { + requestOptions.duplex = "half"; + } + if (typeof AbortController !== "undefined") { + requestOptions.signal = abortSignal; + } + if (keepAliveSupport.supported) { + requestOptions.keepalive = keepAlive; + } + if (typeof this.config.requestInit === "function") { + Object.assign(requestOptions, this.config.requestInit(request)); + } + let removeSignalEventListener = /* @__PURE__ */ __name(() => { + }, "removeSignalEventListener"); + const fetchRequest = createRequest(url, requestOptions); + const raceOfPromises = [ + fetch(fetchRequest).then((response) => { + const fetchHeaders = response.headers; + const transformedHeaders = {}; + for (const pair of fetchHeaders.entries()) { + transformedHeaders[pair[0]] = pair[1]; } - }); - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.destroy(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; + const hasReadableStream = response.body != void 0; + if (!hasReadableStream) { + return response.blob().then((body2) => ({ + response: new import_protocol_http.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: body2 + }) + })); } - } - timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); - const httpAgent = nodeHttpsOptions.agent; - if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { - timeouts.push( - setSocketKeepAlive(req, { - // @ts-expect-error keepAlive is not public on httpAgent. - keepAlive: httpAgent.keepAlive, - // @ts-expect-error keepAliveMsecs is not public on httpAgent. - keepAliveMsecs: httpAgent.keepAliveMsecs + return { + response: new import_protocol_http.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: response.body }) - ); - } - writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { - timeouts.forEach(timing.clearTimeout); - return _reject(e); - }); - }); + }; + }), + requestTimeout(requestTimeoutInMs) + ]; + if (abortSignal) { + raceOfPromises.push( + new Promise((resolve, reject) => { + const onAbort = /* @__PURE__ */ __name(() => { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); + } else { + abortSignal.onabort = onAbort; + } + }) + ); + } + return Promise.race(raceOfPromises).finally(removeSignalEventListener); } updateHttpClientConfig(key, value) { this.config = void 0; this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; + config[key] = value; + return config; }); } httpHandlerConfigs() { @@ -72124,374 +63309,584 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf } }; -// src/node-http2-handler.ts +// src/stream-collector.ts +var import_util_base64 = __nccwpck_require__(72722); +var streamCollector = /* @__PURE__ */ __name(async (stream) => { + if (typeof Blob === "function" && stream instanceof Blob || stream.constructor?.name === "Blob") { + if (Blob.prototype.arrayBuffer !== void 0) { + return new Uint8Array(await stream.arrayBuffer()); + } + return collectBlob(stream); + } + return collectStream(stream); +}, "streamCollector"); +async function collectBlob(blob) { + const base64 = await readToBase64(blob); + const arrayBuffer = (0, import_util_base64.fromBase64)(base64); + return new Uint8Array(arrayBuffer); +} +__name(collectBlob, "collectBlob"); +async function collectStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +__name(collectStream, "collectStream"); +function readToBase64(blob) { + return new Promise((resolve, reject) => { + const reader = new FileReader(); + reader.onloadend = () => { + if (reader.readyState !== 2) { + return reject(new Error("Reader aborted too early")); + } + const result = reader.result ?? ""; + const commaIndex = result.indexOf(","); + const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; + resolve(result.substring(dataOffset)); + }; + reader.onabort = () => reject(new Error("Read aborted")); + reader.onerror = () => reject(reader.error); + reader.readAsDataURL(blob); + }); +} +__name(readToBase64, "readToBase64"); +// Annotate the CommonJS export names for ESM import in node: +0 && (0); -var import_http22 = __nccwpck_require__(85675); -// src/node-http2-connection-manager.ts -var import_http2 = __toESM(__nccwpck_require__(85675)); -// src/node-http2-connection-pool.ts -var NodeHttp2ConnectionPool = class { - constructor(sessions) { - this.sessions = []; - this.sessions = sessions ?? []; - } - static { - __name(this, "NodeHttp2ConnectionPool"); - } - poll() { - if (this.sessions.length > 0) { - return this.sessions.shift(); - } +/***/ }), + +/***/ 21109: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - offerLast(session) { - this.sessions.push(session); + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + isArrayBuffer: () => isArrayBuffer +}); +module.exports = __toCommonJS(src_exports); +var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 14272: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointFromConfig = void 0; +const node_config_provider_1 = __nccwpck_require__(62021); +const getEndpointUrlConfig_1 = __nccwpck_require__(53219); +const getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId !== null && serviceId !== void 0 ? serviceId : ""))(); +exports.getEndpointFromConfig = getEndpointFromConfig; + + +/***/ }), + +/***/ 53219: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointUrlConfig = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(30489); +const ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; +const CONFIG_ENDPOINT_URL = "endpoint_url"; +const getEndpointUrlConfig = (serviceId) => ({ + environmentVariableSelector: (env) => { + const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); + const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; + if (serviceEndpointUrl) + return serviceEndpointUrl; + const endpointUrl = env[ENV_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return undefined; + }, + configFileSelector: (profile, config) => { + if (config && profile.services) { + const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (servicesSection) { + const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); + const endpointUrl = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (endpointUrl) + return endpointUrl; + } + } + const endpointUrl = profile[CONFIG_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return undefined; + }, + default: undefined, +}); +exports.getEndpointUrlConfig = getEndpointUrlConfig; + + +/***/ }), + +/***/ 42628: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - contains(session) { - return this.sessions.includes(session); + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + endpointMiddleware: () => endpointMiddleware, + endpointMiddlewareOptions: () => endpointMiddlewareOptions, + getEndpointFromInstructions: () => getEndpointFromInstructions, + getEndpointPlugin: () => getEndpointPlugin, + resolveEndpointConfig: () => resolveEndpointConfig, + resolveEndpointRequiredConfig: () => resolveEndpointRequiredConfig, + resolveParams: () => resolveParams, + toEndpointV1: () => toEndpointV1 +}); +module.exports = __toCommonJS(src_exports); + +// src/service-customizations/s3.ts +var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { + const bucket = endpointParams?.Bucket || ""; + if (typeof endpointParams.Bucket === "string") { + endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); } - remove(session) { - this.sessions = this.sessions.filter((s) => s !== session); + if (isArnBucketName(bucket)) { + if (endpointParams.ForcePathStyle === true) { + throw new Error("Path-style addressing cannot be used with ARN buckets"); + } + } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { + endpointParams.ForcePathStyle = true; } - [Symbol.iterator]() { - return this.sessions[Symbol.iterator](); + if (endpointParams.DisableMultiRegionAccessPoints) { + endpointParams.disableMultiRegionAccessPoints = true; + endpointParams.DisableMRAP = true; } - destroy(connection) { - for (const session of this.sessions) { - if (session === connection) { - if (!session.destroyed) { - session.destroy(); - } - } - } + return endpointParams; +}, "resolveParamsForS3"); +var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; +var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; +var DOTS_PATTERN = /\.\./; +var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); +var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { + const [arn, partition, service, , , bucket] = bucketName.split(":"); + const isArn = arn === "arn" && bucketName.split(":").length >= 6; + const isValidArn = Boolean(isArn && partition && service && bucket); + if (isArn && !isValidArn) { + throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); } -}; + return isValidArn; +}, "isArnBucketName"); -// src/node-http2-connection-manager.ts -var NodeHttp2ConnectionManager = class { - constructor(config) { - this.sessionCache = /* @__PURE__ */ new Map(); - this.config = config; - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrency must be greater than zero."); +// src/adaptors/createConfigValueProvider.ts +var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { + const configProvider = /* @__PURE__ */ __name(async () => { + const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; + if (typeof configValue === "function") { + return configValue(); } + return configValue; + }, "configProvider"); + if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = credentials?.credentialScope ?? credentials?.CredentialScope; + return configValue; + }; } - static { - __name(this, "NodeHttp2ConnectionManager"); + if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = credentials?.accountId ?? credentials?.AccountId; + return configValue; + }; } - lease(requestContext, connectionConfiguration) { - const url = this.getUrlString(requestContext); - const existingPool = this.sessionCache.get(url); - if (existingPool) { - const existingSession = existingPool.poll(); - if (existingSession && !this.config.disableConcurrency) { - return existingSession; + if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { + return async () => { + if (config.isCustomEndpoint === false) { + return void 0; } - } - const session = import_http2.default.connect(url); - if (this.config.maxConcurrency) { - session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { - if (err) { - throw new Error( - "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() - ); + const endpoint = await configProvider(); + if (endpoint && typeof endpoint === "object") { + if ("url" in endpoint) { + return endpoint.url.href; } - }); - } - session.unref(); - const destroySessionCb = /* @__PURE__ */ __name(() => { - session.destroy(); - this.deleteSession(url, session); - }, "destroySessionCb"); - session.on("goaway", destroySessionCb); - session.on("error", destroySessionCb); - session.on("frameError", destroySessionCb); - session.on("close", () => this.deleteSession(url, session)); - if (connectionConfiguration.requestTimeout) { - session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + if ("hostname" in endpoint) { + const { protocol, hostname, port, path } = endpoint; + return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; + } + } + return endpoint; + }; + } + return configProvider; +}, "createConfigValueProvider"); + +// src/adaptors/getEndpointFromInstructions.ts +var import_getEndpointFromConfig = __nccwpck_require__(14272); + +// src/adaptors/toEndpointV1.ts +var import_url_parser = __nccwpck_require__(60043); +var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { + if (typeof endpoint === "object") { + if ("url" in endpoint) { + return (0, import_url_parser.parseUrl)(endpoint.url); } - const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); - connectionPool.offerLast(session); - this.sessionCache.set(url, connectionPool); - return session; + return endpoint; } - /** - * Delete a session from the connection pool. - * @param authority The authority of the session to delete. - * @param session The session to delete. - */ - deleteSession(authority, session) { - const existingConnectionPool = this.sessionCache.get(authority); - if (!existingConnectionPool) { - return; + return (0, import_url_parser.parseUrl)(endpoint); +}, "toEndpointV1"); + +// src/adaptors/getEndpointFromInstructions.ts +var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { + if (!clientConfig.isCustomEndpoint) { + let endpointFromConfig; + if (clientConfig.serviceConfiguredEndpoint) { + endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); + } else { + endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId); } - if (!existingConnectionPool.contains(session)) { - return; + if (endpointFromConfig) { + clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); + clientConfig.isCustomEndpoint = true; } - existingConnectionPool.remove(session); - this.sessionCache.set(authority, existingConnectionPool); - } - release(requestContext, session) { - const cacheKey = this.getUrlString(requestContext); - this.sessionCache.get(cacheKey)?.offerLast(session); } - destroy() { - for (const [key, connectionPool] of this.sessionCache) { - for (const session of connectionPool) { - if (!session.destroyed) { - session.destroy(); - } - connectionPool.remove(session); - } - this.sessionCache.delete(key); - } + const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); + if (typeof clientConfig.endpointProvider !== "function") { + throw new Error("config.endpointProvider is not set."); } - setMaxConcurrentStreams(maxConcurrentStreams) { - if (maxConcurrentStreams && maxConcurrentStreams <= 0) { - throw new RangeError("maxConcurrentStreams must be greater than zero."); + const endpoint = clientConfig.endpointProvider(endpointParams, context); + return endpoint; +}, "getEndpointFromInstructions"); +var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { + const endpointParams = {}; + const instructions = instructionsSupplier?.getEndpointParameterInstructions?.() || {}; + for (const [name, instruction] of Object.entries(instructions)) { + switch (instruction.type) { + case "staticContextParams": + endpointParams[name] = instruction.value; + break; + case "contextParams": + endpointParams[name] = commandInput[instruction.name]; + break; + case "clientContextParams": + case "builtInParams": + endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); + break; + case "operationContextParams": + endpointParams[name] = instruction.get(commandInput); + break; + default: + throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); } - this.config.maxConcurrency = maxConcurrentStreams; } - setDisableConcurrentStreams(disableConcurrentStreams) { - this.config.disableConcurrency = disableConcurrentStreams; + if (Object.keys(instructions).length === 0) { + Object.assign(endpointParams, clientConfig); } - getUrlString(request) { - return request.destination.toString(); + if (String(clientConfig.serviceId).toLowerCase() === "s3") { + await resolveParamsForS3(endpointParams); } -}; + return endpointParams; +}, "resolveParams"); -// src/node-http2-handler.ts -var NodeHttp2Handler = class _NodeHttp2Handler { - constructor(options) { - this.metadata = { handlerProtocol: "h2" }; - this.connectionManager = new NodeHttp2ConnectionManager({}); - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((opts) => { - resolve(opts || {}); - }).catch(reject); - } else { - resolve(options || {}); +// src/endpointMiddleware.ts +var import_core = __nccwpck_require__(22743); +var import_util_middleware = __nccwpck_require__(99755); +var endpointMiddleware = /* @__PURE__ */ __name(({ + config, + instructions +}) => { + return (next, context) => async (args) => { + if (config.isCustomEndpoint) { + (0, import_core.setFeature)(context, "ENDPOINT_OVERRIDE", "N"); + } + const endpoint = await getEndpointFromInstructions( + args.input, + { + getEndpointParameterInstructions() { + return instructions; + } + }, + { ...config }, + context + ); + context.endpointV2 = endpoint; + context.authSchemes = endpoint.properties?.authSchemes; + const authScheme = context.authSchemes?.[0]; + if (authScheme) { + context["signing_region"] = authScheme.signingRegion; + context["signing_service"] = authScheme.signingName; + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const httpAuthOption = smithyContext?.selectedHttpAuthScheme?.httpAuthOption; + if (httpAuthOption) { + httpAuthOption.signingProperties = Object.assign( + httpAuthOption.signingProperties || {}, + { + signing_region: authScheme.signingRegion, + signingRegion: authScheme.signingRegion, + signing_service: authScheme.signingName, + signingName: authScheme.signingName, + signingRegionSet: authScheme.signingRegionSet + }, + authScheme.properties + ); } + } + return next({ + ...args }); + }; +}, "endpointMiddleware"); + +// src/getEndpointPlugin.ts +var import_middleware_serde = __nccwpck_require__(62654); +var endpointMiddlewareOptions = { + step: "serialize", + tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], + name: "endpointV2Middleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde.serializerMiddlewareOption.name +}; +var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + endpointMiddleware({ + config, + instructions + }), + endpointMiddlewareOptions + ); } - static { - __name(this, "NodeHttp2Handler"); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof instanceOrOptions?.handle === "function") { - return instanceOrOptions; +}), "getEndpointPlugin"); + +// src/resolveEndpointConfig.ts + +var import_getEndpointFromConfig2 = __nccwpck_require__(14272); +var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { + const tls = input.tls ?? true; + const { endpoint, useDualstackEndpoint, useFipsEndpoint } = input; + const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware.normalizeProvider)(endpoint)()) : void 0; + const isCustomEndpoint = !!endpoint; + const resolvedConfig = Object.assign(input, { + endpoint: customEndpointProvider, + tls, + isCustomEndpoint, + useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(useDualstackEndpoint ?? false), + useFipsEndpoint: (0, import_util_middleware.normalizeProvider)(useFipsEndpoint ?? false) + }); + let configuredEndpointPromise = void 0; + resolvedConfig.serviceConfiguredEndpoint = async () => { + if (input.serviceId && !configuredEndpointPromise) { + configuredEndpointPromise = (0, import_getEndpointFromConfig2.getEndpointFromConfig)(input.serviceId); } - return new _NodeHttp2Handler(instanceOrOptions); + return configuredEndpointPromise; + }; + return resolvedConfig; +}, "resolveEndpointConfig"); + +// src/resolveEndpointRequiredConfig.ts +var resolveEndpointRequiredConfig = /* @__PURE__ */ __name((input) => { + const { endpoint } = input; + if (endpoint === void 0) { + input.endpoint = async () => { + throw new Error( + "@smithy/middleware-endpoint: (default endpointRuleSet) endpoint is not set - you must configure an endpoint." + ); + }; } - destroy() { - this.connectionManager.destroy(); + return input; +}, "resolveEndpointRequiredConfig"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 62654: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - async handle(request, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); - if (this.config.maxConcurrentStreams) { - this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); - } - } - const { requestTimeout, disableConcurrentStreams } = this.config; - return new Promise((_resolve, _reject) => { - let fulfilled = false; - let writeRequestBodyPromise = void 0; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _reject(arg); - }, "reject"); - if (abortSignal?.aborted) { - fulfilled = true; - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const { hostname, method, port, protocol, query } = request; - let auth = ""; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}@`; - } - const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; - const requestContext = { destination: new URL(authority) }; - const session = this.connectionManager.lease(requestContext, { - requestTimeout: this.config?.sessionTimeout, - disableConcurrentStreams: disableConcurrentStreams || false - }); - const rejectWithDestroy = /* @__PURE__ */ __name((err) => { - if (disableConcurrentStreams) { - this.destroySession(session); + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + deserializerMiddleware: () => deserializerMiddleware, + deserializerMiddlewareOption: () => deserializerMiddlewareOption, + getSerdePlugin: () => getSerdePlugin, + serializerMiddleware: () => serializerMiddleware, + serializerMiddlewareOption: () => serializerMiddlewareOption +}); +module.exports = __toCommonJS(src_exports); + +// src/deserializerMiddleware.ts +var import_protocol_http = __nccwpck_require__(20843); +var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next, context) => async (args) => { + const { response } = await next(args); + try { + const parsed = await deserializer(response, options); + return { + response, + output: parsed + }; + } catch (error) { + Object.defineProperty(error, "$response", { + value: response + }); + if (!("$metadata" in error)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + try { + error.message += "\n " + hint; + } catch (e) { + if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { + console.warn(hint); + } else { + context.logger?.warn?.(hint); } - fulfilled = true; - reject(err); - }, "rejectWithDestroy"); - const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; } - const req = session.request({ - ...request.headers, - [import_http22.constants.HTTP2_HEADER_PATH]: path, - [import_http22.constants.HTTP2_HEADER_METHOD]: method - }); - session.ref(); - req.on("response", (headers) => { - const httpResponse = new import_protocol_http.HttpResponse({ - statusCode: headers[":status"] || -1, - headers: getTransformedHeaders(headers), - body: req - }); - fulfilled = true; - resolve({ response: httpResponse }); - if (disableConcurrentStreams) { - session.close(); - this.connectionManager.deleteSession(authority, session); + if (typeof error.$responseBodyText !== "undefined") { + if (error.$response) { + error.$response.body = error.$responseBodyText; } - }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { - req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); - timeoutError.name = "TimeoutError"; - rejectWithDestroy(timeoutError); - }); } - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.close(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - rejectWithDestroy(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; + try { + if (import_protocol_http.HttpResponse.isInstance(response)) { + const { headers = {} } = response; + const headerEntries = Object.entries(headers); + error.$metadata = { + httpStatusCode: response.statusCode, + requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), + extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), + cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) + }; } + } catch (e) { } - req.on("frameError", (type, code, id) => { - rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); - }); - req.on("error", rejectWithDestroy); - req.on("aborted", () => { - rejectWithDestroy( - new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) - ); - }); - req.on("close", () => { - session.unref(); - if (disableConcurrentStreams) { - session.destroy(); - } - if (!fulfilled) { - rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); - } - }); - writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); - }); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } - /** - * Destroys a session. - * @param session - the session to destroy. - */ - destroySession(session) { - if (!session.destroyed) { - session.destroy(); } + throw error; } -}; - -// src/stream-collector/collector.ts - -var Collector = class extends import_stream.Writable { - constructor() { - super(...arguments); - this.bufferedBytes = []; - } - static { - __name(this, "Collector"); - } - _write(chunk, encoding, callback) { - this.bufferedBytes.push(chunk); - callback(); - } -}; +}, "deserializerMiddleware"); +var findHeader = /* @__PURE__ */ __name((pattern, headers) => { + return (headers.find(([k]) => { + return k.match(pattern); + }) || [void 0, void 0])[1]; +}, "findHeader"); -// src/stream-collector/index.ts -var streamCollector = /* @__PURE__ */ __name((stream) => { - if (isReadableStreamInstance(stream)) { - return collectReadableStream(stream); +// src/serializerMiddleware.ts +var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { + const endpointConfig = options; + const endpoint = context.endpointV2?.url && endpointConfig.urlParser ? async () => endpointConfig.urlParser(context.endpointV2.url) : endpointConfig.endpoint; + if (!endpoint) { + throw new Error("No valid endpoint provider available."); } - return new Promise((resolve, reject) => { - const collector = new Collector(); - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function() { - const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); - resolve(bytes); - }); + const request = await serializer(args.input, { ...options, endpoint }); + return next({ + ...args, + request }); -}, "streamCollector"); -var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); -async function collectReadableStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; +}, "serializerMiddleware"); + +// src/serdePlugin.ts +var deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true +}; +var serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true +}; +function getSerdePlugin(config, serializer, deserializer) { + return { + applyToStack: (commandStack) => { + commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); + commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption); } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; - } - return collected; + }; } -__name(collectReadableStream, "collectReadableStream"); +__name(getSerdePlugin, "getSerdePlugin"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -72500,8 +63895,8 @@ __name(collectReadableStream, "collectReadableStream"); /***/ }), -/***/ 64181: -/***/ ((module) => { +/***/ 62021: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -72525,143 +63920,87 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize + loadConfig: () => loadConfig }); module.exports = __toCommonJS(src_exports); -// src/ProviderError.ts -var ProviderError = class _ProviderError extends Error { - constructor(message, options = true) { - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; - } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError.prototype); - logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); - } - static { - __name(this, "ProviderError"); - } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); - } -}; +// src/configLoader.ts -// src/CredentialsProviderError.ts -var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError.prototype); - } - static { - __name(this, "CredentialsProviderError"); - } -}; -// src/TokenProviderError.ts -var TokenProviderError = class _TokenProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError.prototype); - } - static { - __name(this, "TokenProviderError"); - } -}; +// src/fromEnv.ts +var import_property_provider = __nccwpck_require__(64181); -// src/chain.ts -var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError("No providers in chain"); +// src/getSelectorName.ts +function getSelectorName(functionString) { + try { + const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); + constants.delete("CONFIG"); + constants.delete("CONFIG_PREFIX_SEPARATOR"); + constants.delete("ENV"); + return [...constants].join(", "); + } catch (e) { + return functionString; } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err?.tryNextLink) { - continue; - } - throw err; +} +__name(getSelectorName, "getSelectorName"); + +// src/fromEnv.ts +var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { + try { + const config = envVarSelector(process.env, options); + if (config === void 0) { + throw new Error(); } + return config; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, + { logger: options?.logger } + ); } - throw lastProviderError; -}, "chain"); +}, "fromEnv"); -// src/fromStatic.ts -var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); +// src/fromSharedConfigFiles.ts -// src/memoize.ts -var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; +var import_shared_ini_file_loader = __nccwpck_require__(30489); +var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, import_shared_ini_file_loader.getProfileName)(init); + const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; + try { + const cfgFile = preferredFile === "config" ? configFile : credentialsFile; + const configValue = configSelector(mergedProfile, cfgFile); + if (configValue === void 0) { + throw new Error(); } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - return resolved; - }; + return configValue; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, + { logger: init.logger } + ); } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - if (isConstant) { - return resolved; - } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; - } - return resolved; - }; -}, "memoize"); +}, "fromSharedConfigFiles"); + +// src/fromStatic.ts + +var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); +var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); + +// src/configLoader.ts +var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { + const { signingName, logger } = configuration; + const envOptions = { signingName, logger }; + return (0, import_property_provider.memoize)( + (0, import_property_provider.chain)( + fromEnv(environmentVariableSelector, envOptions), + fromSharedConfigFiles(configFileSelector, configuration), + fromStatic(defaultValue) + ) + ); +}, "loadConfig"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -72670,12 +64009,14 @@ var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { /***/ }), -/***/ 20843: +/***/ 82764: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +var __create = Object.create; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { @@ -72690,791 +64031,786 @@ var __copyProps = (to, from, except, desc) => { } return to; }; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - Field: () => Field, - Fields: () => Fields, - HttpRequest: () => HttpRequest, - HttpResponse: () => HttpResponse, - IHttpRequest: () => import_types.HttpRequest, - getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, - isValidHostname: () => isValidHostname, - resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig + DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, + NodeHttp2Handler: () => NodeHttp2Handler, + NodeHttpHandler: () => NodeHttpHandler, + streamCollector: () => streamCollector }); module.exports = __toCommonJS(src_exports); -// src/extensions/httpExtensionConfiguration.ts -var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - setHttpHandler(handler) { - runtimeConfig.httpHandler = handler; - }, - httpHandler() { - return runtimeConfig.httpHandler; - }, - updateHttpClientConfig(key, value) { - runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); - }, - httpHandlerConfigs() { - return runtimeConfig.httpHandler.httpHandlerConfigs(); +// src/node-http-handler.ts +var import_protocol_http = __nccwpck_require__(20843); +var import_querystring_builder = __nccwpck_require__(14959); +var import_http = __nccwpck_require__(58611); +var import_https = __nccwpck_require__(65692); + +// src/constants.ts +var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + +// src/get-transformed-headers.ts +var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; +}, "getTransformedHeaders"); + +// src/timing.ts +var timing = { + setTimeout: (cb, ms) => setTimeout(cb, ms), + clearTimeout: (timeoutId) => clearTimeout(timeoutId) +}; + +// src/set-connection-timeout.ts +var DEFER_EVENT_LISTENER_TIME = 1e3; +var setConnectionTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return -1; + } + const registerTimeout = /* @__PURE__ */ __name((offset) => { + const timeoutId = timing.setTimeout(() => { + request.destroy(); + reject( + Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError" + }) + ); + }, timeoutInMs - offset); + const doWithSocket = /* @__PURE__ */ __name((socket) => { + if (socket?.connecting) { + socket.on("connect", () => { + timing.clearTimeout(timeoutId); + }); + } else { + timing.clearTimeout(timeoutId); + } + }, "doWithSocket"); + if (request.socket) { + doWithSocket(request.socket); + } else { + request.on("socket", doWithSocket); } - }; -}, "getHttpHandlerExtensionConfiguration"); -var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { - return { - httpHandler: httpHandlerExtensionConfiguration.httpHandler() - }; -}, "resolveHttpHandlerRuntimeConfig"); + }, "registerTimeout"); + if (timeoutInMs < 2e3) { + registerTimeout(0); + return 0; + } + return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); +}, "setConnectionTimeout"); -// src/Field.ts -var import_types = __nccwpck_require__(65165); -var Field = class { - static { - __name(this, "Field"); +// src/set-socket-keep-alive.ts +var DEFER_EVENT_LISTENER_TIME2 = 3e3; +var setSocketKeepAlive = /* @__PURE__ */ __name((request, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { + if (keepAlive !== true) { + return -1; } - constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; + const registerListener = /* @__PURE__ */ __name(() => { + if (request.socket) { + request.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + } else { + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); + } + }, "registerListener"); + if (deferTimeMs === 0) { + registerListener(); + return 0; } - /** - * Appends a value to the field. - * - * @param value The value to append. - */ - add(value) { - this.values.push(value); + return timing.setTimeout(registerListener, deferTimeMs); +}, "setSocketKeepAlive"); + +// src/set-socket-timeout.ts +var DEFER_EVENT_LISTENER_TIME3 = 3e3; +var setSocketTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = DEFAULT_REQUEST_TIMEOUT) => { + const registerTimeout = /* @__PURE__ */ __name((offset) => { + const timeout = timeoutInMs - offset; + const onTimeout = /* @__PURE__ */ __name(() => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }, "onTimeout"); + if (request.socket) { + request.socket.setTimeout(timeout, onTimeout); + request.on("close", () => request.socket?.removeListener("timeout", onTimeout)); + } else { + request.setTimeout(timeout, onTimeout); + } + }, "registerTimeout"); + if (0 < timeoutInMs && timeoutInMs < 6e3) { + registerTimeout(0); + return 0; + } + return timing.setTimeout( + registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), + DEFER_EVENT_LISTENER_TIME3 + ); +}, "setSocketTimeout"); + +// src/write-request-body.ts +var import_stream = __nccwpck_require__(2203); +var MIN_WAIT_TIME = 6e3; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + const headers = request.headers ?? {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let sendBody = true; + if (expect === "100-continue") { + sendBody = await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(timing.setTimeout(() => resolve(true), Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + timing.clearTimeout(timeoutId); + resolve(true); + }); + httpRequest.on("response", () => { + timing.clearTimeout(timeoutId); + resolve(false); + }); + httpRequest.on("error", () => { + timing.clearTimeout(timeoutId); + resolve(false); + }); + }) + ]); + } + if (sendBody) { + writeBody(httpRequest, request.body); + } +} +__name(writeRequestBody, "writeRequestBody"); +function writeBody(httpRequest, body) { + if (body instanceof import_stream.Readable) { + body.pipe(httpRequest); + return; + } + if (body) { + if (Buffer.isBuffer(body) || typeof body === "string") { + httpRequest.end(body); + return; + } + const uint8 = body; + if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { + httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); + return; + } + httpRequest.end(Buffer.from(body)); + return; + } + httpRequest.end(); +} +__name(writeBody, "writeBody"); + +// src/node-http-handler.ts +var DEFAULT_REQUEST_TIMEOUT = 0; +var NodeHttpHandler = class _NodeHttpHandler { + constructor(options) { + this.socketWarningTimestamp = 0; + // Node http handler is hard-coded to http/1.1: https://github.com/nodejs/node/blob/ff5664b83b89c55e4ab5d5f60068fb457f1f5872/lib/_http_server.js#L286 + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }).catch(reject); + } else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + static { + __name(this, "NodeHttpHandler"); } /** - * Overwrite existing field values. - * - * @param values The new field values. + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. */ - set(values) { - this.values = values; + static create(instanceOrOptions) { + if (typeof instanceOrOptions?.handle === "function") { + return instanceOrOptions; + } + return new _NodeHttpHandler(instanceOrOptions); } /** - * Remove all matching entries from list. + * @internal * - * @param value Value to remove. + * @param agent - http(s) agent in use by the NodeHttpHandler instance. + * @param socketWarningTimestamp - last socket usage check timestamp. + * @param logger - channel for the warning. + * @returns timestamp of last emitted warning. */ - remove(value) { - this.values = this.values.filter((v) => v !== value); + static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { + const { sockets, requests, maxSockets } = agent; + if (typeof maxSockets !== "number" || maxSockets === Infinity) { + return socketWarningTimestamp; + } + const interval = 15e3; + if (Date.now() - interval < socketWarningTimestamp) { + return socketWarningTimestamp; + } + if (sockets && requests) { + for (const origin in sockets) { + const socketsInUse = sockets[origin]?.length ?? 0; + const requestsEnqueued = requests[origin]?.length ?? 0; + if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { + logger?.warn?.( + `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. +See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html +or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` + ); + return Date.now(); + } + } + } + return socketWarningTimestamp; + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, socketAcquisitionWarningTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout ?? socketTimeout, + socketAcquisitionWarningTimeout, + httpAgent: (() => { + if (httpAgent instanceof import_http.Agent || typeof httpAgent?.destroy === "function") { + return httpAgent; + } + return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); + })(), + httpsAgent: (() => { + if (httpsAgent instanceof import_https.Agent || typeof httpsAgent?.destroy === "function") { + return httpsAgent; + } + return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); + })(), + logger: console + }; + } + destroy() { + this.config?.httpAgent?.destroy(); + this.config?.httpsAgent?.destroy(); + } + async handle(request, { abortSignal, requestTimeout } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + let writeRequestBodyPromise = void 0; + const timeouts = []; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(timing.clearTimeout); + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(timing.clearTimeout); + _reject(arg); + }, "reject"); + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal?.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; + timeouts.push( + timing.setTimeout( + () => { + this.socketWarningTimestamp = _NodeHttpHandler.checkSocketUsage( + agent, + this.socketWarningTimestamp, + this.config.logger + ); + }, + this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) + ) + ); + const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); + let auth = void 0; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + let hostname = request.hostname ?? ""; + if (hostname[0] === "[" && hostname.endsWith("]")) { + hostname = request.hostname.slice(1, -1); + } else { + hostname = request.hostname; + } + const nodeHttpsOptions = { + headers: request.headers, + host: hostname, + method: request.method, + path, + port: request.port, + agent, + auth + }; + const requestFunc = isSSL ? import_https.request : import_http.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new import_protocol_http.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: getTransformedHeaders(res.headers), + body: res + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } else { + reject(err); + } + }); + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.destroy(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; + } + } + const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; + timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); + timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + timeouts.push( + setSocketKeepAlive(req, { + // @ts-expect-error keepAlive is not public on httpAgent. + keepAlive: httpAgent.keepAlive, + // @ts-expect-error keepAliveMsecs is not public on httpAgent. + keepAliveMsecs: httpAgent.keepAliveMsecs + }) + ); + } + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { + timeouts.forEach(timing.clearTimeout); + return _reject(e); + }); + }); } - /** - * Get comma-delimited string. - * - * @returns String representation of {@link Field}. - */ - toString() { - return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); } - /** - * Get string values as a list - * - * @returns Values in {@link Field} as a list. - */ - get() { - return this.values; + httpHandlerConfigs() { + return this.config ?? {}; } }; -// src/Fields.ts -var Fields = class { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - static { - __name(this, "Fields"); - } - /** - * Set entry for a {@link Field} name. The `name` - * attribute will be used to key the collection. - * - * @param field The {@link Field} to set. - */ - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - /** - * Retrieve {@link Field} entry by name. - * - * @param name The name of the {@link Field} entry - * to retrieve - * @returns The {@link Field} if it exists. - */ - getField(name) { - return this.entries[name.toLowerCase()]; - } - /** - * Delete entry from collection. - * - * @param name Name of the entry to delete. - */ - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - /** - * Helper function for retrieving specific types of fields. - * Used to grab all headers or all trailers. - * - * @param kind {@link FieldPosition} of entries to retrieve. - * @returns The {@link Field} entries with the specified - * {@link FieldPosition}. - */ - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } -}; +// src/node-http2-handler.ts -// src/httpRequest.ts -var HttpRequest = class _HttpRequest { - static { - __name(this, "HttpRequest"); - } - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; - this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; +var import_http22 = __nccwpck_require__(85675); + +// src/node-http2-connection-manager.ts +var import_http2 = __toESM(__nccwpck_require__(85675)); + +// src/node-http2-connection-pool.ts +var NodeHttp2ConnectionPool = class { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions ?? []; } - /** - * Note: this does not deep-clone the body. - */ - static clone(request) { - const cloned = new _HttpRequest({ - ...request, - headers: { ...request.headers } - }); - if (cloned.query) { - cloned.query = cloneQuery(cloned.query); - } - return cloned; + static { + __name(this, "NodeHttp2ConnectionPool"); } - /** - * This method only actually asserts that request is the interface {@link IHttpRequest}, - * and not necessarily this concrete class. Left in place for API stability. - * - * Do not call instance methods on the input of this function, and - * do not assume it has the HttpRequest prototype. - */ - static isInstance(request) { - if (!request) { - return false; + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); } - const req = request; - return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; } - /** - * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call - * this method because {@link HttpRequest.isInstance} incorrectly - * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). - */ - clone() { - return _HttpRequest.clone(this); + offerLast(session) { + this.sessions.push(session); } -}; -function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param - }; - }, {}); -} -__name(cloneQuery, "cloneQuery"); - -// src/httpResponse.ts -var HttpResponse = class { - static { - __name(this, "HttpResponse"); + contains(session) { + return this.sessions.includes(session); } - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); } -}; - -// src/isValidHostname.ts -function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); -} -__name(isValidHostname, "isValidHostname"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 14959: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } } - return to; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var src_exports = {}; -__export(src_exports, { - buildQueryString: () => buildQueryString -}); -module.exports = __toCommonJS(src_exports); -var import_util_uri_escape = __nccwpck_require__(87377); -function buildQueryString(query) { - const parts = []; - for (let key of Object.keys(query).sort()) { - const value = query[key]; - key = (0, import_util_uri_escape.escapeUri)(key); - if (Array.isArray(value)) { - for (let i = 0, iLen = value.length; i < iLen; i++) { - parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); - } - } else { - let qsEntry = key; - if (value || typeof value === "string") { - qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; - } - parts.push(qsEntry); +// src/node-http2-connection-manager.ts +var NodeHttp2ConnectionManager = class { + constructor(config) { + this.sessionCache = /* @__PURE__ */ new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); } } - return parts.join("&"); -} -__name(buildQueryString, "buildQueryString"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 15183: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + static { + __name(this, "NodeHttp2ConnectionManager"); } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - parseQueryString: () => parseQueryString -}); -module.exports = __toCommonJS(src_exports); -function parseQueryString(querystring) { - const query = {}; - querystring = querystring.replace(/^\?/, ""); - if (querystring) { - for (const pair of querystring.split("&")) { - let [key, value = null] = pair.split("="); - key = decodeURIComponent(key); - if (value) { - value = decodeURIComponent(value); - } - if (!(key in query)) { - query[key] = value; - } else if (Array.isArray(query[key])) { - query[key].push(value); - } else { - query[key] = [query[key], value]; + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; } } + const session = import_http2.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error( + "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() + ); + } + }); + } + session.unref(); + const destroySessionCb = /* @__PURE__ */ __name(() => { + session.destroy(); + this.deleteSession(url, session); + }, "destroySessionCb"); + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; } - return query; -} -__name(parseQueryString, "parseQueryString"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 23327: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getHomeDir = void 0; -const os_1 = __nccwpck_require__(70857); -const path_1 = __nccwpck_require__(16928); -const homeDirCache = {}; -const getHomeDirCacheKey = () => { - if (process && process.geteuid) { - return `${process.geteuid()}`; + /** + * Delete a session from the connection pool. + * @param authority The authority of the session to delete. + * @param session The session to delete. + */ + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + const cacheKey = this.getUrlString(requestContext); + this.sessionCache.get(cacheKey)?.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); } - return "DEFAULT"; -}; -const getHomeDir = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - const homeDirCacheKey = getHomeDirCacheKey(); - if (!homeDirCache[homeDirCacheKey]) - homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); - return homeDirCache[homeDirCacheKey]; -}; -exports.getHomeDir = getHomeDir; - - -/***/ }), - -/***/ 72412: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFilepath = void 0; -const crypto_1 = __nccwpck_require__(76982); -const path_1 = __nccwpck_require__(16928); -const getHomeDir_1 = __nccwpck_require__(23327); -const getSSOTokenFilepath = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); -}; -exports.getSSOTokenFilepath = getSSOTokenFilepath; - - -/***/ }), - -/***/ 27539: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFromFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const getSSOTokenFilepath_1 = __nccwpck_require__(72412); -const { readFile } = fs_1.promises; -const getSSOTokenFromFile = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); -}; -exports.getSSOTokenFromFile = getSSOTokenFromFile; - - -/***/ }), - -/***/ 30489: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - return to; + setMaxConcurrentStreams(maxConcurrentStreams) { + if (maxConcurrentStreams && maxConcurrentStreams <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } }; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - getProfileName: () => getProfileName, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles -}); -module.exports = __toCommonJS(src_exports); -__reExport(src_exports, __nccwpck_require__(23327), module.exports); - -// src/getProfileName.ts -var ENV_PROFILE = "AWS_PROFILE"; -var DEFAULT_PROFILE = "default"; -var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); - -// src/index.ts -__reExport(src_exports, __nccwpck_require__(72412), module.exports); -__reExport(src_exports, __nccwpck_require__(27539), module.exports); - -// src/loadSharedConfigFiles.ts - -// src/getConfigData.ts -var import_types = __nccwpck_require__(65165); -var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; +// src/node-http2-handler.ts +var NodeHttp2Handler = class _NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((opts) => { + resolve(opts || {}); + }).catch(reject); + } else { + resolve(options || {}); + } + }); } - return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); -}).reduce( - (acc, [key, value]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; - acc[updatedKey] = value; - return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } + static { + __name(this, "NodeHttp2Handler"); } -), "getConfigData"); - -// src/getConfigFilepath.ts -var import_path = __nccwpck_require__(16928); -var import_getHomeDir = __nccwpck_require__(23327); -var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; -var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); - -// src/getCredentialsFilepath.ts - -var import_getHomeDir2 = __nccwpck_require__(23327); -var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; -var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); - -// src/loadSharedConfigFiles.ts -var import_getHomeDir3 = __nccwpck_require__(23327); - -// src/parseIni.ts - -var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; -var profileNameBlockList = ["__proto__", "profile __proto__"]; -var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof instanceOrOptions?.handle === "function") { + return instanceOrOptions; + } + return new _NodeHttp2Handler(instanceOrOptions); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal, requestTimeout } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; + const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; + return new Promise((_resolve, _reject) => { + let fulfilled = false; + let writeRequestBodyPromise = void 0; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }, "reject"); + if (abortSignal?.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: this.config?.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false + }); + const rejectWithDestroy = /* @__PURE__ */ __name((err) => { + if (disableConcurrentStreams) { + this.destroySession(session); } - } else { - currentSection = sectionName; + fulfilled = true; + reject(err); + }, "rejectWithDestroy"); + const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); + if (request.fragment) { + path += `#${request.fragment}`; } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; + const req = session.request({ + ...request.headers, + [import_http22.constants.HTTP2_HEADER_PATH]: path, + [import_http22.constants.HTTP2_HEADER_METHOD]: method + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new import_protocol_http.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: getTransformedHeaders(headers), + body: req + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (effectiveRequestTimeout) { + req.setTimeout(effectiveRequestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; + abortSignal.onabort = onAbort; } } - } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy( + new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) + ); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); + }); } - return map; -}, "parseIni"); - -// src/loadSharedConfigFiles.ts -var import_slurpFile = __nccwpck_require__(47307); -var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var CONFIG_PREFIX_SEPARATOR = "."; -var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); + httpHandlerConfigs() { + return this.config ?? {}; } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; -}, "loadSharedConfigFiles"); - -// src/getSsoSessionData.ts - -var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); - -// src/loadSsoSessionData.ts -var import_slurpFile2 = __nccwpck_require__(47307); -var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); - -// src/mergeConfigFiles.ts -var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); - } else { - merged[key] = values; - } + /** + * Destroys a session. + * @param session - the session to destroy. + */ + destroySession(session) { + if (!session.destroyed) { + session.destroy(); } } - return merged; -}, "mergeConfigFiles"); - -// src/parseKnownFiles.ts -var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); -}, "parseKnownFiles"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 47307: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.slurpFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const { readFile } = fs_1.promises; -const filePromisesHash = {}; -const slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); - } - return filePromisesHash[path]; }; -exports.slurpFile = slurpFile; +// src/stream-collector/collector.ts -/***/ }), - -/***/ 65165: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +var Collector = class extends import_stream.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + static { + __name(this, "Collector"); + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); } - return to; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - AlgorithmId: () => AlgorithmId, - EndpointURLScheme: () => EndpointURLScheme, - FieldPosition: () => FieldPosition, - HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, - HttpAuthLocation: () => HttpAuthLocation, - IniSectionType: () => IniSectionType, - RequestHandlerProtocol: () => RequestHandlerProtocol, - SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig -}); -module.exports = __toCommonJS(src_exports); - -// src/auth/auth.ts -var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { - HttpAuthLocation2["HEADER"] = "header"; - HttpAuthLocation2["QUERY"] = "query"; - return HttpAuthLocation2; -})(HttpAuthLocation || {}); - -// src/auth/HttpApiKeyAuth.ts -var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { - HttpApiKeyAuthLocation2["HEADER"] = "header"; - HttpApiKeyAuthLocation2["QUERY"] = "query"; - return HttpApiKeyAuthLocation2; -})(HttpApiKeyAuthLocation || {}); - -// src/endpoint.ts -var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { - EndpointURLScheme2["HTTP"] = "http"; - EndpointURLScheme2["HTTPS"] = "https"; - return EndpointURLScheme2; -})(EndpointURLScheme || {}); -// src/extensions/checksum.ts -var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { - AlgorithmId2["MD5"] = "md5"; - AlgorithmId2["CRC32"] = "crc32"; - AlgorithmId2["CRC32C"] = "crc32c"; - AlgorithmId2["SHA1"] = "sha1"; - AlgorithmId2["SHA256"] = "sha256"; - return AlgorithmId2; -})(AlgorithmId || {}); -var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const checksumAlgorithms = []; - if (runtimeConfig.sha256 !== void 0) { - checksumAlgorithms.push({ - algorithmId: () => "sha256" /* SHA256 */, - checksumConstructor: () => runtimeConfig.sha256 - }); +// src/stream-collector/index.ts +var streamCollector = /* @__PURE__ */ __name((stream) => { + if (isReadableStreamInstance(stream)) { + return collectReadableStream(stream); } - if (runtimeConfig.md5 != void 0) { - checksumAlgorithms.push({ - algorithmId: () => "md5" /* MD5 */, - checksumConstructor: () => runtimeConfig.md5 + return new Promise((resolve, reject) => { + const collector = new Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); }); - } - return { - addChecksumAlgorithm(algo) { - checksumAlgorithms.push(algo); - }, - checksumAlgorithms() { - return checksumAlgorithms; - } - }; -}, "getChecksumConfiguration"); -var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { - const runtimeConfig = {}; - clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { - runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); - }); - return runtimeConfig; -}, "resolveChecksumRuntimeConfig"); - -// src/extensions/defaultClientConfiguration.ts -var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return getChecksumConfiguration(runtimeConfig); -}, "getDefaultClientConfiguration"); -var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return resolveChecksumRuntimeConfig(config); -}, "resolveDefaultRuntimeConfig"); - -// src/http.ts -var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { - FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; - FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; - return FieldPosition2; -})(FieldPosition || {}); - -// src/middleware.ts -var SMITHY_CONTEXT_KEY = "__smithy_context"; - -// src/profile.ts -var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { - IniSectionType2["PROFILE"] = "profile"; - IniSectionType2["SSO_SESSION"] = "sso-session"; - IniSectionType2["SERVICES"] = "services"; - return IniSectionType2; -})(IniSectionType || {}); - -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); + collector.on("error", reject); + collector.on("finish", function() { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); + }); +}, "streamCollector"); +var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); +async function collectReadableStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +__name(collectReadableStream, "collectReadableStream"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -73483,8 +64819,8 @@ var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { /***/ }), -/***/ 60043: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 64181: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -73508,82 +64844,143 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - parseUrl: () => parseUrl + CredentialsProviderError: () => CredentialsProviderError, + ProviderError: () => ProviderError, + TokenProviderError: () => TokenProviderError, + chain: () => chain, + fromStatic: () => fromStatic, + memoize: () => memoize }); module.exports = __toCommonJS(src_exports); -var import_querystring_parser = __nccwpck_require__(15183); -var parseUrl = /* @__PURE__ */ __name((url) => { - if (typeof url === "string") { - return parseUrl(new URL(url)); + +// src/ProviderError.ts +var ProviderError = class _ProviderError extends Error { + constructor(message, options = true) { + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = void 0; + tryNextLink = options; + } else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; + } + super(message); + this.name = "ProviderError"; + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, _ProviderError.prototype); + logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); } - const { hostname, pathname, port, protocol, search } = url; - let query; - if (search) { - query = (0, import_querystring_parser.parseQueryString)(search); + static { + __name(this, "ProviderError"); } - return { - hostname, - port: port ? parseInt(port) : void 0, - protocol, - path: pathname, - query - }; -}, "parseUrl"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - + /** + * @deprecated use new operator. + */ + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); + } +}; +// src/CredentialsProviderError.ts +var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, _CredentialsProviderError.prototype); + } + static { + __name(this, "CredentialsProviderError"); + } +}; -/***/ }), +// src/TokenProviderError.ts +var TokenProviderError = class _TokenProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, _TokenProviderError.prototype); + } + static { + __name(this, "TokenProviderError"); + } +}; -/***/ 95895: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/chain.ts +var chain = /* @__PURE__ */ __name((...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } catch (err) { + lastProviderError = err; + if (err?.tryNextLink) { + continue; + } + throw err; + } + } + throw lastProviderError; +}, "chain"); -"use strict"; +// src/fromStatic.ts +var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromBase64 = void 0; -const util_buffer_from_1 = __nccwpck_require__(21266); -const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; -const fromBase64 = (input) => { - if ((input.length * 3) % 4 !== 0) { - throw new TypeError(`Incorrect padding on base64 string.`); +// src/memoize.ts +var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async () => { + if (!pending) { + pending = provider(); } - if (!BASE64_REGEX.exec(input)) { - throw new TypeError(`Invalid base64 string.`); + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; } - const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); - return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); -}; -exports.fromBase64 = fromBase64; - - -/***/ }), - -/***/ 72722: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + return resolved; + }; } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -module.exports = __toCommonJS(src_exports); -__reExport(src_exports, __nccwpck_require__(95895), module.exports); -__reExport(src_exports, __nccwpck_require__(97234), module.exports); + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; +}, "memoize"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -73592,34 +64989,7 @@ __reExport(src_exports, __nccwpck_require__(97234), module.exports); /***/ }), -/***/ 97234: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toBase64 = void 0; -const util_buffer_from_1 = __nccwpck_require__(21266); -const util_utf8_1 = __nccwpck_require__(46090); -const toBase64 = (_input) => { - let input; - if (typeof _input === "string") { - input = (0, util_utf8_1.fromUtf8)(_input); - } - else { - input = _input; - } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); - } - return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); -}; -exports.toBase64 = toBase64; - - -/***/ }), - -/***/ 21266: +/***/ 20843: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -73644,24 +65014,234 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - fromArrayBuffer: () => fromArrayBuffer, - fromString: () => fromString + Field: () => Field, + Fields: () => Fields, + HttpRequest: () => HttpRequest, + HttpResponse: () => HttpResponse, + IHttpRequest: () => import_types.HttpRequest, + getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, + isValidHostname: () => isValidHostname, + resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig }); module.exports = __toCommonJS(src_exports); -var import_is_array_buffer = __nccwpck_require__(21109); -var import_buffer = __nccwpck_require__(20181); -var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { - if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { - throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); + +// src/extensions/httpExtensionConfiguration.ts +var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return { + setHttpHandler(handler) { + runtimeConfig.httpHandler = handler; + }, + httpHandler() { + return runtimeConfig.httpHandler; + }, + updateHttpClientConfig(key, value) { + runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return runtimeConfig.httpHandler.httpHandlerConfigs(); + } + }; +}, "getHttpHandlerExtensionConfiguration"); +var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler() + }; +}, "resolveHttpHandlerRuntimeConfig"); + +// src/Field.ts +var import_types = __nccwpck_require__(65165); +var Field = class { + static { + __name(this, "Field"); } - return import_buffer.Buffer.from(input, offset, length); -}, "fromArrayBuffer"); -var fromString = /* @__PURE__ */ __name((input, encoding) => { - if (typeof input !== "string") { - throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; } - return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); -}, "fromString"); + /** + * Appends a value to the field. + * + * @param value The value to append. + */ + add(value) { + this.values.push(value); + } + /** + * Overwrite existing field values. + * + * @param values The new field values. + */ + set(values) { + this.values = values; + } + /** + * Remove all matching entries from list. + * + * @param value Value to remove. + */ + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + /** + * Get comma-delimited string. + * + * @returns String representation of {@link Field}. + */ + toString() { + return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); + } + /** + * Get string values as a list + * + * @returns Values in {@link Field} as a list. + */ + get() { + return this.values; + } +}; + +// src/Fields.ts +var Fields = class { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + static { + __name(this, "Fields"); + } + /** + * Set entry for a {@link Field} name. The `name` + * attribute will be used to key the collection. + * + * @param field The {@link Field} to set. + */ + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + /** + * Retrieve {@link Field} entry by name. + * + * @param name The name of the {@link Field} entry + * to retrieve + * @returns The {@link Field} if it exists. + */ + getField(name) { + return this.entries[name.toLowerCase()]; + } + /** + * Delete entry from collection. + * + * @param name Name of the entry to delete. + */ + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + /** + * Helper function for retrieving specific types of fields. + * Used to grab all headers or all trailers. + * + * @param kind {@link FieldPosition} of entries to retrieve. + * @returns The {@link Field} entries with the specified + * {@link FieldPosition}. + */ + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +}; + +// src/httpRequest.ts + +var HttpRequest = class _HttpRequest { + static { + __name(this, "HttpRequest"); + } + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; + this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + /** + * Note: this does not deep-clone the body. + */ + static clone(request) { + const cloned = new _HttpRequest({ + ...request, + headers: { ...request.headers } + }); + if (cloned.query) { + cloned.query = cloneQuery(cloned.query); + } + return cloned; + } + /** + * This method only actually asserts that request is the interface {@link IHttpRequest}, + * and not necessarily this concrete class. Left in place for API stability. + * + * Do not call instance methods on the input of this function, and + * do not assume it has the HttpRequest prototype. + */ + static isInstance(request) { + if (!request) { + return false; + } + const req = request; + return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; + } + /** + * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call + * this method because {@link HttpRequest.isInstance} incorrectly + * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). + */ + clone() { + return _HttpRequest.clone(this); + } +}; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param + }; + }, {}); +} +__name(cloneQuery, "cloneQuery"); + +// src/httpResponse.ts +var HttpResponse = class { + static { + __name(this, "HttpResponse"); + } + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +}; + +// src/isValidHostname.ts +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +__name(isValidHostname, "isValidHostname"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -73670,8 +65250,8 @@ var fromString = /* @__PURE__ */ __name((input, encoding) => { /***/ }), -/***/ 79916: -/***/ ((module) => { +/***/ 14959: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -73695,44 +65275,30 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - fromHex: () => fromHex, - toHex: () => toHex + buildQueryString: () => buildQueryString }); -module.exports = __toCommonJS(src_exports); -var SHORT_TO_HEX = {}; -var HEX_TO_SHORT = {}; -for (let i = 0; i < 256; i++) { - let encodedByte = i.toString(16).toLowerCase(); - if (encodedByte.length === 1) { - encodedByte = `0${encodedByte}`; - } - SHORT_TO_HEX[i] = encodedByte; - HEX_TO_SHORT[encodedByte] = i; -} -function fromHex(encoded) { - if (encoded.length % 2 !== 0) { - throw new Error("Hex encoded strings must have an even number length"); - } - const out = new Uint8Array(encoded.length / 2); - for (let i = 0; i < encoded.length; i += 2) { - const encodedByte = encoded.slice(i, i + 2).toLowerCase(); - if (encodedByte in HEX_TO_SHORT) { - out[i / 2] = HEX_TO_SHORT[encodedByte]; +module.exports = __toCommonJS(src_exports); +var import_util_uri_escape = __nccwpck_require__(87377); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, import_util_uri_escape.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); + } } else { - throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; + } + parts.push(qsEntry); } } - return out; -} -__name(fromHex, "fromHex"); -function toHex(bytes) { - let out = ""; - for (let i = 0; i < bytes.byteLength; i++) { - out += SHORT_TO_HEX[bytes[i]]; - } - return out; + return parts.join("&"); } -__name(toHex, "toHex"); +__name(buildQueryString, "buildQueryString"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -73741,8 +65307,8 @@ __name(toHex, "toHex"); /***/ }), -/***/ 99755: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 15183: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -73766,529 +65332,114 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - getSmithyContext: () => getSmithyContext, - normalizeProvider: () => normalizeProvider + parseQueryString: () => parseQueryString }); module.exports = __toCommonJS(src_exports); - -// src/getSmithyContext.ts -var import_types = __nccwpck_require__(65165); -var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - -// src/normalizeProvider.ts -var normalizeProvider = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; -}, "normalizeProvider"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 79241: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ByteArrayCollector = void 0; -class ByteArrayCollector { - constructor(allocByteArray) { - this.allocByteArray = allocByteArray; - this.byteLength = 0; - this.byteArrays = []; - } - push(byteArray) { - this.byteArrays.push(byteArray); - this.byteLength += byteArray.byteLength; - } - flush() { - if (this.byteArrays.length === 1) { - const bytes = this.byteArrays[0]; - this.reset(); - return bytes; - } - const aggregation = this.allocByteArray(this.byteLength); - let cursor = 0; - for (let i = 0; i < this.byteArrays.length; ++i) { - const bytes = this.byteArrays[i]; - aggregation.set(bytes, cursor); - cursor += bytes.byteLength; - } - this.reset(); - return aggregation; - } - reset() { - this.byteArrays = []; - this.byteLength = 0; - } -} -exports.ByteArrayCollector = ByteArrayCollector; - - -/***/ }), - -/***/ 34778: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ChecksumStream = void 0; -const ReadableStreamRef = typeof ReadableStream === "function" ? ReadableStream : function () { }; -class ChecksumStream extends ReadableStreamRef { -} -exports.ChecksumStream = ChecksumStream; - - -/***/ }), - -/***/ 72116: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ChecksumStream = void 0; -const util_base64_1 = __nccwpck_require__(72722); -const stream_1 = __nccwpck_require__(2203); -class ChecksumStream extends stream_1.Duplex { - constructor({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder, }) { - var _a, _b; - super(); - if (typeof source.pipe === "function") { - this.source = source; - } - else { - throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); - } - this.base64Encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; - this.expectedChecksum = expectedChecksum; - this.checksum = checksum; - this.checksumSourceLocation = checksumSourceLocation; - this.source.pipe(this); - } - _read(size) { } - _write(chunk, encoding, callback) { - try { - this.checksum.update(chunk); - this.push(chunk); - } - catch (e) { - return callback(e); - } - return callback(); - } - async _final(callback) { - try { - const digest = await this.checksum.digest(); - const received = this.base64Encoder(digest); - if (this.expectedChecksum !== received) { - return callback(new Error(`Checksum mismatch: expected "${this.expectedChecksum}" but received "${received}"` + - ` in response header "${this.checksumSourceLocation}".`)); - } - } - catch (e) { - return callback(e); - } - this.push(null); - return callback(); - } -} -exports.ChecksumStream = ChecksumStream; - - -/***/ }), - -/***/ 49158: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createChecksumStream = void 0; -const util_base64_1 = __nccwpck_require__(72722); -const stream_type_check_1 = __nccwpck_require__(37785); -const ChecksumStream_browser_1 = __nccwpck_require__(34778); -const createChecksumStream = ({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder, }) => { - var _a, _b; - if (!(0, stream_type_check_1.isReadableStream)(source)) { - throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); - } - const encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; - if (typeof TransformStream !== "function") { - throw new Error("@smithy/util-stream: unable to instantiate ChecksumStream because API unavailable: ReadableStream/TransformStream."); - } - const transform = new TransformStream({ - start() { }, - async transform(chunk, controller) { - checksum.update(chunk); - controller.enqueue(chunk); - }, - async flush(controller) { - const digest = await checksum.digest(); - const received = encoder(digest); - if (expectedChecksum !== received) { - const error = new Error(`Checksum mismatch: expected "${expectedChecksum}" but received "${received}"` + - ` in response header "${checksumSourceLocation}".`); - controller.error(error); - } - else { - controller.terminate(); - } - }, - }); - source.pipeThrough(transform); - const readable = transform.readable; - Object.setPrototypeOf(readable, ChecksumStream_browser_1.ChecksumStream.prototype); - return readable; -}; -exports.createChecksumStream = createChecksumStream; - - -/***/ }), - -/***/ 32384: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createChecksumStream = createChecksumStream; -const stream_type_check_1 = __nccwpck_require__(37785); -const ChecksumStream_1 = __nccwpck_require__(72116); -const createChecksumStream_browser_1 = __nccwpck_require__(49158); -function createChecksumStream(init) { - if (typeof ReadableStream === "function" && (0, stream_type_check_1.isReadableStream)(init.source)) { - return (0, createChecksumStream_browser_1.createChecksumStream)(init); +function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } else if (Array.isArray(query[key])) { + query[key].push(value); + } else { + query[key] = [query[key], value]; + } } - return new ChecksumStream_1.ChecksumStream(init); + } + return query; } +__name(parseQueryString, "parseQueryString"); +// Annotate the CommonJS export names for ESM import in node: +0 && (0); -/***/ }), - -/***/ 40260: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createBufferedReadable = createBufferedReadable; -const node_stream_1 = __nccwpck_require__(57075); -const ByteArrayCollector_1 = __nccwpck_require__(79241); -const createBufferedReadableStream_1 = __nccwpck_require__(34335); -const stream_type_check_1 = __nccwpck_require__(37785); -function createBufferedReadable(upstream, size, logger) { - if ((0, stream_type_check_1.isReadableStream)(upstream)) { - return (0, createBufferedReadableStream_1.createBufferedReadableStream)(upstream, size, logger); - } - const downstream = new node_stream_1.Readable({ read() { } }); - let streamBufferingLoggedWarning = false; - let bytesSeen = 0; - const buffers = [ - "", - new ByteArrayCollector_1.ByteArrayCollector((size) => new Uint8Array(size)), - new ByteArrayCollector_1.ByteArrayCollector((size) => Buffer.from(new Uint8Array(size))), - ]; - let mode = -1; - upstream.on("data", (chunk) => { - const chunkMode = (0, createBufferedReadableStream_1.modeOf)(chunk, true); - if (mode !== chunkMode) { - if (mode >= 0) { - downstream.push((0, createBufferedReadableStream_1.flush)(buffers, mode)); - } - mode = chunkMode; - } - if (mode === -1) { - downstream.push(chunk); - return; - } - const chunkSize = (0, createBufferedReadableStream_1.sizeOf)(chunk); - bytesSeen += chunkSize; - const bufferSize = (0, createBufferedReadableStream_1.sizeOf)(buffers[mode]); - if (chunkSize >= size && bufferSize === 0) { - downstream.push(chunk); - } - else { - const newSize = (0, createBufferedReadableStream_1.merge)(buffers, mode, chunk); - if (!streamBufferingLoggedWarning && bytesSeen > size * 2) { - streamBufferingLoggedWarning = true; - logger === null || logger === void 0 ? void 0 : logger.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`); - } - if (newSize >= size) { - downstream.push((0, createBufferedReadableStream_1.flush)(buffers, mode)); - } - } - }); - upstream.on("end", () => { - if (mode !== -1) { - const remainder = (0, createBufferedReadableStream_1.flush)(buffers, mode); - if ((0, createBufferedReadableStream_1.sizeOf)(remainder) > 0) { - downstream.push(remainder); - } - } - downstream.push(null); - }); - return downstream; -} /***/ }), -/***/ 34335: +/***/ 23327: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createBufferedReadable = void 0; -exports.createBufferedReadableStream = createBufferedReadableStream; -exports.merge = merge; -exports.flush = flush; -exports.sizeOf = sizeOf; -exports.modeOf = modeOf; -const ByteArrayCollector_1 = __nccwpck_require__(79241); -function createBufferedReadableStream(upstream, size, logger) { - const reader = upstream.getReader(); - let streamBufferingLoggedWarning = false; - let bytesSeen = 0; - const buffers = ["", new ByteArrayCollector_1.ByteArrayCollector((size) => new Uint8Array(size))]; - let mode = -1; - const pull = async (controller) => { - const { value, done } = await reader.read(); - const chunk = value; - if (done) { - if (mode !== -1) { - const remainder = flush(buffers, mode); - if (sizeOf(remainder) > 0) { - controller.enqueue(remainder); - } - } - controller.close(); - } - else { - const chunkMode = modeOf(chunk, false); - if (mode !== chunkMode) { - if (mode >= 0) { - controller.enqueue(flush(buffers, mode)); - } - mode = chunkMode; - } - if (mode === -1) { - controller.enqueue(chunk); - return; - } - const chunkSize = sizeOf(chunk); - bytesSeen += chunkSize; - const bufferSize = sizeOf(buffers[mode]); - if (chunkSize >= size && bufferSize === 0) { - controller.enqueue(chunk); - } - else { - const newSize = merge(buffers, mode, chunk); - if (!streamBufferingLoggedWarning && bytesSeen > size * 2) { - streamBufferingLoggedWarning = true; - logger === null || logger === void 0 ? void 0 : logger.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`); - } - if (newSize >= size) { - controller.enqueue(flush(buffers, mode)); - } - else { - await pull(controller); - } - } - } - }; - return new ReadableStream({ - pull, - }); -} -exports.createBufferedReadable = createBufferedReadableStream; -function merge(buffers, mode, chunk) { - switch (mode) { - case 0: - buffers[0] += chunk; - return sizeOf(buffers[0]); - case 1: - case 2: - buffers[mode].push(chunk); - return sizeOf(buffers[mode]); - } -} -function flush(buffers, mode) { - switch (mode) { - case 0: - const s = buffers[0]; - buffers[0] = ""; - return s; - case 1: - case 2: - return buffers[mode].flush(); - } - throw new Error(`@smithy/util-stream - invalid index ${mode} given to flush()`); -} -function sizeOf(chunk) { - var _a, _b; - return (_b = (_a = chunk === null || chunk === void 0 ? void 0 : chunk.byteLength) !== null && _a !== void 0 ? _a : chunk === null || chunk === void 0 ? void 0 : chunk.length) !== null && _b !== void 0 ? _b : 0; -} -function modeOf(chunk, allowBuffer = true) { - if (allowBuffer && typeof Buffer !== "undefined" && chunk instanceof Buffer) { - return 2; - } - if (chunk instanceof Uint8Array) { - return 1; - } - if (typeof chunk === "string") { - return 0; +exports.getHomeDir = void 0; +const os_1 = __nccwpck_require__(70857); +const path_1 = __nccwpck_require__(16928); +const homeDirCache = {}; +const getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; } - return -1; -} - - -/***/ }), - -/***/ 22505: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getAwsChunkedEncodingStream = void 0; -const stream_1 = __nccwpck_require__(2203); -const getAwsChunkedEncodingStream = (readableStream, options) => { - const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; - const checksumRequired = base64Encoder !== undefined && - checksumAlgorithmFn !== undefined && - checksumLocationName !== undefined && - streamHasher !== undefined; - const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : undefined; - const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { } }); - readableStream.on("data", (data) => { - const length = bodyLengthChecker(data) || 0; - awsChunkedEncodingStream.push(`${length.toString(16)}\r\n`); - awsChunkedEncodingStream.push(data); - awsChunkedEncodingStream.push("\r\n"); - }); - readableStream.on("end", async () => { - awsChunkedEncodingStream.push(`0\r\n`); - if (checksumRequired) { - const checksum = base64Encoder(await digest); - awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r\n`); - awsChunkedEncodingStream.push(`\r\n`); - } - awsChunkedEncodingStream.push(null); - }); - return awsChunkedEncodingStream; + return "DEFAULT"; }; -exports.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream; - - -/***/ }), - -/***/ 45139: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.headStream = headStream; -async function headStream(stream, bytes) { - var _a; - let byteLengthCounter = 0; - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - byteLengthCounter += (_a = value === null || value === void 0 ? void 0 : value.byteLength) !== null && _a !== void 0 ? _a : 0; - } - if (byteLengthCounter >= bytes) { - break; - } - isDone = done; - } - reader.releaseLock(); - const collected = new Uint8Array(Math.min(bytes, byteLengthCounter)); - let offset = 0; - for (const chunk of chunks) { - if (chunk.byteLength > collected.byteLength - offset) { - collected.set(chunk.subarray(0, collected.byteLength - offset), offset); - break; - } - else { - collected.set(chunk, offset); - } - offset += chunk.length; - } - return collected; -} +const getHomeDir = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; +}; +exports.getHomeDir = getHomeDir; /***/ }), -/***/ 86901: +/***/ 72412: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.headStream = void 0; -const stream_1 = __nccwpck_require__(2203); -const headStream_browser_1 = __nccwpck_require__(45139); -const stream_type_check_1 = __nccwpck_require__(37785); -const headStream = (stream, bytes) => { - if ((0, stream_type_check_1.isReadableStream)(stream)) { - return (0, headStream_browser_1.headStream)(stream, bytes); - } - return new Promise((resolve, reject) => { - const collector = new Collector(); - collector.limit = bytes; - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function () { - const bytes = new Uint8Array(Buffer.concat(this.buffers)); - resolve(bytes); - }); - }); +exports.getSSOTokenFilepath = void 0; +const crypto_1 = __nccwpck_require__(76982); +const path_1 = __nccwpck_require__(16928); +const getHomeDir_1 = __nccwpck_require__(23327); +const getSSOTokenFilepath = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); }; -exports.headStream = headStream; -class Collector extends stream_1.Writable { - constructor() { - super(...arguments); - this.buffers = []; - this.limit = Infinity; - this.bytesBuffered = 0; - } - _write(chunk, encoding, callback) { - var _a; - this.buffers.push(chunk); - this.bytesBuffered += (_a = chunk.byteLength) !== null && _a !== void 0 ? _a : 0; - if (this.bytesBuffered >= this.limit) { - const excess = this.bytesBuffered - this.limit; - const tailBuffer = this.buffers[this.buffers.length - 1]; - this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess); - this.emit("finish"); - } - callback(); - } -} +exports.getSSOTokenFilepath = getSSOTokenFilepath; /***/ }), -/***/ 64691: +/***/ 27539: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFromFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const getSSOTokenFilepath_1 = __nccwpck_require__(72412); +const { readFile } = fs_1.promises; +const getSSOTokenFromFile = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); +}; +exports.getSSOTokenFromFile = getSSOTokenFromFile; + + +/***/ }), + +/***/ 30489: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -74314,71 +65465,174 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter + CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, + DEFAULT_PROFILE: () => DEFAULT_PROFILE, + ENV_PROFILE: () => ENV_PROFILE, + getProfileName: () => getProfileName, + loadSharedConfigFiles: () => loadSharedConfigFiles, + loadSsoSessionData: () => loadSsoSessionData, + parseKnownFiles: () => parseKnownFiles }); module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(23327), module.exports); -// src/blob/transforms.ts -var import_util_base64 = __nccwpck_require__(72722); -var import_util_utf8 = __nccwpck_require__(46090); -function transformToString(payload, encoding = "utf-8") { - if (encoding === "base64") { - return (0, import_util_base64.toBase64)(payload); +// src/getProfileName.ts +var ENV_PROFILE = "AWS_PROFILE"; +var DEFAULT_PROFILE = "default"; +var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); + +// src/index.ts +__reExport(src_exports, __nccwpck_require__(72412), module.exports); +__reExport(src_exports, __nccwpck_require__(27539), module.exports); + +// src/loadSharedConfigFiles.ts + + +// src/getConfigData.ts +var import_types = __nccwpck_require__(65165); +var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { + return false; } - return (0, import_util_utf8.toUtf8)(payload); -} -__name(transformToString, "transformToString"); -function transformFromString(str, encoding) { - if (encoding === "base64") { - return Uint8ArrayBlobAdapter.mutate((0, import_util_base64.fromBase64)(str)); + return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); +}).reduce( + (acc, [key, value]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + acc[updatedKey] = value; + return acc; + }, + { + // Populate default profile, if present. + ...data.default && { default: data.default } } - return Uint8ArrayBlobAdapter.mutate((0, import_util_utf8.fromUtf8)(str)); -} -__name(transformFromString, "transformFromString"); +), "getConfigData"); -// src/blob/Uint8ArrayBlobAdapter.ts -var Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter extends Uint8Array { - static { - __name(this, "Uint8ArrayBlobAdapter"); - } - /** - * @param source - such as a string or Stream. - * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. - */ - static fromString(source, encoding = "utf-8") { - switch (typeof source) { - case "string": - return transformFromString(source, encoding); - default: - throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); +// src/getConfigFilepath.ts +var import_path = __nccwpck_require__(16928); +var import_getHomeDir = __nccwpck_require__(23327); +var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); + +// src/getCredentialsFilepath.ts + +var import_getHomeDir2 = __nccwpck_require__(23327); +var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); + +// src/loadSharedConfigFiles.ts +var import_getHomeDir3 = __nccwpck_require__(23327); + +// src/parseIni.ts + +var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; +var profileNameBlockList = ["__proto__", "profile __proto__"]; +var parseIni = /* @__PURE__ */ __name((iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = void 0; + currentSubSection = void 0; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(import_types.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); + } + } else { + currentSection = sectionName; + } + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } + } else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim() + ]; + if (value === "") { + currentSubSection = name; + } else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = void 0; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; + } + } } } - /** - * @param source - Uint8Array to be mutated. - * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. - */ - static mutate(source) { - Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter.prototype); - return source; + return map; +}, "parseIni"); + +// src/loadSharedConfigFiles.ts +var import_slurpFile = __nccwpck_require__(47307); +var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var CONFIG_PREFIX_SEPARATOR = "."; +var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const homeDir = (0, import_getHomeDir3.getHomeDir)(); + const relativeHomeDirPrefix = "~/"; + let resolvedFilepath = filepath; + if (filepath.startsWith(relativeHomeDirPrefix)) { + resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); } - /** - * @param encoding - default 'utf-8'. - * @returns the blob as string. - */ - transformToString(encoding = "utf-8") { - return transformToString(this, encoding); + let resolvedConfigFilepath = configFilepath; + if (configFilepath.startsWith(relativeHomeDirPrefix)) { + resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); } -}; + const parsedFiles = await Promise.all([ + (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).then(getConfigData).catch(swallowError), + (0, import_slurpFile.slurpFile)(resolvedFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).catch(swallowError) + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1] + }; +}, "loadSharedConfigFiles"); -// src/index.ts -__reExport(src_exports, __nccwpck_require__(72116), module.exports); -__reExport(src_exports, __nccwpck_require__(32384), module.exports); -__reExport(src_exports, __nccwpck_require__(40260), module.exports); -__reExport(src_exports, __nccwpck_require__(22505), module.exports); -__reExport(src_exports, __nccwpck_require__(86901), module.exports); -__reExport(src_exports, __nccwpck_require__(76992), module.exports); -__reExport(src_exports, __nccwpck_require__(73423), module.exports); -__reExport(src_exports, __nccwpck_require__(37785), module.exports); +// src/getSsoSessionData.ts + +var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); + +// src/loadSsoSessionData.ts +var import_slurpFile2 = __nccwpck_require__(47307); +var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); + +// src/mergeConfigFiles.ts +var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== void 0) { + Object.assign(merged[key], values); + } else { + merged[key] = values; + } + } + } + return merged; +}, "mergeConfigFiles"); + +// src/parseKnownFiles.ts +var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); +}, "parseKnownFiles"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -74387,212 +65641,169 @@ __reExport(src_exports, __nccwpck_require__(37785), module.exports); /***/ }), -/***/ 65958: +/***/ 47307: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.sdkStreamMixin = void 0; -const fetch_http_handler_1 = __nccwpck_require__(9136); -const util_base64_1 = __nccwpck_require__(72722); -const util_hex_encoding_1 = __nccwpck_require__(79916); -const util_utf8_1 = __nccwpck_require__(46090); -const stream_type_check_1 = __nccwpck_require__(37785); -const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; -const sdkStreamMixin = (stream) => { - var _a, _b; - if (!isBlobInstance(stream) && !(0, stream_type_check_1.isReadableStream)(stream)) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); +exports.slurpFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const { readFile } = fs_1.promises; +const filePromisesHash = {}; +const slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - return await (0, fetch_http_handler_1.streamCollector)(stream); - }; - const blobToWebStream = (blob) => { - if (typeof blob.stream !== "function") { - throw new Error("Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\n" + - "If you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body"); - } - return blob.stream(); - }; - return Object.assign(stream, { - transformToByteArray: transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === "base64") { - return (0, util_base64_1.toBase64)(buf); - } - else if (encoding === "hex") { - return (0, util_hex_encoding_1.toHex)(buf); - } - else if (encoding === undefined || encoding === "utf8" || encoding === "utf-8") { - return (0, util_utf8_1.toUtf8)(buf); - } - else if (typeof TextDecoder === "function") { - return new TextDecoder(encoding).decode(buf); - } - else { - throw new Error("TextDecoder is not available, please make sure polyfill is provided."); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - if (isBlobInstance(stream)) { - return blobToWebStream(stream); - } - else if ((0, stream_type_check_1.isReadableStream)(stream)) { - return stream; - } - else { - throw new Error(`Cannot transform payload to web stream, got ${stream}`); - } - }, - }); + return filePromisesHash[path]; }; -exports.sdkStreamMixin = sdkStreamMixin; -const isBlobInstance = (stream) => typeof Blob === "function" && stream instanceof Blob; +exports.slurpFile = slurpFile; /***/ }), -/***/ 76992: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; +/***/ 65165: +/***/ ((module) => { -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.sdkStreamMixin = void 0; -const node_http_handler_1 = __nccwpck_require__(82764); -const util_buffer_from_1 = __nccwpck_require__(21266); -const stream_1 = __nccwpck_require__(2203); -const sdk_stream_mixin_browser_1 = __nccwpck_require__(65958); -const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; -const sdkStreamMixin = (stream) => { - var _a, _b; - if (!(stream instanceof stream_1.Readable)) { - try { - return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); - } - catch (e) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); - } - } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - return await (0, node_http_handler_1.streamCollector)(stream); - }; - return Object.assign(stream, { - transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === undefined || Buffer.isEncoding(encoding)) { - return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); - } - else { - const decoder = new TextDecoder(encoding); - return decoder.decode(buf); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - if (stream.readableFlowing !== null) { - throw new Error("The stream has been consumed by other callbacks."); - } - if (typeof stream_1.Readable.toWeb !== "function") { - throw new Error("Readable.toWeb() is not supported. Please ensure a polyfill is available."); - } - transformed = true; - return stream_1.Readable.toWeb(stream); - }, - }); +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); }; -exports.sdkStreamMixin = sdkStreamMixin; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AlgorithmId: () => AlgorithmId, + EndpointURLScheme: () => EndpointURLScheme, + FieldPosition: () => FieldPosition, + HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, + HttpAuthLocation: () => HttpAuthLocation, + IniSectionType: () => IniSectionType, + RequestHandlerProtocol: () => RequestHandlerProtocol, + SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig +}); +module.exports = __toCommonJS(src_exports); -/***/ }), +// src/auth/auth.ts +var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { + HttpAuthLocation2["HEADER"] = "header"; + HttpAuthLocation2["QUERY"] = "query"; + return HttpAuthLocation2; +})(HttpAuthLocation || {}); -/***/ 16441: -/***/ ((__unused_webpack_module, exports) => { +// src/auth/HttpApiKeyAuth.ts +var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { + HttpApiKeyAuthLocation2["HEADER"] = "header"; + HttpApiKeyAuthLocation2["QUERY"] = "query"; + return HttpApiKeyAuthLocation2; +})(HttpApiKeyAuthLocation || {}); -"use strict"; +// src/endpoint.ts +var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { + EndpointURLScheme2["HTTP"] = "http"; + EndpointURLScheme2["HTTPS"] = "https"; + return EndpointURLScheme2; +})(EndpointURLScheme || {}); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.splitStream = splitStream; -async function splitStream(stream) { - if (typeof stream.stream === "function") { - stream = stream.stream(); +// src/extensions/checksum.ts +var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { + AlgorithmId2["MD5"] = "md5"; + AlgorithmId2["CRC32"] = "crc32"; + AlgorithmId2["CRC32C"] = "crc32c"; + AlgorithmId2["SHA1"] = "sha1"; + AlgorithmId2["SHA256"] = "sha256"; + return AlgorithmId2; +})(AlgorithmId || {}); +var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== void 0) { + checksumAlgorithms.push({ + algorithmId: () => "sha256" /* SHA256 */, + checksumConstructor: () => runtimeConfig.sha256 + }); + } + if (runtimeConfig.md5 != void 0) { + checksumAlgorithms.push({ + algorithmId: () => "md5" /* MD5 */, + checksumConstructor: () => runtimeConfig.md5 + }); + } + return { + addChecksumAlgorithm(algo) { + checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return checksumAlgorithms; } - const readableStream = stream; - return readableStream.tee(); -} - - -/***/ }), - -/***/ 73423: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + }; +}, "getChecksumConfiguration"); +var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}, "resolveChecksumRuntimeConfig"); -"use strict"; +// src/extensions/defaultClientConfiguration.ts +var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return getChecksumConfiguration(runtimeConfig); +}, "getDefaultClientConfiguration"); +var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return resolveChecksumRuntimeConfig(config); +}, "resolveDefaultRuntimeConfig"); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.splitStream = splitStream; -const stream_1 = __nccwpck_require__(2203); -const splitStream_browser_1 = __nccwpck_require__(16441); -const stream_type_check_1 = __nccwpck_require__(37785); -async function splitStream(stream) { - if ((0, stream_type_check_1.isReadableStream)(stream) || (0, stream_type_check_1.isBlob)(stream)) { - return (0, splitStream_browser_1.splitStream)(stream); - } - const stream1 = new stream_1.PassThrough(); - const stream2 = new stream_1.PassThrough(); - stream.pipe(stream1); - stream.pipe(stream2); - return [stream1, stream2]; -} +// src/http.ts +var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { + FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; + FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; + return FieldPosition2; +})(FieldPosition || {}); +// src/middleware.ts +var SMITHY_CONTEXT_KEY = "__smithy_context"; -/***/ }), +// src/profile.ts +var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; +})(IniSectionType || {}); -/***/ 37785: -/***/ ((__unused_webpack_module, exports) => { +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); +// Annotate the CommonJS export names for ESM import in node: -"use strict"; +0 && (0); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isBlob = exports.isReadableStream = void 0; -const isReadableStream = (stream) => { - var _a; - return typeof ReadableStream === "function" && - (((_a = stream === null || stream === void 0 ? void 0 : stream.constructor) === null || _a === void 0 ? void 0 : _a.name) === ReadableStream.name || stream instanceof ReadableStream); -}; -exports.isReadableStream = isReadableStream; -const isBlob = (blob) => { - var _a; - return typeof Blob === "function" && (((_a = blob === null || blob === void 0 ? void 0 : blob.constructor) === null || _a === void 0 ? void 0 : _a.name) === Blob.name || blob instanceof Blob); -}; -exports.isBlob = isBlob; /***/ }), -/***/ 87377: -/***/ ((module) => { +/***/ 60043: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -74616,20 +65827,27 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - escapeUri: () => escapeUri, - escapeUriPath: () => escapeUriPath + parseUrl: () => parseUrl }); module.exports = __toCommonJS(src_exports); - -// src/escape-uri.ts -var escapeUri = /* @__PURE__ */ __name((uri) => ( - // AWS percent-encodes some extra non-standard characters in a URI - encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) -), "escapeUri"); -var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); - -// src/escape-uri-path.ts -var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); +var import_querystring_parser = __nccwpck_require__(15183); +var parseUrl = /* @__PURE__ */ __name((url) => { + if (typeof url === "string") { + return parseUrl(new URL(url)); + } + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = (0, import_querystring_parser.parseQueryString)(search); + } + return { + hostname, + port: port ? parseInt(port) : void 0, + protocol, + path: pathname, + query + }; +}, "parseUrl"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -74638,18 +65856,37 @@ var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri /***/ }), -/***/ 46090: +/***/ 95895: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(21266); +const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; +const fromBase64 = (input) => { + if ((input.length * 3) % 4 !== 0) { + throw new TypeError(`Incorrect padding on base64 string.`); + } + if (!BASE64_REGEX.exec(input)) { + throw new TypeError(`Invalid base64 string.`); + } + const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); +}; +exports.fromBase64 = fromBase64; + + +/***/ }), + +/***/ 72722: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; var __copyProps = (to, from, except, desc) => { if (from && typeof from === "object" || typeof from === "function") { for (let key of __getOwnPropNames(from)) @@ -74658,46 +65895,14 @@ var __copyProps = (to, from, except, desc) => { } return to; }; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; -__export(src_exports, { - fromUtf8: () => fromUtf8, - toUint8Array: () => toUint8Array, - toUtf8: () => toUtf8 -}); module.exports = __toCommonJS(src_exports); - -// src/fromUtf8.ts -var import_util_buffer_from = __nccwpck_require__(21266); -var fromUtf8 = /* @__PURE__ */ __name((input) => { - const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); - return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); -}, "fromUtf8"); - -// src/toUint8Array.ts -var toUint8Array = /* @__PURE__ */ __name((data) => { - if (typeof data === "string") { - return fromUtf8(data); - } - if (ArrayBuffer.isView(data)) { - return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); - } - return new Uint8Array(data); -}, "toUint8Array"); - -// src/toUtf8.ts - -var toUtf8 = /* @__PURE__ */ __name((input) => { - if (typeof input === "string") { - return input; - } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); - } - return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); -}, "toUtf8"); +__reExport(src_exports, __nccwpck_require__(95895), module.exports); +__reExport(src_exports, __nccwpck_require__(97234), module.exports); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -74706,11 +65911,36 @@ var toUtf8 = /* @__PURE__ */ __name((input) => { /***/ }), -/***/ 36463: -/***/ ((module) => { +/***/ 97234: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(21266); +const util_utf8_1 = __nccwpck_require__(46090); +const toBase64 = (_input) => { + let input; + if (typeof _input === "string") { + input = (0, util_utf8_1.fromUtf8)(_input); + } + else { + input = _input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); + } + return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); +}; +exports.toBase64 = toBase64; + + +/***/ }), + +/***/ 21266: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; @@ -74731,78 +65961,26 @@ var __copyProps = (to, from, except, desc) => { var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -__export(index_exports, { - NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, - NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, - REGION_ENV_NAME: () => REGION_ENV_NAME, - REGION_INI_NAME: () => REGION_INI_NAME, - getAwsRegionExtensionConfiguration: () => getAwsRegionExtensionConfiguration, - resolveAwsRegionExtensionConfiguration: () => resolveAwsRegionExtensionConfiguration, - resolveRegionConfig: () => resolveRegionConfig +var src_exports = {}; +__export(src_exports, { + fromArrayBuffer: () => fromArrayBuffer, + fromString: () => fromString }); -module.exports = __toCommonJS(index_exports); - -// src/extensions/index.ts -var getAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - setRegion(region) { - runtimeConfig.region = region; - }, - region() { - return runtimeConfig.region; - } - }; -}, "getAwsRegionExtensionConfiguration"); -var resolveAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((awsRegionExtensionConfiguration) => { - return { - region: awsRegionExtensionConfiguration.region() - }; -}, "resolveAwsRegionExtensionConfiguration"); - -// src/regionConfig/config.ts -var REGION_ENV_NAME = "AWS_REGION"; -var REGION_INI_NAME = "region"; -var NODE_REGION_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => env[REGION_ENV_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[REGION_INI_NAME], "configFileSelector"), - default: /* @__PURE__ */ __name(() => { - throw new Error("Region is missing"); - }, "default") -}; -var NODE_REGION_CONFIG_FILE_OPTIONS = { - preferredFile: "credentials" -}; - -// src/regionConfig/isFipsRegion.ts -var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); - -// src/regionConfig/getRealRegion.ts -var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); - -// src/regionConfig/resolveRegionConfig.ts -var resolveRegionConfig = /* @__PURE__ */ __name((input) => { - const { region, useFipsEndpoint } = input; - if (!region) { - throw new Error("Region is missing"); +module.exports = __toCommonJS(src_exports); +var import_is_array_buffer = __nccwpck_require__(21109); +var import_buffer = __nccwpck_require__(20181); +var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { + if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); } - return Object.assign(input, { - region: /* @__PURE__ */ __name(async () => { - if (typeof region === "string") { - return getRealRegion(region); - } - const providedRegion = await region(); - return getRealRegion(providedRegion); - }, "region"), - useFipsEndpoint: /* @__PURE__ */ __name(async () => { - const providedRegion = typeof region === "string" ? region : await region(); - if (isFipsRegion(providedRegion)) { - return true; - } - return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); - }, "useFipsEndpoint") - }); -}, "resolveRegionConfig"); + return import_buffer.Buffer.from(input, offset, length); +}, "fromArrayBuffer"); +var fromString = /* @__PURE__ */ __name((input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + } + return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); +}, "fromString"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -74811,16 +65989,12 @@ var resolveRegionConfig = /* @__PURE__ */ __name((input) => { /***/ }), -/***/ 75433: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; +/***/ 79916: +/***/ ((module) => { -var __create = Object.create; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { @@ -74835,211 +66009,49 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -__export(index_exports, { - fromEnvSigningName: () => fromEnvSigningName, - fromSso: () => fromSso, - fromStatic: () => fromStatic, - nodeProvider: () => nodeProvider +var src_exports = {}; +__export(src_exports, { + fromHex: () => fromHex, + toHex: () => toHex }); -module.exports = __toCommonJS(index_exports); - -// src/fromEnvSigningName.ts -var import_core = __nccwpck_require__(8704); -var import_property_provider = __nccwpck_require__(51515); -var fromEnvSigningName = /* @__PURE__ */ __name(({ logger, signingName } = {}) => async () => { - logger?.debug?.("@aws-sdk/token-providers - fromEnvSigningName"); - if (!signingName) { - throw new import_property_provider.TokenProviderError("Please pass 'signingName' to compute environment variable key", { logger }); - } - const bearerTokenKey = (0, import_core.getBearerTokenEnvKey)(signingName); - if (!(bearerTokenKey in process.env)) { - throw new import_property_provider.TokenProviderError(`Token not present in '${bearerTokenKey}' environment variable`, { logger }); - } - return { token: process.env[bearerTokenKey] }; -}, "fromEnvSigningName"); - -// src/fromSso.ts - - - -// src/constants.ts -var EXPIRE_WINDOW_MS = 5 * 60 * 1e3; -var REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; - -// src/getSsoOidcClient.ts -var getSsoOidcClient = /* @__PURE__ */ __name(async (ssoRegion, init = {}) => { - const { SSOOIDCClient } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(89443))); - const ssoOidcClient = new SSOOIDCClient( - Object.assign({}, init.clientConfig ?? {}, { - region: ssoRegion ?? init.clientConfig?.region, - logger: init.clientConfig?.logger ?? init.parentClientConfig?.logger - }) - ); - return ssoOidcClient; -}, "getSsoOidcClient"); - -// src/getNewSsoOidcToken.ts -var getNewSsoOidcToken = /* @__PURE__ */ __name(async (ssoToken, ssoRegion, init = {}) => { - const { CreateTokenCommand } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(89443))); - const ssoOidcClient = await getSsoOidcClient(ssoRegion, init); - return ssoOidcClient.send( - new CreateTokenCommand({ - clientId: ssoToken.clientId, - clientSecret: ssoToken.clientSecret, - refreshToken: ssoToken.refreshToken, - grantType: "refresh_token" - }) - ); -}, "getNewSsoOidcToken"); - -// src/validateTokenExpiry.ts - -var validateTokenExpiry = /* @__PURE__ */ __name((token) => { - if (token.expiration && token.expiration.getTime() < Date.now()) { - throw new import_property_provider.TokenProviderError(`Token is expired. ${REFRESH_MESSAGE}`, false); - } -}, "validateTokenExpiry"); - -// src/validateTokenKey.ts - -var validateTokenKey = /* @__PURE__ */ __name((key, value, forRefresh = false) => { - if (typeof value === "undefined") { - throw new import_property_provider.TokenProviderError( - `Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${REFRESH_MESSAGE}`, - false - ); - } -}, "validateTokenKey"); - -// src/writeSSOTokenToFile.ts -var import_shared_ini_file_loader = __nccwpck_require__(10751); -var import_fs = __nccwpck_require__(79896); -var { writeFile } = import_fs.promises; -var writeSSOTokenToFile = /* @__PURE__ */ __name((id, ssoToken) => { - const tokenFilepath = (0, import_shared_ini_file_loader.getSSOTokenFilepath)(id); - const tokenString = JSON.stringify(ssoToken, null, 2); - return writeFile(tokenFilepath, tokenString); -}, "writeSSOTokenToFile"); - -// src/fromSso.ts -var lastRefreshAttemptTime = /* @__PURE__ */ new Date(0); -var fromSso = /* @__PURE__ */ __name((_init = {}) => async ({ callerClientConfig } = {}) => { - const init = { - ..._init, - parentClientConfig: { - ...callerClientConfig, - ..._init.parentClientConfig - } - }; - init.logger?.debug("@aws-sdk/token-providers - fromSso"); - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - const profileName = (0, import_shared_ini_file_loader.getProfileName)({ - profile: init.profile ?? callerClientConfig?.profile - }); - const profile = profiles[profileName]; - if (!profile) { - throw new import_property_provider.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); - } else if (!profile["sso_session"]) { - throw new import_property_provider.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); - } - const ssoSessionName = profile["sso_session"]; - const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); - const ssoSession = ssoSessions[ssoSessionName]; - if (!ssoSession) { - throw new import_property_provider.TokenProviderError( - `Sso session '${ssoSessionName}' could not be found in shared credentials file.`, - false - ); - } - for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { - if (!ssoSession[ssoSessionRequiredKey]) { - throw new import_property_provider.TokenProviderError( - `Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, - false - ); - } - } - const ssoStartUrl = ssoSession["sso_start_url"]; - const ssoRegion = ssoSession["sso_region"]; - let ssoToken; - try { - ssoToken = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoSessionName); - } catch (e) { - throw new import_property_provider.TokenProviderError( - `The SSO session token associated with profile=${profileName} was not found or is invalid. ${REFRESH_MESSAGE}`, - false - ); - } - validateTokenKey("accessToken", ssoToken.accessToken); - validateTokenKey("expiresAt", ssoToken.expiresAt); - const { accessToken, expiresAt } = ssoToken; - const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; - if (existingToken.expiration.getTime() - Date.now() > EXPIRE_WINDOW_MS) { - return existingToken; +module.exports = __toCommonJS(src_exports); +var SHORT_TO_HEX = {}; +var HEX_TO_SHORT = {}; +for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; } - if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1e3) { - validateTokenExpiry(existingToken); - return existingToken; + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; +} +function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); } - validateTokenKey("clientId", ssoToken.clientId, true); - validateTokenKey("clientSecret", ssoToken.clientSecret, true); - validateTokenKey("refreshToken", ssoToken.refreshToken, true); - try { - lastRefreshAttemptTime.setTime(Date.now()); - const newSsoOidcToken = await getNewSsoOidcToken(ssoToken, ssoRegion, init); - validateTokenKey("accessToken", newSsoOidcToken.accessToken); - validateTokenKey("expiresIn", newSsoOidcToken.expiresIn); - const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1e3); - try { - await writeSSOTokenToFile(ssoSessionName, { - ...ssoToken, - accessToken: newSsoOidcToken.accessToken, - expiresAt: newTokenExpiration.toISOString(), - refreshToken: newSsoOidcToken.refreshToken - }); - } catch (error) { + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; + } else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); } - return { - token: newSsoOidcToken.accessToken, - expiration: newTokenExpiration - }; - } catch (error) { - validateTokenExpiry(existingToken); - return existingToken; } -}, "fromSso"); - -// src/fromStatic.ts - -var fromStatic = /* @__PURE__ */ __name(({ token, logger }) => async () => { - logger?.debug("@aws-sdk/token-providers - fromStatic"); - if (!token || !token.token) { - throw new import_property_provider.TokenProviderError(`Please pass a valid token to fromStatic`, false); + return out; +} +__name(fromHex, "fromHex"); +function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; } - return token; -}, "fromStatic"); - -// src/nodeProvider.ts - -var nodeProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider.memoize)( - (0, import_property_provider.chain)(fromSso(init), async () => { - throw new import_property_provider.TokenProviderError("Could not load token from any providers", false); - }), - (token) => token.expiration !== void 0 && token.expiration.getTime() - Date.now() < 3e5, - (token) => token.expiration !== void 0 -), "nodeProvider"); + return out; +} +__name(toHex, "toHex"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -75048,8 +66060,8 @@ var nodeProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_pro /***/ }), -/***/ 51515: -/***/ ((module) => { +/***/ 99755: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -75073,450 +66085,530 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize + getSmithyContext: () => getSmithyContext, + normalizeProvider: () => normalizeProvider }); module.exports = __toCommonJS(src_exports); -// src/ProviderError.ts -var ProviderError = class _ProviderError extends Error { - constructor(message, options = true) { - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; - } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError.prototype); - logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); - } - static { - __name(this, "ProviderError"); - } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); - } -}; +// src/getSmithyContext.ts +var import_types = __nccwpck_require__(65165); +var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); -// src/CredentialsProviderError.ts -var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError.prototype); - } - static { - __name(this, "CredentialsProviderError"); - } -}; +// src/normalizeProvider.ts +var normalizeProvider = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}, "normalizeProvider"); +// Annotate the CommonJS export names for ESM import in node: -// src/TokenProviderError.ts -var TokenProviderError = class _TokenProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError.prototype); - } - static { - __name(this, "TokenProviderError"); - } -}; +0 && (0); -// src/chain.ts -var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError("No providers in chain"); - } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err?.tryNextLink) { - continue; - } - throw err; + + +/***/ }), + +/***/ 79241: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ByteArrayCollector = void 0; +class ByteArrayCollector { + constructor(allocByteArray) { + this.allocByteArray = allocByteArray; + this.byteLength = 0; + this.byteArrays = []; } - } - throw lastProviderError; -}, "chain"); + push(byteArray) { + this.byteArrays.push(byteArray); + this.byteLength += byteArray.byteLength; + } + flush() { + if (this.byteArrays.length === 1) { + const bytes = this.byteArrays[0]; + this.reset(); + return bytes; + } + const aggregation = this.allocByteArray(this.byteLength); + let cursor = 0; + for (let i = 0; i < this.byteArrays.length; ++i) { + const bytes = this.byteArrays[i]; + aggregation.set(bytes, cursor); + cursor += bytes.byteLength; + } + this.reset(); + return aggregation; + } + reset() { + this.byteArrays = []; + this.byteLength = 0; + } +} +exports.ByteArrayCollector = ByteArrayCollector; -// src/fromStatic.ts -var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); -// src/memoize.ts -var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); +/***/ }), + +/***/ 34778: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ChecksumStream = void 0; +const ReadableStreamRef = typeof ReadableStream === "function" ? ReadableStream : function () { }; +class ChecksumStream extends ReadableStreamRef { +} +exports.ChecksumStream = ChecksumStream; + + +/***/ }), + +/***/ 72116: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ChecksumStream = void 0; +const util_base64_1 = __nccwpck_require__(72722); +const stream_1 = __nccwpck_require__(2203); +class ChecksumStream extends stream_1.Duplex { + constructor({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder, }) { + var _a, _b; + super(); + if (typeof source.pipe === "function") { + this.source = source; + } + else { + throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); + } + this.base64Encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; + this.expectedChecksum = expectedChecksum; + this.checksum = checksum; + this.checksumSourceLocation = checksumSourceLocation; + this.source.pipe(this); } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; + _read(size) { } + _write(chunk, encoding, callback) { + try { + this.checksum.update(chunk); + this.push(chunk); + } + catch (e) { + return callback(e); + } + return callback(); } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); + async _final(callback) { + try { + const digest = await this.checksum.digest(); + const received = this.base64Encoder(digest); + if (this.expectedChecksum !== received) { + return callback(new Error(`Checksum mismatch: expected "${this.expectedChecksum}" but received "${received}"` + + ` in response header "${this.checksumSourceLocation}".`)); + } + } + catch (e) { + return callback(e); + } + this.push(null); + return callback(); } - if (isConstant) { - return resolved; +} +exports.ChecksumStream = ChecksumStream; + + +/***/ }), + +/***/ 49158: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.createChecksumStream = void 0; +const util_base64_1 = __nccwpck_require__(72722); +const stream_type_check_1 = __nccwpck_require__(37785); +const ChecksumStream_browser_1 = __nccwpck_require__(34778); +const createChecksumStream = ({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder, }) => { + var _a, _b; + if (!(0, stream_type_check_1.isReadableStream)(source)) { + throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; + const encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; + if (typeof TransformStream !== "function") { + throw new Error("@smithy/util-stream: unable to instantiate ChecksumStream because API unavailable: ReadableStream/TransformStream."); } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; + const transform = new TransformStream({ + start() { }, + async transform(chunk, controller) { + checksum.update(chunk); + controller.enqueue(chunk); + }, + async flush(controller) { + const digest = await checksum.digest(); + const received = encoder(digest); + if (expectedChecksum !== received) { + const error = new Error(`Checksum mismatch: expected "${expectedChecksum}" but received "${received}"` + + ` in response header "${checksumSourceLocation}".`); + controller.error(error); + } + else { + controller.terminate(); + } + }, + }); + source.pipeThrough(transform); + const readable = transform.readable; + Object.setPrototypeOf(readable, ChecksumStream_browser_1.ChecksumStream.prototype); + return readable; +}; +exports.createChecksumStream = createChecksumStream; + + +/***/ }), + +/***/ 32384: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.createChecksumStream = createChecksumStream; +const stream_type_check_1 = __nccwpck_require__(37785); +const ChecksumStream_1 = __nccwpck_require__(72116); +const createChecksumStream_browser_1 = __nccwpck_require__(49158); +function createChecksumStream(init) { + if (typeof ReadableStream === "function" && (0, stream_type_check_1.isReadableStream)(init.source)) { + return (0, createChecksumStream_browser_1.createChecksumStream)(init); } - return resolved; - }; -}, "memoize"); -// Annotate the CommonJS export names for ESM import in node: + return new ChecksumStream_1.ChecksumStream(init); +} -0 && (0); +/***/ }), + +/***/ 40260: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.createBufferedReadable = createBufferedReadable; +const node_stream_1 = __nccwpck_require__(57075); +const ByteArrayCollector_1 = __nccwpck_require__(79241); +const createBufferedReadableStream_1 = __nccwpck_require__(34335); +const stream_type_check_1 = __nccwpck_require__(37785); +function createBufferedReadable(upstream, size, logger) { + if ((0, stream_type_check_1.isReadableStream)(upstream)) { + return (0, createBufferedReadableStream_1.createBufferedReadableStream)(upstream, size, logger); + } + const downstream = new node_stream_1.Readable({ read() { } }); + let streamBufferingLoggedWarning = false; + let bytesSeen = 0; + const buffers = [ + "", + new ByteArrayCollector_1.ByteArrayCollector((size) => new Uint8Array(size)), + new ByteArrayCollector_1.ByteArrayCollector((size) => Buffer.from(new Uint8Array(size))), + ]; + let mode = -1; + upstream.on("data", (chunk) => { + const chunkMode = (0, createBufferedReadableStream_1.modeOf)(chunk, true); + if (mode !== chunkMode) { + if (mode >= 0) { + downstream.push((0, createBufferedReadableStream_1.flush)(buffers, mode)); + } + mode = chunkMode; + } + if (mode === -1) { + downstream.push(chunk); + return; + } + const chunkSize = (0, createBufferedReadableStream_1.sizeOf)(chunk); + bytesSeen += chunkSize; + const bufferSize = (0, createBufferedReadableStream_1.sizeOf)(buffers[mode]); + if (chunkSize >= size && bufferSize === 0) { + downstream.push(chunk); + } + else { + const newSize = (0, createBufferedReadableStream_1.merge)(buffers, mode, chunk); + if (!streamBufferingLoggedWarning && bytesSeen > size * 2) { + streamBufferingLoggedWarning = true; + logger === null || logger === void 0 ? void 0 : logger.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`); + } + if (newSize >= size) { + downstream.push((0, createBufferedReadableStream_1.flush)(buffers, mode)); + } + } + }); + upstream.on("end", () => { + if (mode !== -1) { + const remainder = (0, createBufferedReadableStream_1.flush)(buffers, mode); + if ((0, createBufferedReadableStream_1.sizeOf)(remainder) > 0) { + downstream.push(remainder); + } + } + downstream.push(null); + }); + return downstream; +} /***/ }), -/***/ 11593: +/***/ 34335: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getHomeDir = void 0; -const os_1 = __nccwpck_require__(70857); -const path_1 = __nccwpck_require__(16928); -const homeDirCache = {}; -const getHomeDirCacheKey = () => { - if (process && process.geteuid) { - return `${process.geteuid()}`; +exports.createBufferedReadable = void 0; +exports.createBufferedReadableStream = createBufferedReadableStream; +exports.merge = merge; +exports.flush = flush; +exports.sizeOf = sizeOf; +exports.modeOf = modeOf; +const ByteArrayCollector_1 = __nccwpck_require__(79241); +function createBufferedReadableStream(upstream, size, logger) { + const reader = upstream.getReader(); + let streamBufferingLoggedWarning = false; + let bytesSeen = 0; + const buffers = ["", new ByteArrayCollector_1.ByteArrayCollector((size) => new Uint8Array(size))]; + let mode = -1; + const pull = async (controller) => { + const { value, done } = await reader.read(); + const chunk = value; + if (done) { + if (mode !== -1) { + const remainder = flush(buffers, mode); + if (sizeOf(remainder) > 0) { + controller.enqueue(remainder); + } + } + controller.close(); + } + else { + const chunkMode = modeOf(chunk, false); + if (mode !== chunkMode) { + if (mode >= 0) { + controller.enqueue(flush(buffers, mode)); + } + mode = chunkMode; + } + if (mode === -1) { + controller.enqueue(chunk); + return; + } + const chunkSize = sizeOf(chunk); + bytesSeen += chunkSize; + const bufferSize = sizeOf(buffers[mode]); + if (chunkSize >= size && bufferSize === 0) { + controller.enqueue(chunk); + } + else { + const newSize = merge(buffers, mode, chunk); + if (!streamBufferingLoggedWarning && bytesSeen > size * 2) { + streamBufferingLoggedWarning = true; + logger === null || logger === void 0 ? void 0 : logger.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`); + } + if (newSize >= size) { + controller.enqueue(flush(buffers, mode)); + } + else { + await pull(controller); + } + } + } + }; + return new ReadableStream({ + pull, + }); +} +exports.createBufferedReadable = createBufferedReadableStream; +function merge(buffers, mode, chunk) { + switch (mode) { + case 0: + buffers[0] += chunk; + return sizeOf(buffers[0]); + case 1: + case 2: + buffers[mode].push(chunk); + return sizeOf(buffers[mode]); + } +} +function flush(buffers, mode) { + switch (mode) { + case 0: + const s = buffers[0]; + buffers[0] = ""; + return s; + case 1: + case 2: + return buffers[mode].flush(); } - return "DEFAULT"; -}; -const getHomeDir = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - const homeDirCacheKey = getHomeDirCacheKey(); - if (!homeDirCache[homeDirCacheKey]) - homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); - return homeDirCache[homeDirCacheKey]; -}; -exports.getHomeDir = getHomeDir; + throw new Error(`@smithy/util-stream - invalid index ${mode} given to flush()`); +} +function sizeOf(chunk) { + var _a, _b; + return (_b = (_a = chunk === null || chunk === void 0 ? void 0 : chunk.byteLength) !== null && _a !== void 0 ? _a : chunk === null || chunk === void 0 ? void 0 : chunk.length) !== null && _b !== void 0 ? _b : 0; +} +function modeOf(chunk, allowBuffer = true) { + if (allowBuffer && typeof Buffer !== "undefined" && chunk instanceof Buffer) { + return 2; + } + if (chunk instanceof Uint8Array) { + return 1; + } + if (typeof chunk === "string") { + return 0; + } + return -1; +} /***/ }), -/***/ 77366: +/***/ 22505: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFilepath = void 0; -const crypto_1 = __nccwpck_require__(76982); -const path_1 = __nccwpck_require__(16928); -const getHomeDir_1 = __nccwpck_require__(11593); -const getSSOTokenFilepath = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); +exports.getAwsChunkedEncodingStream = void 0; +const stream_1 = __nccwpck_require__(2203); +const getAwsChunkedEncodingStream = (readableStream, options) => { + const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; + const checksumRequired = base64Encoder !== undefined && + checksumAlgorithmFn !== undefined && + checksumLocationName !== undefined && + streamHasher !== undefined; + const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : undefined; + const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { } }); + readableStream.on("data", (data) => { + const length = bodyLengthChecker(data) || 0; + awsChunkedEncodingStream.push(`${length.toString(16)}\r\n`); + awsChunkedEncodingStream.push(data); + awsChunkedEncodingStream.push("\r\n"); + }); + readableStream.on("end", async () => { + awsChunkedEncodingStream.push(`0\r\n`); + if (checksumRequired) { + const checksum = base64Encoder(await digest); + awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r\n`); + awsChunkedEncodingStream.push(`\r\n`); + } + awsChunkedEncodingStream.push(null); + }); + return awsChunkedEncodingStream; }; -exports.getSSOTokenFilepath = getSSOTokenFilepath; +exports.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream; /***/ }), -/***/ 93897: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 45139: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFromFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const getSSOTokenFilepath_1 = __nccwpck_require__(77366); -const { readFile } = fs_1.promises; -const getSSOTokenFromFile = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); -}; -exports.getSSOTokenFromFile = getSSOTokenFromFile; - - -/***/ }), - -/***/ 10751: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - getProfileName: () => getProfileName, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles -}); -module.exports = __toCommonJS(src_exports); -__reExport(src_exports, __nccwpck_require__(11593), module.exports); - -// src/getProfileName.ts -var ENV_PROFILE = "AWS_PROFILE"; -var DEFAULT_PROFILE = "default"; -var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); - -// src/index.ts -__reExport(src_exports, __nccwpck_require__(77366), module.exports); -__reExport(src_exports, __nccwpck_require__(93897), module.exports); - -// src/loadSharedConfigFiles.ts - - -// src/getConfigData.ts -var import_types = __nccwpck_require__(54387); -var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; - } - return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); -}).reduce( - (acc, [key, value]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; - acc[updatedKey] = value; - return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } - } -), "getConfigData"); - -// src/getConfigFilepath.ts -var import_path = __nccwpck_require__(16928); -var import_getHomeDir = __nccwpck_require__(11593); -var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; -var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); - -// src/getCredentialsFilepath.ts - -var import_getHomeDir2 = __nccwpck_require__(11593); -var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; -var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); - -// src/loadSharedConfigFiles.ts -var import_getHomeDir3 = __nccwpck_require__(11593); - -// src/parseIni.ts - -var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; -var profileNameBlockList = ["__proto__", "profile __proto__"]; -var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); +exports.headStream = headStream; +async function headStream(stream, bytes) { + var _a; + let byteLengthCounter = 0; + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + byteLengthCounter += (_a = value === null || value === void 0 ? void 0 : value.byteLength) !== null && _a !== void 0 ? _a : 0; } - } else { - currentSection = sectionName; - } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); - } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; - } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; + if (byteLengthCounter >= bytes) { + break; } - } + isDone = done; } - } - return map; -}, "parseIni"); - -// src/loadSharedConfigFiles.ts -var import_slurpFile = __nccwpck_require__(69545); -var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var CONFIG_PREFIX_SEPARATOR = "."; -var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); - } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); - } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; -}, "loadSharedConfigFiles"); - -// src/getSsoSessionData.ts - -var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); - -// src/loadSsoSessionData.ts -var import_slurpFile2 = __nccwpck_require__(69545); -var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); - -// src/mergeConfigFiles.ts -var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); - } else { - merged[key] = values; - } + reader.releaseLock(); + const collected = new Uint8Array(Math.min(bytes, byteLengthCounter)); + let offset = 0; + for (const chunk of chunks) { + if (chunk.byteLength > collected.byteLength - offset) { + collected.set(chunk.subarray(0, collected.byteLength - offset), offset); + break; + } + else { + collected.set(chunk, offset); + } + offset += chunk.length; } - } - return merged; -}, "mergeConfigFiles"); - -// src/parseKnownFiles.ts -var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); -}, "parseKnownFiles"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - + return collected; +} /***/ }), -/***/ 69545: +/***/ 86901: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.slurpFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const { readFile } = fs_1.promises; -const filePromisesHash = {}; -const slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); +exports.headStream = void 0; +const stream_1 = __nccwpck_require__(2203); +const headStream_browser_1 = __nccwpck_require__(45139); +const stream_type_check_1 = __nccwpck_require__(37785); +const headStream = (stream, bytes) => { + if ((0, stream_type_check_1.isReadableStream)(stream)) { + return (0, headStream_browser_1.headStream)(stream, bytes); } - return filePromisesHash[path]; + return new Promise((resolve, reject) => { + const collector = new Collector(); + collector.limit = bytes; + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.buffers)); + resolve(bytes); + }); + }); }; -exports.slurpFile = slurpFile; +exports.headStream = headStream; +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.buffers = []; + this.limit = Infinity; + this.bytesBuffered = 0; + } + _write(chunk, encoding, callback) { + var _a; + this.buffers.push(chunk); + this.bytesBuffered += (_a = chunk.byteLength) !== null && _a !== void 0 ? _a : 0; + if (this.bytesBuffered >= this.limit) { + const excess = this.bytesBuffered - this.limit; + const tailBuffer = this.buffers[this.buffers.length - 1]; + this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess); + this.emit("finish"); + } + callback(); + } +} /***/ }), -/***/ 54387: -/***/ ((module) => { +/***/ 64691: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -75535,118 +66627,77 @@ var __copyProps = (to, from, except, desc) => { } return to; }; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - AlgorithmId: () => AlgorithmId, - EndpointURLScheme: () => EndpointURLScheme, - FieldPosition: () => FieldPosition, - HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, - HttpAuthLocation: () => HttpAuthLocation, - IniSectionType: () => IniSectionType, - RequestHandlerProtocol: () => RequestHandlerProtocol, - SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig + Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter }); module.exports = __toCommonJS(src_exports); -// src/auth/auth.ts -var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { - HttpAuthLocation2["HEADER"] = "header"; - HttpAuthLocation2["QUERY"] = "query"; - return HttpAuthLocation2; -})(HttpAuthLocation || {}); - -// src/auth/HttpApiKeyAuth.ts -var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { - HttpApiKeyAuthLocation2["HEADER"] = "header"; - HttpApiKeyAuthLocation2["QUERY"] = "query"; - return HttpApiKeyAuthLocation2; -})(HttpApiKeyAuthLocation || {}); - -// src/endpoint.ts -var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { - EndpointURLScheme2["HTTP"] = "http"; - EndpointURLScheme2["HTTPS"] = "https"; - return EndpointURLScheme2; -})(EndpointURLScheme || {}); - -// src/extensions/checksum.ts -var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { - AlgorithmId2["MD5"] = "md5"; - AlgorithmId2["CRC32"] = "crc32"; - AlgorithmId2["CRC32C"] = "crc32c"; - AlgorithmId2["SHA1"] = "sha1"; - AlgorithmId2["SHA256"] = "sha256"; - return AlgorithmId2; -})(AlgorithmId || {}); -var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const checksumAlgorithms = []; - if (runtimeConfig.sha256 !== void 0) { - checksumAlgorithms.push({ - algorithmId: () => "sha256" /* SHA256 */, - checksumConstructor: () => runtimeConfig.sha256 - }); +// src/blob/transforms.ts +var import_util_base64 = __nccwpck_require__(72722); +var import_util_utf8 = __nccwpck_require__(46090); +function transformToString(payload, encoding = "utf-8") { + if (encoding === "base64") { + return (0, import_util_base64.toBase64)(payload); } - if (runtimeConfig.md5 != void 0) { - checksumAlgorithms.push({ - algorithmId: () => "md5" /* MD5 */, - checksumConstructor: () => runtimeConfig.md5 - }); + return (0, import_util_utf8.toUtf8)(payload); +} +__name(transformToString, "transformToString"); +function transformFromString(str, encoding) { + if (encoding === "base64") { + return Uint8ArrayBlobAdapter.mutate((0, import_util_base64.fromBase64)(str)); } - return { - addChecksumAlgorithm(algo) { - checksumAlgorithms.push(algo); - }, - checksumAlgorithms() { - return checksumAlgorithms; - } - }; -}, "getChecksumConfiguration"); -var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { - const runtimeConfig = {}; - clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { - runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); - }); - return runtimeConfig; -}, "resolveChecksumRuntimeConfig"); - -// src/extensions/defaultClientConfiguration.ts -var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return getChecksumConfiguration(runtimeConfig); -}, "getDefaultClientConfiguration"); -var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return resolveChecksumRuntimeConfig(config); -}, "resolveDefaultRuntimeConfig"); - -// src/http.ts -var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { - FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; - FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; - return FieldPosition2; -})(FieldPosition || {}); - -// src/middleware.ts -var SMITHY_CONTEXT_KEY = "__smithy_context"; + return Uint8ArrayBlobAdapter.mutate((0, import_util_utf8.fromUtf8)(str)); +} +__name(transformFromString, "transformFromString"); -// src/profile.ts -var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { - IniSectionType2["PROFILE"] = "profile"; - IniSectionType2["SSO_SESSION"] = "sso-session"; - IniSectionType2["SERVICES"] = "services"; - return IniSectionType2; -})(IniSectionType || {}); +// src/blob/Uint8ArrayBlobAdapter.ts +var Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter extends Uint8Array { + static { + __name(this, "Uint8ArrayBlobAdapter"); + } + /** + * @param source - such as a string or Stream. + * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. + */ + static fromString(source, encoding = "utf-8") { + switch (typeof source) { + case "string": + return transformFromString(source, encoding); + default: + throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); + } + } + /** + * @param source - Uint8Array to be mutated. + * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. + */ + static mutate(source) { + Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter.prototype); + return source; + } + /** + * @param encoding - default 'utf-8'. + * @returns the blob as string. + */ + transformToString(encoding = "utf-8") { + return transformToString(this, encoding); + } +}; -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); +// src/index.ts +__reExport(src_exports, __nccwpck_require__(72116), module.exports); +__reExport(src_exports, __nccwpck_require__(32384), module.exports); +__reExport(src_exports, __nccwpck_require__(40260), module.exports); +__reExport(src_exports, __nccwpck_require__(22505), module.exports); +__reExport(src_exports, __nccwpck_require__(86901), module.exports); +__reExport(src_exports, __nccwpck_require__(76992), module.exports); +__reExport(src_exports, __nccwpck_require__(73423), module.exports); +__reExport(src_exports, __nccwpck_require__(37785), module.exports); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -75655,450 +66706,662 @@ var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { /***/ }), -/***/ 83068: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 65958: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.sdkStreamMixin = void 0; +const fetch_http_handler_1 = __nccwpck_require__(9136); +const util_base64_1 = __nccwpck_require__(72722); +const util_hex_encoding_1 = __nccwpck_require__(79916); +const util_utf8_1 = __nccwpck_require__(46090); +const stream_type_check_1 = __nccwpck_require__(37785); +const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; +const sdkStreamMixin = (stream) => { + var _a, _b; + if (!isBlobInstance(stream) && !(0, stream_type_check_1.isReadableStream)(stream)) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); + } + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + return await (0, fetch_http_handler_1.streamCollector)(stream); + }; + const blobToWebStream = (blob) => { + if (typeof blob.stream !== "function") { + throw new Error("Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\n" + + "If you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body"); + } + return blob.stream(); + }; + return Object.assign(stream, { + transformToByteArray: transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === "base64") { + return (0, util_base64_1.toBase64)(buf); + } + else if (encoding === "hex") { + return (0, util_hex_encoding_1.toHex)(buf); + } + else if (encoding === undefined || encoding === "utf8" || encoding === "utf-8") { + return (0, util_utf8_1.toUtf8)(buf); + } + else if (typeof TextDecoder === "function") { + return new TextDecoder(encoding).decode(buf); + } + else { + throw new Error("TextDecoder is not available, please make sure polyfill is provided."); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + if (isBlobInstance(stream)) { + return blobToWebStream(stream); + } + else if ((0, stream_type_check_1.isReadableStream)(stream)) { + return stream; + } + else { + throw new Error(`Cannot transform payload to web stream, got ${stream}`); + } + }, + }); }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +exports.sdkStreamMixin = sdkStreamMixin; +const isBlobInstance = (stream) => typeof Blob === "function" && stream instanceof Blob; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - ConditionObject: () => import_util_endpoints.ConditionObject, - DeprecatedObject: () => import_util_endpoints.DeprecatedObject, - EndpointError: () => import_util_endpoints.EndpointError, - EndpointObject: () => import_util_endpoints.EndpointObject, - EndpointObjectHeaders: () => import_util_endpoints.EndpointObjectHeaders, - EndpointObjectProperties: () => import_util_endpoints.EndpointObjectProperties, - EndpointParams: () => import_util_endpoints.EndpointParams, - EndpointResolverOptions: () => import_util_endpoints.EndpointResolverOptions, - EndpointRuleObject: () => import_util_endpoints.EndpointRuleObject, - ErrorRuleObject: () => import_util_endpoints.ErrorRuleObject, - EvaluateOptions: () => import_util_endpoints.EvaluateOptions, - Expression: () => import_util_endpoints.Expression, - FunctionArgv: () => import_util_endpoints.FunctionArgv, - FunctionObject: () => import_util_endpoints.FunctionObject, - FunctionReturn: () => import_util_endpoints.FunctionReturn, - ParameterObject: () => import_util_endpoints.ParameterObject, - ReferenceObject: () => import_util_endpoints.ReferenceObject, - ReferenceRecord: () => import_util_endpoints.ReferenceRecord, - RuleSetObject: () => import_util_endpoints.RuleSetObject, - RuleSetRules: () => import_util_endpoints.RuleSetRules, - TreeRuleObject: () => import_util_endpoints.TreeRuleObject, - awsEndpointFunctions: () => awsEndpointFunctions, - getUserAgentPrefix: () => getUserAgentPrefix, - isIpAddress: () => import_util_endpoints.isIpAddress, - partition: () => partition, - resolveEndpoint: () => import_util_endpoints.resolveEndpoint, - setPartitionInfo: () => setPartitionInfo, - useDefaultPartitionInfo: () => useDefaultPartitionInfo -}); -module.exports = __toCommonJS(index_exports); -// src/aws.ts +/***/ }), +/***/ 76992: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -// src/lib/aws/isVirtualHostableS3Bucket.ts +"use strict"; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.sdkStreamMixin = void 0; +const node_http_handler_1 = __nccwpck_require__(82764); +const util_buffer_from_1 = __nccwpck_require__(21266); +const stream_1 = __nccwpck_require__(2203); +const sdk_stream_mixin_browser_1 = __nccwpck_require__(65958); +const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; +const sdkStreamMixin = (stream) => { + var _a, _b; + if (!(stream instanceof stream_1.Readable)) { + try { + return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); + } + catch (e) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); + } + } + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + return await (0, node_http_handler_1.streamCollector)(stream); + }; + return Object.assign(stream, { + transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === undefined || Buffer.isEncoding(encoding)) { + return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); + } + else { + const decoder = new TextDecoder(encoding); + return decoder.decode(buf); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + if (stream.readableFlowing !== null) { + throw new Error("The stream has been consumed by other callbacks."); + } + if (typeof stream_1.Readable.toWeb !== "function") { + throw new Error("Readable.toWeb() is not supported. Please ensure a polyfill is available."); + } + transformed = true; + return stream_1.Readable.toWeb(stream); + }, + }); +}; +exports.sdkStreamMixin = sdkStreamMixin; -// src/lib/isIpAddress.ts -var import_util_endpoints = __nccwpck_require__(79674); -// src/lib/aws/isVirtualHostableS3Bucket.ts -var isVirtualHostableS3Bucket = /* @__PURE__ */ __name((value, allowSubDomains = false) => { - if (allowSubDomains) { - for (const label of value.split(".")) { - if (!isVirtualHostableS3Bucket(label)) { - return false; - } - } - return true; - } - if (!(0, import_util_endpoints.isValidHostLabel)(value)) { - return false; - } - if (value.length < 3 || value.length > 63) { - return false; - } - if (value !== value.toLowerCase()) { - return false; - } - if ((0, import_util_endpoints.isIpAddress)(value)) { - return false; - } - return true; -}, "isVirtualHostableS3Bucket"); +/***/ }), -// src/lib/aws/parseArn.ts -var ARN_DELIMITER = ":"; -var RESOURCE_DELIMITER = "/"; -var parseArn = /* @__PURE__ */ __name((value) => { - const segments = value.split(ARN_DELIMITER); - if (segments.length < 6) return null; - const [arn, partition2, service, region, accountId, ...resourcePath] = segments; - if (arn !== "arn" || partition2 === "" || service === "" || resourcePath.join(ARN_DELIMITER) === "") return null; - const resourceId = resourcePath.map((resource) => resource.split(RESOURCE_DELIMITER)).flat(); - return { - partition: partition2, - service, - region, - accountId, - resourceId - }; -}, "parseArn"); +/***/ 16441: +/***/ ((__unused_webpack_module, exports) => { -// src/lib/aws/partitions.json -var partitions_default = { - partitions: [{ - id: "aws", - outputs: { - dnsSuffix: "amazonaws.com", - dualStackDnsSuffix: "api.aws", - implicitGlobalRegion: "us-east-1", - name: "aws", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^(us|eu|ap|sa|ca|me|af|il|mx)\\-\\w+\\-\\d+$", - regions: { - "af-south-1": { - description: "Africa (Cape Town)" - }, - "ap-east-1": { - description: "Asia Pacific (Hong Kong)" - }, - "ap-east-2": { - description: "Asia Pacific (Taipei)" - }, - "ap-northeast-1": { - description: "Asia Pacific (Tokyo)" - }, - "ap-northeast-2": { - description: "Asia Pacific (Seoul)" - }, - "ap-northeast-3": { - description: "Asia Pacific (Osaka)" - }, - "ap-south-1": { - description: "Asia Pacific (Mumbai)" - }, - "ap-south-2": { - description: "Asia Pacific (Hyderabad)" - }, - "ap-southeast-1": { - description: "Asia Pacific (Singapore)" - }, - "ap-southeast-2": { - description: "Asia Pacific (Sydney)" - }, - "ap-southeast-3": { - description: "Asia Pacific (Jakarta)" - }, - "ap-southeast-4": { - description: "Asia Pacific (Melbourne)" - }, - "ap-southeast-5": { - description: "Asia Pacific (Malaysia)" - }, - "ap-southeast-7": { - description: "Asia Pacific (Thailand)" - }, - "aws-global": { - description: "AWS Standard global region" - }, - "ca-central-1": { - description: "Canada (Central)" - }, - "ca-west-1": { - description: "Canada West (Calgary)" - }, - "eu-central-1": { - description: "Europe (Frankfurt)" - }, - "eu-central-2": { - description: "Europe (Zurich)" - }, - "eu-north-1": { - description: "Europe (Stockholm)" - }, - "eu-south-1": { - description: "Europe (Milan)" - }, - "eu-south-2": { - description: "Europe (Spain)" - }, - "eu-west-1": { - description: "Europe (Ireland)" - }, - "eu-west-2": { - description: "Europe (London)" - }, - "eu-west-3": { - description: "Europe (Paris)" - }, - "il-central-1": { - description: "Israel (Tel Aviv)" - }, - "me-central-1": { - description: "Middle East (UAE)" - }, - "me-south-1": { - description: "Middle East (Bahrain)" - }, - "mx-central-1": { - description: "Mexico (Central)" - }, - "sa-east-1": { - description: "South America (Sao Paulo)" - }, - "us-east-1": { - description: "US East (N. Virginia)" - }, - "us-east-2": { - description: "US East (Ohio)" - }, - "us-west-1": { - description: "US West (N. California)" - }, - "us-west-2": { - description: "US West (Oregon)" - } - } - }, { - id: "aws-cn", - outputs: { - dnsSuffix: "amazonaws.com.cn", - dualStackDnsSuffix: "api.amazonwebservices.com.cn", - implicitGlobalRegion: "cn-northwest-1", - name: "aws-cn", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^cn\\-\\w+\\-\\d+$", - regions: { - "aws-cn-global": { - description: "AWS China global region" - }, - "cn-north-1": { - description: "China (Beijing)" - }, - "cn-northwest-1": { - description: "China (Ningxia)" - } - } - }, { - id: "aws-us-gov", - outputs: { - dnsSuffix: "amazonaws.com", - dualStackDnsSuffix: "api.aws", - implicitGlobalRegion: "us-gov-west-1", - name: "aws-us-gov", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^us\\-gov\\-\\w+\\-\\d+$", - regions: { - "aws-us-gov-global": { - description: "AWS GovCloud (US) global region" - }, - "us-gov-east-1": { - description: "AWS GovCloud (US-East)" - }, - "us-gov-west-1": { - description: "AWS GovCloud (US-West)" - } - } - }, { - id: "aws-iso", - outputs: { - dnsSuffix: "c2s.ic.gov", - dualStackDnsSuffix: "c2s.ic.gov", - implicitGlobalRegion: "us-iso-east-1", - name: "aws-iso", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-iso\\-\\w+\\-\\d+$", - regions: { - "aws-iso-global": { - description: "AWS ISO (US) global region" - }, - "us-iso-east-1": { - description: "US ISO East" - }, - "us-iso-west-1": { - description: "US ISO WEST" - } - } - }, { - id: "aws-iso-b", - outputs: { - dnsSuffix: "sc2s.sgov.gov", - dualStackDnsSuffix: "sc2s.sgov.gov", - implicitGlobalRegion: "us-isob-east-1", - name: "aws-iso-b", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-isob\\-\\w+\\-\\d+$", - regions: { - "aws-iso-b-global": { - description: "AWS ISOB (US) global region" - }, - "us-isob-east-1": { - description: "US ISOB East (Ohio)" - } - } - }, { - id: "aws-iso-e", - outputs: { - dnsSuffix: "cloud.adc-e.uk", - dualStackDnsSuffix: "cloud.adc-e.uk", - implicitGlobalRegion: "eu-isoe-west-1", - name: "aws-iso-e", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^eu\\-isoe\\-\\w+\\-\\d+$", - regions: { - "aws-iso-e-global": { - description: "AWS ISOE (Europe) global region" - }, - "eu-isoe-west-1": { - description: "EU ISOE West" - } - } - }, { - id: "aws-iso-f", - outputs: { - dnsSuffix: "csp.hci.ic.gov", - dualStackDnsSuffix: "csp.hci.ic.gov", - implicitGlobalRegion: "us-isof-south-1", - name: "aws-iso-f", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-isof\\-\\w+\\-\\d+$", - regions: { - "aws-iso-f-global": { - description: "AWS ISOF global region" - }, - "us-isof-east-1": { - description: "US ISOF EAST" - }, - "us-isof-south-1": { - description: "US ISOF SOUTH" - } +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.splitStream = splitStream; +async function splitStream(stream) { + if (typeof stream.stream === "function") { + stream = stream.stream(); } - }, { - id: "aws-eusc", - outputs: { - dnsSuffix: "amazonaws.eu", - dualStackDnsSuffix: "amazonaws.eu", - implicitGlobalRegion: "eusc-de-east-1", - name: "aws-eusc", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^eusc\\-(de)\\-\\w+\\-\\d+$", - regions: { - "eusc-de-east-1": { - description: "EU (Germany)" - } + const readableStream = stream; + return readableStream.tee(); +} + + +/***/ }), + +/***/ 73423: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.splitStream = splitStream; +const stream_1 = __nccwpck_require__(2203); +const splitStream_browser_1 = __nccwpck_require__(16441); +const stream_type_check_1 = __nccwpck_require__(37785); +async function splitStream(stream) { + if ((0, stream_type_check_1.isReadableStream)(stream) || (0, stream_type_check_1.isBlob)(stream)) { + return (0, splitStream_browser_1.splitStream)(stream); } - }], - version: "1.1" + const stream1 = new stream_1.PassThrough(); + const stream2 = new stream_1.PassThrough(); + stream.pipe(stream1); + stream.pipe(stream2); + return [stream1, stream2]; +} + + +/***/ }), + +/***/ 37785: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isBlob = exports.isReadableStream = void 0; +const isReadableStream = (stream) => { + var _a; + return typeof ReadableStream === "function" && + (((_a = stream === null || stream === void 0 ? void 0 : stream.constructor) === null || _a === void 0 ? void 0 : _a.name) === ReadableStream.name || stream instanceof ReadableStream); }; +exports.isReadableStream = isReadableStream; +const isBlob = (blob) => { + var _a; + return typeof Blob === "function" && (((_a = blob === null || blob === void 0 ? void 0 : blob.constructor) === null || _a === void 0 ? void 0 : _a.name) === Blob.name || blob instanceof Blob); +}; +exports.isBlob = isBlob; -// src/lib/aws/partition.ts -var selectedPartitionsInfo = partitions_default; -var selectedUserAgentPrefix = ""; -var partition = /* @__PURE__ */ __name((value) => { - const { partitions } = selectedPartitionsInfo; - for (const partition2 of partitions) { - const { regions, outputs } = partition2; - for (const [region, regionData] of Object.entries(regions)) { - if (region === value) { - return { - ...outputs, - ...regionData - }; - } - } + +/***/ }), + +/***/ 87377: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - for (const partition2 of partitions) { - const { regionRegex, outputs } = partition2; - if (new RegExp(regionRegex).test(value)) { - return { - ...outputs - }; - } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + escapeUri: () => escapeUri, + escapeUriPath: () => escapeUriPath +}); +module.exports = __toCommonJS(src_exports); + +// src/escape-uri.ts +var escapeUri = /* @__PURE__ */ __name((uri) => ( + // AWS percent-encodes some extra non-standard characters in a URI + encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) +), "escapeUri"); +var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); + +// src/escape-uri-path.ts +var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 46090: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - const DEFAULT_PARTITION = partitions.find((partition2) => partition2.id === "aws"); - if (!DEFAULT_PARTITION) { - throw new Error( - "Provided region was not found in the partition array or regex, and default partition with id 'aws' doesn't exist." - ); + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromUtf8: () => fromUtf8, + toUint8Array: () => toUint8Array, + toUtf8: () => toUtf8 +}); +module.exports = __toCommonJS(src_exports); + +// src/fromUtf8.ts +var import_util_buffer_from = __nccwpck_require__(21266); +var fromUtf8 = /* @__PURE__ */ __name((input) => { + const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); + return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); +}, "fromUtf8"); + +// src/toUint8Array.ts +var toUint8Array = /* @__PURE__ */ __name((data) => { + if (typeof data === "string") { + return fromUtf8(data); + } + if (ArrayBuffer.isView(data)) { + return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); + } + return new Uint8Array(data); +}, "toUint8Array"); + +// src/toUtf8.ts + +var toUtf8 = /* @__PURE__ */ __name((input) => { + if (typeof input === "string") { + return input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); + } + return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); +}, "toUtf8"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 36463: +/***/ ((module) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var index_exports = {}; +__export(index_exports, { + NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, + NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, + REGION_ENV_NAME: () => REGION_ENV_NAME, + REGION_INI_NAME: () => REGION_INI_NAME, + getAwsRegionExtensionConfiguration: () => getAwsRegionExtensionConfiguration, + resolveAwsRegionExtensionConfiguration: () => resolveAwsRegionExtensionConfiguration, + resolveRegionConfig: () => resolveRegionConfig +}); +module.exports = __toCommonJS(index_exports); + +// src/extensions/index.ts +var getAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { return { - ...DEFAULT_PARTITION.outputs + setRegion(region) { + runtimeConfig.region = region; + }, + region() { + return runtimeConfig.region; + } }; -}, "partition"); -var setPartitionInfo = /* @__PURE__ */ __name((partitionsInfo, userAgentPrefix = "") => { - selectedPartitionsInfo = partitionsInfo; - selectedUserAgentPrefix = userAgentPrefix; -}, "setPartitionInfo"); -var useDefaultPartitionInfo = /* @__PURE__ */ __name(() => { - setPartitionInfo(partitions_default, ""); -}, "useDefaultPartitionInfo"); -var getUserAgentPrefix = /* @__PURE__ */ __name(() => selectedUserAgentPrefix, "getUserAgentPrefix"); +}, "getAwsRegionExtensionConfiguration"); +var resolveAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((awsRegionExtensionConfiguration) => { + return { + region: awsRegionExtensionConfiguration.region() + }; +}, "resolveAwsRegionExtensionConfiguration"); -// src/aws.ts -var awsEndpointFunctions = { - isVirtualHostableS3Bucket, - parseArn, - partition +// src/regionConfig/config.ts +var REGION_ENV_NAME = "AWS_REGION"; +var REGION_INI_NAME = "region"; +var NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: /* @__PURE__ */ __name((env) => env[REGION_ENV_NAME], "environmentVariableSelector"), + configFileSelector: /* @__PURE__ */ __name((profile) => profile[REGION_INI_NAME], "configFileSelector"), + default: /* @__PURE__ */ __name(() => { + throw new Error("Region is missing"); + }, "default") +}; +var NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials" }; -import_util_endpoints.customEndpointFunctions.aws = awsEndpointFunctions; -// src/resolveEndpoint.ts +// src/regionConfig/isFipsRegion.ts +var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); +// src/regionConfig/getRealRegion.ts +var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); -// src/types/EndpointError.ts +// src/regionConfig/resolveRegionConfig.ts +var resolveRegionConfig = /* @__PURE__ */ __name((input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); + } + return Object.assign(input, { + region: /* @__PURE__ */ __name(async () => { + if (typeof region === "string") { + return getRealRegion(region); + } + const providedRegion = await region(); + return getRealRegion(providedRegion); + }, "region"), + useFipsEndpoint: /* @__PURE__ */ __name(async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if (isFipsRegion(providedRegion)) { + return true; + } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); + }, "useFipsEndpoint") + }); +}, "resolveRegionConfig"); +// Annotate the CommonJS export names for ESM import in node: +0 && (0); -// src/types/EndpointRuleObject.ts -// src/types/ErrorRuleObject.ts +/***/ }), +/***/ 75433: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -// src/types/RuleSetObject.ts +"use strict"; + +var __create = Object.create; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +// src/index.ts +var index_exports = {}; +__export(index_exports, { + fromEnvSigningName: () => fromEnvSigningName, + fromSso: () => fromSso, + fromStatic: () => fromStatic, + nodeProvider: () => nodeProvider +}); +module.exports = __toCommonJS(index_exports); -// src/types/TreeRuleObject.ts +// src/fromEnvSigningName.ts +var import_client = __nccwpck_require__(5152); +var import_httpAuthSchemes = __nccwpck_require__(97523); +var import_property_provider = __nccwpck_require__(51515); +var fromEnvSigningName = /* @__PURE__ */ __name(({ logger, signingName } = {}) => async () => { + logger?.debug?.("@aws-sdk/token-providers - fromEnvSigningName"); + if (!signingName) { + throw new import_property_provider.TokenProviderError("Please pass 'signingName' to compute environment variable key", { logger }); + } + const bearerTokenKey = (0, import_httpAuthSchemes.getBearerTokenEnvKey)(signingName); + if (!(bearerTokenKey in process.env)) { + throw new import_property_provider.TokenProviderError(`Token not present in '${bearerTokenKey}' environment variable`, { logger }); + } + const token = { token: process.env[bearerTokenKey] }; + (0, import_client.setTokenFeature)(token, "BEARER_SERVICE_ENV_VARS", "3"); + return token; +}, "fromEnvSigningName"); + +// src/fromSso.ts + + + +// src/constants.ts +var EXPIRE_WINDOW_MS = 5 * 60 * 1e3; +var REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; + +// src/getSsoOidcClient.ts +var getSsoOidcClient = /* @__PURE__ */ __name(async (ssoRegion, init = {}) => { + const { SSOOIDCClient } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(89443))); + const ssoOidcClient = new SSOOIDCClient( + Object.assign({}, init.clientConfig ?? {}, { + region: ssoRegion ?? init.clientConfig?.region, + logger: init.clientConfig?.logger ?? init.parentClientConfig?.logger + }) + ); + return ssoOidcClient; +}, "getSsoOidcClient"); + +// src/getNewSsoOidcToken.ts +var getNewSsoOidcToken = /* @__PURE__ */ __name(async (ssoToken, ssoRegion, init = {}) => { + const { CreateTokenCommand } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(89443))); + const ssoOidcClient = await getSsoOidcClient(ssoRegion, init); + return ssoOidcClient.send( + new CreateTokenCommand({ + clientId: ssoToken.clientId, + clientSecret: ssoToken.clientSecret, + refreshToken: ssoToken.refreshToken, + grantType: "refresh_token" + }) + ); +}, "getNewSsoOidcToken"); + +// src/validateTokenExpiry.ts + +var validateTokenExpiry = /* @__PURE__ */ __name((token) => { + if (token.expiration && token.expiration.getTime() < Date.now()) { + throw new import_property_provider.TokenProviderError(`Token is expired. ${REFRESH_MESSAGE}`, false); + } +}, "validateTokenExpiry"); + +// src/validateTokenKey.ts + +var validateTokenKey = /* @__PURE__ */ __name((key, value, forRefresh = false) => { + if (typeof value === "undefined") { + throw new import_property_provider.TokenProviderError( + `Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${REFRESH_MESSAGE}`, + false + ); + } +}, "validateTokenKey"); + +// src/writeSSOTokenToFile.ts +var import_shared_ini_file_loader = __nccwpck_require__(10751); +var import_fs = __nccwpck_require__(79896); +var { writeFile } = import_fs.promises; +var writeSSOTokenToFile = /* @__PURE__ */ __name((id, ssoToken) => { + const tokenFilepath = (0, import_shared_ini_file_loader.getSSOTokenFilepath)(id); + const tokenString = JSON.stringify(ssoToken, null, 2); + return writeFile(tokenFilepath, tokenString); +}, "writeSSOTokenToFile"); + +// src/fromSso.ts +var lastRefreshAttemptTime = /* @__PURE__ */ new Date(0); +var fromSso = /* @__PURE__ */ __name((_init = {}) => async ({ callerClientConfig } = {}) => { + const init = { + ..._init, + parentClientConfig: { + ...callerClientConfig, + ..._init.parentClientConfig + } + }; + init.logger?.debug("@aws-sdk/token-providers - fromSso"); + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + const profileName = (0, import_shared_ini_file_loader.getProfileName)({ + profile: init.profile ?? callerClientConfig?.profile + }); + const profile = profiles[profileName]; + if (!profile) { + throw new import_property_provider.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); + } else if (!profile["sso_session"]) { + throw new import_property_provider.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); + } + const ssoSessionName = profile["sso_session"]; + const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); + const ssoSession = ssoSessions[ssoSessionName]; + if (!ssoSession) { + throw new import_property_provider.TokenProviderError( + `Sso session '${ssoSessionName}' could not be found in shared credentials file.`, + false + ); + } + for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { + if (!ssoSession[ssoSessionRequiredKey]) { + throw new import_property_provider.TokenProviderError( + `Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, + false + ); + } + } + const ssoStartUrl = ssoSession["sso_start_url"]; + const ssoRegion = ssoSession["sso_region"]; + let ssoToken; + try { + ssoToken = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoSessionName); + } catch (e) { + throw new import_property_provider.TokenProviderError( + `The SSO session token associated with profile=${profileName} was not found or is invalid. ${REFRESH_MESSAGE}`, + false + ); + } + validateTokenKey("accessToken", ssoToken.accessToken); + validateTokenKey("expiresAt", ssoToken.expiresAt); + const { accessToken, expiresAt } = ssoToken; + const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; + if (existingToken.expiration.getTime() - Date.now() > EXPIRE_WINDOW_MS) { + return existingToken; + } + if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1e3) { + validateTokenExpiry(existingToken); + return existingToken; + } + validateTokenKey("clientId", ssoToken.clientId, true); + validateTokenKey("clientSecret", ssoToken.clientSecret, true); + validateTokenKey("refreshToken", ssoToken.refreshToken, true); + try { + lastRefreshAttemptTime.setTime(Date.now()); + const newSsoOidcToken = await getNewSsoOidcToken(ssoToken, ssoRegion, init); + validateTokenKey("accessToken", newSsoOidcToken.accessToken); + validateTokenKey("expiresIn", newSsoOidcToken.expiresIn); + const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1e3); + try { + await writeSSOTokenToFile(ssoSessionName, { + ...ssoToken, + accessToken: newSsoOidcToken.accessToken, + expiresAt: newTokenExpiration.toISOString(), + refreshToken: newSsoOidcToken.refreshToken + }); + } catch (error) { + } + return { + token: newSsoOidcToken.accessToken, + expiration: newTokenExpiration + }; + } catch (error) { + validateTokenExpiry(existingToken); + return existingToken; + } +}, "fromSso"); + +// src/fromStatic.ts +var fromStatic = /* @__PURE__ */ __name(({ token, logger }) => async () => { + logger?.debug("@aws-sdk/token-providers - fromStatic"); + if (!token || !token.token) { + throw new import_property_provider.TokenProviderError(`Please pass a valid token to fromStatic`, false); + } + return token; +}, "fromStatic"); -// src/types/shared.ts +// src/nodeProvider.ts +var nodeProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider.memoize)( + (0, import_property_provider.chain)(fromSso(init), async () => { + throw new import_property_provider.TokenProviderError("Could not load token from any providers", false); + }), + (token) => token.expiration !== void 0 && token.expiration.getTime() - Date.now() < 3e5, + (token) => token.expiration !== void 0 +), "nodeProvider"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -76107,10 +67370,8 @@ import_util_endpoints.customEndpointFunctions.aws = awsEndpointFunctions; /***/ }), -/***/ 51656: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; +/***/ 51515: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -76132,76 +67393,145 @@ var __copyProps = (to, from, except, desc) => { var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var index_exports = {}; -__export(index_exports, { - NODE_APP_ID_CONFIG_OPTIONS: () => NODE_APP_ID_CONFIG_OPTIONS, - UA_APP_ID_ENV_NAME: () => UA_APP_ID_ENV_NAME, - UA_APP_ID_INI_NAME: () => UA_APP_ID_INI_NAME, - createDefaultUserAgentProvider: () => createDefaultUserAgentProvider, - crtAvailability: () => crtAvailability, - defaultUserAgent: () => defaultUserAgent +var src_exports = {}; +__export(src_exports, { + CredentialsProviderError: () => CredentialsProviderError, + ProviderError: () => ProviderError, + TokenProviderError: () => TokenProviderError, + chain: () => chain, + fromStatic: () => fromStatic, + memoize: () => memoize }); -module.exports = __toCommonJS(index_exports); +module.exports = __toCommonJS(src_exports); -// src/defaultUserAgent.ts -var import_os = __nccwpck_require__(70857); -var import_process = __nccwpck_require__(932); +// src/ProviderError.ts +var ProviderError = class _ProviderError extends Error { + constructor(message, options = true) { + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = void 0; + tryNextLink = options; + } else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; + } + super(message); + this.name = "ProviderError"; + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, _ProviderError.prototype); + logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); + } + static { + __name(this, "ProviderError"); + } + /** + * @deprecated use new operator. + */ + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); + } +}; -// src/crt-availability.ts -var crtAvailability = { - isCrtAvailable: false +// src/CredentialsProviderError.ts +var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, _CredentialsProviderError.prototype); + } + static { + __name(this, "CredentialsProviderError"); + } }; -// src/is-crt-available.ts -var isCrtAvailable = /* @__PURE__ */ __name(() => { - if (crtAvailability.isCrtAvailable) { - return ["md/crt-avail"]; +// src/TokenProviderError.ts +var TokenProviderError = class _TokenProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, _TokenProviderError.prototype); } - return null; -}, "isCrtAvailable"); + static { + __name(this, "TokenProviderError"); + } +}; -// src/defaultUserAgent.ts -var createDefaultUserAgentProvider = /* @__PURE__ */ __name(({ serviceId, clientVersion }) => { - return async (config) => { - const sections = [ - // sdk-metadata - ["aws-sdk-js", clientVersion], - // ua-metadata - ["ua", "2.1"], - // os-metadata - [`os/${(0, import_os.platform)()}`, (0, import_os.release)()], - // language-metadata - // ECMAScript edition doesn't matter in JS, so no version needed. - ["lang/js"], - ["md/nodejs", `${import_process.versions.node}`] - ]; - const crtAvailable = isCrtAvailable(); - if (crtAvailable) { - sections.push(crtAvailable); +// src/chain.ts +var chain = /* @__PURE__ */ __name((...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } catch (err) { + lastProviderError = err; + if (err?.tryNextLink) { + continue; + } + throw err; } - if (serviceId) { - sections.push([`api/${serviceId}`, clientVersion]); + } + throw lastProviderError; +}, "chain"); + +// src/fromStatic.ts +var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); + +// src/memoize.ts +var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async () => { + if (!pending) { + pending = provider(); } - if (import_process.env.AWS_EXECUTION_ENV) { - sections.push([`exec-env/${import_process.env.AWS_EXECUTION_ENV}`]); + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; } - const appId = await config?.userAgentAppId?.(); - const resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; - return resolvedUserAgent; + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; }; -}, "createDefaultUserAgentProvider"); -var defaultUserAgent = createDefaultUserAgentProvider; - -// src/nodeAppIdConfigOptions.ts -var import_middleware_user_agent = __nccwpck_require__(32959); -var UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; -var UA_APP_ID_INI_NAME = "sdk_ua_app_id"; -var UA_APP_ID_INI_NAME_DEPRECATED = "sdk-ua-app-id"; -var NODE_APP_ID_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env2) => env2[UA_APP_ID_ENV_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[UA_APP_ID_INI_NAME] ?? profile[UA_APP_ID_INI_NAME_DEPRECATED], "configFileSelector"), - default: import_middleware_user_agent.DEFAULT_UA_APP_ID -}; +}, "memoize"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -76210,185 +67540,81 @@ var NODE_APP_ID_CONFIG_OPTIONS = { /***/ }), -/***/ 94274: -/***/ ((module) => { +/***/ 11593: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHomeDir = void 0; +const os_1 = __nccwpck_require__(70857); +const path_1 = __nccwpck_require__(16928); +const homeDirCache = {}; +const getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; + } + return "DEFAULT"; }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +const getHomeDir = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +exports.getHomeDir = getHomeDir; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - XmlNode: () => XmlNode, - XmlText: () => XmlText -}); -module.exports = __toCommonJS(index_exports); -// src/escape-attribute.ts -function escapeAttribute(value) { - return value.replace(/&/g, "&").replace(//g, ">").replace(/"/g, """); -} -__name(escapeAttribute, "escapeAttribute"); +/***/ }), -// src/escape-element.ts -function escapeElement(value) { - return value.replace(/&/g, "&").replace(/"/g, """).replace(/'/g, "'").replace(//g, ">").replace(/\r/g, " ").replace(/\n/g, " ").replace(/\u0085/g, " ").replace(/\u2028/, " "); -} -__name(escapeElement, "escapeElement"); +/***/ 77366: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -// src/XmlText.ts -var XmlText = class { - constructor(value) { - this.value = value; - } - static { - __name(this, "XmlText"); - } - toString() { - return escapeElement("" + this.value); - } -}; +"use strict"; -// src/XmlNode.ts -var XmlNode = class _XmlNode { - constructor(name, children = []) { - this.name = name; - this.children = children; - } - static { - __name(this, "XmlNode"); - } - attributes = {}; - static of(name, childText, withName) { - const node = new _XmlNode(name); - if (childText !== void 0) { - node.addChildNode(new XmlText(childText)); - } - if (withName !== void 0) { - node.withName(withName); - } - return node; - } - withName(name) { - this.name = name; - return this; - } - addAttribute(name, value) { - this.attributes[name] = value; - return this; - } - addChildNode(child) { - this.children.push(child); - return this; - } - removeAttribute(name) { - delete this.attributes[name]; - return this; - } - /** - * @internal - * Alias of {@link XmlNode#withName(string)} for codegen brevity. - */ - n(name) { - this.name = name; - return this; - } - /** - * @internal - * Alias of {@link XmlNode#addChildNode(string)} for codegen brevity. - */ - c(child) { - this.children.push(child); - return this; - } - /** - * @internal - * Checked version of {@link XmlNode#addAttribute(string)} for codegen brevity. - */ - a(name, value) { - if (value != null) { - this.attributes[name] = value; - } - return this; - } - /** - * Create a child node. - * Used in serialization of string fields. - * @internal - */ - cc(input, field, withName = field) { - if (input[field] != null) { - const node = _XmlNode.of(field, input[field]).withName(withName); - this.c(node); - } - } - /** - * Creates list child nodes. - * @internal - */ - l(input, listName, memberName, valueProvider) { - if (input[listName] != null) { - const nodes = valueProvider(); - nodes.map((node) => { - node.withName(memberName); - this.c(node); - }); - } - } - /** - * Creates list child nodes with container. - * @internal - */ - lc(input, listName, memberName, valueProvider) { - if (input[listName] != null) { - const nodes = valueProvider(); - const containerNode = new _XmlNode(memberName); - nodes.map((node) => { - containerNode.c(node); - }); - this.c(containerNode); - } - } - toString() { - const hasChildren = Boolean(this.children.length); - let xmlText = `<${this.name}`; - const attributes = this.attributes; - for (const attributeName of Object.keys(attributes)) { - const attribute = attributes[attributeName]; - if (attribute != null) { - xmlText += ` ${attributeName}="${escapeAttribute("" + attribute)}"`; - } - } - return xmlText += !hasChildren ? "/>" : `>${this.children.map((c) => c.toString()).join("")}${this.name}>`; - } +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFilepath = void 0; +const crypto_1 = __nccwpck_require__(76982); +const path_1 = __nccwpck_require__(16928); +const getHomeDir_1 = __nccwpck_require__(11593); +const getSSOTokenFilepath = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); }; -// Annotate the CommonJS export names for ESM import in node: +exports.getSSOTokenFilepath = getSSOTokenFilepath; -0 && (0); +/***/ }), + +/***/ 93897: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFromFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const getSSOTokenFilepath_1 = __nccwpck_require__(77366); +const { readFile } = fs_1.promises; +const getSSOTokenFromFile = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); +}; +exports.getSSOTokenFromFile = getSSOTokenFromFile; /***/ }), -/***/ 39316: +/***/ 10751: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -76408,196 +67634,180 @@ var __copyProps = (to, from, except, desc) => { } return to; }; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - CONFIG_USE_DUALSTACK_ENDPOINT: () => CONFIG_USE_DUALSTACK_ENDPOINT, - CONFIG_USE_FIPS_ENDPOINT: () => CONFIG_USE_FIPS_ENDPOINT, - DEFAULT_USE_DUALSTACK_ENDPOINT: () => DEFAULT_USE_DUALSTACK_ENDPOINT, - DEFAULT_USE_FIPS_ENDPOINT: () => DEFAULT_USE_FIPS_ENDPOINT, - ENV_USE_DUALSTACK_ENDPOINT: () => ENV_USE_DUALSTACK_ENDPOINT, - ENV_USE_FIPS_ENDPOINT: () => ENV_USE_FIPS_ENDPOINT, - NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, - NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, - NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, - NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, - REGION_ENV_NAME: () => REGION_ENV_NAME, - REGION_INI_NAME: () => REGION_INI_NAME, - getRegionInfo: () => getRegionInfo, - resolveCustomEndpointsConfig: () => resolveCustomEndpointsConfig, - resolveEndpointsConfig: () => resolveEndpointsConfig, - resolveRegionConfig: () => resolveRegionConfig + CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, + DEFAULT_PROFILE: () => DEFAULT_PROFILE, + ENV_PROFILE: () => ENV_PROFILE, + getProfileName: () => getProfileName, + loadSharedConfigFiles: () => loadSharedConfigFiles, + loadSsoSessionData: () => loadSsoSessionData, + parseKnownFiles: () => parseKnownFiles }); module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(11593), module.exports); -// src/endpointsConfig/NodeUseDualstackEndpointConfigOptions.ts -var import_util_config_provider = __nccwpck_require__(56716); -var ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; -var CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; -var DEFAULT_USE_DUALSTACK_ENDPOINT = false; -var NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.ENV), - configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), - default: false -}; - -// src/endpointsConfig/NodeUseFipsEndpointConfigOptions.ts - -var ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; -var CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; -var DEFAULT_USE_FIPS_ENDPOINT = false; -var NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.ENV), - configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), - default: false -}; +// src/getProfileName.ts +var ENV_PROFILE = "AWS_PROFILE"; +var DEFAULT_PROFILE = "default"; +var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); -// src/endpointsConfig/resolveCustomEndpointsConfig.ts -var import_util_middleware = __nccwpck_require__(42634); -var resolveCustomEndpointsConfig = /* @__PURE__ */ __name((input) => { - const { tls, endpoint, urlParser, useDualstackEndpoint } = input; - return Object.assign(input, { - tls: tls ?? true, - endpoint: (0, import_util_middleware.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), - isCustomEndpoint: true, - useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(useDualstackEndpoint ?? false) - }); -}, "resolveCustomEndpointsConfig"); +// src/index.ts +__reExport(src_exports, __nccwpck_require__(77366), module.exports); +__reExport(src_exports, __nccwpck_require__(93897), module.exports); -// src/endpointsConfig/resolveEndpointsConfig.ts +// src/loadSharedConfigFiles.ts -// src/endpointsConfig/utils/getEndpointFromRegion.ts -var getEndpointFromRegion = /* @__PURE__ */ __name(async (input) => { - const { tls = true } = input; - const region = await input.region(); - const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); - if (!dnsHostRegex.test(region)) { - throw new Error("Invalid region in client config"); - } - const useDualstackEndpoint = await input.useDualstackEndpoint(); - const useFipsEndpoint = await input.useFipsEndpoint(); - const { hostname } = await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }) ?? {}; - if (!hostname) { - throw new Error("Cannot resolve hostname from client config"); +// src/getConfigData.ts +var import_types = __nccwpck_require__(54387); +var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { + return false; } - return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); -}, "getEndpointFromRegion"); + return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); +}).reduce( + (acc, [key, value]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + acc[updatedKey] = value; + return acc; + }, + { + // Populate default profile, if present. + ...data.default && { default: data.default } + } +), "getConfigData"); -// src/endpointsConfig/resolveEndpointsConfig.ts -var resolveEndpointsConfig = /* @__PURE__ */ __name((input) => { - const useDualstackEndpoint = (0, import_util_middleware.normalizeProvider)(input.useDualstackEndpoint ?? false); - const { endpoint, useFipsEndpoint, urlParser, tls } = input; - return Object.assign(input, { - tls: tls ?? true, - endpoint: endpoint ? (0, import_util_middleware.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) : () => getEndpointFromRegion({ ...input, useDualstackEndpoint, useFipsEndpoint }), - isCustomEndpoint: !!endpoint, - useDualstackEndpoint - }); -}, "resolveEndpointsConfig"); +// src/getConfigFilepath.ts +var import_path = __nccwpck_require__(16928); +var import_getHomeDir = __nccwpck_require__(11593); +var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); -// src/regionConfig/config.ts -var REGION_ENV_NAME = "AWS_REGION"; -var REGION_INI_NAME = "region"; -var NODE_REGION_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[REGION_ENV_NAME], - configFileSelector: (profile) => profile[REGION_INI_NAME], - default: () => { - throw new Error("Region is missing"); - } -}; -var NODE_REGION_CONFIG_FILE_OPTIONS = { - preferredFile: "credentials" -}; +// src/getCredentialsFilepath.ts -// src/regionConfig/isFipsRegion.ts -var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); +var import_getHomeDir2 = __nccwpck_require__(11593); +var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); -// src/regionConfig/getRealRegion.ts -var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); +// src/loadSharedConfigFiles.ts +var import_getHomeDir3 = __nccwpck_require__(11593); -// src/regionConfig/resolveRegionConfig.ts -var resolveRegionConfig = /* @__PURE__ */ __name((input) => { - const { region, useFipsEndpoint } = input; - if (!region) { - throw new Error("Region is missing"); - } - return Object.assign(input, { - region: async () => { - if (typeof region === "string") { - return getRealRegion(region); +// src/parseIni.ts + +var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; +var profileNameBlockList = ["__proto__", "profile __proto__"]; +var parseIni = /* @__PURE__ */ __name((iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = void 0; + currentSubSection = void 0; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(import_types.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); + } + } else { + currentSection = sectionName; } - const providedRegion = await region(); - return getRealRegion(providedRegion); - }, - useFipsEndpoint: async () => { - const providedRegion = typeof region === "string" ? region : await region(); - if (isFipsRegion(providedRegion)) { - return true; + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } + } else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim() + ]; + if (value === "") { + currentSubSection = name; + } else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = void 0; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; + } } - return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); } - }); -}, "resolveRegionConfig"); + } + return map; +}, "parseIni"); -// src/regionInfo/getHostnameFromVariants.ts -var getHostnameFromVariants = /* @__PURE__ */ __name((variants = [], { useFipsEndpoint, useDualstackEndpoint }) => variants.find( - ({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack") -)?.hostname, "getHostnameFromVariants"); +// src/loadSharedConfigFiles.ts +var import_slurpFile = __nccwpck_require__(69545); +var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var CONFIG_PREFIX_SEPARATOR = "."; +var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const homeDir = (0, import_getHomeDir3.getHomeDir)(); + const relativeHomeDirPrefix = "~/"; + let resolvedFilepath = filepath; + if (filepath.startsWith(relativeHomeDirPrefix)) { + resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); + } + let resolvedConfigFilepath = configFilepath; + if (configFilepath.startsWith(relativeHomeDirPrefix)) { + resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); + } + const parsedFiles = await Promise.all([ + (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).then(getConfigData).catch(swallowError), + (0, import_slurpFile.slurpFile)(resolvedFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).catch(swallowError) + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1] + }; +}, "loadSharedConfigFiles"); -// src/regionInfo/getResolvedHostname.ts -var getResolvedHostname = /* @__PURE__ */ __name((resolvedRegion, { regionHostname, partitionHostname }) => regionHostname ? regionHostname : partitionHostname ? partitionHostname.replace("{region}", resolvedRegion) : void 0, "getResolvedHostname"); +// src/getSsoSessionData.ts -// src/regionInfo/getResolvedPartition.ts -var getResolvedPartition = /* @__PURE__ */ __name((region, { partitionHash }) => Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region)) ?? "aws", "getResolvedPartition"); +var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); -// src/regionInfo/getResolvedSigningRegion.ts -var getResolvedSigningRegion = /* @__PURE__ */ __name((hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { - if (signingRegion) { - return signingRegion; - } else if (useFipsEndpoint) { - const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); - const regionRegexmatchArray = hostname.match(regionRegexJs); - if (regionRegexmatchArray) { - return regionRegexmatchArray[0].slice(1, -1); +// src/loadSsoSessionData.ts +var import_slurpFile2 = __nccwpck_require__(69545); +var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); + +// src/mergeConfigFiles.ts +var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== void 0) { + Object.assign(merged[key], values); + } else { + merged[key] = values; + } } } -}, "getResolvedSigningRegion"); + return merged; +}, "mergeConfigFiles"); -// src/regionInfo/getRegionInfo.ts -var getRegionInfo = /* @__PURE__ */ __name((region, { - useFipsEndpoint = false, - useDualstackEndpoint = false, - signingService, - regionHash, - partitionHash -}) => { - const partition = getResolvedPartition(region, { partitionHash }); - const resolvedRegion = region in regionHash ? region : partitionHash[partition]?.endpoint ?? region; - const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; - const regionHostname = getHostnameFromVariants(regionHash[resolvedRegion]?.variants, hostnameOptions); - const partitionHostname = getHostnameFromVariants(partitionHash[partition]?.variants, hostnameOptions); - const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname }); - if (hostname === void 0) { - throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); - } - const signingRegion = getResolvedSigningRegion(hostname, { - signingRegion: regionHash[resolvedRegion]?.signingRegion, - regionRegex: partitionHash[partition].regionRegex, - useFipsEndpoint - }); - return { - partition, - signingService, - hostname, - ...signingRegion && { signingRegion }, - ...regionHash[resolvedRegion]?.signingService && { - signingService: regionHash[resolvedRegion].signingService - } - }; -}, "getRegionInfo"); +// src/parseKnownFiles.ts +var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); +}, "parseKnownFiles"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -76606,7 +67816,28 @@ var getRegionInfo = /* @__PURE__ */ __name((region, { /***/ }), -/***/ 12588: +/***/ 69545: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.slurpFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const { readFile } = fs_1.promises; +const filePromisesHash = {}; +const slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); + } + return filePromisesHash[path]; +}; +exports.slurpFile = slurpFile; + + +/***/ }), + +/***/ 54387: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -76718,515 +67949,506 @@ var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; return FieldPosition2; -})(FieldPosition || {}); - -// src/middleware.ts -var SMITHY_CONTEXT_KEY = "__smithy_context"; - -// src/profile.ts -var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { - IniSectionType2["PROFILE"] = "profile"; - IniSectionType2["SSO_SESSION"] = "sso-session"; - IniSectionType2["SERVICES"] = "services"; - return IniSectionType2; -})(IniSectionType || {}); - -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 42634: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - getSmithyContext: () => getSmithyContext, - normalizeProvider: () => normalizeProvider -}); -module.exports = __toCommonJS(src_exports); - -// src/getSmithyContext.ts -var import_types = __nccwpck_require__(12588); -var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - -// src/normalizeProvider.ts -var normalizeProvider = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; -}, "normalizeProvider"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 40566: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - DEFAULT_MAX_RETRIES: () => DEFAULT_MAX_RETRIES, - DEFAULT_TIMEOUT: () => DEFAULT_TIMEOUT, - ENV_CMDS_AUTH_TOKEN: () => ENV_CMDS_AUTH_TOKEN, - ENV_CMDS_FULL_URI: () => ENV_CMDS_FULL_URI, - ENV_CMDS_RELATIVE_URI: () => ENV_CMDS_RELATIVE_URI, - Endpoint: () => Endpoint, - fromContainerMetadata: () => fromContainerMetadata, - fromInstanceMetadata: () => fromInstanceMetadata, - getInstanceMetadataEndpoint: () => getInstanceMetadataEndpoint, - httpRequest: () => httpRequest, - providerConfigFromInit: () => providerConfigFromInit -}); -module.exports = __toCommonJS(src_exports); - -// src/fromContainerMetadata.ts - -var import_url = __nccwpck_require__(87016); - -// src/remoteProvider/httpRequest.ts -var import_property_provider = __nccwpck_require__(42382); -var import_buffer = __nccwpck_require__(20181); -var import_http = __nccwpck_require__(58611); -function httpRequest(options) { - return new Promise((resolve, reject) => { - const req = (0, import_http.request)({ - method: "GET", - ...options, - // Node.js http module doesn't accept hostname with square brackets - // Refs: https://github.com/nodejs/node/issues/39738 - hostname: options.hostname?.replace(/^\[(.+)\]$/, "$1") - }); - req.on("error", (err) => { - reject(Object.assign(new import_property_provider.ProviderError("Unable to connect to instance metadata service"), err)); - req.destroy(); - }); - req.on("timeout", () => { - reject(new import_property_provider.ProviderError("TimeoutError from instance metadata service")); - req.destroy(); - }); - req.on("response", (res) => { - const { statusCode = 400 } = res; - if (statusCode < 200 || 300 <= statusCode) { - reject( - Object.assign(new import_property_provider.ProviderError("Error response received from instance metadata service"), { statusCode }) - ); - req.destroy(); - } - const chunks = []; - res.on("data", (chunk) => { - chunks.push(chunk); - }); - res.on("end", () => { - resolve(import_buffer.Buffer.concat(chunks)); - req.destroy(); - }); - }); - req.end(); - }); -} -__name(httpRequest, "httpRequest"); - -// src/remoteProvider/ImdsCredentials.ts -var isImdsCredentials = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.AccessKeyId === "string" && typeof arg.SecretAccessKey === "string" && typeof arg.Token === "string" && typeof arg.Expiration === "string", "isImdsCredentials"); -var fromImdsCredentials = /* @__PURE__ */ __name((creds) => ({ - accessKeyId: creds.AccessKeyId, - secretAccessKey: creds.SecretAccessKey, - sessionToken: creds.Token, - expiration: new Date(creds.Expiration), - ...creds.AccountId && { accountId: creds.AccountId } -}), "fromImdsCredentials"); - -// src/remoteProvider/RemoteProviderInit.ts -var DEFAULT_TIMEOUT = 1e3; -var DEFAULT_MAX_RETRIES = 0; -var providerConfigFromInit = /* @__PURE__ */ __name(({ - maxRetries = DEFAULT_MAX_RETRIES, - timeout = DEFAULT_TIMEOUT -}) => ({ maxRetries, timeout }), "providerConfigFromInit"); - -// src/remoteProvider/retry.ts -var retry = /* @__PURE__ */ __name((toRetry, maxRetries) => { - let promise = toRetry(); - for (let i = 0; i < maxRetries; i++) { - promise = promise.catch(toRetry); - } - return promise; -}, "retry"); - -// src/fromContainerMetadata.ts -var ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; -var ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; -var ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; -var fromContainerMetadata = /* @__PURE__ */ __name((init = {}) => { - const { timeout, maxRetries } = providerConfigFromInit(init); - return () => retry(async () => { - const requestOptions = await getCmdsUri({ logger: init.logger }); - const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); - if (!isImdsCredentials(credsResponse)) { - throw new import_property_provider.CredentialsProviderError("Invalid response received from instance metadata service.", { - logger: init.logger - }); - } - return fromImdsCredentials(credsResponse); - }, maxRetries); -}, "fromContainerMetadata"); -var requestFromEcsImds = /* @__PURE__ */ __name(async (timeout, options) => { - if (process.env[ENV_CMDS_AUTH_TOKEN]) { - options.headers = { - ...options.headers, - Authorization: process.env[ENV_CMDS_AUTH_TOKEN] - }; - } - const buffer = await httpRequest({ - ...options, - timeout - }); - return buffer.toString(); -}, "requestFromEcsImds"); -var CMDS_IP = "169.254.170.2"; -var GREENGRASS_HOSTS = { - localhost: true, - "127.0.0.1": true -}; -var GREENGRASS_PROTOCOLS = { - "http:": true, - "https:": true -}; -var getCmdsUri = /* @__PURE__ */ __name(async ({ logger }) => { - if (process.env[ENV_CMDS_RELATIVE_URI]) { - return { - hostname: CMDS_IP, - path: process.env[ENV_CMDS_RELATIVE_URI] - }; - } - if (process.env[ENV_CMDS_FULL_URI]) { - const parsed = (0, import_url.parse)(process.env[ENV_CMDS_FULL_URI]); - if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { - throw new import_property_provider.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { - tryNextLink: false, - logger - }); - } - if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { - throw new import_property_provider.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { - tryNextLink: false, - logger - }); - } - return { - ...parsed, - port: parsed.port ? parseInt(parsed.port, 10) : void 0 - }; - } - throw new import_property_provider.CredentialsProviderError( - `The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, - { - tryNextLink: false, - logger - } - ); -}, "getCmdsUri"); +})(FieldPosition || {}); -// src/fromInstanceMetadata.ts +// src/middleware.ts +var SMITHY_CONTEXT_KEY = "__smithy_context"; + +// src/profile.ts +var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; +})(IniSectionType || {}); + +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); +// Annotate the CommonJS export names for ESM import in node: +0 && (0); -// src/error/InstanceMetadataV1FallbackError.ts -var InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError extends import_property_provider.CredentialsProviderError { - constructor(message, tryNextLink = true) { - super(message, tryNextLink); - this.tryNextLink = tryNextLink; - this.name = "InstanceMetadataV1FallbackError"; - Object.setPrototypeOf(this, _InstanceMetadataV1FallbackError.prototype); - } - static { - __name(this, "InstanceMetadataV1FallbackError"); +/***/ }), + +/***/ 83068: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/utils/getInstanceMetadataEndpoint.ts -var import_node_config_provider = __nccwpck_require__(85744); -var import_url_parser = __nccwpck_require__(38118); +// src/index.ts +var index_exports = {}; +__export(index_exports, { + ConditionObject: () => import_util_endpoints.ConditionObject, + DeprecatedObject: () => import_util_endpoints.DeprecatedObject, + EndpointError: () => import_util_endpoints.EndpointError, + EndpointObject: () => import_util_endpoints.EndpointObject, + EndpointObjectHeaders: () => import_util_endpoints.EndpointObjectHeaders, + EndpointObjectProperties: () => import_util_endpoints.EndpointObjectProperties, + EndpointParams: () => import_util_endpoints.EndpointParams, + EndpointResolverOptions: () => import_util_endpoints.EndpointResolverOptions, + EndpointRuleObject: () => import_util_endpoints.EndpointRuleObject, + ErrorRuleObject: () => import_util_endpoints.ErrorRuleObject, + EvaluateOptions: () => import_util_endpoints.EvaluateOptions, + Expression: () => import_util_endpoints.Expression, + FunctionArgv: () => import_util_endpoints.FunctionArgv, + FunctionObject: () => import_util_endpoints.FunctionObject, + FunctionReturn: () => import_util_endpoints.FunctionReturn, + ParameterObject: () => import_util_endpoints.ParameterObject, + ReferenceObject: () => import_util_endpoints.ReferenceObject, + ReferenceRecord: () => import_util_endpoints.ReferenceRecord, + RuleSetObject: () => import_util_endpoints.RuleSetObject, + RuleSetRules: () => import_util_endpoints.RuleSetRules, + TreeRuleObject: () => import_util_endpoints.TreeRuleObject, + awsEndpointFunctions: () => awsEndpointFunctions, + getUserAgentPrefix: () => getUserAgentPrefix, + isIpAddress: () => import_util_endpoints.isIpAddress, + partition: () => partition, + resolveDefaultAwsRegionalEndpointsConfig: () => resolveDefaultAwsRegionalEndpointsConfig, + resolveEndpoint: () => import_util_endpoints.resolveEndpoint, + setPartitionInfo: () => setPartitionInfo, + toEndpointV1: () => toEndpointV1, + useDefaultPartitionInfo: () => useDefaultPartitionInfo +}); +module.exports = __toCommonJS(index_exports); -// src/config/Endpoint.ts -var Endpoint = /* @__PURE__ */ ((Endpoint2) => { - Endpoint2["IPv4"] = "http://169.254.169.254"; - Endpoint2["IPv6"] = "http://[fd00:ec2::254]"; - return Endpoint2; -})(Endpoint || {}); +// src/aws.ts -// src/config/EndpointConfigOptions.ts -var ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; -var CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; -var ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[ENV_ENDPOINT_NAME], - configFileSelector: (profile) => profile[CONFIG_ENDPOINT_NAME], - default: void 0 -}; -// src/config/EndpointMode.ts -var EndpointMode = /* @__PURE__ */ ((EndpointMode2) => { - EndpointMode2["IPv4"] = "IPv4"; - EndpointMode2["IPv6"] = "IPv6"; - return EndpointMode2; -})(EndpointMode || {}); +// src/lib/aws/isVirtualHostableS3Bucket.ts -// src/config/EndpointModeConfigOptions.ts -var ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; -var CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; -var ENDPOINT_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[ENV_ENDPOINT_MODE_NAME], - configFileSelector: (profile) => profile[CONFIG_ENDPOINT_MODE_NAME], - default: "IPv4" /* IPv4 */ -}; -// src/utils/getInstanceMetadataEndpoint.ts -var getInstanceMetadataEndpoint = /* @__PURE__ */ __name(async () => (0, import_url_parser.parseUrl)(await getFromEndpointConfig() || await getFromEndpointModeConfig()), "getInstanceMetadataEndpoint"); -var getFromEndpointConfig = /* @__PURE__ */ __name(async () => (0, import_node_config_provider.loadConfig)(ENDPOINT_CONFIG_OPTIONS)(), "getFromEndpointConfig"); -var getFromEndpointModeConfig = /* @__PURE__ */ __name(async () => { - const endpointMode = await (0, import_node_config_provider.loadConfig)(ENDPOINT_MODE_CONFIG_OPTIONS)(); - switch (endpointMode) { - case "IPv4" /* IPv4 */: - return "http://169.254.169.254" /* IPv4 */; - case "IPv6" /* IPv6 */: - return "http://[fd00:ec2::254]" /* IPv6 */; - default: - throw new Error(`Unsupported endpoint mode: ${endpointMode}. Select from ${Object.values(EndpointMode)}`); +// src/lib/isIpAddress.ts +var import_util_endpoints = __nccwpck_require__(79674); + +// src/lib/aws/isVirtualHostableS3Bucket.ts +var isVirtualHostableS3Bucket = /* @__PURE__ */ __name((value, allowSubDomains = false) => { + if (allowSubDomains) { + for (const label of value.split(".")) { + if (!isVirtualHostableS3Bucket(label)) { + return false; + } + } + return true; } -}, "getFromEndpointModeConfig"); + if (!(0, import_util_endpoints.isValidHostLabel)(value)) { + return false; + } + if (value.length < 3 || value.length > 63) { + return false; + } + if (value !== value.toLowerCase()) { + return false; + } + if ((0, import_util_endpoints.isIpAddress)(value)) { + return false; + } + return true; +}, "isVirtualHostableS3Bucket"); -// src/utils/getExtendedInstanceMetadataCredentials.ts -var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; -var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; -var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; -var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger) => { - const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); - const newExpiration = new Date(Date.now() + refreshInterval * 1e3); - logger.warn( - `Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}. -For more information, please visit: ` + STATIC_STABILITY_DOC_URL - ); - const originalExpiration = credentials.originalExpiration ?? credentials.expiration; +// src/lib/aws/parseArn.ts +var ARN_DELIMITER = ":"; +var RESOURCE_DELIMITER = "/"; +var parseArn = /* @__PURE__ */ __name((value) => { + const segments = value.split(ARN_DELIMITER); + if (segments.length < 6) return null; + const [arn, partition2, service, region, accountId, ...resourcePath] = segments; + if (arn !== "arn" || partition2 === "" || service === "" || resourcePath.join(ARN_DELIMITER) === "") return null; + const resourceId = resourcePath.map((resource) => resource.split(RESOURCE_DELIMITER)).flat(); return { - ...credentials, - ...originalExpiration ? { originalExpiration } : {}, - expiration: newExpiration + partition: partition2, + service, + region, + accountId, + resourceId }; -}, "getExtendedInstanceMetadataCredentials"); +}, "parseArn"); -// src/utils/staticStabilityProvider.ts -var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => { - const logger = options?.logger || console; - let pastCredentials; - return async () => { - let credentials; - try { - credentials = await provider(); - if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { - credentials = getExtendedInstanceMetadataCredentials(credentials, logger); +// src/lib/aws/partitions.json +var partitions_default = { + partitions: [{ + id: "aws", + outputs: { + dnsSuffix: "amazonaws.com", + dualStackDnsSuffix: "api.aws", + implicitGlobalRegion: "us-east-1", + name: "aws", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^(us|eu|ap|sa|ca|me|af|il|mx)\\-\\w+\\-\\d+$", + regions: { + "af-south-1": { + description: "Africa (Cape Town)" + }, + "ap-east-1": { + description: "Asia Pacific (Hong Kong)" + }, + "ap-east-2": { + description: "Asia Pacific (Taipei)" + }, + "ap-northeast-1": { + description: "Asia Pacific (Tokyo)" + }, + "ap-northeast-2": { + description: "Asia Pacific (Seoul)" + }, + "ap-northeast-3": { + description: "Asia Pacific (Osaka)" + }, + "ap-south-1": { + description: "Asia Pacific (Mumbai)" + }, + "ap-south-2": { + description: "Asia Pacific (Hyderabad)" + }, + "ap-southeast-1": { + description: "Asia Pacific (Singapore)" + }, + "ap-southeast-2": { + description: "Asia Pacific (Sydney)" + }, + "ap-southeast-3": { + description: "Asia Pacific (Jakarta)" + }, + "ap-southeast-4": { + description: "Asia Pacific (Melbourne)" + }, + "ap-southeast-5": { + description: "Asia Pacific (Malaysia)" + }, + "ap-southeast-7": { + description: "Asia Pacific (Thailand)" + }, + "aws-global": { + description: "AWS Standard global region" + }, + "ca-central-1": { + description: "Canada (Central)" + }, + "ca-west-1": { + description: "Canada West (Calgary)" + }, + "eu-central-1": { + description: "Europe (Frankfurt)" + }, + "eu-central-2": { + description: "Europe (Zurich)" + }, + "eu-north-1": { + description: "Europe (Stockholm)" + }, + "eu-south-1": { + description: "Europe (Milan)" + }, + "eu-south-2": { + description: "Europe (Spain)" + }, + "eu-west-1": { + description: "Europe (Ireland)" + }, + "eu-west-2": { + description: "Europe (London)" + }, + "eu-west-3": { + description: "Europe (Paris)" + }, + "il-central-1": { + description: "Israel (Tel Aviv)" + }, + "me-central-1": { + description: "Middle East (UAE)" + }, + "me-south-1": { + description: "Middle East (Bahrain)" + }, + "mx-central-1": { + description: "Mexico (Central)" + }, + "sa-east-1": { + description: "South America (Sao Paulo)" + }, + "us-east-1": { + description: "US East (N. Virginia)" + }, + "us-east-2": { + description: "US East (Ohio)" + }, + "us-west-1": { + description: "US West (N. California)" + }, + "us-west-2": { + description: "US West (Oregon)" } - } catch (e) { - if (pastCredentials) { - logger.warn("Credential renew failed: ", e); - credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); - } else { - throw e; + } + }, { + id: "aws-cn", + outputs: { + dnsSuffix: "amazonaws.com.cn", + dualStackDnsSuffix: "api.amazonwebservices.com.cn", + implicitGlobalRegion: "cn-northwest-1", + name: "aws-cn", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^cn\\-\\w+\\-\\d+$", + regions: { + "aws-cn-global": { + description: "AWS China global region" + }, + "cn-north-1": { + description: "China (Beijing)" + }, + "cn-northwest-1": { + description: "China (Ningxia)" } } - pastCredentials = credentials; - return credentials; - }; -}, "staticStabilityProvider"); - -// src/fromInstanceMetadata.ts -var IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; -var IMDS_TOKEN_PATH = "/latest/api/token"; -var AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; -var PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; -var X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; -var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata"); -var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => { - let disableFetchToken = false; - const { logger, profile } = init; - const { timeout, maxRetries } = providerConfigFromInit(init); - const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => { - const isImdsV1Fallback = disableFetchToken || options.headers?.[X_AWS_EC2_METADATA_TOKEN] == null; - if (isImdsV1Fallback) { - let fallbackBlockedFromProfile = false; - let fallbackBlockedFromProcessEnv = false; - const configValue = await (0, import_node_config_provider.loadConfig)( - { - environmentVariableSelector: (env) => { - const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; - fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; - if (envValue === void 0) { - throw new import_property_provider.CredentialsProviderError( - `${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, - { logger: init.logger } - ); - } - return fallbackBlockedFromProcessEnv; - }, - configFileSelector: (profile2) => { - const profileValue = profile2[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; - fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; - return fallbackBlockedFromProfile; - }, - default: false - }, - { - profile - } - )(); - if (init.ec2MetadataV1Disabled || configValue) { - const causes = []; - if (init.ec2MetadataV1Disabled) - causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); - if (fallbackBlockedFromProfile) - causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); - if (fallbackBlockedFromProcessEnv) - causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); - throw new InstanceMetadataV1FallbackError( - `AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join( - ", " - )}].` - ); + }, { + id: "aws-us-gov", + outputs: { + dnsSuffix: "amazonaws.com", + dualStackDnsSuffix: "api.aws", + implicitGlobalRegion: "us-gov-west-1", + name: "aws-us-gov", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^us\\-gov\\-\\w+\\-\\d+$", + regions: { + "aws-us-gov-global": { + description: "AWS GovCloud (US) global region" + }, + "us-gov-east-1": { + description: "AWS GovCloud (US-East)" + }, + "us-gov-west-1": { + description: "AWS GovCloud (US-West)" } } - const imdsProfile = (await retry(async () => { - let profile2; - try { - profile2 = await getProfile(options); - } catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; + }, { + id: "aws-iso", + outputs: { + dnsSuffix: "c2s.ic.gov", + dualStackDnsSuffix: "c2s.ic.gov", + implicitGlobalRegion: "us-iso-east-1", + name: "aws-iso", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-iso\\-\\w+\\-\\d+$", + regions: { + "aws-iso-global": { + description: "AWS ISO (US) global region" + }, + "us-iso-east-1": { + description: "US ISO East" + }, + "us-iso-west-1": { + description: "US ISO WEST" + } + } + }, { + id: "aws-iso-b", + outputs: { + dnsSuffix: "sc2s.sgov.gov", + dualStackDnsSuffix: "sc2s.sgov.gov", + implicitGlobalRegion: "us-isob-east-1", + name: "aws-iso-b", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-isob\\-\\w+\\-\\d+$", + regions: { + "aws-iso-b-global": { + description: "AWS ISOB (US) global region" + }, + "us-isob-east-1": { + description: "US ISOB East (Ohio)" + } + } + }, { + id: "aws-iso-e", + outputs: { + dnsSuffix: "cloud.adc-e.uk", + dualStackDnsSuffix: "cloud.adc-e.uk", + implicitGlobalRegion: "eu-isoe-west-1", + name: "aws-iso-e", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^eu\\-isoe\\-\\w+\\-\\d+$", + regions: { + "aws-iso-e-global": { + description: "AWS ISOE (Europe) global region" + }, + "eu-isoe-west-1": { + description: "EU ISOE West" + } + } + }, { + id: "aws-iso-f", + outputs: { + dnsSuffix: "csp.hci.ic.gov", + dualStackDnsSuffix: "csp.hci.ic.gov", + implicitGlobalRegion: "us-isof-south-1", + name: "aws-iso-f", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-isof\\-\\w+\\-\\d+$", + regions: { + "aws-iso-f-global": { + description: "AWS ISOF global region" + }, + "us-isof-east-1": { + description: "US ISOF EAST" + }, + "us-isof-south-1": { + description: "US ISOF SOUTH" } - return profile2; - }, maxRetries2)).trim(); - return retry(async () => { - let creds; - try { - creds = await getCredentialsFromProfile(imdsProfile, options, init); - } catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; + } + }, { + id: "aws-eusc", + outputs: { + dnsSuffix: "amazonaws.eu", + dualStackDnsSuffix: "amazonaws.eu", + implicitGlobalRegion: "eusc-de-east-1", + name: "aws-eusc", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^eusc\\-(de)\\-\\w+\\-\\d+$", + regions: { + "eusc-de-east-1": { + description: "EU (Germany)" } - return creds; - }, maxRetries2); - }, "getCredentials"); - return async () => { - const endpoint = await getInstanceMetadataEndpoint(); - if (disableFetchToken) { - logger?.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); - return getCredentials(maxRetries, { ...endpoint, timeout }); - } else { - let token; - try { - token = (await getMetadataToken({ ...endpoint, timeout })).toString(); - } catch (error) { - if (error?.statusCode === 400) { - throw Object.assign(error, { - message: "EC2 Metadata token request returned error" - }); - } else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { - disableFetchToken = true; - } - logger?.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); - return getCredentials(maxRetries, { ...endpoint, timeout }); + } + }], + version: "1.1" +}; + +// src/lib/aws/partition.ts +var selectedPartitionsInfo = partitions_default; +var selectedUserAgentPrefix = ""; +var partition = /* @__PURE__ */ __name((value) => { + const { partitions } = selectedPartitionsInfo; + for (const partition2 of partitions) { + const { regions, outputs } = partition2; + for (const [region, regionData] of Object.entries(regions)) { + if (region === value) { + return { + ...outputs, + ...regionData + }; } - return getCredentials(maxRetries, { - ...endpoint, - headers: { - [X_AWS_EC2_METADATA_TOKEN]: token - }, - timeout - }); } + } + for (const partition2 of partitions) { + const { regionRegex, outputs } = partition2; + if (new RegExp(regionRegex).test(value)) { + return { + ...outputs + }; + } + } + const DEFAULT_PARTITION = partitions.find((partition2) => partition2.id === "aws"); + if (!DEFAULT_PARTITION) { + throw new Error( + "Provided region was not found in the partition array or regex, and default partition with id 'aws' doesn't exist." + ); + } + return { + ...DEFAULT_PARTITION.outputs }; -}, "getInstanceMetadataProvider"); -var getMetadataToken = /* @__PURE__ */ __name(async (options) => httpRequest({ - ...options, - path: IMDS_TOKEN_PATH, - method: "PUT", - headers: { - "x-aws-ec2-metadata-token-ttl-seconds": "21600" +}, "partition"); +var setPartitionInfo = /* @__PURE__ */ __name((partitionsInfo, userAgentPrefix = "") => { + selectedPartitionsInfo = partitionsInfo; + selectedUserAgentPrefix = userAgentPrefix; +}, "setPartitionInfo"); +var useDefaultPartitionInfo = /* @__PURE__ */ __name(() => { + setPartitionInfo(partitions_default, ""); +}, "useDefaultPartitionInfo"); +var getUserAgentPrefix = /* @__PURE__ */ __name(() => selectedUserAgentPrefix, "getUserAgentPrefix"); + +// src/aws.ts +var awsEndpointFunctions = { + isVirtualHostableS3Bucket, + parseArn, + partition +}; +import_util_endpoints.customEndpointFunctions.aws = awsEndpointFunctions; + +// src/resolveDefaultAwsRegionalEndpointsConfig.ts +var import_url_parser = __nccwpck_require__(67320); +var resolveDefaultAwsRegionalEndpointsConfig = /* @__PURE__ */ __name((input) => { + if (typeof input.endpointProvider !== "function") { + throw new Error("@aws-sdk/util-endpoint - endpointProvider and endpoint missing in config for this client."); } -}), "getMetadataToken"); -var getProfile = /* @__PURE__ */ __name(async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(), "getProfile"); -var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, init) => { - const credentialsResponse = JSON.parse( - (await httpRequest({ - ...options, - path: IMDS_PATH + profile - })).toString() - ); - if (!isImdsCredentials(credentialsResponse)) { - throw new import_property_provider.CredentialsProviderError("Invalid response received from instance metadata service.", { - logger: init.logger - }); + const { endpoint } = input; + if (endpoint === void 0) { + input.endpoint = async () => { + return toEndpointV1( + input.endpointProvider( + { + Region: typeof input.region === "function" ? await input.region() : input.region, + UseDualStack: typeof input.useDualstackEndpoint === "function" ? await input.useDualstackEndpoint() : input.useDualstackEndpoint, + UseFIPS: typeof input.useFipsEndpoint === "function" ? await input.useFipsEndpoint() : input.useFipsEndpoint, + Endpoint: void 0 + }, + { logger: input.logger } + ) + ); + }; } - return fromImdsCredentials(credentialsResponse); -}, "getCredentialsFromProfile"); + return input; +}, "resolveDefaultAwsRegionalEndpointsConfig"); +var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => (0, import_url_parser.parseUrl)(endpoint.url), "toEndpointV1"); + +// src/resolveEndpoint.ts + + +// src/types/EndpointError.ts + + +// src/types/EndpointRuleObject.ts + + +// src/types/ErrorRuleObject.ts + + +// src/types/RuleSetObject.ts + + +// src/types/TreeRuleObject.ts + + +// src/types/shared.ts + // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -77235,8 +68457,8 @@ var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, /***/ }), -/***/ 85744: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 8776: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -77260,87 +68482,31 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - loadConfig: () => loadConfig + parseQueryString: () => parseQueryString }); module.exports = __toCommonJS(src_exports); - -// src/configLoader.ts - - -// src/fromEnv.ts -var import_property_provider = __nccwpck_require__(42382); - -// src/getSelectorName.ts -function getSelectorName(functionString) { - try { - const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); - constants.delete("CONFIG"); - constants.delete("CONFIG_PREFIX_SEPARATOR"); - constants.delete("ENV"); - return [...constants].join(", "); - } catch (e) { - return functionString; - } -} -__name(getSelectorName, "getSelectorName"); - -// src/fromEnv.ts -var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { - try { - const config = envVarSelector(process.env, options); - if (config === void 0) { - throw new Error(); - } - return config; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, - { logger: options?.logger } - ); - } -}, "fromEnv"); - -// src/fromSharedConfigFiles.ts - -var import_shared_ini_file_loader = __nccwpck_require__(38924); -var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, import_shared_ini_file_loader.getProfileName)(init); - const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; - try { - const cfgFile = preferredFile === "config" ? configFile : credentialsFile; - const configValue = configSelector(mergedProfile, cfgFile); - if (configValue === void 0) { - throw new Error(); +function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } else if (Array.isArray(query[key])) { + query[key].push(value); + } else { + query[key] = [query[key], value]; + } } - return configValue; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, - { logger: init.logger } - ); } -}, "fromSharedConfigFiles"); - -// src/fromStatic.ts - -var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); -var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); - -// src/configLoader.ts -var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { - const { signingName, logger } = configuration; - const envOptions = { signingName, logger }; - return (0, import_property_provider.memoize)( - (0, import_property_provider.chain)( - fromEnv(environmentVariableSelector, envOptions), - fromSharedConfigFiles(configFileSelector, configuration), - fromStatic(defaultValue) - ) - ); -}, "loadConfig"); + return query; +} +__name(parseQueryString, "parseQueryString"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -77349,8 +68515,8 @@ var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFi /***/ }), -/***/ 42382: -/***/ ((module) => { +/***/ 67320: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -77374,143 +68540,27 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize + parseUrl: () => parseUrl }); module.exports = __toCommonJS(src_exports); - -// src/ProviderError.ts -var ProviderError = class _ProviderError extends Error { - constructor(message, options = true) { - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; - } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError.prototype); - logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); - } - static { - __name(this, "ProviderError"); - } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); - } -}; - -// src/CredentialsProviderError.ts -var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError.prototype); - } - static { - __name(this, "CredentialsProviderError"); - } -}; - -// src/TokenProviderError.ts -var TokenProviderError = class _TokenProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError.prototype); - } - static { - __name(this, "TokenProviderError"); - } -}; - -// src/chain.ts -var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError("No providers in chain"); - } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err?.tryNextLink) { - continue; - } - throw err; - } +var import_querystring_parser = __nccwpck_require__(8776); +var parseUrl = /* @__PURE__ */ __name((url) => { + if (typeof url === "string") { + return parseUrl(new URL(url)); } - throw lastProviderError; -}, "chain"); - -// src/fromStatic.ts -var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); - -// src/memoize.ts -var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - return resolved; - }; + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = (0, import_querystring_parser.parseQueryString)(search); } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - if (isConstant) { - return resolved; - } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; - } - return resolved; + return { + hostname, + port: port ? parseInt(port) : void 0, + protocol, + path: pathname, + query }; -}, "memoize"); +}, "parseUrl"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -77519,8 +68569,10 @@ var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { /***/ }), -/***/ 39982: -/***/ ((module) => { +/***/ 51656: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -77542,33 +68594,76 @@ var __copyProps = (to, from, except, desc) => { var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts -var src_exports = {}; -__export(src_exports, { - parseQueryString: () => parseQueryString +var index_exports = {}; +__export(index_exports, { + NODE_APP_ID_CONFIG_OPTIONS: () => NODE_APP_ID_CONFIG_OPTIONS, + UA_APP_ID_ENV_NAME: () => UA_APP_ID_ENV_NAME, + UA_APP_ID_INI_NAME: () => UA_APP_ID_INI_NAME, + createDefaultUserAgentProvider: () => createDefaultUserAgentProvider, + crtAvailability: () => crtAvailability, + defaultUserAgent: () => defaultUserAgent }); -module.exports = __toCommonJS(src_exports); -function parseQueryString(querystring) { - const query = {}; - querystring = querystring.replace(/^\?/, ""); - if (querystring) { - for (const pair of querystring.split("&")) { - let [key, value = null] = pair.split("="); - key = decodeURIComponent(key); - if (value) { - value = decodeURIComponent(value); - } - if (!(key in query)) { - query[key] = value; - } else if (Array.isArray(query[key])) { - query[key].push(value); - } else { - query[key] = [query[key], value]; - } - } +module.exports = __toCommonJS(index_exports); + +// src/defaultUserAgent.ts +var import_os = __nccwpck_require__(70857); +var import_process = __nccwpck_require__(932); + +// src/crt-availability.ts +var crtAvailability = { + isCrtAvailable: false +}; + +// src/is-crt-available.ts +var isCrtAvailable = /* @__PURE__ */ __name(() => { + if (crtAvailability.isCrtAvailable) { + return ["md/crt-avail"]; } - return query; -} -__name(parseQueryString, "parseQueryString"); + return null; +}, "isCrtAvailable"); + +// src/defaultUserAgent.ts +var createDefaultUserAgentProvider = /* @__PURE__ */ __name(({ serviceId, clientVersion }) => { + return async (config) => { + const sections = [ + // sdk-metadata + ["aws-sdk-js", clientVersion], + // ua-metadata + ["ua", "2.1"], + // os-metadata + [`os/${(0, import_os.platform)()}`, (0, import_os.release)()], + // language-metadata + // ECMAScript edition doesn't matter in JS, so no version needed. + ["lang/js"], + ["md/nodejs", `${import_process.versions.node}`] + ]; + const crtAvailable = isCrtAvailable(); + if (crtAvailable) { + sections.push(crtAvailable); + } + if (serviceId) { + sections.push([`api/${serviceId}`, clientVersion]); + } + if (import_process.env.AWS_EXECUTION_ENV) { + sections.push([`exec-env/${import_process.env.AWS_EXECUTION_ENV}`]); + } + const appId = await config?.userAgentAppId?.(); + const resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; + return resolvedUserAgent; + }; +}, "createDefaultUserAgentProvider"); +var defaultUserAgent = createDefaultUserAgentProvider; + +// src/nodeAppIdConfigOptions.ts +var import_middleware_user_agent = __nccwpck_require__(32959); +var UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; +var UA_APP_ID_INI_NAME = "sdk_ua_app_id"; +var UA_APP_ID_INI_NAME_DEPRECATED = "sdk-ua-app-id"; +var NODE_APP_ID_CONFIG_OPTIONS = { + environmentVariableSelector: /* @__PURE__ */ __name((env2) => env2[UA_APP_ID_ENV_NAME], "environmentVariableSelector"), + configFileSelector: /* @__PURE__ */ __name((profile) => profile[UA_APP_ID_INI_NAME] ?? profile[UA_APP_ID_INI_NAME_DEPRECATED], "configFileSelector"), + default: import_middleware_user_agent.DEFAULT_UA_APP_ID +}; // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -77577,81 +68672,185 @@ __name(parseQueryString, "parseQueryString"); /***/ }), -/***/ 48660: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 94274: +/***/ ((module) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getHomeDir = void 0; -const os_1 = __nccwpck_require__(70857); -const path_1 = __nccwpck_require__(16928); -const homeDirCache = {}; -const getHomeDirCacheKey = () => { - if (process && process.geteuid) { - return `${process.geteuid()}`; - } - return "DEFAULT"; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); }; -const getHomeDir = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - const homeDirCacheKey = getHomeDirCacheKey(); - if (!homeDirCache[homeDirCacheKey]) - homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); - return homeDirCache[homeDirCacheKey]; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; }; -exports.getHomeDir = getHomeDir; - +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -/***/ }), +// src/index.ts +var index_exports = {}; +__export(index_exports, { + XmlNode: () => XmlNode, + XmlText: () => XmlText +}); +module.exports = __toCommonJS(index_exports); -/***/ 17669: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/escape-attribute.ts +function escapeAttribute(value) { + return value.replace(/&/g, "&").replace(//g, ">").replace(/"/g, """); +} +__name(escapeAttribute, "escapeAttribute"); -"use strict"; +// src/escape-element.ts +function escapeElement(value) { + return value.replace(/&/g, "&").replace(/"/g, """).replace(/'/g, "'").replace(//g, ">").replace(/\r/g, " ").replace(/\n/g, " ").replace(/\u0085/g, " ").replace(/\u2028/, " "); +} +__name(escapeElement, "escapeElement"); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFilepath = void 0; -const crypto_1 = __nccwpck_require__(76982); -const path_1 = __nccwpck_require__(16928); -const getHomeDir_1 = __nccwpck_require__(48660); -const getSSOTokenFilepath = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); +// src/XmlText.ts +var XmlText = class { + constructor(value) { + this.value = value; + } + static { + __name(this, "XmlText"); + } + toString() { + return escapeElement("" + this.value); + } }; -exports.getSSOTokenFilepath = getSSOTokenFilepath; - - -/***/ }), -/***/ 88262: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/XmlNode.ts +var XmlNode = class _XmlNode { + constructor(name, children = []) { + this.name = name; + this.children = children; + } + static { + __name(this, "XmlNode"); + } + attributes = {}; + static of(name, childText, withName) { + const node = new _XmlNode(name); + if (childText !== void 0) { + node.addChildNode(new XmlText(childText)); + } + if (withName !== void 0) { + node.withName(withName); + } + return node; + } + withName(name) { + this.name = name; + return this; + } + addAttribute(name, value) { + this.attributes[name] = value; + return this; + } + addChildNode(child) { + this.children.push(child); + return this; + } + removeAttribute(name) { + delete this.attributes[name]; + return this; + } + /** + * @internal + * Alias of {@link XmlNode#withName(string)} for codegen brevity. + */ + n(name) { + this.name = name; + return this; + } + /** + * @internal + * Alias of {@link XmlNode#addChildNode(string)} for codegen brevity. + */ + c(child) { + this.children.push(child); + return this; + } + /** + * @internal + * Checked version of {@link XmlNode#addAttribute(string)} for codegen brevity. + */ + a(name, value) { + if (value != null) { + this.attributes[name] = value; + } + return this; + } + /** + * Create a child node. + * Used in serialization of string fields. + * @internal + */ + cc(input, field, withName = field) { + if (input[field] != null) { + const node = _XmlNode.of(field, input[field]).withName(withName); + this.c(node); + } + } + /** + * Creates list child nodes. + * @internal + */ + l(input, listName, memberName, valueProvider) { + if (input[listName] != null) { + const nodes = valueProvider(); + nodes.map((node) => { + node.withName(memberName); + this.c(node); + }); + } + } + /** + * Creates list child nodes with container. + * @internal + */ + lc(input, listName, memberName, valueProvider) { + if (input[listName] != null) { + const nodes = valueProvider(); + const containerNode = new _XmlNode(memberName); + nodes.map((node) => { + containerNode.c(node); + }); + this.c(containerNode); + } + } + toString() { + const hasChildren = Boolean(this.children.length); + let xmlText = `<${this.name}`; + const attributes = this.attributes; + for (const attributeName of Object.keys(attributes)) { + const attribute = attributes[attributeName]; + if (attribute != null) { + xmlText += ` ${attributeName}="${escapeAttribute("" + attribute)}"`; + } + } + return xmlText += !hasChildren ? "/>" : `>${this.children.map((c) => c.toString()).join("")}${this.name}>`; + } +}; +// Annotate the CommonJS export names for ESM import in node: -"use strict"; +0 && (0); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFromFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const getSSOTokenFilepath_1 = __nccwpck_require__(17669); -const { readFile } = fs_1.promises; -const getSSOTokenFromFile = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); -}; -exports.getSSOTokenFromFile = getSSOTokenFromFile; /***/ }), -/***/ 38924: +/***/ 39316: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -77671,180 +68870,196 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - getProfileName: () => getProfileName, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles + CONFIG_USE_DUALSTACK_ENDPOINT: () => CONFIG_USE_DUALSTACK_ENDPOINT, + CONFIG_USE_FIPS_ENDPOINT: () => CONFIG_USE_FIPS_ENDPOINT, + DEFAULT_USE_DUALSTACK_ENDPOINT: () => DEFAULT_USE_DUALSTACK_ENDPOINT, + DEFAULT_USE_FIPS_ENDPOINT: () => DEFAULT_USE_FIPS_ENDPOINT, + ENV_USE_DUALSTACK_ENDPOINT: () => ENV_USE_DUALSTACK_ENDPOINT, + ENV_USE_FIPS_ENDPOINT: () => ENV_USE_FIPS_ENDPOINT, + NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, + NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, + NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, + NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, + REGION_ENV_NAME: () => REGION_ENV_NAME, + REGION_INI_NAME: () => REGION_INI_NAME, + getRegionInfo: () => getRegionInfo, + resolveCustomEndpointsConfig: () => resolveCustomEndpointsConfig, + resolveEndpointsConfig: () => resolveEndpointsConfig, + resolveRegionConfig: () => resolveRegionConfig }); module.exports = __toCommonJS(src_exports); -__reExport(src_exports, __nccwpck_require__(48660), module.exports); -// src/getProfileName.ts -var ENV_PROFILE = "AWS_PROFILE"; -var DEFAULT_PROFILE = "default"; -var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); +// src/endpointsConfig/NodeUseDualstackEndpointConfigOptions.ts +var import_util_config_provider = __nccwpck_require__(56716); +var ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; +var CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; +var DEFAULT_USE_DUALSTACK_ENDPOINT = false; +var NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.ENV), + configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), + default: false +}; -// src/index.ts -__reExport(src_exports, __nccwpck_require__(17669), module.exports); -__reExport(src_exports, __nccwpck_require__(88262), module.exports); +// src/endpointsConfig/NodeUseFipsEndpointConfigOptions.ts -// src/loadSharedConfigFiles.ts +var ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; +var CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; +var DEFAULT_USE_FIPS_ENDPOINT = false; +var NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.ENV), + configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), + default: false +}; + +// src/endpointsConfig/resolveCustomEndpointsConfig.ts +var import_util_middleware = __nccwpck_require__(42634); +var resolveCustomEndpointsConfig = /* @__PURE__ */ __name((input) => { + const { tls, endpoint, urlParser, useDualstackEndpoint } = input; + return Object.assign(input, { + tls: tls ?? true, + endpoint: (0, import_util_middleware.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), + isCustomEndpoint: true, + useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(useDualstackEndpoint ?? false) + }); +}, "resolveCustomEndpointsConfig"); + +// src/endpointsConfig/resolveEndpointsConfig.ts -// src/getConfigData.ts -var import_types = __nccwpck_require__(31242); -var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; +// src/endpointsConfig/utils/getEndpointFromRegion.ts +var getEndpointFromRegion = /* @__PURE__ */ __name(async (input) => { + const { tls = true } = input; + const region = await input.region(); + const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); + if (!dnsHostRegex.test(region)) { + throw new Error("Invalid region in client config"); } - return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); -}).reduce( - (acc, [key, value]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; - acc[updatedKey] = value; - return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } + const useDualstackEndpoint = await input.useDualstackEndpoint(); + const useFipsEndpoint = await input.useFipsEndpoint(); + const { hostname } = await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }) ?? {}; + if (!hostname) { + throw new Error("Cannot resolve hostname from client config"); } -), "getConfigData"); - -// src/getConfigFilepath.ts -var import_path = __nccwpck_require__(16928); -var import_getHomeDir = __nccwpck_require__(48660); -var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; -var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); + return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); +}, "getEndpointFromRegion"); -// src/getCredentialsFilepath.ts +// src/endpointsConfig/resolveEndpointsConfig.ts +var resolveEndpointsConfig = /* @__PURE__ */ __name((input) => { + const useDualstackEndpoint = (0, import_util_middleware.normalizeProvider)(input.useDualstackEndpoint ?? false); + const { endpoint, useFipsEndpoint, urlParser, tls } = input; + return Object.assign(input, { + tls: tls ?? true, + endpoint: endpoint ? (0, import_util_middleware.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) : () => getEndpointFromRegion({ ...input, useDualstackEndpoint, useFipsEndpoint }), + isCustomEndpoint: !!endpoint, + useDualstackEndpoint + }); +}, "resolveEndpointsConfig"); -var import_getHomeDir2 = __nccwpck_require__(48660); -var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; -var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); +// src/regionConfig/config.ts +var REGION_ENV_NAME = "AWS_REGION"; +var REGION_INI_NAME = "region"; +var NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[REGION_ENV_NAME], + configFileSelector: (profile) => profile[REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + } +}; +var NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials" +}; -// src/loadSharedConfigFiles.ts -var import_getHomeDir3 = __nccwpck_require__(48660); +// src/regionConfig/isFipsRegion.ts +var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); -// src/parseIni.ts +// src/regionConfig/getRealRegion.ts +var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); -var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; -var profileNameBlockList = ["__proto__", "profile __proto__"]; -var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); - } - } else { - currentSection = sectionName; - } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); +// src/regionConfig/resolveRegionConfig.ts +var resolveRegionConfig = /* @__PURE__ */ __name((input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); + } + return Object.assign(input, { + region: async () => { + if (typeof region === "string") { + return getRealRegion(region); } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; - } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; - } + const providedRegion = await region(); + return getRealRegion(providedRegion); + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if (isFipsRegion(providedRegion)) { + return true; } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); } - } - return map; -}, "parseIni"); - -// src/loadSharedConfigFiles.ts -var import_slurpFile = __nccwpck_require__(91550); -var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var CONFIG_PREFIX_SEPARATOR = "."; -var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); - } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); - } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; -}, "loadSharedConfigFiles"); + }); +}, "resolveRegionConfig"); -// src/getSsoSessionData.ts +// src/regionInfo/getHostnameFromVariants.ts +var getHostnameFromVariants = /* @__PURE__ */ __name((variants = [], { useFipsEndpoint, useDualstackEndpoint }) => variants.find( + ({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack") +)?.hostname, "getHostnameFromVariants"); -var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); +// src/regionInfo/getResolvedHostname.ts +var getResolvedHostname = /* @__PURE__ */ __name((resolvedRegion, { regionHostname, partitionHostname }) => regionHostname ? regionHostname : partitionHostname ? partitionHostname.replace("{region}", resolvedRegion) : void 0, "getResolvedHostname"); -// src/loadSsoSessionData.ts -var import_slurpFile2 = __nccwpck_require__(91550); -var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); +// src/regionInfo/getResolvedPartition.ts +var getResolvedPartition = /* @__PURE__ */ __name((region, { partitionHash }) => Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region)) ?? "aws", "getResolvedPartition"); -// src/mergeConfigFiles.ts -var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); - } else { - merged[key] = values; - } +// src/regionInfo/getResolvedSigningRegion.ts +var getResolvedSigningRegion = /* @__PURE__ */ __name((hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { + if (signingRegion) { + return signingRegion; + } else if (useFipsEndpoint) { + const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); + const regionRegexmatchArray = hostname.match(regionRegexJs); + if (regionRegexmatchArray) { + return regionRegexmatchArray[0].slice(1, -1); } } - return merged; -}, "mergeConfigFiles"); - -// src/parseKnownFiles.ts -var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); -}, "parseKnownFiles"); +}, "getResolvedSigningRegion"); + +// src/regionInfo/getRegionInfo.ts +var getRegionInfo = /* @__PURE__ */ __name((region, { + useFipsEndpoint = false, + useDualstackEndpoint = false, + signingService, + regionHash, + partitionHash +}) => { + const partition = getResolvedPartition(region, { partitionHash }); + const resolvedRegion = region in regionHash ? region : partitionHash[partition]?.endpoint ?? region; + const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; + const regionHostname = getHostnameFromVariants(regionHash[resolvedRegion]?.variants, hostnameOptions); + const partitionHostname = getHostnameFromVariants(partitionHash[partition]?.variants, hostnameOptions); + const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname }); + if (hostname === void 0) { + throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); + } + const signingRegion = getResolvedSigningRegion(hostname, { + signingRegion: regionHash[resolvedRegion]?.signingRegion, + regionRegex: partitionHash[partition].regionRegex, + useFipsEndpoint + }); + return { + partition, + signingService, + hostname, + ...signingRegion && { signingRegion }, + ...regionHash[resolvedRegion]?.signingService && { + signingService: regionHash[resolvedRegion].signingService + } + }; +}, "getRegionInfo"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -77853,28 +69068,7 @@ var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { /***/ }), -/***/ 91550: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.slurpFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const { readFile } = fs_1.promises; -const filePromisesHash = {}; -const slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); - } - return filePromisesHash[path]; -}; -exports.slurpFile = slurpFile; - - -/***/ }), - -/***/ 31242: +/***/ 12588: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -78014,7 +69208,7 @@ var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { /***/ }), -/***/ 38118: +/***/ 42634: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -78039,27 +69233,22 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - parseUrl: () => parseUrl + getSmithyContext: () => getSmithyContext, + normalizeProvider: () => normalizeProvider }); module.exports = __toCommonJS(src_exports); -var import_querystring_parser = __nccwpck_require__(39982); -var parseUrl = /* @__PURE__ */ __name((url) => { - if (typeof url === "string") { - return parseUrl(new URL(url)); - } - const { hostname, pathname, port, protocol, search } = url; - let query; - if (search) { - query = (0, import_querystring_parser.parseQueryString)(search); - } - return { - hostname, - port: port ? parseInt(port) : void 0, - protocol, - path: pathname, - query - }; -}, "parseUrl"); + +// src/getSmithyContext.ts +var import_types = __nccwpck_require__(12588); +var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); + +// src/normalizeProvider.ts +var normalizeProvider = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}, "normalizeProvider"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -78068,7 +69257,7 @@ var parseUrl = /* @__PURE__ */ __name((url) => { /***/ }), -/***/ 47809: +/***/ 40566: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -78093,213 +69282,413 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - FetchHttpHandler: () => FetchHttpHandler, - keepAliveSupport: () => keepAliveSupport, - streamCollector: () => streamCollector + DEFAULT_MAX_RETRIES: () => DEFAULT_MAX_RETRIES, + DEFAULT_TIMEOUT: () => DEFAULT_TIMEOUT, + ENV_CMDS_AUTH_TOKEN: () => ENV_CMDS_AUTH_TOKEN, + ENV_CMDS_FULL_URI: () => ENV_CMDS_FULL_URI, + ENV_CMDS_RELATIVE_URI: () => ENV_CMDS_RELATIVE_URI, + Endpoint: () => Endpoint, + fromContainerMetadata: () => fromContainerMetadata, + fromInstanceMetadata: () => fromInstanceMetadata, + getInstanceMetadataEndpoint: () => getInstanceMetadataEndpoint, + httpRequest: () => httpRequest, + providerConfigFromInit: () => providerConfigFromInit }); module.exports = __toCommonJS(src_exports); -// src/fetch-http-handler.ts -var import_protocol_http = __nccwpck_require__(72356); -var import_querystring_builder = __nccwpck_require__(18256); +// src/fromContainerMetadata.ts -// src/create-request.ts -function createRequest(url, requestOptions) { - return new Request(url, requestOptions); -} -__name(createRequest, "createRequest"); +var import_url = __nccwpck_require__(87016); -// src/request-timeout.ts -function requestTimeout(timeoutInMs = 0) { +// src/remoteProvider/httpRequest.ts +var import_property_provider = __nccwpck_require__(42382); +var import_buffer = __nccwpck_require__(20181); +var import_http = __nccwpck_require__(58611); +function httpRequest(options) { return new Promise((resolve, reject) => { - if (timeoutInMs) { - setTimeout(() => { - const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); - timeoutError.name = "TimeoutError"; - reject(timeoutError); - }, timeoutInMs); - } + const req = (0, import_http.request)({ + method: "GET", + ...options, + // Node.js http module doesn't accept hostname with square brackets + // Refs: https://github.com/nodejs/node/issues/39738 + hostname: options.hostname?.replace(/^\[(.+)\]$/, "$1") + }); + req.on("error", (err) => { + reject(Object.assign(new import_property_provider.ProviderError("Unable to connect to instance metadata service"), err)); + req.destroy(); + }); + req.on("timeout", () => { + reject(new import_property_provider.ProviderError("TimeoutError from instance metadata service")); + req.destroy(); + }); + req.on("response", (res) => { + const { statusCode = 400 } = res; + if (statusCode < 200 || 300 <= statusCode) { + reject( + Object.assign(new import_property_provider.ProviderError("Error response received from instance metadata service"), { statusCode }) + ); + req.destroy(); + } + const chunks = []; + res.on("data", (chunk) => { + chunks.push(chunk); + }); + res.on("end", () => { + resolve(import_buffer.Buffer.concat(chunks)); + req.destroy(); + }); + }); + req.end(); }); } -__name(requestTimeout, "requestTimeout"); +__name(httpRequest, "httpRequest"); -// src/fetch-http-handler.ts -var keepAliveSupport = { - supported: void 0 -}; -var _FetchHttpHandler = class _FetchHttpHandler { - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; - } - return new _FetchHttpHandler(instanceOrOptions); +// src/remoteProvider/ImdsCredentials.ts +var isImdsCredentials = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.AccessKeyId === "string" && typeof arg.SecretAccessKey === "string" && typeof arg.Token === "string" && typeof arg.Expiration === "string", "isImdsCredentials"); +var fromImdsCredentials = /* @__PURE__ */ __name((creds) => ({ + accessKeyId: creds.AccessKeyId, + secretAccessKey: creds.SecretAccessKey, + sessionToken: creds.Token, + expiration: new Date(creds.Expiration), + ...creds.AccountId && { accountId: creds.AccountId } +}), "fromImdsCredentials"); + +// src/remoteProvider/RemoteProviderInit.ts +var DEFAULT_TIMEOUT = 1e3; +var DEFAULT_MAX_RETRIES = 0; +var providerConfigFromInit = /* @__PURE__ */ __name(({ + maxRetries = DEFAULT_MAX_RETRIES, + timeout = DEFAULT_TIMEOUT +}) => ({ maxRetries, timeout }), "providerConfigFromInit"); + +// src/remoteProvider/retry.ts +var retry = /* @__PURE__ */ __name((toRetry, maxRetries) => { + let promise = toRetry(); + for (let i = 0; i < maxRetries; i++) { + promise = promise.catch(toRetry); } - constructor(options) { - if (typeof options === "function") { - this.configProvider = options().then((opts) => opts || {}); - } else { - this.config = options ?? {}; - this.configProvider = Promise.resolve(this.config); - } - if (keepAliveSupport.supported === void 0) { - keepAliveSupport.supported = Boolean( - typeof Request !== "undefined" && "keepalive" in createRequest("https://[::1]") - ); + return promise; +}, "retry"); + +// src/fromContainerMetadata.ts +var ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; +var ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; +var ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; +var fromContainerMetadata = /* @__PURE__ */ __name((init = {}) => { + const { timeout, maxRetries } = providerConfigFromInit(init); + return () => retry(async () => { + const requestOptions = await getCmdsUri({ logger: init.logger }); + const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); + if (!isImdsCredentials(credsResponse)) { + throw new import_property_provider.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger + }); } + return fromImdsCredentials(credsResponse); + }, maxRetries); +}, "fromContainerMetadata"); +var requestFromEcsImds = /* @__PURE__ */ __name(async (timeout, options) => { + if (process.env[ENV_CMDS_AUTH_TOKEN]) { + options.headers = { + ...options.headers, + Authorization: process.env[ENV_CMDS_AUTH_TOKEN] + }; } - destroy() { + const buffer = await httpRequest({ + ...options, + timeout + }); + return buffer.toString(); +}, "requestFromEcsImds"); +var CMDS_IP = "169.254.170.2"; +var GREENGRASS_HOSTS = { + localhost: true, + "127.0.0.1": true +}; +var GREENGRASS_PROTOCOLS = { + "http:": true, + "https:": true +}; +var getCmdsUri = /* @__PURE__ */ __name(async ({ logger }) => { + if (process.env[ENV_CMDS_RELATIVE_URI]) { + return { + hostname: CMDS_IP, + path: process.env[ENV_CMDS_RELATIVE_URI] + }; } - async handle(request, { abortSignal } = {}) { - var _a; - if (!this.config) { - this.config = await this.configProvider; - } - const requestTimeoutInMs = this.config.requestTimeout; - const keepAlive = this.config.keepAlive === true; - const credentials = this.config.credentials; - if (abortSignal == null ? void 0 : abortSignal.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - return Promise.reject(abortError); - } - let path = request.path; - const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; + if (process.env[ENV_CMDS_FULL_URI]) { + const parsed = (0, import_url.parse)(process.env[ENV_CMDS_FULL_URI]); + if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { + throw new import_property_provider.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { + tryNextLink: false, + logger + }); } - let auth = ""; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}@`; + if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { + throw new import_property_provider.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { + tryNextLink: false, + logger + }); } - const { port, method } = request; - const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; - const body = method === "GET" || method === "HEAD" ? void 0 : request.body; - const requestOptions = { - body, - headers: new Headers(request.headers), - method, - credentials + return { + ...parsed, + port: parsed.port ? parseInt(parsed.port, 10) : void 0 }; - if ((_a = this.config) == null ? void 0 : _a.cache) { - requestOptions.cache = this.config.cache; - } - if (body) { - requestOptions.duplex = "half"; - } - if (typeof AbortController !== "undefined") { - requestOptions.signal = abortSignal; + } + throw new import_property_provider.CredentialsProviderError( + `The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, + { + tryNextLink: false, + logger } - if (keepAliveSupport.supported) { - requestOptions.keepalive = keepAlive; + ); +}, "getCmdsUri"); + +// src/fromInstanceMetadata.ts + + + +// src/error/InstanceMetadataV1FallbackError.ts + +var InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError extends import_property_provider.CredentialsProviderError { + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + this.name = "InstanceMetadataV1FallbackError"; + Object.setPrototypeOf(this, _InstanceMetadataV1FallbackError.prototype); + } + static { + __name(this, "InstanceMetadataV1FallbackError"); + } +}; + +// src/utils/getInstanceMetadataEndpoint.ts +var import_node_config_provider = __nccwpck_require__(85744); +var import_url_parser = __nccwpck_require__(38118); + +// src/config/Endpoint.ts +var Endpoint = /* @__PURE__ */ ((Endpoint2) => { + Endpoint2["IPv4"] = "http://169.254.169.254"; + Endpoint2["IPv6"] = "http://[fd00:ec2::254]"; + return Endpoint2; +})(Endpoint || {}); + +// src/config/EndpointConfigOptions.ts +var ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; +var CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; +var ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_NAME], + default: void 0 +}; + +// src/config/EndpointMode.ts +var EndpointMode = /* @__PURE__ */ ((EndpointMode2) => { + EndpointMode2["IPv4"] = "IPv4"; + EndpointMode2["IPv6"] = "IPv6"; + return EndpointMode2; +})(EndpointMode || {}); + +// src/config/EndpointModeConfigOptions.ts +var ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; +var CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; +var ENDPOINT_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_MODE_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_MODE_NAME], + default: "IPv4" /* IPv4 */ +}; + +// src/utils/getInstanceMetadataEndpoint.ts +var getInstanceMetadataEndpoint = /* @__PURE__ */ __name(async () => (0, import_url_parser.parseUrl)(await getFromEndpointConfig() || await getFromEndpointModeConfig()), "getInstanceMetadataEndpoint"); +var getFromEndpointConfig = /* @__PURE__ */ __name(async () => (0, import_node_config_provider.loadConfig)(ENDPOINT_CONFIG_OPTIONS)(), "getFromEndpointConfig"); +var getFromEndpointModeConfig = /* @__PURE__ */ __name(async () => { + const endpointMode = await (0, import_node_config_provider.loadConfig)(ENDPOINT_MODE_CONFIG_OPTIONS)(); + switch (endpointMode) { + case "IPv4" /* IPv4 */: + return "http://169.254.169.254" /* IPv4 */; + case "IPv6" /* IPv6 */: + return "http://[fd00:ec2::254]" /* IPv6 */; + default: + throw new Error(`Unsupported endpoint mode: ${endpointMode}. Select from ${Object.values(EndpointMode)}`); + } +}, "getFromEndpointModeConfig"); + +// src/utils/getExtendedInstanceMetadataCredentials.ts +var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; +var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; +var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; +var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger) => { + const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); + const newExpiration = new Date(Date.now() + refreshInterval * 1e3); + logger.warn( + `Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}. +For more information, please visit: ` + STATIC_STABILITY_DOC_URL + ); + const originalExpiration = credentials.originalExpiration ?? credentials.expiration; + return { + ...credentials, + ...originalExpiration ? { originalExpiration } : {}, + expiration: newExpiration + }; +}, "getExtendedInstanceMetadataCredentials"); + +// src/utils/staticStabilityProvider.ts +var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => { + const logger = options?.logger || console; + let pastCredentials; + return async () => { + let credentials; + try { + credentials = await provider(); + if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { + credentials = getExtendedInstanceMetadataCredentials(credentials, logger); + } + } catch (e) { + if (pastCredentials) { + logger.warn("Credential renew failed: ", e); + credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); + } else { + throw e; + } } - if (typeof this.config.requestInit === "function") { - Object.assign(requestOptions, this.config.requestInit(request)); + pastCredentials = credentials; + return credentials; + }; +}, "staticStabilityProvider"); + +// src/fromInstanceMetadata.ts +var IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; +var IMDS_TOKEN_PATH = "/latest/api/token"; +var AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; +var PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; +var X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; +var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata"); +var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => { + let disableFetchToken = false; + const { logger, profile } = init; + const { timeout, maxRetries } = providerConfigFromInit(init); + const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => { + const isImdsV1Fallback = disableFetchToken || options.headers?.[X_AWS_EC2_METADATA_TOKEN] == null; + if (isImdsV1Fallback) { + let fallbackBlockedFromProfile = false; + let fallbackBlockedFromProcessEnv = false; + const configValue = await (0, import_node_config_provider.loadConfig)( + { + environmentVariableSelector: (env) => { + const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; + if (envValue === void 0) { + throw new import_property_provider.CredentialsProviderError( + `${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, + { logger: init.logger } + ); + } + return fallbackBlockedFromProcessEnv; + }, + configFileSelector: (profile2) => { + const profileValue = profile2[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; + return fallbackBlockedFromProfile; + }, + default: false + }, + { + profile + } + )(); + if (init.ec2MetadataV1Disabled || configValue) { + const causes = []; + if (init.ec2MetadataV1Disabled) + causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); + if (fallbackBlockedFromProfile) + causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); + if (fallbackBlockedFromProcessEnv) + causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); + throw new InstanceMetadataV1FallbackError( + `AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join( + ", " + )}].` + ); + } } - let removeSignalEventListener = /* @__PURE__ */ __name(() => { - }, "removeSignalEventListener"); - const fetchRequest = createRequest(url, requestOptions); - const raceOfPromises = [ - fetch(fetchRequest).then((response) => { - const fetchHeaders = response.headers; - const transformedHeaders = {}; - for (const pair of fetchHeaders.entries()) { - transformedHeaders[pair[0]] = pair[1]; + const imdsProfile = (await retry(async () => { + let profile2; + try { + profile2 = await getProfile(options); + } catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return profile2; + }, maxRetries2)).trim(); + return retry(async () => { + let creds; + try { + creds = await getCredentialsFromProfile(imdsProfile, options, init); + } catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; } - const hasReadableStream = response.body != void 0; - if (!hasReadableStream) { - return response.blob().then((body2) => ({ - response: new import_protocol_http.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: body2 - }) - })); + throw err; + } + return creds; + }, maxRetries2); + }, "getCredentials"); + return async () => { + const endpoint = await getInstanceMetadataEndpoint(); + if (disableFetchToken) { + logger?.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); + return getCredentials(maxRetries, { ...endpoint, timeout }); + } else { + let token; + try { + token = (await getMetadataToken({ ...endpoint, timeout })).toString(); + } catch (error) { + if (error?.statusCode === 400) { + throw Object.assign(error, { + message: "EC2 Metadata token request returned error" + }); + } else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { + disableFetchToken = true; } - return { - response: new import_protocol_http.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: response.body - }) - }; - }), - requestTimeout(requestTimeoutInMs) - ]; - if (abortSignal) { - raceOfPromises.push( - new Promise((resolve, reject) => { - const onAbort = /* @__PURE__ */ __name(() => { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); - } else { - abortSignal.onabort = onAbort; - } - }) - ); + logger?.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); + return getCredentials(maxRetries, { ...endpoint, timeout }); + } + return getCredentials(maxRetries, { + ...endpoint, + headers: { + [X_AWS_EC2_METADATA_TOKEN]: token + }, + timeout + }); } - return Promise.race(raceOfPromises).finally(removeSignalEventListener); + }; +}, "getInstanceMetadataProvider"); +var getMetadataToken = /* @__PURE__ */ __name(async (options) => httpRequest({ + ...options, + path: IMDS_TOKEN_PATH, + method: "PUT", + headers: { + "x-aws-ec2-metadata-token-ttl-seconds": "21600" } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - config[key] = value; - return config; +}), "getMetadataToken"); +var getProfile = /* @__PURE__ */ __name(async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(), "getProfile"); +var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, init) => { + const credentialsResponse = JSON.parse( + (await httpRequest({ + ...options, + path: IMDS_PATH + profile + })).toString() + ); + if (!isImdsCredentials(credentialsResponse)) { + throw new import_property_provider.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger }); } - httpHandlerConfigs() { - return this.config ?? {}; - } -}; -__name(_FetchHttpHandler, "FetchHttpHandler"); -var FetchHttpHandler = _FetchHttpHandler; - -// src/stream-collector.ts -var streamCollector = /* @__PURE__ */ __name(async (stream) => { - var _a; - if (typeof Blob === "function" && stream instanceof Blob || ((_a = stream.constructor) == null ? void 0 : _a.name) === "Blob") { - return new Uint8Array(await stream.arrayBuffer()); - } - return collectStream(stream); -}, "streamCollector"); -async function collectStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; - } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; - } - return collected; -} -__name(collectStream, "collectStream"); + return fromImdsCredentials(credentialsResponse); +}, "getCredentialsFromProfile"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -78308,7 +69697,7 @@ __name(collectStream, "collectStream"); /***/ }), -/***/ 5092: +/***/ 85744: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -78333,133 +69722,87 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - Hash: () => Hash + loadConfig: () => loadConfig }); module.exports = __toCommonJS(src_exports); -var import_util_buffer_from = __nccwpck_require__(34677); -var import_util_utf8 = __nccwpck_require__(82155); -var import_buffer = __nccwpck_require__(20181); -var import_crypto = __nccwpck_require__(76982); -var Hash = class { - static { - __name(this, "Hash"); - } - constructor(algorithmIdentifier, secret) { - this.algorithmIdentifier = algorithmIdentifier; - this.secret = secret; - this.reset(); - } - update(toHash, encoding) { - this.hash.update((0, import_util_utf8.toUint8Array)(castSourceData(toHash, encoding))); - } - digest() { - return Promise.resolve(this.hash.digest()); - } - reset() { - this.hash = this.secret ? (0, import_crypto.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) : (0, import_crypto.createHash)(this.algorithmIdentifier); - } -}; -function castSourceData(toCast, encoding) { - if (import_buffer.Buffer.isBuffer(toCast)) { - return toCast; - } - if (typeof toCast === "string") { - return (0, import_util_buffer_from.fromString)(toCast, encoding); - } - if (ArrayBuffer.isView(toCast)) { - return (0, import_util_buffer_from.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); - } - return (0, import_util_buffer_from.fromArrayBuffer)(toCast); -} -__name(castSourceData, "castSourceData"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - +// src/configLoader.ts -/***/ }), -/***/ 68628: -/***/ ((module) => { +// src/fromEnv.ts +var import_property_provider = __nccwpck_require__(42382); -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +// src/getSelectorName.ts +function getSelectorName(functionString) { + try { + const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); + constants.delete("CONFIG"); + constants.delete("CONFIG_PREFIX_SEPARATOR"); + constants.delete("ENV"); + return [...constants].join(", "); + } catch (e) { + return functionString; } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - isArrayBuffer: () => isArrayBuffer -}); -module.exports = __toCommonJS(src_exports); -var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); +} +__name(getSelectorName, "getSelectorName"); +// src/fromEnv.ts +var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { + try { + const config = envVarSelector(process.env, options); + if (config === void 0) { + throw new Error(); + } + return config; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, + { logger: options?.logger } + ); + } +}, "fromEnv"); +// src/fromSharedConfigFiles.ts -/***/ }), +var import_shared_ini_file_loader = __nccwpck_require__(38924); +var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, import_shared_ini_file_loader.getProfileName)(init); + const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; + try { + const cfgFile = preferredFile === "config" ? configFile : credentialsFile; + const configValue = configSelector(mergedProfile, cfgFile); + if (configValue === void 0) { + throw new Error(); + } + return configValue; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, + { logger: init.logger } + ); + } +}, "fromSharedConfigFiles"); -/***/ 34677: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +// src/fromStatic.ts -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); +var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); -// src/index.ts -var src_exports = {}; -__export(src_exports, { - fromArrayBuffer: () => fromArrayBuffer, - fromString: () => fromString -}); -module.exports = __toCommonJS(src_exports); -var import_is_array_buffer = __nccwpck_require__(68628); -var import_buffer = __nccwpck_require__(20181); -var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { - if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { - throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); - } - return import_buffer.Buffer.from(input, offset, length); -}, "fromArrayBuffer"); -var fromString = /* @__PURE__ */ __name((input, encoding) => { - if (typeof input !== "string") { - throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); - } - return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); -}, "fromString"); +// src/configLoader.ts +var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { + const { signingName, logger } = configuration; + const envOptions = { signingName, logger }; + return (0, import_property_provider.memoize)( + (0, import_property_provider.chain)( + fromEnv(environmentVariableSelector, envOptions), + fromSharedConfigFiles(configFileSelector, configuration), + fromStatic(defaultValue) + ) + ); +}, "loadConfig"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -78468,8 +69811,8 @@ var fromString = /* @__PURE__ */ __name((input, encoding) => { /***/ }), -/***/ 82155: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 42382: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -78493,78 +69836,143 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - fromUtf8: () => fromUtf8, - toUint8Array: () => toUint8Array, - toUtf8: () => toUtf8 + CredentialsProviderError: () => CredentialsProviderError, + ProviderError: () => ProviderError, + TokenProviderError: () => TokenProviderError, + chain: () => chain, + fromStatic: () => fromStatic, + memoize: () => memoize }); module.exports = __toCommonJS(src_exports); -// src/fromUtf8.ts -var import_util_buffer_from = __nccwpck_require__(34677); -var fromUtf8 = /* @__PURE__ */ __name((input) => { - const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); - return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); -}, "fromUtf8"); - -// src/toUint8Array.ts -var toUint8Array = /* @__PURE__ */ __name((data) => { - if (typeof data === "string") { - return fromUtf8(data); +// src/ProviderError.ts +var ProviderError = class _ProviderError extends Error { + constructor(message, options = true) { + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = void 0; + tryNextLink = options; + } else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; + } + super(message); + this.name = "ProviderError"; + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, _ProviderError.prototype); + logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); } - if (ArrayBuffer.isView(data)) { - return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); + static { + __name(this, "ProviderError"); } - return new Uint8Array(data); -}, "toUint8Array"); - -// src/toUtf8.ts + /** + * @deprecated use new operator. + */ + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); + } +}; -var toUtf8 = /* @__PURE__ */ __name((input) => { - if (typeof input === "string") { - return input; +// src/CredentialsProviderError.ts +var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, _CredentialsProviderError.prototype); } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); + static { + __name(this, "CredentialsProviderError"); } - return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); -}, "toUtf8"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - +}; +// src/TokenProviderError.ts +var TokenProviderError = class _TokenProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, _TokenProviderError.prototype); + } + static { + __name(this, "TokenProviderError"); + } +}; -/***/ }), +// src/chain.ts +var chain = /* @__PURE__ */ __name((...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } catch (err) { + lastProviderError = err; + if (err?.tryNextLink) { + continue; + } + throw err; + } + } + throw lastProviderError; +}, "chain"); -/***/ 86130: -/***/ ((module) => { +// src/fromStatic.ts +var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +// src/memoize.ts +var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async () => { + if (!pending) { + pending = provider(); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + return resolved; + }; } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - isArrayBuffer: () => isArrayBuffer -}); -module.exports = __toCommonJS(src_exports); -var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; +}, "memoize"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -78573,8 +69981,8 @@ var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "func /***/ }), -/***/ 47212: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 39982: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -78598,47 +70006,31 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - contentLengthMiddleware: () => contentLengthMiddleware, - contentLengthMiddlewareOptions: () => contentLengthMiddlewareOptions, - getContentLengthPlugin: () => getContentLengthPlugin + parseQueryString: () => parseQueryString }); module.exports = __toCommonJS(src_exports); -var import_protocol_http = __nccwpck_require__(86382); -var CONTENT_LENGTH_HEADER = "content-length"; -function contentLengthMiddleware(bodyLengthChecker) { - return (next) => async (args) => { - const request = args.request; - if (import_protocol_http.HttpRequest.isInstance(request)) { - const { body, headers } = request; - if (body && Object.keys(headers).map((str) => str.toLowerCase()).indexOf(CONTENT_LENGTH_HEADER) === -1) { - try { - const length = bodyLengthChecker(body); - request.headers = { - ...request.headers, - [CONTENT_LENGTH_HEADER]: String(length) - }; - } catch (error) { - } +function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } else if (Array.isArray(query[key])) { + query[key].push(value); + } else { + query[key] = [query[key], value]; } } - return next({ - ...args, - request - }); - }; -} -__name(contentLengthMiddleware, "contentLengthMiddleware"); -var contentLengthMiddlewareOptions = { - step: "build", - tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], - name: "contentLengthMiddleware", - override: true -}; -var getContentLengthPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: (clientStack) => { - clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions); } -}), "getContentLengthPlugin"); + return query; +} +__name(parseQueryString, "parseQueryString"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -78647,7 +70039,81 @@ var getContentLengthPlugin = /* @__PURE__ */ __name((options) => ({ /***/ }), -/***/ 86382: +/***/ 48660: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHomeDir = void 0; +const os_1 = __nccwpck_require__(70857); +const path_1 = __nccwpck_require__(16928); +const homeDirCache = {}; +const getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; + } + return "DEFAULT"; +}; +const getHomeDir = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; +}; +exports.getHomeDir = getHomeDir; + + +/***/ }), + +/***/ 17669: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFilepath = void 0; +const crypto_1 = __nccwpck_require__(76982); +const path_1 = __nccwpck_require__(16928); +const getHomeDir_1 = __nccwpck_require__(48660); +const getSSOTokenFilepath = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); +}; +exports.getSSOTokenFilepath = getSSOTokenFilepath; + + +/***/ }), + +/***/ 88262: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFromFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const getSSOTokenFilepath_1 = __nccwpck_require__(17669); +const { readFile } = fs_1.promises; +const getSSOTokenFromFile = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); +}; +exports.getSSOTokenFromFile = getSSOTokenFromFile; + + +/***/ }), + +/***/ 38924: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -78667,239 +70133,180 @@ var __copyProps = (to, from, except, desc) => { } return to; }; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - Field: () => Field, - Fields: () => Fields, - HttpRequest: () => HttpRequest, - HttpResponse: () => HttpResponse, - IHttpRequest: () => import_types.HttpRequest, - getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, - isValidHostname: () => isValidHostname, - resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig + CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, + DEFAULT_PROFILE: () => DEFAULT_PROFILE, + ENV_PROFILE: () => ENV_PROFILE, + getProfileName: () => getProfileName, + loadSharedConfigFiles: () => loadSharedConfigFiles, + loadSsoSessionData: () => loadSsoSessionData, + parseKnownFiles: () => parseKnownFiles }); module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(48660), module.exports); -// src/extensions/httpExtensionConfiguration.ts -var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - setHttpHandler(handler) { - runtimeConfig.httpHandler = handler; - }, - httpHandler() { - return runtimeConfig.httpHandler; - }, - updateHttpClientConfig(key, value) { - runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); - }, - httpHandlerConfigs() { - return runtimeConfig.httpHandler.httpHandlerConfigs(); - } - }; -}, "getHttpHandlerExtensionConfiguration"); -var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { - return { - httpHandler: httpHandlerExtensionConfiguration.httpHandler() - }; -}, "resolveHttpHandlerRuntimeConfig"); +// src/getProfileName.ts +var ENV_PROFILE = "AWS_PROFILE"; +var DEFAULT_PROFILE = "default"; +var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); -// src/Field.ts -var import_types = __nccwpck_require__(12276); -var Field = class { - static { - __name(this, "Field"); - } - constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - /** - * Appends a value to the field. - * - * @param value The value to append. - */ - add(value) { - this.values.push(value); - } - /** - * Overwrite existing field values. - * - * @param values The new field values. - */ - set(values) { - this.values = values; - } - /** - * Remove all matching entries from list. - * - * @param value Value to remove. - */ - remove(value) { - this.values = this.values.filter((v) => v !== value); - } - /** - * Get comma-delimited string. - * - * @returns String representation of {@link Field}. - */ - toString() { - return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); - } - /** - * Get string values as a list - * - * @returns Values in {@link Field} as a list. - */ - get() { - return this.values; - } -}; +// src/index.ts +__reExport(src_exports, __nccwpck_require__(17669), module.exports); +__reExport(src_exports, __nccwpck_require__(88262), module.exports); -// src/Fields.ts -var Fields = class { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - static { - __name(this, "Fields"); - } - /** - * Set entry for a {@link Field} name. The `name` - * attribute will be used to key the collection. - * - * @param field The {@link Field} to set. - */ - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - /** - * Retrieve {@link Field} entry by name. - * - * @param name The name of the {@link Field} entry - * to retrieve - * @returns The {@link Field} if it exists. - */ - getField(name) { - return this.entries[name.toLowerCase()]; - } - /** - * Delete entry from collection. - * - * @param name Name of the entry to delete. - */ - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - /** - * Helper function for retrieving specific types of fields. - * Used to grab all headers or all trailers. - * - * @param kind {@link FieldPosition} of entries to retrieve. - * @returns The {@link Field} entries with the specified - * {@link FieldPosition}. - */ - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } -}; +// src/loadSharedConfigFiles.ts -// src/httpRequest.ts -var HttpRequest = class _HttpRequest { - static { - __name(this, "HttpRequest"); - } - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; - this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; +// src/getConfigData.ts +var import_types = __nccwpck_require__(31242); +var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { + return false; } - /** - * Note: this does not deep-clone the body. - */ - static clone(request) { - const cloned = new _HttpRequest({ - ...request, - headers: { ...request.headers } - }); - if (cloned.query) { - cloned.query = cloneQuery(cloned.query); - } - return cloned; + return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); +}).reduce( + (acc, [key, value]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + acc[updatedKey] = value; + return acc; + }, + { + // Populate default profile, if present. + ...data.default && { default: data.default } } - /** - * This method only actually asserts that request is the interface {@link IHttpRequest}, - * and not necessarily this concrete class. Left in place for API stability. - * - * Do not call instance methods on the input of this function, and - * do not assume it has the HttpRequest prototype. - */ - static isInstance(request) { - if (!request) { - return false; +), "getConfigData"); + +// src/getConfigFilepath.ts +var import_path = __nccwpck_require__(16928); +var import_getHomeDir = __nccwpck_require__(48660); +var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); + +// src/getCredentialsFilepath.ts + +var import_getHomeDir2 = __nccwpck_require__(48660); +var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); + +// src/loadSharedConfigFiles.ts +var import_getHomeDir3 = __nccwpck_require__(48660); + +// src/parseIni.ts + +var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; +var profileNameBlockList = ["__proto__", "profile __proto__"]; +var parseIni = /* @__PURE__ */ __name((iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = void 0; + currentSubSection = void 0; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(import_types.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); + } + } else { + currentSection = sectionName; + } + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } + } else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim() + ]; + if (value === "") { + currentSubSection = name; + } else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = void 0; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; + } + } } - const req = request; - return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; - } - /** - * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call - * this method because {@link HttpRequest.isInstance} incorrectly - * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). - */ - clone() { - return _HttpRequest.clone(this); } -}; -function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param - }; - }, {}); -} -__name(cloneQuery, "cloneQuery"); + return map; +}, "parseIni"); -// src/httpResponse.ts -var HttpResponse = class { - static { - __name(this, "HttpResponse"); +// src/loadSharedConfigFiles.ts +var import_slurpFile = __nccwpck_require__(91550); +var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var CONFIG_PREFIX_SEPARATOR = "."; +var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const homeDir = (0, import_getHomeDir3.getHomeDir)(); + const relativeHomeDirPrefix = "~/"; + let resolvedFilepath = filepath; + if (filepath.startsWith(relativeHomeDirPrefix)) { + resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); } - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; + let resolvedConfigFilepath = configFilepath; + if (configFilepath.startsWith(relativeHomeDirPrefix)) { + resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + const parsedFiles = await Promise.all([ + (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).then(getConfigData).catch(swallowError), + (0, import_slurpFile.slurpFile)(resolvedFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).catch(swallowError) + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1] + }; +}, "loadSharedConfigFiles"); + +// src/getSsoSessionData.ts + +var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); + +// src/loadSsoSessionData.ts +var import_slurpFile2 = __nccwpck_require__(91550); +var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); + +// src/mergeConfigFiles.ts +var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== void 0) { + Object.assign(merged[key], values); + } else { + merged[key] = values; + } + } } -}; + return merged; +}, "mergeConfigFiles"); -// src/isValidHostname.ts -function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); -} -__name(isValidHostname, "isValidHostname"); +// src/parseKnownFiles.ts +var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); +}, "parseKnownFiles"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -78908,7 +70315,28 @@ __name(isValidHostname, "isValidHostname"); /***/ }), -/***/ 12276: +/***/ 91550: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.slurpFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const { readFile } = fs_1.promises; +const filePromisesHash = {}; +const slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); + } + return filePromisesHash[path]; +}; +exports.slurpFile = slurpFile; + + +/***/ }), + +/***/ 31242: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -79048,7 +70476,7 @@ var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { /***/ }), -/***/ 19618: +/***/ 38118: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -79073,386 +70501,267 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, - CONFIG_MAX_ATTEMPTS: () => CONFIG_MAX_ATTEMPTS, - CONFIG_RETRY_MODE: () => CONFIG_RETRY_MODE, - ENV_MAX_ATTEMPTS: () => ENV_MAX_ATTEMPTS, - ENV_RETRY_MODE: () => ENV_RETRY_MODE, - NODE_MAX_ATTEMPT_CONFIG_OPTIONS: () => NODE_MAX_ATTEMPT_CONFIG_OPTIONS, - NODE_RETRY_MODE_CONFIG_OPTIONS: () => NODE_RETRY_MODE_CONFIG_OPTIONS, - StandardRetryStrategy: () => StandardRetryStrategy, - defaultDelayDecider: () => defaultDelayDecider, - defaultRetryDecider: () => defaultRetryDecider, - getOmitRetryHeadersPlugin: () => getOmitRetryHeadersPlugin, - getRetryAfterHint: () => getRetryAfterHint, - getRetryPlugin: () => getRetryPlugin, - omitRetryHeadersMiddleware: () => omitRetryHeadersMiddleware, - omitRetryHeadersMiddlewareOptions: () => omitRetryHeadersMiddlewareOptions, - resolveRetryConfig: () => resolveRetryConfig, - retryMiddleware: () => retryMiddleware, - retryMiddlewareOptions: () => retryMiddlewareOptions + parseUrl: () => parseUrl }); module.exports = __toCommonJS(src_exports); +var import_querystring_parser = __nccwpck_require__(39982); +var parseUrl = /* @__PURE__ */ __name((url) => { + if (typeof url === "string") { + return parseUrl(new URL(url)); + } + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = (0, import_querystring_parser.parseQueryString)(search); + } + return { + hostname, + port: port ? parseInt(port) : void 0, + protocol, + path: pathname, + query + }; +}, "parseUrl"); +// Annotate the CommonJS export names for ESM import in node: -// src/AdaptiveRetryStrategy.ts +0 && (0); -// src/StandardRetryStrategy.ts -var import_protocol_http = __nccwpck_require__(64864); +/***/ }), -var import_uuid = __nccwpck_require__(12048); +/***/ 47809: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -// src/defaultRetryQuota.ts -var import_util_retry = __nccwpck_require__(15518); -var getDefaultRetryQuota = /* @__PURE__ */ __name((initialRetryTokens, options) => { - const MAX_CAPACITY = initialRetryTokens; - const noRetryIncrement = options?.noRetryIncrement ?? import_util_retry.NO_RETRY_INCREMENT; - const retryCost = options?.retryCost ?? import_util_retry.RETRY_COST; - const timeoutRetryCost = options?.timeoutRetryCost ?? import_util_retry.TIMEOUT_RETRY_COST; - let availableCapacity = initialRetryTokens; - const getCapacityAmount = /* @__PURE__ */ __name((error) => error.name === "TimeoutError" ? timeoutRetryCost : retryCost, "getCapacityAmount"); - const hasRetryTokens = /* @__PURE__ */ __name((error) => getCapacityAmount(error) <= availableCapacity, "hasRetryTokens"); - const retrieveRetryTokens = /* @__PURE__ */ __name((error) => { - if (!hasRetryTokens(error)) { - throw new Error("No retry token available"); - } - const capacityAmount = getCapacityAmount(error); - availableCapacity -= capacityAmount; - return capacityAmount; - }, "retrieveRetryTokens"); - const releaseRetryTokens = /* @__PURE__ */ __name((capacityReleaseAmount) => { - availableCapacity += capacityReleaseAmount ?? noRetryIncrement; - availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); - }, "releaseRetryTokens"); - return Object.freeze({ - hasRetryTokens, - retrieveRetryTokens, - releaseRetryTokens - }); -}, "getDefaultRetryQuota"); +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/delayDecider.ts +// src/index.ts +var src_exports = {}; +__export(src_exports, { + FetchHttpHandler: () => FetchHttpHandler, + keepAliveSupport: () => keepAliveSupport, + streamCollector: () => streamCollector +}); +module.exports = __toCommonJS(src_exports); -var defaultDelayDecider = /* @__PURE__ */ __name((delayBase, attempts) => Math.floor(Math.min(import_util_retry.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)), "defaultDelayDecider"); +// src/fetch-http-handler.ts +var import_protocol_http = __nccwpck_require__(72356); +var import_querystring_builder = __nccwpck_require__(18256); -// src/retryDecider.ts -var import_service_error_classification = __nccwpck_require__(42058); -var defaultRetryDecider = /* @__PURE__ */ __name((error) => { - if (!error) { - return false; - } - return (0, import_service_error_classification.isRetryableByTrait)(error) || (0, import_service_error_classification.isClockSkewError)(error) || (0, import_service_error_classification.isThrottlingError)(error) || (0, import_service_error_classification.isTransientError)(error); -}, "defaultRetryDecider"); +// src/create-request.ts +function createRequest(url, requestOptions) { + return new Request(url, requestOptions); +} +__name(createRequest, "createRequest"); -// src/util.ts -var asSdkError = /* @__PURE__ */ __name((error) => { - if (error instanceof Error) - return error; - if (error instanceof Object) - return Object.assign(new Error(), error); - if (typeof error === "string") - return new Error(error); - return new Error(`AWS SDK error wrapper for ${error}`); -}, "asSdkError"); +// src/request-timeout.ts +function requestTimeout(timeoutInMs = 0) { + return new Promise((resolve, reject) => { + if (timeoutInMs) { + setTimeout(() => { + const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); + timeoutError.name = "TimeoutError"; + reject(timeoutError); + }, timeoutInMs); + } + }); +} +__name(requestTimeout, "requestTimeout"); -// src/StandardRetryStrategy.ts -var StandardRetryStrategy = class { - constructor(maxAttemptsProvider, options) { - this.maxAttemptsProvider = maxAttemptsProvider; - this.mode = import_util_retry.RETRY_MODES.STANDARD; - this.retryDecider = options?.retryDecider ?? defaultRetryDecider; - this.delayDecider = options?.delayDecider ?? defaultDelayDecider; - this.retryQuota = options?.retryQuota ?? getDefaultRetryQuota(import_util_retry.INITIAL_RETRY_TOKENS); - } - static { - __name(this, "StandardRetryStrategy"); - } - shouldRetry(error, attempts, maxAttempts) { - return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); - } - async getMaxAttempts() { - let maxAttempts; - try { - maxAttempts = await this.maxAttemptsProvider(); - } catch (error) { - maxAttempts = import_util_retry.DEFAULT_MAX_ATTEMPTS; +// src/fetch-http-handler.ts +var keepAliveSupport = { + supported: void 0 +}; +var _FetchHttpHandler = class _FetchHttpHandler { + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } - return maxAttempts; + return new _FetchHttpHandler(instanceOrOptions); } - async retry(next, args, options) { - let retryTokenAmount; - let attempts = 0; - let totalDelay = 0; - const maxAttempts = await this.getMaxAttempts(); - const { request } = args; - if (import_protocol_http.HttpRequest.isInstance(request)) { - request.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); + constructor(options) { + if (typeof options === "function") { + this.configProvider = options().then((opts) => opts || {}); + } else { + this.config = options ?? {}; + this.configProvider = Promise.resolve(this.config); } - while (true) { - try { - if (import_protocol_http.HttpRequest.isInstance(request)) { - request.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; - } - if (options?.beforeRequest) { - await options.beforeRequest(); - } - const { response, output } = await next(args); - if (options?.afterRequest) { - options.afterRequest(response); - } - this.retryQuota.releaseRetryTokens(retryTokenAmount); - output.$metadata.attempts = attempts + 1; - output.$metadata.totalRetryDelay = totalDelay; - return { response, output }; - } catch (e) { - const err = asSdkError(e); - attempts++; - if (this.shouldRetry(err, attempts, maxAttempts)) { - retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); - const delayFromDecider = this.delayDecider( - (0, import_service_error_classification.isThrottlingError)(err) ? import_util_retry.THROTTLING_RETRY_DELAY_BASE : import_util_retry.DEFAULT_RETRY_DELAY_BASE, - attempts - ); - const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); - const delay = Math.max(delayFromResponse || 0, delayFromDecider); - totalDelay += delay; - await new Promise((resolve) => setTimeout(resolve, delay)); - continue; - } - if (!err.$metadata) { - err.$metadata = {}; - } - err.$metadata.attempts = attempts; - err.$metadata.totalRetryDelay = totalDelay; - throw err; - } + if (keepAliveSupport.supported === void 0) { + keepAliveSupport.supported = Boolean( + typeof Request !== "undefined" && "keepalive" in createRequest("https://[::1]") + ); } } -}; -var getDelayFromRetryAfterHeader = /* @__PURE__ */ __name((response) => { - if (!import_protocol_http.HttpResponse.isInstance(response)) - return; - const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); - if (!retryAfterHeaderName) - return; - const retryAfter = response.headers[retryAfterHeaderName]; - const retryAfterSeconds = Number(retryAfter); - if (!Number.isNaN(retryAfterSeconds)) - return retryAfterSeconds * 1e3; - const retryAfterDate = new Date(retryAfter); - return retryAfterDate.getTime() - Date.now(); -}, "getDelayFromRetryAfterHeader"); - -// src/AdaptiveRetryStrategy.ts -var AdaptiveRetryStrategy = class extends StandardRetryStrategy { - static { - __name(this, "AdaptiveRetryStrategy"); - } - constructor(maxAttemptsProvider, options) { - const { rateLimiter, ...superOptions } = options ?? {}; - super(maxAttemptsProvider, superOptions); - this.rateLimiter = rateLimiter ?? new import_util_retry.DefaultRateLimiter(); - this.mode = import_util_retry.RETRY_MODES.ADAPTIVE; - } - async retry(next, args) { - return super.retry(next, args, { - beforeRequest: async () => { - return this.rateLimiter.getSendToken(); - }, - afterRequest: (response) => { - this.rateLimiter.updateClientSendingRate(response); - } - }); + destroy() { } -}; - -// src/configurations.ts -var import_util_middleware = __nccwpck_require__(73976); - -var ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; -var CONFIG_MAX_ATTEMPTS = "max_attempts"; -var NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => { - const value = env[ENV_MAX_ATTEMPTS]; - if (!value) - return void 0; - const maxAttempt = parseInt(value); - if (Number.isNaN(maxAttempt)) { - throw new Error(`Environment variable ${ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); + async handle(request, { abortSignal } = {}) { + var _a; + if (!this.config) { + this.config = await this.configProvider; } - return maxAttempt; - }, - configFileSelector: (profile) => { - const value = profile[CONFIG_MAX_ATTEMPTS]; - if (!value) - return void 0; - const maxAttempt = parseInt(value); - if (Number.isNaN(maxAttempt)) { - throw new Error(`Shared config file entry ${CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); + const requestTimeoutInMs = this.config.requestTimeout; + const keepAlive = this.config.keepAlive === true; + const credentials = this.config.credentials; + if (abortSignal == null ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + return Promise.reject(abortError); } - return maxAttempt; - }, - default: import_util_retry.DEFAULT_MAX_ATTEMPTS -}; -var resolveRetryConfig = /* @__PURE__ */ __name((input) => { - const { retryStrategy, retryMode: _retryMode, maxAttempts: _maxAttempts } = input; - const maxAttempts = (0, import_util_middleware.normalizeProvider)(_maxAttempts ?? import_util_retry.DEFAULT_MAX_ATTEMPTS); - return Object.assign(input, { - maxAttempts, - retryStrategy: async () => { - if (retryStrategy) { - return retryStrategy; - } - const retryMode = await (0, import_util_middleware.normalizeProvider)(_retryMode)(); - if (retryMode === import_util_retry.RETRY_MODES.ADAPTIVE) { - return new import_util_retry.AdaptiveRetryStrategy(maxAttempts); - } - return new import_util_retry.StandardRetryStrategy(maxAttempts); + let path = request.path; + const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); + if (queryString) { + path += `?${queryString}`; } - }); -}, "resolveRetryConfig"); -var ENV_RETRY_MODE = "AWS_RETRY_MODE"; -var CONFIG_RETRY_MODE = "retry_mode"; -var NODE_RETRY_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[ENV_RETRY_MODE], - configFileSelector: (profile) => profile[CONFIG_RETRY_MODE], - default: import_util_retry.DEFAULT_RETRY_MODE -}; - -// src/omitRetryHeadersMiddleware.ts - - -var omitRetryHeadersMiddleware = /* @__PURE__ */ __name(() => (next) => async (args) => { - const { request } = args; - if (import_protocol_http.HttpRequest.isInstance(request)) { - delete request.headers[import_util_retry.INVOCATION_ID_HEADER]; - delete request.headers[import_util_retry.REQUEST_HEADER]; - } - return next(args); -}, "omitRetryHeadersMiddleware"); -var omitRetryHeadersMiddlewareOptions = { - name: "omitRetryHeadersMiddleware", - tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], - relation: "before", - toMiddleware: "awsAuthMiddleware", - override: true -}; -var getOmitRetryHeadersPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo(omitRetryHeadersMiddleware(), omitRetryHeadersMiddlewareOptions); - } -}), "getOmitRetryHeadersPlugin"); - -// src/retryMiddleware.ts - - -var import_smithy_client = __nccwpck_require__(61411); - - -var import_isStreamingPayload = __nccwpck_require__(49831); -var retryMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { - let retryStrategy = await options.retryStrategy(); - const maxAttempts = await options.maxAttempts(); - if (isRetryStrategyV2(retryStrategy)) { - retryStrategy = retryStrategy; - let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); - let lastError = new Error(); - let attempts = 0; - let totalRetryDelay = 0; - const { request } = args; - const isRequest = import_protocol_http.HttpRequest.isInstance(request); - if (isRequest) { - request.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); + if (request.fragment) { + path += `#${request.fragment}`; } - while (true) { - try { - if (isRequest) { - request.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const { port, method } = request; + const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; + const body = method === "GET" || method === "HEAD" ? void 0 : request.body; + const requestOptions = { + body, + headers: new Headers(request.headers), + method, + credentials + }; + if ((_a = this.config) == null ? void 0 : _a.cache) { + requestOptions.cache = this.config.cache; + } + if (body) { + requestOptions.duplex = "half"; + } + if (typeof AbortController !== "undefined") { + requestOptions.signal = abortSignal; + } + if (keepAliveSupport.supported) { + requestOptions.keepalive = keepAlive; + } + if (typeof this.config.requestInit === "function") { + Object.assign(requestOptions, this.config.requestInit(request)); + } + let removeSignalEventListener = /* @__PURE__ */ __name(() => { + }, "removeSignalEventListener"); + const fetchRequest = createRequest(url, requestOptions); + const raceOfPromises = [ + fetch(fetchRequest).then((response) => { + const fetchHeaders = response.headers; + const transformedHeaders = {}; + for (const pair of fetchHeaders.entries()) { + transformedHeaders[pair[0]] = pair[1]; } - const { response, output } = await next(args); - retryStrategy.recordSuccess(retryToken); - output.$metadata.attempts = attempts + 1; - output.$metadata.totalRetryDelay = totalRetryDelay; - return { response, output }; - } catch (e) { - const retryErrorInfo = getRetryErrorInfo(e); - lastError = asSdkError(e); - if (isRequest && (0, import_isStreamingPayload.isStreamingPayload)(request)) { - (context.logger instanceof import_smithy_client.NoOpLogger ? console : context.logger)?.warn( - "An error was encountered in a non-retryable streaming request." - ); - throw lastError; + const hasReadableStream = response.body != void 0; + if (!hasReadableStream) { + return response.blob().then((body2) => ({ + response: new import_protocol_http.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: body2 + }) + })); } - try { - retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); - } catch (refreshError) { - if (!lastError.$metadata) { - lastError.$metadata = {}; + return { + response: new import_protocol_http.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: response.body + }) + }; + }), + requestTimeout(requestTimeoutInMs) + ]; + if (abortSignal) { + raceOfPromises.push( + new Promise((resolve, reject) => { + const onAbort = /* @__PURE__ */ __name(() => { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); + } else { + abortSignal.onabort = onAbort; } - lastError.$metadata.attempts = attempts + 1; - lastError.$metadata.totalRetryDelay = totalRetryDelay; - throw lastError; - } - attempts = retryToken.getRetryCount(); - const delay = retryToken.getRetryDelay(); - totalRetryDelay += delay; - await new Promise((resolve) => setTimeout(resolve, delay)); - } + }) + ); } - } else { - retryStrategy = retryStrategy; - if (retryStrategy?.mode) - context.userAgent = [...context.userAgent || [], ["cfg/retry-mode", retryStrategy.mode]]; - return retryStrategy.retry(next, args); + return Promise.race(raceOfPromises).finally(removeSignalEventListener); + } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + config[key] = value; + return config; + }); } -}, "retryMiddleware"); -var isRetryStrategyV2 = /* @__PURE__ */ __name((retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && typeof retryStrategy.recordSuccess !== "undefined", "isRetryStrategyV2"); -var getRetryErrorInfo = /* @__PURE__ */ __name((error) => { - const errorInfo = { - error, - errorType: getRetryErrorType(error) - }; - const retryAfterHint = getRetryAfterHint(error.$response); - if (retryAfterHint) { - errorInfo.retryAfterHint = retryAfterHint; + httpHandlerConfigs() { + return this.config ?? {}; } - return errorInfo; -}, "getRetryErrorInfo"); -var getRetryErrorType = /* @__PURE__ */ __name((error) => { - if ((0, import_service_error_classification.isThrottlingError)(error)) - return "THROTTLING"; - if ((0, import_service_error_classification.isTransientError)(error)) - return "TRANSIENT"; - if ((0, import_service_error_classification.isServerError)(error)) - return "SERVER_ERROR"; - return "CLIENT_ERROR"; -}, "getRetryErrorType"); -var retryMiddlewareOptions = { - name: "retryMiddleware", - tags: ["RETRY"], - step: "finalizeRequest", - priority: "high", - override: true }; -var getRetryPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: (clientStack) => { - clientStack.add(retryMiddleware(options), retryMiddlewareOptions); +__name(_FetchHttpHandler, "FetchHttpHandler"); +var FetchHttpHandler = _FetchHttpHandler; + +// src/stream-collector.ts +var streamCollector = /* @__PURE__ */ __name(async (stream) => { + var _a; + if (typeof Blob === "function" && stream instanceof Blob || ((_a = stream.constructor) == null ? void 0 : _a.name) === "Blob") { + return new Uint8Array(await stream.arrayBuffer()); } -}), "getRetryPlugin"); -var getRetryAfterHint = /* @__PURE__ */ __name((response) => { - if (!import_protocol_http.HttpResponse.isInstance(response)) - return; - const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); - if (!retryAfterHeaderName) - return; - const retryAfter = response.headers[retryAfterHeaderName]; - const retryAfterSeconds = Number(retryAfter); - if (!Number.isNaN(retryAfterSeconds)) - return new Date(retryAfterSeconds * 1e3); - const retryAfterDate = new Date(retryAfter); - return retryAfterDate; -}, "getRetryAfterHint"); + return collectStream(stream); +}, "streamCollector"); +async function collectStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +__name(collectStream, "collectStream"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -79461,22 +70770,7 @@ var getRetryAfterHint = /* @__PURE__ */ __name((response) => { /***/ }), -/***/ 49831: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isStreamingPayload = void 0; -const stream_1 = __nccwpck_require__(2203); -const isStreamingPayload = (request) => (request === null || request === void 0 ? void 0 : request.body) instanceof stream_1.Readable || - (typeof ReadableStream !== "undefined" && (request === null || request === void 0 ? void 0 : request.body) instanceof ReadableStream); -exports.isStreamingPayload = isStreamingPayload; - - -/***/ }), - -/***/ 64864: +/***/ 5092: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -79501,234 +70795,133 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - Field: () => Field, - Fields: () => Fields, - HttpRequest: () => HttpRequest, - HttpResponse: () => HttpResponse, - IHttpRequest: () => import_types.HttpRequest, - getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, - isValidHostname: () => isValidHostname, - resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig + Hash: () => Hash }); module.exports = __toCommonJS(src_exports); - -// src/extensions/httpExtensionConfiguration.ts -var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - setHttpHandler(handler) { - runtimeConfig.httpHandler = handler; - }, - httpHandler() { - return runtimeConfig.httpHandler; - }, - updateHttpClientConfig(key, value) { - runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); - }, - httpHandlerConfigs() { - return runtimeConfig.httpHandler.httpHandlerConfigs(); - } - }; -}, "getHttpHandlerExtensionConfiguration"); -var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { - return { - httpHandler: httpHandlerExtensionConfiguration.httpHandler() - }; -}, "resolveHttpHandlerRuntimeConfig"); - -// src/Field.ts -var import_types = __nccwpck_require__(36158); -var Field = class { +var import_util_buffer_from = __nccwpck_require__(34677); +var import_util_utf8 = __nccwpck_require__(82155); +var import_buffer = __nccwpck_require__(20181); +var import_crypto = __nccwpck_require__(76982); +var Hash = class { static { - __name(this, "Field"); - } - constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - /** - * Appends a value to the field. - * - * @param value The value to append. - */ - add(value) { - this.values.push(value); + __name(this, "Hash"); } - /** - * Overwrite existing field values. - * - * @param values The new field values. - */ - set(values) { - this.values = values; + constructor(algorithmIdentifier, secret) { + this.algorithmIdentifier = algorithmIdentifier; + this.secret = secret; + this.reset(); } - /** - * Remove all matching entries from list. - * - * @param value Value to remove. - */ - remove(value) { - this.values = this.values.filter((v) => v !== value); + update(toHash, encoding) { + this.hash.update((0, import_util_utf8.toUint8Array)(castSourceData(toHash, encoding))); } - /** - * Get comma-delimited string. - * - * @returns String representation of {@link Field}. - */ - toString() { - return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); + digest() { + return Promise.resolve(this.hash.digest()); } - /** - * Get string values as a list - * - * @returns Values in {@link Field} as a list. - */ - get() { - return this.values; + reset() { + this.hash = this.secret ? (0, import_crypto.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) : (0, import_crypto.createHash)(this.algorithmIdentifier); } }; - -// src/Fields.ts -var Fields = class { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - static { - __name(this, "Fields"); - } - /** - * Set entry for a {@link Field} name. The `name` - * attribute will be used to key the collection. - * - * @param field The {@link Field} to set. - */ - setField(field) { - this.entries[field.name.toLowerCase()] = field; +function castSourceData(toCast, encoding) { + if (import_buffer.Buffer.isBuffer(toCast)) { + return toCast; } - /** - * Retrieve {@link Field} entry by name. - * - * @param name The name of the {@link Field} entry - * to retrieve - * @returns The {@link Field} if it exists. - */ - getField(name) { - return this.entries[name.toLowerCase()]; + if (typeof toCast === "string") { + return (0, import_util_buffer_from.fromString)(toCast, encoding); } - /** - * Delete entry from collection. - * - * @param name Name of the entry to delete. - */ - removeField(name) { - delete this.entries[name.toLowerCase()]; + if (ArrayBuffer.isView(toCast)) { + return (0, import_util_buffer_from.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); } - /** - * Helper function for retrieving specific types of fields. - * Used to grab all headers or all trailers. - * - * @param kind {@link FieldPosition} of entries to retrieve. - * @returns The {@link Field} entries with the specified - * {@link FieldPosition}. - */ - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); + return (0, import_util_buffer_from.fromArrayBuffer)(toCast); +} +__name(castSourceData, "castSourceData"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 68628: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/httpRequest.ts +// src/index.ts +var src_exports = {}; +__export(src_exports, { + isArrayBuffer: () => isArrayBuffer +}); +module.exports = __toCommonJS(src_exports); +var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); +// Annotate the CommonJS export names for ESM import in node: -var HttpRequest = class _HttpRequest { - static { - __name(this, "HttpRequest"); - } - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; - this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; - } - /** - * Note: this does not deep-clone the body. - */ - static clone(request) { - const cloned = new _HttpRequest({ - ...request, - headers: { ...request.headers } - }); - if (cloned.query) { - cloned.query = cloneQuery(cloned.query); - } - return cloned; - } - /** - * This method only actually asserts that request is the interface {@link IHttpRequest}, - * and not necessarily this concrete class. Left in place for API stability. - * - * Do not call instance methods on the input of this function, and - * do not assume it has the HttpRequest prototype. - */ - static isInstance(request) { - if (!request) { - return false; - } - const req = request; - return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; - } - /** - * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call - * this method because {@link HttpRequest.isInstance} incorrectly - * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). - */ - clone() { - return _HttpRequest.clone(this); +0 && (0); + + + +/***/ }), + +/***/ 34677: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; -function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param - }; - }, {}); -} -__name(cloneQuery, "cloneQuery"); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/httpResponse.ts -var HttpResponse = class { - static { - __name(this, "HttpResponse"); - } - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromArrayBuffer: () => fromArrayBuffer, + fromString: () => fromString +}); +module.exports = __toCommonJS(src_exports); +var import_is_array_buffer = __nccwpck_require__(68628); +var import_buffer = __nccwpck_require__(20181); +var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { + if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + return import_buffer.Buffer.from(input, offset, length); +}, "fromArrayBuffer"); +var fromString = /* @__PURE__ */ __name((input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); } -}; - -// src/isValidHostname.ts -function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); -} -__name(isValidHostname, "isValidHostname"); + return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); +}, "fromString"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -79737,8 +70930,8 @@ __name(isValidHostname, "isValidHostname"); /***/ }), -/***/ 36158: -/***/ ((module) => { +/***/ 82155: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -79762,113 +70955,78 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - AlgorithmId: () => AlgorithmId, - EndpointURLScheme: () => EndpointURLScheme, - FieldPosition: () => FieldPosition, - HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, - HttpAuthLocation: () => HttpAuthLocation, - IniSectionType: () => IniSectionType, - RequestHandlerProtocol: () => RequestHandlerProtocol, - SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig + fromUtf8: () => fromUtf8, + toUint8Array: () => toUint8Array, + toUtf8: () => toUtf8 }); module.exports = __toCommonJS(src_exports); -// src/auth/auth.ts -var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { - HttpAuthLocation2["HEADER"] = "header"; - HttpAuthLocation2["QUERY"] = "query"; - return HttpAuthLocation2; -})(HttpAuthLocation || {}); +// src/fromUtf8.ts +var import_util_buffer_from = __nccwpck_require__(34677); +var fromUtf8 = /* @__PURE__ */ __name((input) => { + const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); + return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); +}, "fromUtf8"); -// src/auth/HttpApiKeyAuth.ts -var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { - HttpApiKeyAuthLocation2["HEADER"] = "header"; - HttpApiKeyAuthLocation2["QUERY"] = "query"; - return HttpApiKeyAuthLocation2; -})(HttpApiKeyAuthLocation || {}); +// src/toUint8Array.ts +var toUint8Array = /* @__PURE__ */ __name((data) => { + if (typeof data === "string") { + return fromUtf8(data); + } + if (ArrayBuffer.isView(data)) { + return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); + } + return new Uint8Array(data); +}, "toUint8Array"); -// src/endpoint.ts -var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { - EndpointURLScheme2["HTTP"] = "http"; - EndpointURLScheme2["HTTPS"] = "https"; - return EndpointURLScheme2; -})(EndpointURLScheme || {}); +// src/toUtf8.ts -// src/extensions/checksum.ts -var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { - AlgorithmId2["MD5"] = "md5"; - AlgorithmId2["CRC32"] = "crc32"; - AlgorithmId2["CRC32C"] = "crc32c"; - AlgorithmId2["SHA1"] = "sha1"; - AlgorithmId2["SHA256"] = "sha256"; - return AlgorithmId2; -})(AlgorithmId || {}); -var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const checksumAlgorithms = []; - if (runtimeConfig.sha256 !== void 0) { - checksumAlgorithms.push({ - algorithmId: () => "sha256" /* SHA256 */, - checksumConstructor: () => runtimeConfig.sha256 - }); +var toUtf8 = /* @__PURE__ */ __name((input) => { + if (typeof input === "string") { + return input; } - if (runtimeConfig.md5 != void 0) { - checksumAlgorithms.push({ - algorithmId: () => "md5" /* MD5 */, - checksumConstructor: () => runtimeConfig.md5 - }); + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); } - return { - addChecksumAlgorithm(algo) { - checksumAlgorithms.push(algo); - }, - checksumAlgorithms() { - return checksumAlgorithms; - } - }; -}, "getChecksumConfiguration"); -var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { - const runtimeConfig = {}; - clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { - runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); - }); - return runtimeConfig; -}, "resolveChecksumRuntimeConfig"); - -// src/extensions/defaultClientConfiguration.ts -var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return getChecksumConfiguration(runtimeConfig); -}, "getDefaultClientConfiguration"); -var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return resolveChecksumRuntimeConfig(config); -}, "resolveDefaultRuntimeConfig"); + return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); +}, "toUtf8"); +// Annotate the CommonJS export names for ESM import in node: -// src/http.ts -var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { - FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; - FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; - return FieldPosition2; -})(FieldPosition || {}); +0 && (0); -// src/middleware.ts -var SMITHY_CONTEXT_KEY = "__smithy_context"; -// src/profile.ts -var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { - IniSectionType2["PROFILE"] = "profile"; - IniSectionType2["SSO_SESSION"] = "sso-session"; - IniSectionType2["SERVICES"] = "services"; - return IniSectionType2; -})(IniSectionType || {}); -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); +/***/ }), + +/***/ 86130: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + isArrayBuffer: () => isArrayBuffer +}); +module.exports = __toCommonJS(src_exports); +var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -79877,7 +71035,7 @@ var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { /***/ }), -/***/ 73976: +/***/ 47212: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -79902,22 +71060,47 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - getSmithyContext: () => getSmithyContext, - normalizeProvider: () => normalizeProvider + contentLengthMiddleware: () => contentLengthMiddleware, + contentLengthMiddlewareOptions: () => contentLengthMiddlewareOptions, + getContentLengthPlugin: () => getContentLengthPlugin }); module.exports = __toCommonJS(src_exports); - -// src/getSmithyContext.ts -var import_types = __nccwpck_require__(36158); -var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - -// src/normalizeProvider.ts -var normalizeProvider = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; -}, "normalizeProvider"); +var import_protocol_http = __nccwpck_require__(86382); +var CONTENT_LENGTH_HEADER = "content-length"; +function contentLengthMiddleware(bodyLengthChecker) { + return (next) => async (args) => { + const request = args.request; + if (import_protocol_http.HttpRequest.isInstance(request)) { + const { body, headers } = request; + if (body && Object.keys(headers).map((str) => str.toLowerCase()).indexOf(CONTENT_LENGTH_HEADER) === -1) { + try { + const length = bodyLengthChecker(body); + request.headers = { + ...request.headers, + [CONTENT_LENGTH_HEADER]: String(length) + }; + } catch (error) { + } + } + } + return next({ + ...args, + request + }); + }; +} +__name(contentLengthMiddleware, "contentLengthMiddleware"); +var contentLengthMiddlewareOptions = { + step: "build", + tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], + name: "contentLengthMiddleware", + override: true +}; +var getContentLengthPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions); + } +}), "getContentLengthPlugin"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -79926,8 +71109,8 @@ var normalizeProvider = /* @__PURE__ */ __name((input) => { /***/ }), -/***/ 9208: -/***/ ((module) => { +/***/ 86382: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -79951,299 +71134,234 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - constructStack: () => constructStack + Field: () => Field, + Fields: () => Fields, + HttpRequest: () => HttpRequest, + HttpResponse: () => HttpResponse, + IHttpRequest: () => import_types.HttpRequest, + getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, + isValidHostname: () => isValidHostname, + resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig }); module.exports = __toCommonJS(src_exports); -// src/MiddlewareStack.ts -var getAllAliases = /* @__PURE__ */ __name((name, aliases) => { - const _aliases = []; - if (name) { - _aliases.push(name); - } - if (aliases) { - for (const alias of aliases) { - _aliases.push(alias); - } - } - return _aliases; -}, "getAllAliases"); -var getMiddlewareNameWithAliases = /* @__PURE__ */ __name((name, aliases) => { - return `${name || "anonymous"}${aliases && aliases.length > 0 ? ` (a.k.a. ${aliases.join(",")})` : ""}`; -}, "getMiddlewareNameWithAliases"); -var constructStack = /* @__PURE__ */ __name(() => { - let absoluteEntries = []; - let relativeEntries = []; - let identifyOnResolve = false; - const entriesNameSet = /* @__PURE__ */ new Set(); - const sort = /* @__PURE__ */ __name((entries) => entries.sort( - (a, b) => stepWeights[b.step] - stepWeights[a.step] || priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"] - ), "sort"); - const removeByName = /* @__PURE__ */ __name((toRemove) => { - let isRemoved = false; - const filterCb = /* @__PURE__ */ __name((entry) => { - const aliases = getAllAliases(entry.name, entry.aliases); - if (aliases.includes(toRemove)) { - isRemoved = true; - for (const alias of aliases) { - entriesNameSet.delete(alias); - } - return false; - } - return true; - }, "filterCb"); - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }, "removeByName"); - const removeByReference = /* @__PURE__ */ __name((toRemove) => { - let isRemoved = false; - const filterCb = /* @__PURE__ */ __name((entry) => { - if (entry.middleware === toRemove) { - isRemoved = true; - for (const alias of getAllAliases(entry.name, entry.aliases)) { - entriesNameSet.delete(alias); - } - return false; - } - return true; - }, "filterCb"); - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }, "removeByReference"); - const cloneTo = /* @__PURE__ */ __name((toStack) => { - var _a; - absoluteEntries.forEach((entry) => { - toStack.add(entry.middleware, { ...entry }); - }); - relativeEntries.forEach((entry) => { - toStack.addRelativeTo(entry.middleware, { ...entry }); - }); - (_a = toStack.identifyOnResolve) == null ? void 0 : _a.call(toStack, stack.identifyOnResolve()); - return toStack; - }, "cloneTo"); - const expandRelativeMiddlewareList = /* @__PURE__ */ __name((from) => { - const expandedMiddlewareList = []; - from.before.forEach((entry) => { - if (entry.before.length === 0 && entry.after.length === 0) { - expandedMiddlewareList.push(entry); - } else { - expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); - } - }); - expandedMiddlewareList.push(from); - from.after.reverse().forEach((entry) => { - if (entry.before.length === 0 && entry.after.length === 0) { - expandedMiddlewareList.push(entry); - } else { - expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); - } - }); - return expandedMiddlewareList; - }, "expandRelativeMiddlewareList"); - const getMiddlewareList = /* @__PURE__ */ __name((debug = false) => { - const normalizedAbsoluteEntries = []; - const normalizedRelativeEntries = []; - const normalizedEntriesNameMap = {}; - absoluteEntries.forEach((entry) => { - const normalizedEntry = { - ...entry, - before: [], - after: [] - }; - for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { - normalizedEntriesNameMap[alias] = normalizedEntry; - } - normalizedAbsoluteEntries.push(normalizedEntry); - }); - relativeEntries.forEach((entry) => { - const normalizedEntry = { - ...entry, - before: [], - after: [] - }; - for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { - normalizedEntriesNameMap[alias] = normalizedEntry; - } - normalizedRelativeEntries.push(normalizedEntry); - }); - normalizedRelativeEntries.forEach((entry) => { - if (entry.toMiddleware) { - const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; - if (toMiddleware === void 0) { - if (debug) { - return; - } - throw new Error( - `${entry.toMiddleware} is not found when adding ${getMiddlewareNameWithAliases(entry.name, entry.aliases)} middleware ${entry.relation} ${entry.toMiddleware}` - ); - } - if (entry.relation === "after") { - toMiddleware.after.push(entry); - } - if (entry.relation === "before") { - toMiddleware.before.push(entry); - } - } - }); - const mainChain = sort(normalizedAbsoluteEntries).map(expandRelativeMiddlewareList).reduce( - (wholeList, expandedMiddlewareList) => { - wholeList.push(...expandedMiddlewareList); - return wholeList; - }, - [] - ); - return mainChain; - }, "getMiddlewareList"); - const stack = { - add: (middleware, options = {}) => { - const { name, override, aliases: _aliases } = options; - const entry = { - step: "initialize", - priority: "normal", - middleware, - ...options - }; - const aliases = getAllAliases(name, _aliases); - if (aliases.length > 0) { - if (aliases.some((alias) => entriesNameSet.has(alias))) { - if (!override) - throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); - for (const alias of aliases) { - const toOverrideIndex = absoluteEntries.findIndex( - (entry2) => { - var _a; - return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); - } - ); - if (toOverrideIndex === -1) { - continue; - } - const toOverride = absoluteEntries[toOverrideIndex]; - if (toOverride.step !== entry.step || entry.priority !== toOverride.priority) { - throw new Error( - `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware with ${entry.priority} priority in ${entry.step} step.` - ); - } - absoluteEntries.splice(toOverrideIndex, 1); - } - } - for (const alias of aliases) { - entriesNameSet.add(alias); - } - } - absoluteEntries.push(entry); - }, - addRelativeTo: (middleware, options) => { - const { name, override, aliases: _aliases } = options; - const entry = { - middleware, - ...options - }; - const aliases = getAllAliases(name, _aliases); - if (aliases.length > 0) { - if (aliases.some((alias) => entriesNameSet.has(alias))) { - if (!override) - throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); - for (const alias of aliases) { - const toOverrideIndex = relativeEntries.findIndex( - (entry2) => { - var _a; - return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); - } - ); - if (toOverrideIndex === -1) { - continue; - } - const toOverride = relativeEntries[toOverrideIndex]; - if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { - throw new Error( - `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware ${entry.relation} "${entry.toMiddleware}" middleware.` - ); - } - relativeEntries.splice(toOverrideIndex, 1); - } - } - for (const alias of aliases) { - entriesNameSet.add(alias); - } - } - relativeEntries.push(entry); - }, - clone: () => cloneTo(constructStack()), - use: (plugin) => { - plugin.applyToStack(stack); - }, - remove: (toRemove) => { - if (typeof toRemove === "string") - return removeByName(toRemove); - else - return removeByReference(toRemove); - }, - removeByTag: (toRemove) => { - let isRemoved = false; - const filterCb = /* @__PURE__ */ __name((entry) => { - const { tags, name, aliases: _aliases } = entry; - if (tags && tags.includes(toRemove)) { - const aliases = getAllAliases(name, _aliases); - for (const alias of aliases) { - entriesNameSet.delete(alias); - } - isRemoved = true; - return false; - } - return true; - }, "filterCb"); - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }, - concat: (from) => { - var _a; - const cloned = cloneTo(constructStack()); - cloned.use(from); - cloned.identifyOnResolve( - identifyOnResolve || cloned.identifyOnResolve() || (((_a = from.identifyOnResolve) == null ? void 0 : _a.call(from)) ?? false) - ); - return cloned; +// src/extensions/httpExtensionConfiguration.ts +var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return { + setHttpHandler(handler) { + runtimeConfig.httpHandler = handler; }, - applyToStack: cloneTo, - identify: () => { - return getMiddlewareList(true).map((mw) => { - const step = mw.step ?? mw.relation + " " + mw.toMiddleware; - return getMiddlewareNameWithAliases(mw.name, mw.aliases) + " - " + step; - }); + httpHandler() { + return runtimeConfig.httpHandler; }, - identifyOnResolve(toggle) { - if (typeof toggle === "boolean") - identifyOnResolve = toggle; - return identifyOnResolve; + updateHttpClientConfig(key, value) { + runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); }, - resolve: (handler, context) => { - for (const middleware of getMiddlewareList().map((entry) => entry.middleware).reverse()) { - handler = middleware(handler, context); - } - if (identifyOnResolve) { - console.log(stack.identify()); - } - return handler; + httpHandlerConfigs() { + return runtimeConfig.httpHandler.httpHandlerConfigs(); + } + }; +}, "getHttpHandlerExtensionConfiguration"); +var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler() + }; +}, "resolveHttpHandlerRuntimeConfig"); + +// src/Field.ts +var import_types = __nccwpck_require__(12276); +var Field = class { + static { + __name(this, "Field"); + } + constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + /** + * Appends a value to the field. + * + * @param value The value to append. + */ + add(value) { + this.values.push(value); + } + /** + * Overwrite existing field values. + * + * @param values The new field values. + */ + set(values) { + this.values = values; + } + /** + * Remove all matching entries from list. + * + * @param value Value to remove. + */ + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + /** + * Get comma-delimited string. + * + * @returns String representation of {@link Field}. + */ + toString() { + return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); + } + /** + * Get string values as a list + * + * @returns Values in {@link Field} as a list. + */ + get() { + return this.values; + } +}; + +// src/Fields.ts +var Fields = class { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + static { + __name(this, "Fields"); + } + /** + * Set entry for a {@link Field} name. The `name` + * attribute will be used to key the collection. + * + * @param field The {@link Field} to set. + */ + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + /** + * Retrieve {@link Field} entry by name. + * + * @param name The name of the {@link Field} entry + * to retrieve + * @returns The {@link Field} if it exists. + */ + getField(name) { + return this.entries[name.toLowerCase()]; + } + /** + * Delete entry from collection. + * + * @param name Name of the entry to delete. + */ + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + /** + * Helper function for retrieving specific types of fields. + * Used to grab all headers or all trailers. + * + * @param kind {@link FieldPosition} of entries to retrieve. + * @returns The {@link Field} entries with the specified + * {@link FieldPosition}. + */ + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +}; + +// src/httpRequest.ts + +var HttpRequest = class _HttpRequest { + static { + __name(this, "HttpRequest"); + } + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; + this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + /** + * Note: this does not deep-clone the body. + */ + static clone(request) { + const cloned = new _HttpRequest({ + ...request, + headers: { ...request.headers } + }); + if (cloned.query) { + cloned.query = cloneQuery(cloned.query); } - }; - return stack; -}, "constructStack"); -var stepWeights = { - initialize: 5, - serialize: 4, - build: 3, - finalizeRequest: 2, - deserialize: 1 + return cloned; + } + /** + * This method only actually asserts that request is the interface {@link IHttpRequest}, + * and not necessarily this concrete class. Left in place for API stability. + * + * Do not call instance methods on the input of this function, and + * do not assume it has the HttpRequest prototype. + */ + static isInstance(request) { + if (!request) { + return false; + } + const req = request; + return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; + } + /** + * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call + * this method because {@link HttpRequest.isInstance} incorrectly + * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). + */ + clone() { + return _HttpRequest.clone(this); + } }; -var priorityWeights = { - high: 3, - normal: 2, - low: 1 +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param + }; + }, {}); +} +__name(cloneQuery, "cloneQuery"); + +// src/httpResponse.ts +var HttpResponse = class { + static { + __name(this, "HttpResponse"); + } + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } }; + +// src/isValidHostname.ts +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +__name(isValidHostname, "isValidHostname"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -80252,14 +71370,12 @@ var priorityWeights = { /***/ }), -/***/ 61279: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 12276: +/***/ ((module) => { -var __create = Object.create; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { @@ -80274,776 +71390,531 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, - NodeHttp2Handler: () => NodeHttp2Handler, - NodeHttpHandler: () => NodeHttpHandler, - streamCollector: () => streamCollector + AlgorithmId: () => AlgorithmId, + EndpointURLScheme: () => EndpointURLScheme, + FieldPosition: () => FieldPosition, + HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, + HttpAuthLocation: () => HttpAuthLocation, + IniSectionType: () => IniSectionType, + RequestHandlerProtocol: () => RequestHandlerProtocol, + SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig }); module.exports = __toCommonJS(src_exports); -// src/node-http-handler.ts -var import_protocol_http = __nccwpck_require__(72356); -var import_querystring_builder = __nccwpck_require__(18256); -var import_http = __nccwpck_require__(58611); -var import_https = __nccwpck_require__(65692); - -// src/constants.ts -var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; - -// src/get-transformed-headers.ts -var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { - const transformedHeaders = {}; - for (const name of Object.keys(headers)) { - const headerValues = headers[name]; - transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; - } - return transformedHeaders; -}, "getTransformedHeaders"); - -// src/timing.ts -var timing = { - setTimeout: (cb, ms) => setTimeout(cb, ms), - clearTimeout: (timeoutId) => clearTimeout(timeoutId) -}; - -// src/set-connection-timeout.ts -var DEFER_EVENT_LISTENER_TIME = 1e3; -var setConnectionTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { - if (!timeoutInMs) { - return -1; - } - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeoutId = timing.setTimeout(() => { - request.destroy(); - reject( - Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { - name: "TimeoutError" - }) - ); - }, timeoutInMs - offset); - const doWithSocket = /* @__PURE__ */ __name((socket) => { - if (socket == null ? void 0 : socket.connecting) { - socket.on("connect", () => { - timing.clearTimeout(timeoutId); - }); - } else { - timing.clearTimeout(timeoutId); - } - }, "doWithSocket"); - if (request.socket) { - doWithSocket(request.socket); - } else { - request.on("socket", doWithSocket); - } - }, "registerTimeout"); - if (timeoutInMs < 2e3) { - registerTimeout(0); - return 0; - } - return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); -}, "setConnectionTimeout"); - -// src/set-socket-keep-alive.ts -var DEFER_EVENT_LISTENER_TIME2 = 3e3; -var setSocketKeepAlive = /* @__PURE__ */ __name((request, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { - if (keepAlive !== true) { - return -1; - } - const registerListener = /* @__PURE__ */ __name(() => { - if (request.socket) { - request.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - } else { - request.on("socket", (socket) => { - socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - }); - } - }, "registerListener"); - if (deferTimeMs === 0) { - registerListener(); - return 0; - } - return timing.setTimeout(registerListener, deferTimeMs); -}, "setSocketKeepAlive"); - -// src/set-socket-timeout.ts -var DEFER_EVENT_LISTENER_TIME3 = 3e3; -var setSocketTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { - const registerTimeout = /* @__PURE__ */ __name((offset) => { - request.setTimeout(timeoutInMs - offset, () => { - request.destroy(); - reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); - }); - }, "registerTimeout"); - if (0 < timeoutInMs && timeoutInMs < 6e3) { - registerTimeout(0); - return 0; - } - return timing.setTimeout( - registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), - DEFER_EVENT_LISTENER_TIME3 - ); -}, "setSocketTimeout"); +// src/auth/auth.ts +var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { + HttpAuthLocation2["HEADER"] = "header"; + HttpAuthLocation2["QUERY"] = "query"; + return HttpAuthLocation2; +})(HttpAuthLocation || {}); -// src/write-request-body.ts -var import_stream = __nccwpck_require__(2203); -var MIN_WAIT_TIME = 1e3; -async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { - const headers = request.headers ?? {}; - const expect = headers["Expect"] || headers["expect"]; - let timeoutId = -1; - let sendBody = true; - if (expect === "100-continue") { - sendBody = await Promise.race([ - new Promise((resolve) => { - timeoutId = Number(timing.setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); - }), - new Promise((resolve) => { - httpRequest.on("continue", () => { - timing.clearTimeout(timeoutId); - resolve(true); - }); - httpRequest.on("response", () => { - timing.clearTimeout(timeoutId); - resolve(false); - }); - httpRequest.on("error", () => { - timing.clearTimeout(timeoutId); - resolve(false); - }); - }) - ]); - } - if (sendBody) { - writeBody(httpRequest, request.body); - } -} -__name(writeRequestBody, "writeRequestBody"); -function writeBody(httpRequest, body) { - if (body instanceof import_stream.Readable) { - body.pipe(httpRequest); - return; - } - if (body) { - if (Buffer.isBuffer(body) || typeof body === "string") { - httpRequest.end(body); - return; - } - const uint8 = body; - if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { - httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); - return; - } - httpRequest.end(Buffer.from(body)); - return; - } - httpRequest.end(); -} -__name(writeBody, "writeBody"); +// src/auth/HttpApiKeyAuth.ts +var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { + HttpApiKeyAuthLocation2["HEADER"] = "header"; + HttpApiKeyAuthLocation2["QUERY"] = "query"; + return HttpApiKeyAuthLocation2; +})(HttpApiKeyAuthLocation || {}); -// src/node-http-handler.ts -var DEFAULT_REQUEST_TIMEOUT = 0; -var _NodeHttpHandler = class _NodeHttpHandler { - constructor(options) { - this.socketWarningTimestamp = 0; - // Node http handler is hard-coded to http/1.1: https://github.com/nodejs/node/blob/ff5664b83b89c55e4ab5d5f60068fb457f1f5872/lib/_http_server.js#L286 - this.metadata = { handlerProtocol: "http/1.1" }; - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((_options) => { - resolve(this.resolveDefaultConfig(_options)); - }).catch(reject); - } else { - resolve(this.resolveDefaultConfig(options)); - } - }); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; - } - return new _NodeHttpHandler(instanceOrOptions); - } - /** - * @internal - * - * @param agent - http(s) agent in use by the NodeHttpHandler instance. - * @param socketWarningTimestamp - last socket usage check timestamp. - * @param logger - channel for the warning. - * @returns timestamp of last emitted warning. - */ - static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { - var _a, _b, _c; - const { sockets, requests, maxSockets } = agent; - if (typeof maxSockets !== "number" || maxSockets === Infinity) { - return socketWarningTimestamp; - } - const interval = 15e3; - if (Date.now() - interval < socketWarningTimestamp) { - return socketWarningTimestamp; - } - if (sockets && requests) { - for (const origin in sockets) { - const socketsInUse = ((_a = sockets[origin]) == null ? void 0 : _a.length) ?? 0; - const requestsEnqueued = ((_b = requests[origin]) == null ? void 0 : _b.length) ?? 0; - if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { - (_c = logger == null ? void 0 : logger.warn) == null ? void 0 : _c.call( - logger, - `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. -See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html -or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` - ); - return Date.now(); - } - } - } - return socketWarningTimestamp; - } - resolveDefaultConfig(options) { - const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; - const keepAlive = true; - const maxSockets = 50; - return { - connectionTimeout, - requestTimeout: requestTimeout ?? socketTimeout, - httpAgent: (() => { - if (httpAgent instanceof import_http.Agent || typeof (httpAgent == null ? void 0 : httpAgent.destroy) === "function") { - return httpAgent; - } - return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); - })(), - httpsAgent: (() => { - if (httpsAgent instanceof import_https.Agent || typeof (httpsAgent == null ? void 0 : httpsAgent.destroy) === "function") { - return httpsAgent; - } - return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); - })(), - logger: console - }; - } - destroy() { - var _a, _b, _c, _d; - (_b = (_a = this.config) == null ? void 0 : _a.httpAgent) == null ? void 0 : _b.destroy(); - (_d = (_c = this.config) == null ? void 0 : _c.httpsAgent) == null ? void 0 : _d.destroy(); - } - async handle(request, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - } - return new Promise((_resolve, _reject) => { - let writeRequestBodyPromise = void 0; - const timeouts = []; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(timing.clearTimeout); - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(timing.clearTimeout); - _reject(arg); - }, "reject"); - if (!this.config) { - throw new Error("Node HTTP request handler config is not resolved"); - } - if (abortSignal == null ? void 0 : abortSignal.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const isSSL = request.protocol === "https:"; - const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; - timeouts.push( - timing.setTimeout( - () => { - this.socketWarningTimestamp = _NodeHttpHandler.checkSocketUsage( - agent, - this.socketWarningTimestamp, - this.config.logger - ); - }, - this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) - ) - ); - const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); - let auth = void 0; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}`; - } - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - let hostname = request.hostname ?? ""; - if (hostname[0] === "[" && hostname.endsWith("]")) { - hostname = request.hostname.slice(1, -1); - } else { - hostname = request.hostname; - } - const nodeHttpsOptions = { - headers: request.headers, - host: hostname, - method: request.method, - path, - port: request.port, - agent, - auth - }; - const requestFunc = isSSL ? import_https.request : import_http.request; - const req = requestFunc(nodeHttpsOptions, (res) => { - const httpResponse = new import_protocol_http.HttpResponse({ - statusCode: res.statusCode || -1, - reason: res.statusMessage, - headers: getTransformedHeaders(res.headers), - body: res - }); - resolve({ response: httpResponse }); - }); - req.on("error", (err) => { - if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { - reject(Object.assign(err, { name: "TimeoutError" })); - } else { - reject(err); - } - }); - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.destroy(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; - } - } - timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); - const httpAgent = nodeHttpsOptions.agent; - if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { - timeouts.push( - setSocketKeepAlive(req, { - // @ts-expect-error keepAlive is not public on httpAgent. - keepAlive: httpAgent.keepAlive, - // @ts-expect-error keepAliveMsecs is not public on httpAgent. - keepAliveMsecs: httpAgent.keepAliveMsecs - }) - ); - } - writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { - timeouts.forEach(timing.clearTimeout); - return _reject(e); - }); +// src/endpoint.ts +var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { + EndpointURLScheme2["HTTP"] = "http"; + EndpointURLScheme2["HTTPS"] = "https"; + return EndpointURLScheme2; +})(EndpointURLScheme || {}); + +// src/extensions/checksum.ts +var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { + AlgorithmId2["MD5"] = "md5"; + AlgorithmId2["CRC32"] = "crc32"; + AlgorithmId2["CRC32C"] = "crc32c"; + AlgorithmId2["SHA1"] = "sha1"; + AlgorithmId2["SHA256"] = "sha256"; + return AlgorithmId2; +})(AlgorithmId || {}); +var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== void 0) { + checksumAlgorithms.push({ + algorithmId: () => "sha256" /* SHA256 */, + checksumConstructor: () => runtimeConfig.sha256 }); } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; + if (runtimeConfig.md5 != void 0) { + checksumAlgorithms.push({ + algorithmId: () => "md5" /* MD5 */, + checksumConstructor: () => runtimeConfig.md5 }); } - httpHandlerConfigs() { - return this.config ?? {}; - } -}; -__name(_NodeHttpHandler, "NodeHttpHandler"); -var NodeHttpHandler = _NodeHttpHandler; + return { + addChecksumAlgorithm(algo) { + checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return checksumAlgorithms; + } + }; +}, "getChecksumConfiguration"); +var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}, "resolveChecksumRuntimeConfig"); -// src/node-http2-handler.ts +// src/extensions/defaultClientConfiguration.ts +var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return getChecksumConfiguration(runtimeConfig); +}, "getDefaultClientConfiguration"); +var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return resolveChecksumRuntimeConfig(config); +}, "resolveDefaultRuntimeConfig"); + +// src/http.ts +var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { + FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; + FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; + return FieldPosition2; +})(FieldPosition || {}); +// src/middleware.ts +var SMITHY_CONTEXT_KEY = "__smithy_context"; -var import_http22 = __nccwpck_require__(85675); +// src/profile.ts +var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; +})(IniSectionType || {}); -// src/node-http2-connection-manager.ts -var import_http2 = __toESM(__nccwpck_require__(85675)); +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); +// Annotate the CommonJS export names for ESM import in node: -// src/node-http2-connection-pool.ts -var _NodeHttp2ConnectionPool = class _NodeHttp2ConnectionPool { - constructor(sessions) { - this.sessions = []; - this.sessions = sessions ?? []; - } - poll() { - if (this.sessions.length > 0) { - return this.sessions.shift(); - } - } - offerLast(session) { - this.sessions.push(session); - } - contains(session) { - return this.sessions.includes(session); - } - remove(session) { - this.sessions = this.sessions.filter((s) => s !== session); - } - [Symbol.iterator]() { - return this.sessions[Symbol.iterator](); - } - destroy(connection) { - for (const session of this.sessions) { - if (session === connection) { - if (!session.destroyed) { - session.destroy(); - } - } - } +0 && (0); + + + +/***/ }), + +/***/ 19618: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; -__name(_NodeHttp2ConnectionPool, "NodeHttp2ConnectionPool"); -var NodeHttp2ConnectionPool = _NodeHttp2ConnectionPool; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/node-http2-connection-manager.ts -var _NodeHttp2ConnectionManager = class _NodeHttp2ConnectionManager { - constructor(config) { - this.sessionCache = /* @__PURE__ */ new Map(); - this.config = config; - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrency must be greater than zero."); - } - } - lease(requestContext, connectionConfiguration) { - const url = this.getUrlString(requestContext); - const existingPool = this.sessionCache.get(url); - if (existingPool) { - const existingSession = existingPool.poll(); - if (existingSession && !this.config.disableConcurrency) { - return existingSession; - } - } - const session = import_http2.default.connect(url); - if (this.config.maxConcurrency) { - session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { - if (err) { - throw new Error( - "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() - ); - } - }); - } - session.unref(); - const destroySessionCb = /* @__PURE__ */ __name(() => { - session.destroy(); - this.deleteSession(url, session); - }, "destroySessionCb"); - session.on("goaway", destroySessionCb); - session.on("error", destroySessionCb); - session.on("frameError", destroySessionCb); - session.on("close", () => this.deleteSession(url, session)); - if (connectionConfiguration.requestTimeout) { - session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); - } - const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); - connectionPool.offerLast(session); - this.sessionCache.set(url, connectionPool); - return session; - } - /** - * Delete a session from the connection pool. - * @param authority The authority of the session to delete. - * @param session The session to delete. - */ - deleteSession(authority, session) { - const existingConnectionPool = this.sessionCache.get(authority); - if (!existingConnectionPool) { - return; - } - if (!existingConnectionPool.contains(session)) { - return; - } - existingConnectionPool.remove(session); - this.sessionCache.set(authority, existingConnectionPool); - } - release(requestContext, session) { - var _a; - const cacheKey = this.getUrlString(requestContext); - (_a = this.sessionCache.get(cacheKey)) == null ? void 0 : _a.offerLast(session); - } - destroy() { - for (const [key, connectionPool] of this.sessionCache) { - for (const session of connectionPool) { - if (!session.destroyed) { - session.destroy(); - } - connectionPool.remove(session); - } - this.sessionCache.delete(key); - } - } - setMaxConcurrentStreams(maxConcurrentStreams) { - if (maxConcurrentStreams && maxConcurrentStreams <= 0) { - throw new RangeError("maxConcurrentStreams must be greater than zero."); +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, + CONFIG_MAX_ATTEMPTS: () => CONFIG_MAX_ATTEMPTS, + CONFIG_RETRY_MODE: () => CONFIG_RETRY_MODE, + ENV_MAX_ATTEMPTS: () => ENV_MAX_ATTEMPTS, + ENV_RETRY_MODE: () => ENV_RETRY_MODE, + NODE_MAX_ATTEMPT_CONFIG_OPTIONS: () => NODE_MAX_ATTEMPT_CONFIG_OPTIONS, + NODE_RETRY_MODE_CONFIG_OPTIONS: () => NODE_RETRY_MODE_CONFIG_OPTIONS, + StandardRetryStrategy: () => StandardRetryStrategy, + defaultDelayDecider: () => defaultDelayDecider, + defaultRetryDecider: () => defaultRetryDecider, + getOmitRetryHeadersPlugin: () => getOmitRetryHeadersPlugin, + getRetryAfterHint: () => getRetryAfterHint, + getRetryPlugin: () => getRetryPlugin, + omitRetryHeadersMiddleware: () => omitRetryHeadersMiddleware, + omitRetryHeadersMiddlewareOptions: () => omitRetryHeadersMiddlewareOptions, + resolveRetryConfig: () => resolveRetryConfig, + retryMiddleware: () => retryMiddleware, + retryMiddlewareOptions: () => retryMiddlewareOptions +}); +module.exports = __toCommonJS(src_exports); + +// src/AdaptiveRetryStrategy.ts + + +// src/StandardRetryStrategy.ts +var import_protocol_http = __nccwpck_require__(64864); + + +var import_uuid = __nccwpck_require__(12048); + +// src/defaultRetryQuota.ts +var import_util_retry = __nccwpck_require__(15518); +var getDefaultRetryQuota = /* @__PURE__ */ __name((initialRetryTokens, options) => { + const MAX_CAPACITY = initialRetryTokens; + const noRetryIncrement = options?.noRetryIncrement ?? import_util_retry.NO_RETRY_INCREMENT; + const retryCost = options?.retryCost ?? import_util_retry.RETRY_COST; + const timeoutRetryCost = options?.timeoutRetryCost ?? import_util_retry.TIMEOUT_RETRY_COST; + let availableCapacity = initialRetryTokens; + const getCapacityAmount = /* @__PURE__ */ __name((error) => error.name === "TimeoutError" ? timeoutRetryCost : retryCost, "getCapacityAmount"); + const hasRetryTokens = /* @__PURE__ */ __name((error) => getCapacityAmount(error) <= availableCapacity, "hasRetryTokens"); + const retrieveRetryTokens = /* @__PURE__ */ __name((error) => { + if (!hasRetryTokens(error)) { + throw new Error("No retry token available"); } - this.config.maxConcurrency = maxConcurrentStreams; + const capacityAmount = getCapacityAmount(error); + availableCapacity -= capacityAmount; + return capacityAmount; + }, "retrieveRetryTokens"); + const releaseRetryTokens = /* @__PURE__ */ __name((capacityReleaseAmount) => { + availableCapacity += capacityReleaseAmount ?? noRetryIncrement; + availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); + }, "releaseRetryTokens"); + return Object.freeze({ + hasRetryTokens, + retrieveRetryTokens, + releaseRetryTokens + }); +}, "getDefaultRetryQuota"); + +// src/delayDecider.ts + +var defaultDelayDecider = /* @__PURE__ */ __name((delayBase, attempts) => Math.floor(Math.min(import_util_retry.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)), "defaultDelayDecider"); + +// src/retryDecider.ts +var import_service_error_classification = __nccwpck_require__(42058); +var defaultRetryDecider = /* @__PURE__ */ __name((error) => { + if (!error) { + return false; } - setDisableConcurrentStreams(disableConcurrentStreams) { - this.config.disableConcurrency = disableConcurrentStreams; + return (0, import_service_error_classification.isRetryableByTrait)(error) || (0, import_service_error_classification.isClockSkewError)(error) || (0, import_service_error_classification.isThrottlingError)(error) || (0, import_service_error_classification.isTransientError)(error); +}, "defaultRetryDecider"); + +// src/util.ts +var asSdkError = /* @__PURE__ */ __name((error) => { + if (error instanceof Error) + return error; + if (error instanceof Object) + return Object.assign(new Error(), error); + if (typeof error === "string") + return new Error(error); + return new Error(`AWS SDK error wrapper for ${error}`); +}, "asSdkError"); + +// src/StandardRetryStrategy.ts +var StandardRetryStrategy = class { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = import_util_retry.RETRY_MODES.STANDARD; + this.retryDecider = options?.retryDecider ?? defaultRetryDecider; + this.delayDecider = options?.delayDecider ?? defaultDelayDecider; + this.retryQuota = options?.retryQuota ?? getDefaultRetryQuota(import_util_retry.INITIAL_RETRY_TOKENS); } - getUrlString(request) { - return request.destination.toString(); + static { + __name(this, "StandardRetryStrategy"); } -}; -__name(_NodeHttp2ConnectionManager, "NodeHttp2ConnectionManager"); -var NodeHttp2ConnectionManager = _NodeHttp2ConnectionManager; - -// src/node-http2-handler.ts -var _NodeHttp2Handler = class _NodeHttp2Handler { - constructor(options) { - this.metadata = { handlerProtocol: "h2" }; - this.connectionManager = new NodeHttp2ConnectionManager({}); - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((opts) => { - resolve(opts || {}); - }).catch(reject); - } else { - resolve(options || {}); - } - }); + shouldRetry(error, attempts, maxAttempts) { + return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { - return instanceOrOptions; + async getMaxAttempts() { + let maxAttempts; + try { + maxAttempts = await this.maxAttemptsProvider(); + } catch (error) { + maxAttempts = import_util_retry.DEFAULT_MAX_ATTEMPTS; } - return new _NodeHttp2Handler(instanceOrOptions); - } - destroy() { - this.connectionManager.destroy(); + return maxAttempts; } - async handle(request, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); - if (this.config.maxConcurrentStreams) { - this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); - } + async retry(next, args, options) { + let retryTokenAmount; + let attempts = 0; + let totalDelay = 0; + const maxAttempts = await this.getMaxAttempts(); + const { request } = args; + if (import_protocol_http.HttpRequest.isInstance(request)) { + request.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); } - const { requestTimeout, disableConcurrentStreams } = this.config; - return new Promise((_resolve, _reject) => { - var _a; - let fulfilled = false; - let writeRequestBodyPromise = void 0; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _reject(arg); - }, "reject"); - if (abortSignal == null ? void 0 : abortSignal.aborted) { - fulfilled = true; - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const { hostname, method, port, protocol, query } = request; - let auth = ""; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}@`; - } - const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; - const requestContext = { destination: new URL(authority) }; - const session = this.connectionManager.lease(requestContext, { - requestTimeout: (_a = this.config) == null ? void 0 : _a.sessionTimeout, - disableConcurrentStreams: disableConcurrentStreams || false - }); - const rejectWithDestroy = /* @__PURE__ */ __name((err) => { - if (disableConcurrentStreams) { - this.destroySession(session); + while (true) { + try { + if (import_protocol_http.HttpRequest.isInstance(request)) { + request.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; } - fulfilled = true; - reject(err); - }, "rejectWithDestroy"); - const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - const req = session.request({ - ...request.headers, - [import_http22.constants.HTTP2_HEADER_PATH]: path, - [import_http22.constants.HTTP2_HEADER_METHOD]: method - }); - session.ref(); - req.on("response", (headers) => { - const httpResponse = new import_protocol_http.HttpResponse({ - statusCode: headers[":status"] || -1, - headers: getTransformedHeaders(headers), - body: req - }); - fulfilled = true; - resolve({ response: httpResponse }); - if (disableConcurrentStreams) { - session.close(); - this.connectionManager.deleteSession(authority, session); + if (options?.beforeRequest) { + await options.beforeRequest(); } - }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { - req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); - timeoutError.name = "TimeoutError"; - rejectWithDestroy(timeoutError); - }); - } - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.close(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - rejectWithDestroy(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; + const { response, output } = await next(args); + if (options?.afterRequest) { + options.afterRequest(response); } - } - req.on("frameError", (type, code, id) => { - rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); - }); - req.on("error", rejectWithDestroy); - req.on("aborted", () => { - rejectWithDestroy( - new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) - ); - }); - req.on("close", () => { - session.unref(); - if (disableConcurrentStreams) { - session.destroy(); + this.retryQuota.releaseRetryTokens(retryTokenAmount); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalDelay; + return { response, output }; + } catch (e) { + const err = asSdkError(e); + attempts++; + if (this.shouldRetry(err, attempts, maxAttempts)) { + retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); + const delayFromDecider = this.delayDecider( + (0, import_service_error_classification.isThrottlingError)(err) ? import_util_retry.THROTTLING_RETRY_DELAY_BASE : import_util_retry.DEFAULT_RETRY_DELAY_BASE, + attempts + ); + const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); + const delay = Math.max(delayFromResponse || 0, delayFromDecider); + totalDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + continue; } - if (!fulfilled) { - rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + if (!err.$metadata) { + err.$metadata = {}; } - }); - writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); - }); + err.$metadata.attempts = attempts; + err.$metadata.totalRetryDelay = totalDelay; + throw err; + } + } } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; - }); +}; +var getDelayFromRetryAfterHeader = /* @__PURE__ */ __name((response) => { + if (!import_protocol_http.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return retryAfterSeconds * 1e3; + const retryAfterDate = new Date(retryAfter); + return retryAfterDate.getTime() - Date.now(); +}, "getDelayFromRetryAfterHeader"); + +// src/AdaptiveRetryStrategy.ts +var AdaptiveRetryStrategy = class extends StandardRetryStrategy { + static { + __name(this, "AdaptiveRetryStrategy"); } - httpHandlerConfigs() { - return this.config ?? {}; + constructor(maxAttemptsProvider, options) { + const { rateLimiter, ...superOptions } = options ?? {}; + super(maxAttemptsProvider, superOptions); + this.rateLimiter = rateLimiter ?? new import_util_retry.DefaultRateLimiter(); + this.mode = import_util_retry.RETRY_MODES.ADAPTIVE; } - /** - * Destroys a session. - * @param session The session to destroy. - */ - destroySession(session) { - if (!session.destroyed) { - session.destroy(); - } + async retry(next, args) { + return super.retry(next, args, { + beforeRequest: async () => { + return this.rateLimiter.getSendToken(); + }, + afterRequest: (response) => { + this.rateLimiter.updateClientSendingRate(response); + } + }); } }; -__name(_NodeHttp2Handler, "NodeHttp2Handler"); -var NodeHttp2Handler = _NodeHttp2Handler; -// src/stream-collector/collector.ts +// src/configurations.ts +var import_util_middleware = __nccwpck_require__(73976); -var _Collector = class _Collector extends import_stream.Writable { - constructor() { - super(...arguments); - this.bufferedBytes = []; - } - _write(chunk, encoding, callback) { - this.bufferedBytes.push(chunk); - callback(); - } +var ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; +var CONFIG_MAX_ATTEMPTS = "max_attempts"; +var NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + const value = env[ENV_MAX_ATTEMPTS]; + if (!value) + return void 0; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Environment variable ${ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + configFileSelector: (profile) => { + const value = profile[CONFIG_MAX_ATTEMPTS]; + if (!value) + return void 0; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Shared config file entry ${CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + default: import_util_retry.DEFAULT_MAX_ATTEMPTS +}; +var resolveRetryConfig = /* @__PURE__ */ __name((input) => { + const { retryStrategy, retryMode: _retryMode, maxAttempts: _maxAttempts } = input; + const maxAttempts = (0, import_util_middleware.normalizeProvider)(_maxAttempts ?? import_util_retry.DEFAULT_MAX_ATTEMPTS); + return Object.assign(input, { + maxAttempts, + retryStrategy: async () => { + if (retryStrategy) { + return retryStrategy; + } + const retryMode = await (0, import_util_middleware.normalizeProvider)(_retryMode)(); + if (retryMode === import_util_retry.RETRY_MODES.ADAPTIVE) { + return new import_util_retry.AdaptiveRetryStrategy(maxAttempts); + } + return new import_util_retry.StandardRetryStrategy(maxAttempts); + } + }); +}, "resolveRetryConfig"); +var ENV_RETRY_MODE = "AWS_RETRY_MODE"; +var CONFIG_RETRY_MODE = "retry_mode"; +var NODE_RETRY_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_RETRY_MODE], + configFileSelector: (profile) => profile[CONFIG_RETRY_MODE], + default: import_util_retry.DEFAULT_RETRY_MODE }; -__name(_Collector, "Collector"); -var Collector = _Collector; -// src/stream-collector/index.ts -var streamCollector = /* @__PURE__ */ __name((stream) => { - if (isReadableStreamInstance(stream)) { - return collectReadableStream(stream); +// src/omitRetryHeadersMiddleware.ts + + +var omitRetryHeadersMiddleware = /* @__PURE__ */ __name(() => (next) => async (args) => { + const { request } = args; + if (import_protocol_http.HttpRequest.isInstance(request)) { + delete request.headers[import_util_retry.INVOCATION_ID_HEADER]; + delete request.headers[import_util_retry.REQUEST_HEADER]; } - return new Promise((resolve, reject) => { - const collector = new Collector(); - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function() { - const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); - resolve(bytes); - }); - }); -}, "streamCollector"); -var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); -async function collectReadableStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; + return next(args); +}, "omitRetryHeadersMiddleware"); +var omitRetryHeadersMiddlewareOptions = { + name: "omitRetryHeadersMiddleware", + tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], + relation: "before", + toMiddleware: "awsAuthMiddleware", + override: true +}; +var getOmitRetryHeadersPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(omitRetryHeadersMiddleware(), omitRetryHeadersMiddlewareOptions); + } +}), "getOmitRetryHeadersPlugin"); + +// src/retryMiddleware.ts + + +var import_smithy_client = __nccwpck_require__(61411); + + +var import_isStreamingPayload = __nccwpck_require__(49831); +var retryMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { + let retryStrategy = await options.retryStrategy(); + const maxAttempts = await options.maxAttempts(); + if (isRetryStrategyV2(retryStrategy)) { + retryStrategy = retryStrategy; + let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); + let lastError = new Error(); + let attempts = 0; + let totalRetryDelay = 0; + const { request } = args; + const isRequest = import_protocol_http.HttpRequest.isInstance(request); + if (isRequest) { + request.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); } - isDone = done; + while (true) { + try { + if (isRequest) { + request.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + const { response, output } = await next(args); + retryStrategy.recordSuccess(retryToken); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalRetryDelay; + return { response, output }; + } catch (e) { + const retryErrorInfo = getRetryErrorInfo(e); + lastError = asSdkError(e); + if (isRequest && (0, import_isStreamingPayload.isStreamingPayload)(request)) { + (context.logger instanceof import_smithy_client.NoOpLogger ? console : context.logger)?.warn( + "An error was encountered in a non-retryable streaming request." + ); + throw lastError; + } + try { + retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); + } catch (refreshError) { + if (!lastError.$metadata) { + lastError.$metadata = {}; + } + lastError.$metadata.attempts = attempts + 1; + lastError.$metadata.totalRetryDelay = totalRetryDelay; + throw lastError; + } + attempts = retryToken.getRetryCount(); + const delay = retryToken.getRetryDelay(); + totalRetryDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + } + } else { + retryStrategy = retryStrategy; + if (retryStrategy?.mode) + context.userAgent = [...context.userAgent || [], ["cfg/retry-mode", retryStrategy.mode]]; + return retryStrategy.retry(next, args); } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; +}, "retryMiddleware"); +var isRetryStrategyV2 = /* @__PURE__ */ __name((retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && typeof retryStrategy.recordSuccess !== "undefined", "isRetryStrategyV2"); +var getRetryErrorInfo = /* @__PURE__ */ __name((error) => { + const errorInfo = { + error, + errorType: getRetryErrorType(error) + }; + const retryAfterHint = getRetryAfterHint(error.$response); + if (retryAfterHint) { + errorInfo.retryAfterHint = retryAfterHint; } - return collected; -} -__name(collectReadableStream, "collectReadableStream"); + return errorInfo; +}, "getRetryErrorInfo"); +var getRetryErrorType = /* @__PURE__ */ __name((error) => { + if ((0, import_service_error_classification.isThrottlingError)(error)) + return "THROTTLING"; + if ((0, import_service_error_classification.isTransientError)(error)) + return "TRANSIENT"; + if ((0, import_service_error_classification.isServerError)(error)) + return "SERVER_ERROR"; + return "CLIENT_ERROR"; +}, "getRetryErrorType"); +var retryMiddlewareOptions = { + name: "retryMiddleware", + tags: ["RETRY"], + step: "finalizeRequest", + priority: "high", + override: true +}; +var getRetryPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(retryMiddleware(options), retryMiddlewareOptions); + } +}), "getRetryPlugin"); +var getRetryAfterHint = /* @__PURE__ */ __name((response) => { + if (!import_protocol_http.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return new Date(retryAfterSeconds * 1e3); + const retryAfterDate = new Date(retryAfter); + return retryAfterDate; +}, "getRetryAfterHint"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -81052,7 +71923,22 @@ __name(collectReadableStream, "collectReadableStream"); /***/ }), -/***/ 72356: +/***/ 49831: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isStreamingPayload = void 0; +const stream_1 = __nccwpck_require__(2203); +const isStreamingPayload = (request) => (request === null || request === void 0 ? void 0 : request.body) instanceof stream_1.Readable || + (typeof ReadableStream !== "undefined" && (request === null || request === void 0 ? void 0 : request.body) instanceof ReadableStream); +exports.isStreamingPayload = isStreamingPayload; + + +/***/ }), + +/***/ 64864: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -81090,19 +71976,18 @@ module.exports = __toCommonJS(src_exports); // src/extensions/httpExtensionConfiguration.ts var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - let httpHandler = runtimeConfig.httpHandler; return { setHttpHandler(handler) { - httpHandler = handler; + runtimeConfig.httpHandler = handler; }, httpHandler() { - return httpHandler; + return runtimeConfig.httpHandler; }, updateHttpClientConfig(key, value) { - httpHandler.updateHttpClientConfig(key, value); + runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); }, httpHandlerConfigs() { - return httpHandler.httpHandlerConfigs(); + return runtimeConfig.httpHandler.httpHandlerConfigs(); } }; }, "getHttpHandlerExtensionConfiguration"); @@ -81113,8 +71998,11 @@ var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensi }, "resolveHttpHandlerRuntimeConfig"); // src/Field.ts -var import_types = __nccwpck_require__(90690); -var _Field = class _Field { +var import_types = __nccwpck_require__(36158); +var Field = class { + static { + __name(this, "Field"); + } constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { this.name = name; this.kind = kind; @@ -81161,16 +72049,17 @@ var _Field = class _Field { return this.values; } }; -__name(_Field, "Field"); -var Field = _Field; // src/Fields.ts -var _Fields = class _Fields { +var Fields = class { constructor({ fields = [], encoding = "utf-8" }) { this.entries = {}; fields.forEach(this.setField.bind(this)); this.encoding = encoding; } + static { + __name(this, "Fields"); + } /** * Set entry for a {@link Field} name. The `name` * attribute will be used to key the collection. @@ -81210,12 +72099,13 @@ var _Fields = class _Fields { return Object.values(this.entries).filter((field) => field.kind === kind); } }; -__name(_Fields, "Fields"); -var Fields = _Fields; // src/httpRequest.ts -var _HttpRequest = class _HttpRequest { +var HttpRequest = class _HttpRequest { + static { + __name(this, "HttpRequest"); + } constructor(options) { this.method = options.method || "GET"; this.hostname = options.hostname || "localhost"; @@ -81265,8 +72155,6 @@ var _HttpRequest = class _HttpRequest { return _HttpRequest.clone(this); } }; -__name(_HttpRequest, "HttpRequest"); -var HttpRequest = _HttpRequest; function cloneQuery(query) { return Object.keys(query).reduce((carry, paramName) => { const param = query[paramName]; @@ -81279,7 +72167,10 @@ function cloneQuery(query) { __name(cloneQuery, "cloneQuery"); // src/httpResponse.ts -var _HttpResponse = class _HttpResponse { +var HttpResponse = class { + static { + __name(this, "HttpResponse"); + } constructor(options) { this.statusCode = options.statusCode; this.reason = options.reason; @@ -81293,8 +72184,6 @@ var _HttpResponse = class _HttpResponse { return typeof resp.statusCode === "number" && typeof resp.headers === "object"; } }; -__name(_HttpResponse, "HttpResponse"); -var HttpResponse = _HttpResponse; // src/isValidHostname.ts function isValidHostname(hostname) { @@ -81310,8 +72199,8 @@ __name(isValidHostname, "isValidHostname"); /***/ }), -/***/ 18256: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 36158: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -81335,30 +72224,162 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - buildQueryString: () => buildQueryString + AlgorithmId: () => AlgorithmId, + EndpointURLScheme: () => EndpointURLScheme, + FieldPosition: () => FieldPosition, + HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, + HttpAuthLocation: () => HttpAuthLocation, + IniSectionType: () => IniSectionType, + RequestHandlerProtocol: () => RequestHandlerProtocol, + SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig }); module.exports = __toCommonJS(src_exports); -var import_util_uri_escape = __nccwpck_require__(80146); -function buildQueryString(query) { - const parts = []; - for (let key of Object.keys(query).sort()) { - const value = query[key]; - key = (0, import_util_uri_escape.escapeUri)(key); - if (Array.isArray(value)) { - for (let i = 0, iLen = value.length; i < iLen; i++) { - parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); - } - } else { - let qsEntry = key; - if (value || typeof value === "string") { - qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; - } - parts.push(qsEntry); + +// src/auth/auth.ts +var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { + HttpAuthLocation2["HEADER"] = "header"; + HttpAuthLocation2["QUERY"] = "query"; + return HttpAuthLocation2; +})(HttpAuthLocation || {}); + +// src/auth/HttpApiKeyAuth.ts +var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { + HttpApiKeyAuthLocation2["HEADER"] = "header"; + HttpApiKeyAuthLocation2["QUERY"] = "query"; + return HttpApiKeyAuthLocation2; +})(HttpApiKeyAuthLocation || {}); + +// src/endpoint.ts +var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { + EndpointURLScheme2["HTTP"] = "http"; + EndpointURLScheme2["HTTPS"] = "https"; + return EndpointURLScheme2; +})(EndpointURLScheme || {}); + +// src/extensions/checksum.ts +var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { + AlgorithmId2["MD5"] = "md5"; + AlgorithmId2["CRC32"] = "crc32"; + AlgorithmId2["CRC32C"] = "crc32c"; + AlgorithmId2["SHA1"] = "sha1"; + AlgorithmId2["SHA256"] = "sha256"; + return AlgorithmId2; +})(AlgorithmId || {}); +var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== void 0) { + checksumAlgorithms.push({ + algorithmId: () => "sha256" /* SHA256 */, + checksumConstructor: () => runtimeConfig.sha256 + }); + } + if (runtimeConfig.md5 != void 0) { + checksumAlgorithms.push({ + algorithmId: () => "md5" /* MD5 */, + checksumConstructor: () => runtimeConfig.md5 + }); + } + return { + addChecksumAlgorithm(algo) { + checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return checksumAlgorithms; } + }; +}, "getChecksumConfiguration"); +var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}, "resolveChecksumRuntimeConfig"); + +// src/extensions/defaultClientConfiguration.ts +var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return getChecksumConfiguration(runtimeConfig); +}, "getDefaultClientConfiguration"); +var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return resolveChecksumRuntimeConfig(config); +}, "resolveDefaultRuntimeConfig"); + +// src/http.ts +var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { + FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; + FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; + return FieldPosition2; +})(FieldPosition || {}); + +// src/middleware.ts +var SMITHY_CONTEXT_KEY = "__smithy_context"; + +// src/profile.ts +var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; +})(IniSectionType || {}); + +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 73976: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - return parts.join("&"); -} -__name(buildQueryString, "buildQueryString"); + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + getSmithyContext: () => getSmithyContext, + normalizeProvider: () => normalizeProvider +}); +module.exports = __toCommonJS(src_exports); + +// src/getSmithyContext.ts +var import_types = __nccwpck_require__(36158); +var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); + +// src/normalizeProvider.ts +var normalizeProvider = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}, "normalizeProvider"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -81367,7 +72388,7 @@ __name(buildQueryString, "buildQueryString"); /***/ }), -/***/ 42058: +/***/ 9208: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -81392,82 +72413,299 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - isBrowserNetworkError: () => isBrowserNetworkError, - isClockSkewCorrectedError: () => isClockSkewCorrectedError, - isClockSkewError: () => isClockSkewError, - isRetryableByTrait: () => isRetryableByTrait, - isServerError: () => isServerError, - isThrottlingError: () => isThrottlingError, - isTransientError: () => isTransientError + constructStack: () => constructStack }); module.exports = __toCommonJS(src_exports); -// src/constants.ts -var CLOCK_SKEW_ERROR_CODES = [ - "AuthFailure", - "InvalidSignatureException", - "RequestExpired", - "RequestInTheFuture", - "RequestTimeTooSkewed", - "SignatureDoesNotMatch" -]; -var THROTTLING_ERROR_CODES = [ - "BandwidthLimitExceeded", - "EC2ThrottledException", - "LimitExceededException", - "PriorRequestNotComplete", - "ProvisionedThroughputExceededException", - "RequestLimitExceeded", - "RequestThrottled", - "RequestThrottledException", - "SlowDown", - "ThrottledException", - "Throttling", - "ThrottlingException", - "TooManyRequestsException", - "TransactionInProgressException" - // DynamoDB -]; -var TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; -var TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; -var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; -var NODEJS_NETWORK_ERROR_CODES = ["EHOSTUNREACH", "ENETUNREACH", "ENOTFOUND"]; - -// src/index.ts -var isRetryableByTrait = /* @__PURE__ */ __name((error) => error.$retryable !== void 0, "isRetryableByTrait"); -var isClockSkewError = /* @__PURE__ */ __name((error) => CLOCK_SKEW_ERROR_CODES.includes(error.name), "isClockSkewError"); -var isClockSkewCorrectedError = /* @__PURE__ */ __name((error) => error.$metadata?.clockSkewCorrected, "isClockSkewCorrectedError"); -var isBrowserNetworkError = /* @__PURE__ */ __name((error) => { - const errorMessages = /* @__PURE__ */ new Set([ - "Failed to fetch", - // Chrome - "NetworkError when attempting to fetch resource", - // Firefox - "The Internet connection appears to be offline", - // Safari 16 - "Load failed", - // Safari 17+ - "Network request failed" - // `cross-fetch` - ]); - const isValid = error && error instanceof TypeError; - if (!isValid) { - return false; +// src/MiddlewareStack.ts +var getAllAliases = /* @__PURE__ */ __name((name, aliases) => { + const _aliases = []; + if (name) { + _aliases.push(name); } - return errorMessages.has(error.message); -}, "isBrowserNetworkError"); -var isThrottlingError = /* @__PURE__ */ __name((error) => error.$metadata?.httpStatusCode === 429 || THROTTLING_ERROR_CODES.includes(error.name) || error.$retryable?.throttling == true, "isThrottlingError"); -var isTransientError = /* @__PURE__ */ __name((error, depth = 0) => isClockSkewCorrectedError(error) || TRANSIENT_ERROR_CODES.includes(error.name) || NODEJS_TIMEOUT_ERROR_CODES.includes(error?.code || "") || NODEJS_NETWORK_ERROR_CODES.includes(error?.code || "") || TRANSIENT_ERROR_STATUS_CODES.includes(error.$metadata?.httpStatusCode || 0) || isBrowserNetworkError(error) || error.cause !== void 0 && depth <= 10 && isTransientError(error.cause, depth + 1), "isTransientError"); -var isServerError = /* @__PURE__ */ __name((error) => { - if (error.$metadata?.httpStatusCode !== void 0) { - const statusCode = error.$metadata.httpStatusCode; - if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { - return true; + if (aliases) { + for (const alias of aliases) { + _aliases.push(alias); } - return false; } - return false; -}, "isServerError"); + return _aliases; +}, "getAllAliases"); +var getMiddlewareNameWithAliases = /* @__PURE__ */ __name((name, aliases) => { + return `${name || "anonymous"}${aliases && aliases.length > 0 ? ` (a.k.a. ${aliases.join(",")})` : ""}`; +}, "getMiddlewareNameWithAliases"); +var constructStack = /* @__PURE__ */ __name(() => { + let absoluteEntries = []; + let relativeEntries = []; + let identifyOnResolve = false; + const entriesNameSet = /* @__PURE__ */ new Set(); + const sort = /* @__PURE__ */ __name((entries) => entries.sort( + (a, b) => stepWeights[b.step] - stepWeights[a.step] || priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"] + ), "sort"); + const removeByName = /* @__PURE__ */ __name((toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + const aliases = getAllAliases(entry.name, entry.aliases); + if (aliases.includes(toRemove)) { + isRemoved = true; + for (const alias of aliases) { + entriesNameSet.delete(alias); + } + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, "removeByName"); + const removeByReference = /* @__PURE__ */ __name((toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + if (entry.middleware === toRemove) { + isRemoved = true; + for (const alias of getAllAliases(entry.name, entry.aliases)) { + entriesNameSet.delete(alias); + } + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, "removeByReference"); + const cloneTo = /* @__PURE__ */ __name((toStack) => { + var _a; + absoluteEntries.forEach((entry) => { + toStack.add(entry.middleware, { ...entry }); + }); + relativeEntries.forEach((entry) => { + toStack.addRelativeTo(entry.middleware, { ...entry }); + }); + (_a = toStack.identifyOnResolve) == null ? void 0 : _a.call(toStack, stack.identifyOnResolve()); + return toStack; + }, "cloneTo"); + const expandRelativeMiddlewareList = /* @__PURE__ */ __name((from) => { + const expandedMiddlewareList = []; + from.before.forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + expandedMiddlewareList.push(from); + from.after.reverse().forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + return expandedMiddlewareList; + }, "expandRelativeMiddlewareList"); + const getMiddlewareList = /* @__PURE__ */ __name((debug = false) => { + const normalizedAbsoluteEntries = []; + const normalizedRelativeEntries = []; + const normalizedEntriesNameMap = {}; + absoluteEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [] + }; + for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { + normalizedEntriesNameMap[alias] = normalizedEntry; + } + normalizedAbsoluteEntries.push(normalizedEntry); + }); + relativeEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [] + }; + for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { + normalizedEntriesNameMap[alias] = normalizedEntry; + } + normalizedRelativeEntries.push(normalizedEntry); + }); + normalizedRelativeEntries.forEach((entry) => { + if (entry.toMiddleware) { + const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; + if (toMiddleware === void 0) { + if (debug) { + return; + } + throw new Error( + `${entry.toMiddleware} is not found when adding ${getMiddlewareNameWithAliases(entry.name, entry.aliases)} middleware ${entry.relation} ${entry.toMiddleware}` + ); + } + if (entry.relation === "after") { + toMiddleware.after.push(entry); + } + if (entry.relation === "before") { + toMiddleware.before.push(entry); + } + } + }); + const mainChain = sort(normalizedAbsoluteEntries).map(expandRelativeMiddlewareList).reduce( + (wholeList, expandedMiddlewareList) => { + wholeList.push(...expandedMiddlewareList); + return wholeList; + }, + [] + ); + return mainChain; + }, "getMiddlewareList"); + const stack = { + add: (middleware, options = {}) => { + const { name, override, aliases: _aliases } = options; + const entry = { + step: "initialize", + priority: "normal", + middleware, + ...options + }; + const aliases = getAllAliases(name, _aliases); + if (aliases.length > 0) { + if (aliases.some((alias) => entriesNameSet.has(alias))) { + if (!override) + throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); + for (const alias of aliases) { + const toOverrideIndex = absoluteEntries.findIndex( + (entry2) => { + var _a; + return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); + } + ); + if (toOverrideIndex === -1) { + continue; + } + const toOverride = absoluteEntries[toOverrideIndex]; + if (toOverride.step !== entry.step || entry.priority !== toOverride.priority) { + throw new Error( + `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware with ${entry.priority} priority in ${entry.step} step.` + ); + } + absoluteEntries.splice(toOverrideIndex, 1); + } + } + for (const alias of aliases) { + entriesNameSet.add(alias); + } + } + absoluteEntries.push(entry); + }, + addRelativeTo: (middleware, options) => { + const { name, override, aliases: _aliases } = options; + const entry = { + middleware, + ...options + }; + const aliases = getAllAliases(name, _aliases); + if (aliases.length > 0) { + if (aliases.some((alias) => entriesNameSet.has(alias))) { + if (!override) + throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); + for (const alias of aliases) { + const toOverrideIndex = relativeEntries.findIndex( + (entry2) => { + var _a; + return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); + } + ); + if (toOverrideIndex === -1) { + continue; + } + const toOverride = relativeEntries[toOverrideIndex]; + if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { + throw new Error( + `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware ${entry.relation} "${entry.toMiddleware}" middleware.` + ); + } + relativeEntries.splice(toOverrideIndex, 1); + } + } + for (const alias of aliases) { + entriesNameSet.add(alias); + } + } + relativeEntries.push(entry); + }, + clone: () => cloneTo(constructStack()), + use: (plugin) => { + plugin.applyToStack(stack); + }, + remove: (toRemove) => { + if (typeof toRemove === "string") + return removeByName(toRemove); + else + return removeByReference(toRemove); + }, + removeByTag: (toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + const { tags, name, aliases: _aliases } = entry; + if (tags && tags.includes(toRemove)) { + const aliases = getAllAliases(name, _aliases); + for (const alias of aliases) { + entriesNameSet.delete(alias); + } + isRemoved = true; + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, + concat: (from) => { + var _a; + const cloned = cloneTo(constructStack()); + cloned.use(from); + cloned.identifyOnResolve( + identifyOnResolve || cloned.identifyOnResolve() || (((_a = from.identifyOnResolve) == null ? void 0 : _a.call(from)) ?? false) + ); + return cloned; + }, + applyToStack: cloneTo, + identify: () => { + return getMiddlewareList(true).map((mw) => { + const step = mw.step ?? mw.relation + " " + mw.toMiddleware; + return getMiddlewareNameWithAliases(mw.name, mw.aliases) + " - " + step; + }); + }, + identifyOnResolve(toggle) { + if (typeof toggle === "boolean") + identifyOnResolve = toggle; + return identifyOnResolve; + }, + resolve: (handler, context) => { + for (const middleware of getMiddlewareList().map((entry) => entry.middleware).reverse()) { + handler = middleware(handler, context); + } + if (identifyOnResolve) { + console.log(stack.identify()); + } + return handler; + } + }; + return stack; +}, "constructStack"); +var stepWeights = { + initialize: 5, + serialize: 4, + build: 3, + finalizeRequest: 2, + deserialize: 1 +}; +var priorityWeights = { + high: 3, + normal: 2, + low: 1 +}; // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -81476,12 +72714,14 @@ var isServerError = /* @__PURE__ */ __name((error) => { /***/ }), -/***/ 75118: +/***/ 61279: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +var __create = Object.create; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { @@ -81496,664 +72736,776 @@ var __copyProps = (to, from, except, desc) => { } return to; }; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - ALGORITHM_IDENTIFIER: () => ALGORITHM_IDENTIFIER, - ALGORITHM_IDENTIFIER_V4A: () => ALGORITHM_IDENTIFIER_V4A, - ALGORITHM_QUERY_PARAM: () => ALGORITHM_QUERY_PARAM, - ALWAYS_UNSIGNABLE_HEADERS: () => ALWAYS_UNSIGNABLE_HEADERS, - AMZ_DATE_HEADER: () => AMZ_DATE_HEADER, - AMZ_DATE_QUERY_PARAM: () => AMZ_DATE_QUERY_PARAM, - AUTH_HEADER: () => AUTH_HEADER, - CREDENTIAL_QUERY_PARAM: () => CREDENTIAL_QUERY_PARAM, - DATE_HEADER: () => DATE_HEADER, - EVENT_ALGORITHM_IDENTIFIER: () => EVENT_ALGORITHM_IDENTIFIER, - EXPIRES_QUERY_PARAM: () => EXPIRES_QUERY_PARAM, - GENERATED_HEADERS: () => GENERATED_HEADERS, - HOST_HEADER: () => HOST_HEADER, - KEY_TYPE_IDENTIFIER: () => KEY_TYPE_IDENTIFIER, - MAX_CACHE_SIZE: () => MAX_CACHE_SIZE, - MAX_PRESIGNED_TTL: () => MAX_PRESIGNED_TTL, - PROXY_HEADER_PATTERN: () => PROXY_HEADER_PATTERN, - REGION_SET_PARAM: () => REGION_SET_PARAM, - SEC_HEADER_PATTERN: () => SEC_HEADER_PATTERN, - SHA256_HEADER: () => SHA256_HEADER, - SIGNATURE_HEADER: () => SIGNATURE_HEADER, - SIGNATURE_QUERY_PARAM: () => SIGNATURE_QUERY_PARAM, - SIGNED_HEADERS_QUERY_PARAM: () => SIGNED_HEADERS_QUERY_PARAM, - SignatureV4: () => SignatureV4, - SignatureV4Base: () => SignatureV4Base, - TOKEN_HEADER: () => TOKEN_HEADER, - TOKEN_QUERY_PARAM: () => TOKEN_QUERY_PARAM, - UNSIGNABLE_PATTERNS: () => UNSIGNABLE_PATTERNS, - UNSIGNED_PAYLOAD: () => UNSIGNED_PAYLOAD, - clearCredentialCache: () => clearCredentialCache, - createScope: () => createScope, - getCanonicalHeaders: () => getCanonicalHeaders, - getCanonicalQuery: () => getCanonicalQuery, - getPayloadHash: () => getPayloadHash, - getSigningKey: () => getSigningKey, - hasHeader: () => hasHeader, - moveHeadersToQuery: () => moveHeadersToQuery, - prepareRequest: () => prepareRequest, - signatureV4aContainer: () => signatureV4aContainer + DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, + NodeHttp2Handler: () => NodeHttp2Handler, + NodeHttpHandler: () => NodeHttpHandler, + streamCollector: () => streamCollector }); module.exports = __toCommonJS(src_exports); -// src/SignatureV4.ts - -var import_util_utf85 = __nccwpck_require__(67529); +// src/node-http-handler.ts +var import_protocol_http = __nccwpck_require__(72356); +var import_querystring_builder = __nccwpck_require__(18256); +var import_http = __nccwpck_require__(58611); +var import_https = __nccwpck_require__(65692); // src/constants.ts -var ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; -var CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; -var AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; -var SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; -var EXPIRES_QUERY_PARAM = "X-Amz-Expires"; -var SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; -var TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; -var REGION_SET_PARAM = "X-Amz-Region-Set"; -var AUTH_HEADER = "authorization"; -var AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase(); -var DATE_HEADER = "date"; -var GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER]; -var SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase(); -var SHA256_HEADER = "x-amz-content-sha256"; -var TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase(); -var HOST_HEADER = "host"; -var ALWAYS_UNSIGNABLE_HEADERS = { - authorization: true, - "cache-control": true, - connection: true, - expect: true, - from: true, - "keep-alive": true, - "max-forwards": true, - pragma: true, - referer: true, - te: true, - trailer: true, - "transfer-encoding": true, - upgrade: true, - "user-agent": true, - "x-amzn-trace-id": true -}; -var PROXY_HEADER_PATTERN = /^proxy-/; -var SEC_HEADER_PATTERN = /^sec-/; -var UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i]; -var ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; -var ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256"; -var EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; -var UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; -var MAX_CACHE_SIZE = 50; -var KEY_TYPE_IDENTIFIER = "aws4_request"; -var MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; +var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; -// src/credentialDerivation.ts -var import_util_hex_encoding = __nccwpck_require__(7299); -var import_util_utf8 = __nccwpck_require__(67529); -var signingKeyCache = {}; -var cacheQueue = []; -var createScope = /* @__PURE__ */ __name((shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`, "createScope"); -var getSigningKey = /* @__PURE__ */ __name(async (sha256Constructor, credentials, shortDate, region, service) => { - const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); - const cacheKey = `${shortDate}:${region}:${service}:${(0, import_util_hex_encoding.toHex)(credsHash)}:${credentials.sessionToken}`; - if (cacheKey in signingKeyCache) { - return signingKeyCache[cacheKey]; - } - cacheQueue.push(cacheKey); - while (cacheQueue.length > MAX_CACHE_SIZE) { - delete signingKeyCache[cacheQueue.shift()]; - } - let key = `AWS4${credentials.secretAccessKey}`; - for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) { - key = await hmac(sha256Constructor, key, signable); - } - return signingKeyCache[cacheKey] = key; -}, "getSigningKey"); -var clearCredentialCache = /* @__PURE__ */ __name(() => { - cacheQueue.length = 0; - Object.keys(signingKeyCache).forEach((cacheKey) => { - delete signingKeyCache[cacheKey]; - }); -}, "clearCredentialCache"); -var hmac = /* @__PURE__ */ __name((ctor, secret, data) => { - const hash = new ctor(secret); - hash.update((0, import_util_utf8.toUint8Array)(data)); - return hash.digest(); -}, "hmac"); +// src/get-transformed-headers.ts +var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; +}, "getTransformedHeaders"); -// src/getCanonicalHeaders.ts -var getCanonicalHeaders = /* @__PURE__ */ __name(({ headers }, unsignableHeaders, signableHeaders) => { - const canonical = {}; - for (const headerName of Object.keys(headers).sort()) { - if (headers[headerName] == void 0) { - continue; - } - const canonicalHeaderName = headerName.toLowerCase(); - if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS || unsignableHeaders?.has(canonicalHeaderName) || PROXY_HEADER_PATTERN.test(canonicalHeaderName) || SEC_HEADER_PATTERN.test(canonicalHeaderName)) { - if (!signableHeaders || signableHeaders && !signableHeaders.has(canonicalHeaderName)) { - continue; +// src/timing.ts +var timing = { + setTimeout: (cb, ms) => setTimeout(cb, ms), + clearTimeout: (timeoutId) => clearTimeout(timeoutId) +}; + +// src/set-connection-timeout.ts +var DEFER_EVENT_LISTENER_TIME = 1e3; +var setConnectionTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return -1; + } + const registerTimeout = /* @__PURE__ */ __name((offset) => { + const timeoutId = timing.setTimeout(() => { + request.destroy(); + reject( + Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError" + }) + ); + }, timeoutInMs - offset); + const doWithSocket = /* @__PURE__ */ __name((socket) => { + if (socket == null ? void 0 : socket.connecting) { + socket.on("connect", () => { + timing.clearTimeout(timeoutId); + }); + } else { + timing.clearTimeout(timeoutId); } + }, "doWithSocket"); + if (request.socket) { + doWithSocket(request.socket); + } else { + request.on("socket", doWithSocket); } - canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); + }, "registerTimeout"); + if (timeoutInMs < 2e3) { + registerTimeout(0); + return 0; } - return canonical; -}, "getCanonicalHeaders"); - -// src/getPayloadHash.ts -var import_is_array_buffer = __nccwpck_require__(52706); + return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); +}, "setConnectionTimeout"); -var import_util_utf82 = __nccwpck_require__(67529); -var getPayloadHash = /* @__PURE__ */ __name(async ({ headers, body }, hashConstructor) => { - for (const headerName of Object.keys(headers)) { - if (headerName.toLowerCase() === SHA256_HEADER) { - return headers[headerName]; - } +// src/set-socket-keep-alive.ts +var DEFER_EVENT_LISTENER_TIME2 = 3e3; +var setSocketKeepAlive = /* @__PURE__ */ __name((request, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { + if (keepAlive !== true) { + return -1; } - if (body == void 0) { - return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; - } else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, import_is_array_buffer.isArrayBuffer)(body)) { - const hashCtor = new hashConstructor(); - hashCtor.update((0, import_util_utf82.toUint8Array)(body)); - return (0, import_util_hex_encoding.toHex)(await hashCtor.digest()); + const registerListener = /* @__PURE__ */ __name(() => { + if (request.socket) { + request.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + } else { + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); + } + }, "registerListener"); + if (deferTimeMs === 0) { + registerListener(); + return 0; } - return UNSIGNED_PAYLOAD; -}, "getPayloadHash"); + return timing.setTimeout(registerListener, deferTimeMs); +}, "setSocketKeepAlive"); -// src/HeaderFormatter.ts +// src/set-socket-timeout.ts +var DEFER_EVENT_LISTENER_TIME3 = 3e3; +var setSocketTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { + const registerTimeout = /* @__PURE__ */ __name((offset) => { + request.setTimeout(timeoutInMs - offset, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); + }, "registerTimeout"); + if (0 < timeoutInMs && timeoutInMs < 6e3) { + registerTimeout(0); + return 0; + } + return timing.setTimeout( + registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), + DEFER_EVENT_LISTENER_TIME3 + ); +}, "setSocketTimeout"); -var import_util_utf83 = __nccwpck_require__(67529); -var HeaderFormatter = class { - static { - __name(this, "HeaderFormatter"); +// src/write-request-body.ts +var import_stream = __nccwpck_require__(2203); +var MIN_WAIT_TIME = 1e3; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + const headers = request.headers ?? {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let sendBody = true; + if (expect === "100-continue") { + sendBody = await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(timing.setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + timing.clearTimeout(timeoutId); + resolve(true); + }); + httpRequest.on("response", () => { + timing.clearTimeout(timeoutId); + resolve(false); + }); + httpRequest.on("error", () => { + timing.clearTimeout(timeoutId); + resolve(false); + }); + }) + ]); } - format(headers) { - const chunks = []; - for (const headerName of Object.keys(headers)) { - const bytes = (0, import_util_utf83.fromUtf8)(headerName); - chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); - } - const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); - let position = 0; - for (const chunk of chunks) { - out.set(chunk, position); - position += chunk.byteLength; - } - return out; + if (sendBody) { + writeBody(httpRequest, request.body); } - formatHeaderValue(header) { - switch (header.type) { - case "boolean": - return Uint8Array.from([header.value ? 0 /* boolTrue */ : 1 /* boolFalse */]); - case "byte": - return Uint8Array.from([2 /* byte */, header.value]); - case "short": - const shortView = new DataView(new ArrayBuffer(3)); - shortView.setUint8(0, 3 /* short */); - shortView.setInt16(1, header.value, false); - return new Uint8Array(shortView.buffer); - case "integer": - const intView = new DataView(new ArrayBuffer(5)); - intView.setUint8(0, 4 /* integer */); - intView.setInt32(1, header.value, false); - return new Uint8Array(intView.buffer); - case "long": - const longBytes = new Uint8Array(9); - longBytes[0] = 5 /* long */; - longBytes.set(header.value.bytes, 1); - return longBytes; - case "binary": - const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); - binView.setUint8(0, 6 /* byteArray */); - binView.setUint16(1, header.value.byteLength, false); - const binBytes = new Uint8Array(binView.buffer); - binBytes.set(header.value, 3); - return binBytes; - case "string": - const utf8Bytes = (0, import_util_utf83.fromUtf8)(header.value); - const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); - strView.setUint8(0, 7 /* string */); - strView.setUint16(1, utf8Bytes.byteLength, false); - const strBytes = new Uint8Array(strView.buffer); - strBytes.set(utf8Bytes, 3); - return strBytes; - case "timestamp": - const tsBytes = new Uint8Array(9); - tsBytes[0] = 8 /* timestamp */; - tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1); - return tsBytes; - case "uuid": - if (!UUID_PATTERN.test(header.value)) { - throw new Error(`Invalid UUID received: ${header.value}`); - } - const uuidBytes = new Uint8Array(17); - uuidBytes[0] = 9 /* uuid */; - uuidBytes.set((0, import_util_hex_encoding.fromHex)(header.value.replace(/\-/g, "")), 1); - return uuidBytes; - } +} +__name(writeRequestBody, "writeRequestBody"); +function writeBody(httpRequest, body) { + if (body instanceof import_stream.Readable) { + body.pipe(httpRequest); + return; } -}; -var UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; -var Int64 = class _Int64 { - constructor(bytes) { - this.bytes = bytes; - if (bytes.byteLength !== 8) { - throw new Error("Int64 buffers must be exactly 8 bytes"); + if (body) { + if (Buffer.isBuffer(body) || typeof body === "string") { + httpRequest.end(body); + return; + } + const uint8 = body; + if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { + httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); + return; } + httpRequest.end(Buffer.from(body)); + return; } - static { - __name(this, "Int64"); + httpRequest.end(); +} +__name(writeBody, "writeBody"); + +// src/node-http-handler.ts +var DEFAULT_REQUEST_TIMEOUT = 0; +var _NodeHttpHandler = class _NodeHttpHandler { + constructor(options) { + this.socketWarningTimestamp = 0; + // Node http handler is hard-coded to http/1.1: https://github.com/nodejs/node/blob/ff5664b83b89c55e4ab5d5f60068fb457f1f5872/lib/_http_server.js#L286 + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }).catch(reject); + } else { + resolve(this.resolveDefaultConfig(options)); + } + }); } - static fromNumber(number) { - if (number > 9223372036854776e3 || number < -9223372036854776e3) { - throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); - } - const bytes = new Uint8Array(8); - for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { - bytes[i] = remaining; - } - if (number < 0) { - negate(bytes); + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } - return new _Int64(bytes); + return new _NodeHttpHandler(instanceOrOptions); } /** - * Called implicitly by infix arithmetic operators. + * @internal + * + * @param agent - http(s) agent in use by the NodeHttpHandler instance. + * @param socketWarningTimestamp - last socket usage check timestamp. + * @param logger - channel for the warning. + * @returns timestamp of last emitted warning. */ - valueOf() { - const bytes = this.bytes.slice(0); - const negative = bytes[0] & 128; - if (negative) { - negate(bytes); + static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { + var _a, _b, _c; + const { sockets, requests, maxSockets } = agent; + if (typeof maxSockets !== "number" || maxSockets === Infinity) { + return socketWarningTimestamp; } - return parseInt((0, import_util_hex_encoding.toHex)(bytes), 16) * (negative ? -1 : 1); - } - toString() { - return String(this.valueOf()); + const interval = 15e3; + if (Date.now() - interval < socketWarningTimestamp) { + return socketWarningTimestamp; + } + if (sockets && requests) { + for (const origin in sockets) { + const socketsInUse = ((_a = sockets[origin]) == null ? void 0 : _a.length) ?? 0; + const requestsEnqueued = ((_b = requests[origin]) == null ? void 0 : _b.length) ?? 0; + if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { + (_c = logger == null ? void 0 : logger.warn) == null ? void 0 : _c.call( + logger, + `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. +See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html +or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` + ); + return Date.now(); + } + } + } + return socketWarningTimestamp; } -}; -function negate(bytes) { - for (let i = 0; i < 8; i++) { - bytes[i] ^= 255; + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout ?? socketTimeout, + httpAgent: (() => { + if (httpAgent instanceof import_http.Agent || typeof (httpAgent == null ? void 0 : httpAgent.destroy) === "function") { + return httpAgent; + } + return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); + })(), + httpsAgent: (() => { + if (httpsAgent instanceof import_https.Agent || typeof (httpsAgent == null ? void 0 : httpsAgent.destroy) === "function") { + return httpsAgent; + } + return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); + })(), + logger: console + }; } - for (let i = 7; i > -1; i--) { - bytes[i]++; - if (bytes[i] !== 0) - break; + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) == null ? void 0 : _a.httpAgent) == null ? void 0 : _b.destroy(); + (_d = (_c = this.config) == null ? void 0 : _c.httpsAgent) == null ? void 0 : _d.destroy(); } -} -__name(negate, "negate"); - -// src/headerUtil.ts -var hasHeader = /* @__PURE__ */ __name((soughtHeader, headers) => { - soughtHeader = soughtHeader.toLowerCase(); - for (const headerName of Object.keys(headers)) { - if (soughtHeader === headerName.toLowerCase()) { - return true; + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; } + return new Promise((_resolve, _reject) => { + let writeRequestBodyPromise = void 0; + const timeouts = []; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(timing.clearTimeout); + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(timing.clearTimeout); + _reject(arg); + }, "reject"); + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal == null ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; + timeouts.push( + timing.setTimeout( + () => { + this.socketWarningTimestamp = _NodeHttpHandler.checkSocketUsage( + agent, + this.socketWarningTimestamp, + this.config.logger + ); + }, + this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) + ) + ); + const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); + let auth = void 0; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + let hostname = request.hostname ?? ""; + if (hostname[0] === "[" && hostname.endsWith("]")) { + hostname = request.hostname.slice(1, -1); + } else { + hostname = request.hostname; + } + const nodeHttpsOptions = { + headers: request.headers, + host: hostname, + method: request.method, + path, + port: request.port, + agent, + auth + }; + const requestFunc = isSSL ? import_https.request : import_http.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new import_protocol_http.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: getTransformedHeaders(res.headers), + body: res + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } else { + reject(err); + } + }); + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.destroy(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; + } + } + timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); + timeouts.push(setSocketTimeout(req, reject, this.config.requestTimeout)); + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + timeouts.push( + setSocketKeepAlive(req, { + // @ts-expect-error keepAlive is not public on httpAgent. + keepAlive: httpAgent.keepAlive, + // @ts-expect-error keepAliveMsecs is not public on httpAgent. + keepAliveMsecs: httpAgent.keepAliveMsecs + }) + ); + } + writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { + timeouts.forEach(timing.clearTimeout); + return _reject(e); + }); + }); } - return false; -}, "hasHeader"); - -// src/moveHeadersToQuery.ts -var import_protocol_http = __nccwpck_require__(74996); -var moveHeadersToQuery = /* @__PURE__ */ __name((request, options = {}) => { - const { headers, query = {} } = import_protocol_http.HttpRequest.clone(request); - for (const name of Object.keys(headers)) { - const lname = name.toLowerCase(); - if (lname.slice(0, 6) === "x-amz-" && !options.unhoistableHeaders?.has(lname) || options.hoistableHeaders?.has(lname)) { - query[name] = headers[name]; - delete headers[name]; - } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); } - return { - ...request, - headers, - query - }; -}, "moveHeadersToQuery"); - -// src/prepareRequest.ts - -var prepareRequest = /* @__PURE__ */ __name((request) => { - request = import_protocol_http.HttpRequest.clone(request); - for (const headerName of Object.keys(request.headers)) { - if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { - delete request.headers[headerName]; - } + httpHandlerConfigs() { + return this.config ?? {}; } - return request; -}, "prepareRequest"); +}; +__name(_NodeHttpHandler, "NodeHttpHandler"); +var NodeHttpHandler = _NodeHttpHandler; -// src/SignatureV4Base.ts +// src/node-http2-handler.ts -var import_util_middleware = __nccwpck_require__(83732); -var import_util_utf84 = __nccwpck_require__(67529); +var import_http22 = __nccwpck_require__(85675); -// src/getCanonicalQuery.ts -var import_util_uri_escape = __nccwpck_require__(87938); -var getCanonicalQuery = /* @__PURE__ */ __name(({ query = {} }) => { - const keys = []; - const serialized = {}; - for (const key of Object.keys(query)) { - if (key.toLowerCase() === SIGNATURE_HEADER) { - continue; - } - const encodedKey = (0, import_util_uri_escape.escapeUri)(key); - keys.push(encodedKey); - const value = query[key]; - if (typeof value === "string") { - serialized[encodedKey] = `${encodedKey}=${(0, import_util_uri_escape.escapeUri)(value)}`; - } else if (Array.isArray(value)) { - serialized[encodedKey] = value.slice(0).reduce((encoded, value2) => encoded.concat([`${encodedKey}=${(0, import_util_uri_escape.escapeUri)(value2)}`]), []).sort().join("&"); +// src/node-http2-connection-manager.ts +var import_http2 = __toESM(__nccwpck_require__(85675)); + +// src/node-http2-connection-pool.ts +var _NodeHttp2ConnectionPool = class _NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions ?? []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); } } - return keys.sort().map((key) => serialized[key]).filter((serialized2) => serialized2).join("&"); -}, "getCanonicalQuery"); - -// src/utilDate.ts -var iso8601 = /* @__PURE__ */ __name((time) => toDate(time).toISOString().replace(/\.\d{3}Z$/, "Z"), "iso8601"); -var toDate = /* @__PURE__ */ __name((time) => { - if (typeof time === "number") { - return new Date(time * 1e3); + offerLast(session) { + this.sessions.push(session); } - if (typeof time === "string") { - if (Number(time)) { - return new Date(Number(time) * 1e3); + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } } - return new Date(time); } - return time; -}, "toDate"); +}; +__name(_NodeHttp2ConnectionPool, "NodeHttp2ConnectionPool"); +var NodeHttp2ConnectionPool = _NodeHttp2ConnectionPool; -// src/SignatureV4Base.ts -var SignatureV4Base = class { - static { - __name(this, "SignatureV4Base"); +// src/node-http2-connection-manager.ts +var _NodeHttp2ConnectionManager = class _NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = /* @__PURE__ */ new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } } - constructor({ - applyChecksum, - credentials, - region, - service, - sha256, - uriEscapePath = true - }) { - this.service = service; - this.sha256 = sha256; - this.uriEscapePath = uriEscapePath; - this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; - this.regionProvider = (0, import_util_middleware.normalizeProvider)(region); - this.credentialProvider = (0, import_util_middleware.normalizeProvider)(credentials); + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = import_http2.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error( + "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() + ); + } + }); + } + session.unref(); + const destroySessionCb = /* @__PURE__ */ __name(() => { + session.destroy(); + this.deleteSession(url, session); + }, "destroySessionCb"); + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; } - createCanonicalRequest(request, canonicalHeaders, payloadHash) { - const sortedHeaders = Object.keys(canonicalHeaders).sort(); - return `${request.method} -${this.getCanonicalPath(request)} -${getCanonicalQuery(request)} -${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} - -${sortedHeaders.join(";")} -${payloadHash}`; + /** + * Delete a session from the connection pool. + * @param authority The authority of the session to delete. + * @param session The session to delete. + */ + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); } - async createStringToSign(longDate, credentialScope, canonicalRequest, algorithmIdentifier) { - const hash = new this.sha256(); - hash.update((0, import_util_utf84.toUint8Array)(canonicalRequest)); - const hashedRequest = await hash.digest(); - return `${algorithmIdentifier} -${longDate} -${credentialScope} -${(0, import_util_hex_encoding.toHex)(hashedRequest)}`; + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) == null ? void 0 : _a.offerLast(session); } - getCanonicalPath({ path }) { - if (this.uriEscapePath) { - const normalizedPathSegments = []; - for (const pathSegment of path.split("/")) { - if (pathSegment?.length === 0) - continue; - if (pathSegment === ".") - continue; - if (pathSegment === "..") { - normalizedPathSegments.pop(); - } else { - normalizedPathSegments.push(pathSegment); + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); } + connectionPool.remove(session); } - const normalizedPath = `${path?.startsWith("/") ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && path?.endsWith("/") ? "/" : ""}`; - const doubleEncoded = (0, import_util_uri_escape.escapeUri)(normalizedPath); - return doubleEncoded.replace(/%2F/g, "/"); + this.sessionCache.delete(key); } - return path; } - validateResolvedCredentials(credentials) { - if (typeof credentials !== "object" || // @ts-expect-error: Property 'accessKeyId' does not exist on type 'object'.ts(2339) - typeof credentials.accessKeyId !== "string" || // @ts-expect-error: Property 'secretAccessKey' does not exist on type 'object'.ts(2339) - typeof credentials.secretAccessKey !== "string") { - throw new Error("Resolved credential object is not valid"); + setMaxConcurrentStreams(maxConcurrentStreams) { + if (maxConcurrentStreams && maxConcurrentStreams <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); } + this.config.maxConcurrency = maxConcurrentStreams; } - formatDate(now) { - const longDate = iso8601(now).replace(/[\-:]/g, ""); - return { - longDate, - shortDate: longDate.slice(0, 8) - }; + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; } - getCanonicalHeaderList(headers) { - return Object.keys(headers).sort().join(";"); + getUrlString(request) { + return request.destination.toString(); } }; +__name(_NodeHttp2ConnectionManager, "NodeHttp2ConnectionManager"); +var NodeHttp2ConnectionManager = _NodeHttp2ConnectionManager; -// src/SignatureV4.ts -var SignatureV4 = class extends SignatureV4Base { - constructor({ - applyChecksum, - credentials, - region, - service, - sha256, - uriEscapePath = true - }) { - super({ - applyChecksum, - credentials, - region, - service, - sha256, - uriEscapePath +// src/node-http2-handler.ts +var _NodeHttp2Handler = class _NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((opts) => { + resolve(opts || {}); + }).catch(reject); + } else { + resolve(options || {}); + } }); - this.headerFormatter = new HeaderFormatter(); - } - static { - __name(this, "SignatureV4"); - } - async presign(originalRequest, options = {}) { - const { - signingDate = /* @__PURE__ */ new Date(), - expiresIn = 3600, - unsignableHeaders, - unhoistableHeaders, - signableHeaders, - hoistableHeaders, - signingRegion, - signingService - } = options; - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const { longDate, shortDate } = this.formatDate(signingDate); - if (expiresIn > MAX_PRESIGNED_TTL) { - return Promise.reject( - "Signature version 4 presigned URLs must have an expiration date less than one week in the future" - ); - } - const scope = createScope(shortDate, region, signingService ?? this.service); - const request = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders, hoistableHeaders }); - if (credentials.sessionToken) { - request.query[TOKEN_QUERY_PARAM] = credentials.sessionToken; - } - request.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER; - request.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; - request.query[AMZ_DATE_QUERY_PARAM] = longDate; - request.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10); - const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); - request.query[SIGNED_HEADERS_QUERY_PARAM] = this.getCanonicalHeaderList(canonicalHeaders); - request.query[SIGNATURE_QUERY_PARAM] = await this.getSignature( - longDate, - scope, - this.getSigningKey(credentials, region, shortDate, signingService), - this.createCanonicalRequest(request, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)) - ); - return request; } - async sign(toSign, options) { - if (typeof toSign === "string") { - return this.signString(toSign, options); - } else if (toSign.headers && toSign.payload) { - return this.signEvent(toSign, options); - } else if (toSign.message) { - return this.signMessage(toSign, options); - } else { - return this.signRequest(toSign, options); + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; } + return new _NodeHttp2Handler(instanceOrOptions); } - async signEvent({ headers, payload }, { signingDate = /* @__PURE__ */ new Date(), priorSignature, signingRegion, signingService }) { - const region = signingRegion ?? await this.regionProvider(); - const { shortDate, longDate } = this.formatDate(signingDate); - const scope = createScope(shortDate, region, signingService ?? this.service); - const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256); - const hash = new this.sha256(); - hash.update(headers); - const hashedHeaders = (0, import_util_hex_encoding.toHex)(await hash.digest()); - const stringToSign = [ - EVENT_ALGORITHM_IDENTIFIER, - longDate, - scope, - priorSignature, - hashedHeaders, - hashedPayload - ].join("\n"); - return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); + destroy() { + this.connectionManager.destroy(); } - async signMessage(signableMessage, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService }) { - const promise = this.signEvent( - { - headers: this.headerFormatter.format(signableMessage.message.headers), - payload: signableMessage.message.body - }, - { - signingDate, - signingRegion, - signingService, - priorSignature: signableMessage.priorSignature + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); } - ); - return promise.then((signature) => { - return { message: signableMessage.message, signature }; + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a; + let fulfilled = false; + let writeRequestBodyPromise = void 0; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }, "reject"); + if (abortSignal == null ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_a = this.config) == null ? void 0 : _a.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false + }); + const rejectWithDestroy = /* @__PURE__ */ __name((err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }, "rejectWithDestroy"); + const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [import_http22.constants.HTTP2_HEADER_PATH]: path, + [import_http22.constants.HTTP2_HEADER_METHOD]: method + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new import_protocol_http.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: getTransformedHeaders(headers), + body: req + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } else { + abortSignal.onabort = onAbort; + } + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy( + new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) + ); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); }); } - async signString(stringToSign, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService } = {}) { - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const { shortDate } = this.formatDate(signingDate); - const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); - hash.update((0, import_util_utf85.toUint8Array)(stringToSign)); - return (0, import_util_hex_encoding.toHex)(await hash.digest()); - } - async signRequest(requestToSign, { - signingDate = /* @__PURE__ */ new Date(), - signableHeaders, - unsignableHeaders, - signingRegion, - signingService - } = {}) { - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const request = prepareRequest(requestToSign); - const { longDate, shortDate } = this.formatDate(signingDate); - const scope = createScope(shortDate, region, signingService ?? this.service); - request.headers[AMZ_DATE_HEADER] = longDate; - if (credentials.sessionToken) { - request.headers[TOKEN_HEADER] = credentials.sessionToken; - } - const payloadHash = await getPayloadHash(request, this.sha256); - if (!hasHeader(SHA256_HEADER, request.headers) && this.applyChecksum) { - request.headers[SHA256_HEADER] = payloadHash; - } - const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); - const signature = await this.getSignature( - longDate, - scope, - this.getSigningKey(credentials, region, shortDate, signingService), - this.createCanonicalRequest(request, canonicalHeaders, payloadHash) - ); - request.headers[AUTH_HEADER] = `${ALGORITHM_IDENTIFIER} Credential=${credentials.accessKeyId}/${scope}, SignedHeaders=${this.getCanonicalHeaderList(canonicalHeaders)}, Signature=${signature}`; - return request; + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); } - async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { - const stringToSign = await this.createStringToSign( - longDate, - credentialScope, - canonicalRequest, - ALGORITHM_IDENTIFIER - ); - const hash = new this.sha256(await keyPromise); - hash.update((0, import_util_utf85.toUint8Array)(stringToSign)); - return (0, import_util_hex_encoding.toHex)(await hash.digest()); + httpHandlerConfigs() { + return this.config ?? {}; } - getSigningKey(credentials, region, shortDate, service) { - return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service); + /** + * Destroys a session. + * @param session The session to destroy. + */ + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } } }; +__name(_NodeHttp2Handler, "NodeHttp2Handler"); +var NodeHttp2Handler = _NodeHttp2Handler; -// src/signature-v4a-container.ts -var signatureV4aContainer = { - SignatureV4a: null -}; -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 52706: -/***/ ((module) => { +// src/stream-collector/collector.ts -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +var _Collector = class _Collector extends import_stream.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); } - return to; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +__name(_Collector, "Collector"); +var Collector = _Collector; -// src/index.ts -var src_exports = {}; -__export(src_exports, { - isArrayBuffer: () => isArrayBuffer -}); -module.exports = __toCommonJS(src_exports); -var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); +// src/stream-collector/index.ts +var streamCollector = /* @__PURE__ */ __name((stream) => { + if (isReadableStreamInstance(stream)) { + return collectReadableStream(stream); + } + return new Promise((resolve, reject) => { + const collector = new Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function() { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); + }); +}, "streamCollector"); +var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); +async function collectReadableStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +__name(collectReadableStream, "collectReadableStream"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -82162,7 +73514,7 @@ var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "func /***/ }), -/***/ 74996: +/***/ 72356: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -82200,18 +73552,19 @@ module.exports = __toCommonJS(src_exports); // src/extensions/httpExtensionConfiguration.ts var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; return { setHttpHandler(handler) { - runtimeConfig.httpHandler = handler; + httpHandler = handler; }, httpHandler() { - return runtimeConfig.httpHandler; + return httpHandler; }, updateHttpClientConfig(key, value) { - runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); + httpHandler.updateHttpClientConfig(key, value); }, httpHandlerConfigs() { - return runtimeConfig.httpHandler.httpHandlerConfigs(); + return httpHandler.httpHandlerConfigs(); } }; }, "getHttpHandlerExtensionConfiguration"); @@ -82222,11 +73575,8 @@ var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensi }, "resolveHttpHandlerRuntimeConfig"); // src/Field.ts -var import_types = __nccwpck_require__(59442); -var Field = class { - static { - __name(this, "Field"); - } +var import_types = __nccwpck_require__(90690); +var _Field = class _Field { constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { this.name = name; this.kind = kind; @@ -82273,17 +73623,16 @@ var Field = class { return this.values; } }; +__name(_Field, "Field"); +var Field = _Field; // src/Fields.ts -var Fields = class { +var _Fields = class _Fields { constructor({ fields = [], encoding = "utf-8" }) { this.entries = {}; fields.forEach(this.setField.bind(this)); this.encoding = encoding; } - static { - __name(this, "Fields"); - } /** * Set entry for a {@link Field} name. The `name` * attribute will be used to key the collection. @@ -82323,13 +73672,12 @@ var Fields = class { return Object.values(this.entries).filter((field) => field.kind === kind); } }; +__name(_Fields, "Fields"); +var Fields = _Fields; // src/httpRequest.ts -var HttpRequest = class _HttpRequest { - static { - __name(this, "HttpRequest"); - } +var _HttpRequest = class _HttpRequest { constructor(options) { this.method = options.method || "GET"; this.hostname = options.hostname || "localhost"; @@ -82379,6 +73727,8 @@ var HttpRequest = class _HttpRequest { return _HttpRequest.clone(this); } }; +__name(_HttpRequest, "HttpRequest"); +var HttpRequest = _HttpRequest; function cloneQuery(query) { return Object.keys(query).reduce((carry, paramName) => { const param = query[paramName]; @@ -82391,10 +73741,7 @@ function cloneQuery(query) { __name(cloneQuery, "cloneQuery"); // src/httpResponse.ts -var HttpResponse = class { - static { - __name(this, "HttpResponse"); - } +var _HttpResponse = class _HttpResponse { constructor(options) { this.statusCode = options.statusCode; this.reason = options.reason; @@ -82408,6 +73755,8 @@ var HttpResponse = class { return typeof resp.statusCode === "number" && typeof resp.headers === "object"; } }; +__name(_HttpResponse, "HttpResponse"); +var HttpResponse = _HttpResponse; // src/isValidHostname.ts function isValidHostname(hostname) { @@ -82423,147 +73772,7 @@ __name(isValidHostname, "isValidHostname"); /***/ }), -/***/ 59442: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - AlgorithmId: () => AlgorithmId, - EndpointURLScheme: () => EndpointURLScheme, - FieldPosition: () => FieldPosition, - HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, - HttpAuthLocation: () => HttpAuthLocation, - IniSectionType: () => IniSectionType, - RequestHandlerProtocol: () => RequestHandlerProtocol, - SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig -}); -module.exports = __toCommonJS(src_exports); - -// src/auth/auth.ts -var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { - HttpAuthLocation2["HEADER"] = "header"; - HttpAuthLocation2["QUERY"] = "query"; - return HttpAuthLocation2; -})(HttpAuthLocation || {}); - -// src/auth/HttpApiKeyAuth.ts -var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { - HttpApiKeyAuthLocation2["HEADER"] = "header"; - HttpApiKeyAuthLocation2["QUERY"] = "query"; - return HttpApiKeyAuthLocation2; -})(HttpApiKeyAuthLocation || {}); - -// src/endpoint.ts -var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { - EndpointURLScheme2["HTTP"] = "http"; - EndpointURLScheme2["HTTPS"] = "https"; - return EndpointURLScheme2; -})(EndpointURLScheme || {}); - -// src/extensions/checksum.ts -var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { - AlgorithmId2["MD5"] = "md5"; - AlgorithmId2["CRC32"] = "crc32"; - AlgorithmId2["CRC32C"] = "crc32c"; - AlgorithmId2["SHA1"] = "sha1"; - AlgorithmId2["SHA256"] = "sha256"; - return AlgorithmId2; -})(AlgorithmId || {}); -var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const checksumAlgorithms = []; - if (runtimeConfig.sha256 !== void 0) { - checksumAlgorithms.push({ - algorithmId: () => "sha256" /* SHA256 */, - checksumConstructor: () => runtimeConfig.sha256 - }); - } - if (runtimeConfig.md5 != void 0) { - checksumAlgorithms.push({ - algorithmId: () => "md5" /* MD5 */, - checksumConstructor: () => runtimeConfig.md5 - }); - } - return { - addChecksumAlgorithm(algo) { - checksumAlgorithms.push(algo); - }, - checksumAlgorithms() { - return checksumAlgorithms; - } - }; -}, "getChecksumConfiguration"); -var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { - const runtimeConfig = {}; - clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { - runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); - }); - return runtimeConfig; -}, "resolveChecksumRuntimeConfig"); - -// src/extensions/defaultClientConfiguration.ts -var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return getChecksumConfiguration(runtimeConfig); -}, "getDefaultClientConfiguration"); -var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return resolveChecksumRuntimeConfig(config); -}, "resolveDefaultRuntimeConfig"); - -// src/http.ts -var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { - FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; - FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; - return FieldPosition2; -})(FieldPosition || {}); - -// src/middleware.ts -var SMITHY_CONTEXT_KEY = "__smithy_context"; - -// src/profile.ts -var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { - IniSectionType2["PROFILE"] = "profile"; - IniSectionType2["SSO_SESSION"] = "sso-session"; - IniSectionType2["SERVICES"] = "services"; - return IniSectionType2; -})(IniSectionType || {}); - -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 91207: +/***/ 18256: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -82588,144 +73797,30 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - fromArrayBuffer: () => fromArrayBuffer, - fromString: () => fromString -}); -module.exports = __toCommonJS(src_exports); -var import_is_array_buffer = __nccwpck_require__(52706); -var import_buffer = __nccwpck_require__(20181); -var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { - if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { - throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); - } - return import_buffer.Buffer.from(input, offset, length); -}, "fromArrayBuffer"); -var fromString = /* @__PURE__ */ __name((input, encoding) => { - if (typeof input !== "string") { - throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); - } - return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); -}, "fromString"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 7299: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - fromHex: () => fromHex, - toHex: () => toHex + buildQueryString: () => buildQueryString }); module.exports = __toCommonJS(src_exports); -var SHORT_TO_HEX = {}; -var HEX_TO_SHORT = {}; -for (let i = 0; i < 256; i++) { - let encodedByte = i.toString(16).toLowerCase(); - if (encodedByte.length === 1) { - encodedByte = `0${encodedByte}`; - } - SHORT_TO_HEX[i] = encodedByte; - HEX_TO_SHORT[encodedByte] = i; -} -function fromHex(encoded) { - if (encoded.length % 2 !== 0) { - throw new Error("Hex encoded strings must have an even number length"); - } - const out = new Uint8Array(encoded.length / 2); - for (let i = 0; i < encoded.length; i += 2) { - const encodedByte = encoded.slice(i, i + 2).toLowerCase(); - if (encodedByte in HEX_TO_SHORT) { - out[i / 2] = HEX_TO_SHORT[encodedByte]; +var import_util_uri_escape = __nccwpck_require__(80146); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, import_util_uri_escape.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); + } } else { - throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; + } + parts.push(qsEntry); } } - return out; -} -__name(fromHex, "fromHex"); -function toHex(bytes) { - let out = ""; - for (let i = 0; i < bytes.byteLength; i++) { - out += SHORT_TO_HEX[bytes[i]]; - } - return out; + return parts.join("&"); } -__name(toHex, "toHex"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 83732: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - getSmithyContext: () => getSmithyContext, - normalizeProvider: () => normalizeProvider -}); -module.exports = __toCommonJS(src_exports); - -// src/getSmithyContext.ts -var import_types = __nccwpck_require__(59442); -var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - -// src/normalizeProvider.ts -var normalizeProvider = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; -}, "normalizeProvider"); +__name(buildQueryString, "buildQueryString"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -82734,7 +73829,7 @@ var normalizeProvider = /* @__PURE__ */ __name((input) => { /***/ }), -/***/ 87938: +/***/ 42058: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -82759,88 +73854,82 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - escapeUri: () => escapeUri, - escapeUriPath: () => escapeUriPath -}); -module.exports = __toCommonJS(src_exports); - -// src/escape-uri.ts -var escapeUri = /* @__PURE__ */ __name((uri) => ( - // AWS percent-encodes some extra non-standard characters in a URI - encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) -), "escapeUri"); -var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); - -// src/escape-uri-path.ts -var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 67529: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - fromUtf8: () => fromUtf8, - toUint8Array: () => toUint8Array, - toUtf8: () => toUtf8 -}); -module.exports = __toCommonJS(src_exports); - -// src/fromUtf8.ts -var import_util_buffer_from = __nccwpck_require__(91207); -var fromUtf8 = /* @__PURE__ */ __name((input) => { - const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); - return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); -}, "fromUtf8"); - -// src/toUint8Array.ts -var toUint8Array = /* @__PURE__ */ __name((data) => { - if (typeof data === "string") { - return fromUtf8(data); - } - if (ArrayBuffer.isView(data)) { - return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); - } - return new Uint8Array(data); -}, "toUint8Array"); + isBrowserNetworkError: () => isBrowserNetworkError, + isClockSkewCorrectedError: () => isClockSkewCorrectedError, + isClockSkewError: () => isClockSkewError, + isRetryableByTrait: () => isRetryableByTrait, + isServerError: () => isServerError, + isThrottlingError: () => isThrottlingError, + isTransientError: () => isTransientError +}); +module.exports = __toCommonJS(src_exports); -// src/toUtf8.ts +// src/constants.ts +var CLOCK_SKEW_ERROR_CODES = [ + "AuthFailure", + "InvalidSignatureException", + "RequestExpired", + "RequestInTheFuture", + "RequestTimeTooSkewed", + "SignatureDoesNotMatch" +]; +var THROTTLING_ERROR_CODES = [ + "BandwidthLimitExceeded", + "EC2ThrottledException", + "LimitExceededException", + "PriorRequestNotComplete", + "ProvisionedThroughputExceededException", + "RequestLimitExceeded", + "RequestThrottled", + "RequestThrottledException", + "SlowDown", + "ThrottledException", + "Throttling", + "ThrottlingException", + "TooManyRequestsException", + "TransactionInProgressException" + // DynamoDB +]; +var TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; +var TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; +var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; +var NODEJS_NETWORK_ERROR_CODES = ["EHOSTUNREACH", "ENETUNREACH", "ENOTFOUND"]; -var toUtf8 = /* @__PURE__ */ __name((input) => { - if (typeof input === "string") { - return input; +// src/index.ts +var isRetryableByTrait = /* @__PURE__ */ __name((error) => error.$retryable !== void 0, "isRetryableByTrait"); +var isClockSkewError = /* @__PURE__ */ __name((error) => CLOCK_SKEW_ERROR_CODES.includes(error.name), "isClockSkewError"); +var isClockSkewCorrectedError = /* @__PURE__ */ __name((error) => error.$metadata?.clockSkewCorrected, "isClockSkewCorrectedError"); +var isBrowserNetworkError = /* @__PURE__ */ __name((error) => { + const errorMessages = /* @__PURE__ */ new Set([ + "Failed to fetch", + // Chrome + "NetworkError when attempting to fetch resource", + // Firefox + "The Internet connection appears to be offline", + // Safari 16 + "Load failed", + // Safari 17+ + "Network request failed" + // `cross-fetch` + ]); + const isValid = error && error instanceof TypeError; + if (!isValid) { + return false; } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); + return errorMessages.has(error.message); +}, "isBrowserNetworkError"); +var isThrottlingError = /* @__PURE__ */ __name((error) => error.$metadata?.httpStatusCode === 429 || THROTTLING_ERROR_CODES.includes(error.name) || error.$retryable?.throttling == true, "isThrottlingError"); +var isTransientError = /* @__PURE__ */ __name((error, depth = 0) => isClockSkewCorrectedError(error) || TRANSIENT_ERROR_CODES.includes(error.name) || NODEJS_TIMEOUT_ERROR_CODES.includes(error?.code || "") || NODEJS_NETWORK_ERROR_CODES.includes(error?.code || "") || TRANSIENT_ERROR_STATUS_CODES.includes(error.$metadata?.httpStatusCode || 0) || isBrowserNetworkError(error) || error.cause !== void 0 && depth <= 10 && isTransientError(error.cause, depth + 1), "isTransientError"); +var isServerError = /* @__PURE__ */ __name((error) => { + if (error.$metadata?.httpStatusCode !== void 0) { + const statusCode = error.$metadata.httpStatusCode; + if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { + return true; + } + return false; } - return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); -}, "toUtf8"); + return false; +}, "isServerError"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -82849,7 +73938,7 @@ var toUtf8 = /* @__PURE__ */ __name((input) => { /***/ }), -/***/ 61411: +/***/ 75118: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -82874,1205 +73963,920 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - Client: () => Client, - Command: () => Command, - LazyJsonString: () => LazyJsonString, - NoOpLogger: () => NoOpLogger, - SENSITIVE_STRING: () => SENSITIVE_STRING, - ServiceException: () => ServiceException, - StringWrapper: () => StringWrapper, - _json: () => _json, - collectBody: () => collectBody, - convertMap: () => convertMap, - createAggregatedClient: () => createAggregatedClient, - dateToUtcString: () => dateToUtcString, - decorateServiceException: () => decorateServiceException, - emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, - expectBoolean: () => expectBoolean, - expectByte: () => expectByte, - expectFloat32: () => expectFloat32, - expectInt: () => expectInt, - expectInt32: () => expectInt32, - expectLong: () => expectLong, - expectNonNull: () => expectNonNull, - expectNumber: () => expectNumber, - expectObject: () => expectObject, - expectShort: () => expectShort, - expectString: () => expectString, - expectUnion: () => expectUnion, - extendedEncodeURIComponent: () => extendedEncodeURIComponent, - getArrayIfSingleItem: () => getArrayIfSingleItem, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - getDefaultExtensionConfiguration: () => getDefaultExtensionConfiguration, - getValueFromTextNode: () => getValueFromTextNode, - handleFloat: () => handleFloat, - isSerializableHeaderValue: () => isSerializableHeaderValue, - limitedParseDouble: () => limitedParseDouble, - limitedParseFloat: () => limitedParseFloat, - limitedParseFloat32: () => limitedParseFloat32, - loadConfigsForDefaultMode: () => loadConfigsForDefaultMode, - logger: () => logger, - map: () => map, - parseBoolean: () => parseBoolean, - parseEpochTimestamp: () => parseEpochTimestamp, - parseRfc3339DateTime: () => parseRfc3339DateTime, - parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, - parseRfc7231DateTime: () => parseRfc7231DateTime, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig, - resolvedPath: () => resolvedPath, - serializeDateTime: () => serializeDateTime, - serializeFloat: () => serializeFloat, - splitEvery: () => splitEvery, - strictParseByte: () => strictParseByte, - strictParseDouble: () => strictParseDouble, - strictParseFloat: () => strictParseFloat, - strictParseFloat32: () => strictParseFloat32, - strictParseInt: () => strictParseInt, - strictParseInt32: () => strictParseInt32, - strictParseLong: () => strictParseLong, - strictParseShort: () => strictParseShort, - take: () => take, - throwDefaultError: () => throwDefaultError, - withBaseException: () => withBaseException + ALGORITHM_IDENTIFIER: () => ALGORITHM_IDENTIFIER, + ALGORITHM_IDENTIFIER_V4A: () => ALGORITHM_IDENTIFIER_V4A, + ALGORITHM_QUERY_PARAM: () => ALGORITHM_QUERY_PARAM, + ALWAYS_UNSIGNABLE_HEADERS: () => ALWAYS_UNSIGNABLE_HEADERS, + AMZ_DATE_HEADER: () => AMZ_DATE_HEADER, + AMZ_DATE_QUERY_PARAM: () => AMZ_DATE_QUERY_PARAM, + AUTH_HEADER: () => AUTH_HEADER, + CREDENTIAL_QUERY_PARAM: () => CREDENTIAL_QUERY_PARAM, + DATE_HEADER: () => DATE_HEADER, + EVENT_ALGORITHM_IDENTIFIER: () => EVENT_ALGORITHM_IDENTIFIER, + EXPIRES_QUERY_PARAM: () => EXPIRES_QUERY_PARAM, + GENERATED_HEADERS: () => GENERATED_HEADERS, + HOST_HEADER: () => HOST_HEADER, + KEY_TYPE_IDENTIFIER: () => KEY_TYPE_IDENTIFIER, + MAX_CACHE_SIZE: () => MAX_CACHE_SIZE, + MAX_PRESIGNED_TTL: () => MAX_PRESIGNED_TTL, + PROXY_HEADER_PATTERN: () => PROXY_HEADER_PATTERN, + REGION_SET_PARAM: () => REGION_SET_PARAM, + SEC_HEADER_PATTERN: () => SEC_HEADER_PATTERN, + SHA256_HEADER: () => SHA256_HEADER, + SIGNATURE_HEADER: () => SIGNATURE_HEADER, + SIGNATURE_QUERY_PARAM: () => SIGNATURE_QUERY_PARAM, + SIGNED_HEADERS_QUERY_PARAM: () => SIGNED_HEADERS_QUERY_PARAM, + SignatureV4: () => SignatureV4, + SignatureV4Base: () => SignatureV4Base, + TOKEN_HEADER: () => TOKEN_HEADER, + TOKEN_QUERY_PARAM: () => TOKEN_QUERY_PARAM, + UNSIGNABLE_PATTERNS: () => UNSIGNABLE_PATTERNS, + UNSIGNED_PAYLOAD: () => UNSIGNED_PAYLOAD, + clearCredentialCache: () => clearCredentialCache, + createScope: () => createScope, + getCanonicalHeaders: () => getCanonicalHeaders, + getCanonicalQuery: () => getCanonicalQuery, + getPayloadHash: () => getPayloadHash, + getSigningKey: () => getSigningKey, + hasHeader: () => hasHeader, + moveHeadersToQuery: () => moveHeadersToQuery, + prepareRequest: () => prepareRequest, + signatureV4aContainer: () => signatureV4aContainer }); module.exports = __toCommonJS(src_exports); -// src/client.ts -var import_middleware_stack = __nccwpck_require__(9208); -var _Client = class _Client { - constructor(config) { - this.config = config; - this.middlewareStack = (0, import_middleware_stack.constructStack)(); - } - send(command, optionsOrCb, cb) { - const options = typeof optionsOrCb !== "function" ? optionsOrCb : void 0; - const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; - const useHandlerCache = options === void 0 && this.config.cacheMiddleware === true; - let handler; - if (useHandlerCache) { - if (!this.handlers) { - this.handlers = /* @__PURE__ */ new WeakMap(); - } - const handlers = this.handlers; - if (handlers.has(command.constructor)) { - handler = handlers.get(command.constructor); - } else { - handler = command.resolveMiddleware(this.middlewareStack, this.config, options); - handlers.set(command.constructor, handler); - } - } else { - delete this.handlers; - handler = command.resolveMiddleware(this.middlewareStack, this.config, options); - } - if (callback) { - handler(command).then( - (result) => callback(null, result.output), - (err) => callback(err) - ).catch( - // prevent any errors thrown in the callback from triggering an - // unhandled promise rejection - () => { - } - ); - } else { - return handler(command).then((result) => result.output); - } - } - destroy() { - var _a, _b, _c; - (_c = (_b = (_a = this.config) == null ? void 0 : _a.requestHandler) == null ? void 0 : _b.destroy) == null ? void 0 : _c.call(_b); - delete this.handlers; - } -}; -__name(_Client, "Client"); -var Client = _Client; - -// src/collect-stream-body.ts -var import_util_stream = __nccwpck_require__(4252); -var collectBody = /* @__PURE__ */ __name(async (streamBody = new Uint8Array(), context) => { - if (streamBody instanceof Uint8Array) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); - } - if (!streamBody) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); - } - const fromContext = context.streamCollector(streamBody); - return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); -}, "collectBody"); - -// src/command.ts +// src/SignatureV4.ts -var import_types = __nccwpck_require__(90690); -var _Command = class _Command { - constructor() { - this.middlewareStack = (0, import_middleware_stack.constructStack)(); - } - /** - * Factory for Command ClassBuilder. - * @internal - */ - static classBuilder() { - return new ClassBuilder(); - } - /** - * @internal - */ - resolveMiddlewareWithContext(clientStack, configuration, options, { - middlewareFn, - clientName, - commandName, - inputFilterSensitiveLog, - outputFilterSensitiveLog, - smithyContext, - additionalContext, - CommandCtor - }) { - for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) { - this.middlewareStack.use(mw); - } - const stack = clientStack.concat(this.middlewareStack); - const { logger: logger2 } = configuration; - const handlerExecutionContext = { - logger: logger2, - clientName, - commandName, - inputFilterSensitiveLog, - outputFilterSensitiveLog, - [import_types.SMITHY_CONTEXT_KEY]: { - commandInstance: this, - ...smithyContext - }, - ...additionalContext - }; - const { requestHandler } = configuration; - return stack.resolve( - (request) => requestHandler.handle(request.request, options || {}), - handlerExecutionContext - ); - } -}; -__name(_Command, "Command"); -var Command = _Command; -var _ClassBuilder = class _ClassBuilder { - constructor() { - this._init = () => { - }; - this._ep = {}; - this._middlewareFn = () => []; - this._commandName = ""; - this._clientName = ""; - this._additionalContext = {}; - this._smithyContext = {}; - this._inputFilterSensitiveLog = (_) => _; - this._outputFilterSensitiveLog = (_) => _; - this._serializer = null; - this._deserializer = null; - } - /** - * Optional init callback. - */ - init(cb) { - this._init = cb; - } - /** - * Set the endpoint parameter instructions. - */ - ep(endpointParameterInstructions) { - this._ep = endpointParameterInstructions; - return this; - } - /** - * Add any number of middleware. - */ - m(middlewareSupplier) { - this._middlewareFn = middlewareSupplier; - return this; - } - /** - * Set the initial handler execution context Smithy field. - */ - s(service, operation, smithyContext = {}) { - this._smithyContext = { - service, - operation, - ...smithyContext - }; - return this; - } - /** - * Set the initial handler execution context. - */ - c(additionalContext = {}) { - this._additionalContext = additionalContext; - return this; - } - /** - * Set constant string identifiers for the operation. - */ - n(clientName, commandName) { - this._clientName = clientName; - this._commandName = commandName; - return this; - } - /** - * Set the input and output sensistive log filters. - */ - f(inputFilter = (_) => _, outputFilter = (_) => _) { - this._inputFilterSensitiveLog = inputFilter; - this._outputFilterSensitiveLog = outputFilter; - return this; - } - /** - * Sets the serializer. - */ - ser(serializer) { - this._serializer = serializer; - return this; - } - /** - * Sets the deserializer. - */ - de(deserializer) { - this._deserializer = deserializer; - return this; - } - /** - * @returns a Command class with the classBuilder properties. - */ - build() { - var _a; - const closure = this; - let CommandRef; - return CommandRef = (_a = class extends Command { - /** - * @public - */ - constructor(...[input]) { - super(); - /** - * @internal - */ - // @ts-ignore used in middlewareFn closure. - this.serialize = closure._serializer; - /** - * @internal - */ - // @ts-ignore used in middlewareFn closure. - this.deserialize = closure._deserializer; - this.input = input ?? {}; - closure._init(this); - } - /** - * @public - */ - static getEndpointParameterInstructions() { - return closure._ep; - } - /** - * @internal - */ - resolveMiddleware(stack, configuration, options) { - return this.resolveMiddlewareWithContext(stack, configuration, options, { - CommandCtor: CommandRef, - middlewareFn: closure._middlewareFn, - clientName: closure._clientName, - commandName: closure._commandName, - inputFilterSensitiveLog: closure._inputFilterSensitiveLog, - outputFilterSensitiveLog: closure._outputFilterSensitiveLog, - smithyContext: closure._smithyContext, - additionalContext: closure._additionalContext - }); - } - }, __name(_a, "CommandRef"), _a); - } -}; -__name(_ClassBuilder, "ClassBuilder"); -var ClassBuilder = _ClassBuilder; +var import_util_utf85 = __nccwpck_require__(67529); // src/constants.ts -var SENSITIVE_STRING = "***SensitiveInformation***"; - -// src/create-aggregated-client.ts -var createAggregatedClient = /* @__PURE__ */ __name((commands, Client2) => { - for (const command of Object.keys(commands)) { - const CommandCtor = commands[command]; - const methodImpl = /* @__PURE__ */ __name(async function(args, optionsOrCb, cb) { - const command2 = new CommandCtor(args); - if (typeof optionsOrCb === "function") { - this.send(command2, optionsOrCb); - } else if (typeof cb === "function") { - if (typeof optionsOrCb !== "object") - throw new Error(`Expected http options but got ${typeof optionsOrCb}`); - this.send(command2, optionsOrCb || {}, cb); - } else { - return this.send(command2, optionsOrCb); - } - }, "methodImpl"); - const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, ""); - Client2.prototype[methodName] = methodImpl; - } -}, "createAggregatedClient"); +var ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; +var CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; +var AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; +var SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; +var EXPIRES_QUERY_PARAM = "X-Amz-Expires"; +var SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; +var TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; +var REGION_SET_PARAM = "X-Amz-Region-Set"; +var AUTH_HEADER = "authorization"; +var AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase(); +var DATE_HEADER = "date"; +var GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER]; +var SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase(); +var SHA256_HEADER = "x-amz-content-sha256"; +var TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase(); +var HOST_HEADER = "host"; +var ALWAYS_UNSIGNABLE_HEADERS = { + authorization: true, + "cache-control": true, + connection: true, + expect: true, + from: true, + "keep-alive": true, + "max-forwards": true, + pragma: true, + referer: true, + te: true, + trailer: true, + "transfer-encoding": true, + upgrade: true, + "user-agent": true, + "x-amzn-trace-id": true +}; +var PROXY_HEADER_PATTERN = /^proxy-/; +var SEC_HEADER_PATTERN = /^sec-/; +var UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i]; +var ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; +var ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256"; +var EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; +var UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; +var MAX_CACHE_SIZE = 50; +var KEY_TYPE_IDENTIFIER = "aws4_request"; +var MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; -// src/parse-utils.ts -var parseBoolean = /* @__PURE__ */ __name((value) => { - switch (value) { - case "true": - return true; - case "false": - return false; - default: - throw new Error(`Unable to parse boolean value "${value}"`); +// src/credentialDerivation.ts +var import_util_hex_encoding = __nccwpck_require__(7299); +var import_util_utf8 = __nccwpck_require__(67529); +var signingKeyCache = {}; +var cacheQueue = []; +var createScope = /* @__PURE__ */ __name((shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`, "createScope"); +var getSigningKey = /* @__PURE__ */ __name(async (sha256Constructor, credentials, shortDate, region, service) => { + const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); + const cacheKey = `${shortDate}:${region}:${service}:${(0, import_util_hex_encoding.toHex)(credsHash)}:${credentials.sessionToken}`; + if (cacheKey in signingKeyCache) { + return signingKeyCache[cacheKey]; } -}, "parseBoolean"); -var expectBoolean = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; + cacheQueue.push(cacheKey); + while (cacheQueue.length > MAX_CACHE_SIZE) { + delete signingKeyCache[cacheQueue.shift()]; } - if (typeof value === "number") { - if (value === 0 || value === 1) { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (value === 0) { - return false; - } - if (value === 1) { - return true; - } + let key = `AWS4${credentials.secretAccessKey}`; + for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) { + key = await hmac(sha256Constructor, key, signable); } - if (typeof value === "string") { - const lower = value.toLowerCase(); - if (lower === "false" || lower === "true") { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (lower === "false") { - return false; - } - if (lower === "true") { - return true; + return signingKeyCache[cacheKey] = key; +}, "getSigningKey"); +var clearCredentialCache = /* @__PURE__ */ __name(() => { + cacheQueue.length = 0; + Object.keys(signingKeyCache).forEach((cacheKey) => { + delete signingKeyCache[cacheKey]; + }); +}, "clearCredentialCache"); +var hmac = /* @__PURE__ */ __name((ctor, secret, data) => { + const hash = new ctor(secret); + hash.update((0, import_util_utf8.toUint8Array)(data)); + return hash.digest(); +}, "hmac"); + +// src/getCanonicalHeaders.ts +var getCanonicalHeaders = /* @__PURE__ */ __name(({ headers }, unsignableHeaders, signableHeaders) => { + const canonical = {}; + for (const headerName of Object.keys(headers).sort()) { + if (headers[headerName] == void 0) { + continue; } - } - if (typeof value === "boolean") { - return value; - } - throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); -}, "expectBoolean"); -var expectNumber = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - const parsed = parseFloat(value); - if (!Number.isNaN(parsed)) { - if (String(parsed) !== String(value)) { - logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); + const canonicalHeaderName = headerName.toLowerCase(); + if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS || unsignableHeaders?.has(canonicalHeaderName) || PROXY_HEADER_PATTERN.test(canonicalHeaderName) || SEC_HEADER_PATTERN.test(canonicalHeaderName)) { + if (!signableHeaders || signableHeaders && !signableHeaders.has(canonicalHeaderName)) { + continue; } - return parsed; } + canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); } - if (typeof value === "number") { - return value; - } - throw new TypeError(`Expected number, got ${typeof value}: ${value}`); -}, "expectNumber"); -var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); -var expectFloat32 = /* @__PURE__ */ __name((value) => { - const expected = expectNumber(value); - if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { - if (Math.abs(expected) > MAX_FLOAT) { - throw new TypeError(`Expected 32-bit float, got ${value}`); + return canonical; +}, "getCanonicalHeaders"); + +// src/getPayloadHash.ts +var import_is_array_buffer = __nccwpck_require__(52706); + +var import_util_utf82 = __nccwpck_require__(67529); +var getPayloadHash = /* @__PURE__ */ __name(async ({ headers, body }, hashConstructor) => { + for (const headerName of Object.keys(headers)) { + if (headerName.toLowerCase() === SHA256_HEADER) { + return headers[headerName]; } } - return expected; -}, "expectFloat32"); -var expectLong = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (Number.isInteger(value) && !Number.isNaN(value)) { - return value; - } - throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); -}, "expectLong"); -var expectInt = expectLong; -var expectInt32 = /* @__PURE__ */ __name((value) => expectSizedInt(value, 32), "expectInt32"); -var expectShort = /* @__PURE__ */ __name((value) => expectSizedInt(value, 16), "expectShort"); -var expectByte = /* @__PURE__ */ __name((value) => expectSizedInt(value, 8), "expectByte"); -var expectSizedInt = /* @__PURE__ */ __name((value, size) => { - const expected = expectLong(value); - if (expected !== void 0 && castInt(expected, size) !== expected) { - throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + if (body == void 0) { + return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; + } else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, import_is_array_buffer.isArrayBuffer)(body)) { + const hashCtor = new hashConstructor(); + hashCtor.update((0, import_util_utf82.toUint8Array)(body)); + return (0, import_util_hex_encoding.toHex)(await hashCtor.digest()); } - return expected; -}, "expectSizedInt"); -var castInt = /* @__PURE__ */ __name((value, size) => { - switch (size) { - case 32: - return Int32Array.of(value)[0]; - case 16: - return Int16Array.of(value)[0]; - case 8: - return Int8Array.of(value)[0]; + return UNSIGNED_PAYLOAD; +}, "getPayloadHash"); + +// src/HeaderFormatter.ts + +var import_util_utf83 = __nccwpck_require__(67529); +var HeaderFormatter = class { + static { + __name(this, "HeaderFormatter"); } -}, "castInt"); -var expectNonNull = /* @__PURE__ */ __name((value, location) => { - if (value === null || value === void 0) { - if (location) { - throw new TypeError(`Expected a non-null value for ${location}`); + format(headers) { + const chunks = []; + for (const headerName of Object.keys(headers)) { + const bytes = (0, import_util_utf83.fromUtf8)(headerName); + chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); } - throw new TypeError("Expected a non-null value"); - } - return value; -}, "expectNonNull"); -var expectObject = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "object" && !Array.isArray(value)) { - return value; - } - const receivedType = Array.isArray(value) ? "array" : typeof value; - throw new TypeError(`Expected object, got ${receivedType}: ${value}`); -}, "expectObject"); -var expectString = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - return value; - } - if (["boolean", "number", "bigint"].includes(typeof value)) { - logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); - return String(value); - } - throw new TypeError(`Expected string, got ${typeof value}: ${value}`); -}, "expectString"); -var expectUnion = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; - } - const asObject = expectObject(value); - const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); - if (setKeys.length === 0) { - throw new TypeError(`Unions must have exactly one non-null member. None were found.`); - } - if (setKeys.length > 1) { - throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); - } - return asObject; -}, "expectUnion"); -var strictParseDouble = /* @__PURE__ */ __name((value) => { - if (typeof value == "string") { - return expectNumber(parseNumber(value)); - } - return expectNumber(value); -}, "strictParseDouble"); -var strictParseFloat = strictParseDouble; -var strictParseFloat32 = /* @__PURE__ */ __name((value) => { - if (typeof value == "string") { - return expectFloat32(parseNumber(value)); + const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); + let position = 0; + for (const chunk of chunks) { + out.set(chunk, position); + position += chunk.byteLength; + } + return out; } - return expectFloat32(value); -}, "strictParseFloat32"); -var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; -var parseNumber = /* @__PURE__ */ __name((value) => { - const matches = value.match(NUMBER_REGEX); - if (matches === null || matches[0].length !== value.length) { - throw new TypeError(`Expected real number, got implicit NaN`); + formatHeaderValue(header) { + switch (header.type) { + case "boolean": + return Uint8Array.from([header.value ? 0 /* boolTrue */ : 1 /* boolFalse */]); + case "byte": + return Uint8Array.from([2 /* byte */, header.value]); + case "short": + const shortView = new DataView(new ArrayBuffer(3)); + shortView.setUint8(0, 3 /* short */); + shortView.setInt16(1, header.value, false); + return new Uint8Array(shortView.buffer); + case "integer": + const intView = new DataView(new ArrayBuffer(5)); + intView.setUint8(0, 4 /* integer */); + intView.setInt32(1, header.value, false); + return new Uint8Array(intView.buffer); + case "long": + const longBytes = new Uint8Array(9); + longBytes[0] = 5 /* long */; + longBytes.set(header.value.bytes, 1); + return longBytes; + case "binary": + const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); + binView.setUint8(0, 6 /* byteArray */); + binView.setUint16(1, header.value.byteLength, false); + const binBytes = new Uint8Array(binView.buffer); + binBytes.set(header.value, 3); + return binBytes; + case "string": + const utf8Bytes = (0, import_util_utf83.fromUtf8)(header.value); + const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); + strView.setUint8(0, 7 /* string */); + strView.setUint16(1, utf8Bytes.byteLength, false); + const strBytes = new Uint8Array(strView.buffer); + strBytes.set(utf8Bytes, 3); + return strBytes; + case "timestamp": + const tsBytes = new Uint8Array(9); + tsBytes[0] = 8 /* timestamp */; + tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1); + return tsBytes; + case "uuid": + if (!UUID_PATTERN.test(header.value)) { + throw new Error(`Invalid UUID received: ${header.value}`); + } + const uuidBytes = new Uint8Array(17); + uuidBytes[0] = 9 /* uuid */; + uuidBytes.set((0, import_util_hex_encoding.fromHex)(header.value.replace(/\-/g, "")), 1); + return uuidBytes; + } } - return parseFloat(value); -}, "parseNumber"); -var limitedParseDouble = /* @__PURE__ */ __name((value) => { - if (typeof value == "string") { - return parseFloatString(value); +}; +var UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; +var Int64 = class _Int64 { + constructor(bytes) { + this.bytes = bytes; + if (bytes.byteLength !== 8) { + throw new Error("Int64 buffers must be exactly 8 bytes"); + } } - return expectNumber(value); -}, "limitedParseDouble"); -var handleFloat = limitedParseDouble; -var limitedParseFloat = limitedParseDouble; -var limitedParseFloat32 = /* @__PURE__ */ __name((value) => { - if (typeof value == "string") { - return parseFloatString(value); + static { + __name(this, "Int64"); } - return expectFloat32(value); -}, "limitedParseFloat32"); -var parseFloatString = /* @__PURE__ */ __name((value) => { - switch (value) { - case "NaN": - return NaN; - case "Infinity": - return Infinity; - case "-Infinity": - return -Infinity; - default: - throw new Error(`Unable to parse float value: ${value}`); + static fromNumber(number) { + if (number > 9223372036854776e3 || number < -9223372036854776e3) { + throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); + } + const bytes = new Uint8Array(8); + for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { + bytes[i] = remaining; + } + if (number < 0) { + negate(bytes); + } + return new _Int64(bytes); } -}, "parseFloatString"); -var strictParseLong = /* @__PURE__ */ __name((value) => { - if (typeof value === "string") { - return expectLong(parseNumber(value)); + /** + * Called implicitly by infix arithmetic operators. + */ + valueOf() { + const bytes = this.bytes.slice(0); + const negative = bytes[0] & 128; + if (negative) { + negate(bytes); + } + return parseInt((0, import_util_hex_encoding.toHex)(bytes), 16) * (negative ? -1 : 1); } - return expectLong(value); -}, "strictParseLong"); -var strictParseInt = strictParseLong; -var strictParseInt32 = /* @__PURE__ */ __name((value) => { - if (typeof value === "string") { - return expectInt32(parseNumber(value)); + toString() { + return String(this.valueOf()); } - return expectInt32(value); -}, "strictParseInt32"); -var strictParseShort = /* @__PURE__ */ __name((value) => { - if (typeof value === "string") { - return expectShort(parseNumber(value)); +}; +function negate(bytes) { + for (let i = 0; i < 8; i++) { + bytes[i] ^= 255; } - return expectShort(value); -}, "strictParseShort"); -var strictParseByte = /* @__PURE__ */ __name((value) => { - if (typeof value === "string") { - return expectByte(parseNumber(value)); + for (let i = 7; i > -1; i--) { + bytes[i]++; + if (bytes[i] !== 0) + break; } - return expectByte(value); -}, "strictParseByte"); -var stackTraceWarning = /* @__PURE__ */ __name((message) => { - return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); -}, "stackTraceWarning"); -var logger = { - warn: console.warn -}; - -// src/date-utils.ts -var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; -var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; -function dateToUtcString(date) { - const year = date.getUTCFullYear(); - const month = date.getUTCMonth(); - const dayOfWeek = date.getUTCDay(); - const dayOfMonthInt = date.getUTCDate(); - const hoursInt = date.getUTCHours(); - const minutesInt = date.getUTCMinutes(); - const secondsInt = date.getUTCSeconds(); - const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; - const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; - const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; - const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; - return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; } -__name(dateToUtcString, "dateToUtcString"); -var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); -var parseRfc3339DateTime = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; +__name(negate, "negate"); + +// src/headerUtil.ts +var hasHeader = /* @__PURE__ */ __name((soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return true; + } } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); + return false; +}, "hasHeader"); + +// src/moveHeadersToQuery.ts +var import_protocol_http = __nccwpck_require__(74996); +var moveHeadersToQuery = /* @__PURE__ */ __name((request, options = {}) => { + const { headers, query = {} } = import_protocol_http.HttpRequest.clone(request); + for (const name of Object.keys(headers)) { + const lname = name.toLowerCase(); + if (lname.slice(0, 6) === "x-amz-" && !options.unhoistableHeaders?.has(lname) || options.hoistableHeaders?.has(lname)) { + query[name] = headers[name]; + delete headers[name]; + } } - const match = RFC3339.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); + return { + ...request, + headers, + query + }; +}, "moveHeadersToQuery"); + +// src/prepareRequest.ts + +var prepareRequest = /* @__PURE__ */ __name((request) => { + request = import_protocol_http.HttpRequest.clone(request); + for (const headerName of Object.keys(request.headers)) { + if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { + delete request.headers[headerName]; + } } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); -}, "parseRfc3339DateTime"); -var RFC3339_WITH_OFFSET = new RegExp( - /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ -); -var parseRfc3339DateTimeWithOffset = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; + return request; +}, "prepareRequest"); + +// src/SignatureV4Base.ts + +var import_util_middleware = __nccwpck_require__(83732); + +var import_util_utf84 = __nccwpck_require__(67529); + +// src/getCanonicalQuery.ts +var import_util_uri_escape = __nccwpck_require__(87938); +var getCanonicalQuery = /* @__PURE__ */ __name(({ query = {} }) => { + const keys = []; + const serialized = {}; + for (const key of Object.keys(query)) { + if (key.toLowerCase() === SIGNATURE_HEADER) { + continue; + } + const encodedKey = (0, import_util_uri_escape.escapeUri)(key); + keys.push(encodedKey); + const value = query[key]; + if (typeof value === "string") { + serialized[encodedKey] = `${encodedKey}=${(0, import_util_uri_escape.escapeUri)(value)}`; + } else if (Array.isArray(value)) { + serialized[encodedKey] = value.slice(0).reduce((encoded, value2) => encoded.concat([`${encodedKey}=${(0, import_util_uri_escape.escapeUri)(value2)}`]), []).sort().join("&"); + } } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); + return keys.sort().map((key) => serialized[key]).filter((serialized2) => serialized2).join("&"); +}, "getCanonicalQuery"); + +// src/utilDate.ts +var iso8601 = /* @__PURE__ */ __name((time) => toDate(time).toISOString().replace(/\.\d{3}Z$/, "Z"), "iso8601"); +var toDate = /* @__PURE__ */ __name((time) => { + if (typeof time === "number") { + return new Date(time * 1e3); } - const match = RFC3339_WITH_OFFSET.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); + if (typeof time === "string") { + if (Number(time)) { + return new Date(Number(time) * 1e3); + } + return new Date(time); } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); - if (offsetStr.toUpperCase() != "Z") { - date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); + return time; +}, "toDate"); + +// src/SignatureV4Base.ts +var SignatureV4Base = class { + static { + __name(this, "SignatureV4Base"); } - return date; -}, "parseRfc3339DateTimeWithOffset"); -var IMF_FIXDATE = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ -); -var RFC_850_DATE = new RegExp( - /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ -); -var ASC_TIME = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ -); -var parseRfc7231DateTime = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; + constructor({ + applyChecksum, + credentials, + region, + service, + sha256, + uriEscapePath = true + }) { + this.service = service; + this.sha256 = sha256; + this.uriEscapePath = uriEscapePath; + this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; + this.regionProvider = (0, import_util_middleware.normalizeProvider)(region); + this.credentialProvider = (0, import_util_middleware.normalizeProvider)(credentials); } - if (typeof value !== "string") { - throw new TypeError("RFC-7231 date-times must be expressed as strings"); + createCanonicalRequest(request, canonicalHeaders, payloadHash) { + const sortedHeaders = Object.keys(canonicalHeaders).sort(); + return `${request.method} +${this.getCanonicalPath(request)} +${getCanonicalQuery(request)} +${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} + +${sortedHeaders.join(";")} +${payloadHash}`; } - let match = IMF_FIXDATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr, "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); + async createStringToSign(longDate, credentialScope, canonicalRequest, algorithmIdentifier) { + const hash = new this.sha256(); + hash.update((0, import_util_utf84.toUint8Array)(canonicalRequest)); + const hashedRequest = await hash.digest(); + return `${algorithmIdentifier} +${longDate} +${credentialScope} +${(0, import_util_hex_encoding.toHex)(hashedRequest)}`; } - match = RFC_850_DATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return adjustRfc850Year( - buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { - hours, - minutes, - seconds, - fractionalMilliseconds - }) - ); + getCanonicalPath({ path }) { + if (this.uriEscapePath) { + const normalizedPathSegments = []; + for (const pathSegment of path.split("/")) { + if (pathSegment?.length === 0) + continue; + if (pathSegment === ".") + continue; + if (pathSegment === "..") { + normalizedPathSegments.pop(); + } else { + normalizedPathSegments.push(pathSegment); + } + } + const normalizedPath = `${path?.startsWith("/") ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && path?.endsWith("/") ? "/" : ""}`; + const doubleEncoded = (0, import_util_uri_escape.escapeUri)(normalizedPath); + return doubleEncoded.replace(/%2F/g, "/"); + } + return path; } - match = ASC_TIME.exec(value); - if (match) { - const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr.trimLeft(), "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); + validateResolvedCredentials(credentials) { + if (typeof credentials !== "object" || // @ts-expect-error: Property 'accessKeyId' does not exist on type 'object'.ts(2339) + typeof credentials.accessKeyId !== "string" || // @ts-expect-error: Property 'secretAccessKey' does not exist on type 'object'.ts(2339) + typeof credentials.secretAccessKey !== "string") { + throw new Error("Resolved credential object is not valid"); + } } - throw new TypeError("Invalid RFC-7231 date-time value"); -}, "parseRfc7231DateTime"); -var parseEpochTimestamp = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return void 0; + formatDate(now) { + const longDate = iso8601(now).replace(/[\-:]/g, ""); + return { + longDate, + shortDate: longDate.slice(0, 8) + }; } - let valueAsDouble; - if (typeof value === "number") { - valueAsDouble = value; - } else if (typeof value === "string") { - valueAsDouble = strictParseDouble(value); - } else if (typeof value === "object" && value.tag === 1) { - valueAsDouble = value.value; - } else { - throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + getCanonicalHeaderList(headers) { + return Object.keys(headers).sort().join(";"); } - if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { - throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); +}; + +// src/SignatureV4.ts +var SignatureV4 = class extends SignatureV4Base { + constructor({ + applyChecksum, + credentials, + region, + service, + sha256, + uriEscapePath = true + }) { + super({ + applyChecksum, + credentials, + region, + service, + sha256, + uriEscapePath + }); + this.headerFormatter = new HeaderFormatter(); } - return new Date(Math.round(valueAsDouble * 1e3)); -}, "parseEpochTimestamp"); -var buildDate = /* @__PURE__ */ __name((year, month, day, time) => { - const adjustedMonth = month - 1; - validateDayOfMonth(year, adjustedMonth, day); - return new Date( - Date.UTC( - year, - adjustedMonth, - day, - parseDateValue(time.hours, "hour", 0, 23), - parseDateValue(time.minutes, "minute", 0, 59), - // seconds can go up to 60 for leap seconds - parseDateValue(time.seconds, "seconds", 0, 60), - parseMilliseconds(time.fractionalMilliseconds) - ) - ); -}, "buildDate"); -var parseTwoDigitYear = /* @__PURE__ */ __name((value) => { - const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); - const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); - if (valueInThisCentury < thisYear) { - return valueInThisCentury + 100; + static { + __name(this, "SignatureV4"); } - return valueInThisCentury; -}, "parseTwoDigitYear"); -var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; -var adjustRfc850Year = /* @__PURE__ */ __name((input) => { - if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { - return new Date( - Date.UTC( - input.getUTCFullYear() - 100, - input.getUTCMonth(), - input.getUTCDate(), - input.getUTCHours(), - input.getUTCMinutes(), - input.getUTCSeconds(), - input.getUTCMilliseconds() - ) + async presign(originalRequest, options = {}) { + const { + signingDate = /* @__PURE__ */ new Date(), + expiresIn = 3600, + unsignableHeaders, + unhoistableHeaders, + signableHeaders, + hoistableHeaders, + signingRegion, + signingService + } = options; + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const { longDate, shortDate } = this.formatDate(signingDate); + if (expiresIn > MAX_PRESIGNED_TTL) { + return Promise.reject( + "Signature version 4 presigned URLs must have an expiration date less than one week in the future" + ); + } + const scope = createScope(shortDate, region, signingService ?? this.service); + const request = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders, hoistableHeaders }); + if (credentials.sessionToken) { + request.query[TOKEN_QUERY_PARAM] = credentials.sessionToken; + } + request.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER; + request.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; + request.query[AMZ_DATE_QUERY_PARAM] = longDate; + request.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10); + const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); + request.query[SIGNED_HEADERS_QUERY_PARAM] = this.getCanonicalHeaderList(canonicalHeaders); + request.query[SIGNATURE_QUERY_PARAM] = await this.getSignature( + longDate, + scope, + this.getSigningKey(credentials, region, shortDate, signingService), + this.createCanonicalRequest(request, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)) ); + return request; } - return input; -}, "adjustRfc850Year"); -var parseMonthByShortName = /* @__PURE__ */ __name((value) => { - const monthIdx = MONTHS.indexOf(value); - if (monthIdx < 0) { - throw new TypeError(`Invalid month: ${value}`); - } - return monthIdx + 1; -}, "parseMonthByShortName"); -var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; -var validateDayOfMonth = /* @__PURE__ */ __name((year, month, day) => { - let maxDays = DAYS_IN_MONTH[month]; - if (month === 1 && isLeapYear(year)) { - maxDays = 29; + async sign(toSign, options) { + if (typeof toSign === "string") { + return this.signString(toSign, options); + } else if (toSign.headers && toSign.payload) { + return this.signEvent(toSign, options); + } else if (toSign.message) { + return this.signMessage(toSign, options); + } else { + return this.signRequest(toSign, options); + } } - if (day > maxDays) { - throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); + async signEvent({ headers, payload }, { signingDate = /* @__PURE__ */ new Date(), priorSignature, signingRegion, signingService }) { + const region = signingRegion ?? await this.regionProvider(); + const { shortDate, longDate } = this.formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256); + const hash = new this.sha256(); + hash.update(headers); + const hashedHeaders = (0, import_util_hex_encoding.toHex)(await hash.digest()); + const stringToSign = [ + EVENT_ALGORITHM_IDENTIFIER, + longDate, + scope, + priorSignature, + hashedHeaders, + hashedPayload + ].join("\n"); + return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); } -}, "validateDayOfMonth"); -var isLeapYear = /* @__PURE__ */ __name((year) => { - return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); -}, "isLeapYear"); -var parseDateValue = /* @__PURE__ */ __name((value, type, lower, upper) => { - const dateVal = strictParseByte(stripLeadingZeroes(value)); - if (dateVal < lower || dateVal > upper) { - throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + async signMessage(signableMessage, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService }) { + const promise = this.signEvent( + { + headers: this.headerFormatter.format(signableMessage.message.headers), + payload: signableMessage.message.body + }, + { + signingDate, + signingRegion, + signingService, + priorSignature: signableMessage.priorSignature + } + ); + return promise.then((signature) => { + return { message: signableMessage.message, signature }; + }); } - return dateVal; -}, "parseDateValue"); -var parseMilliseconds = /* @__PURE__ */ __name((value) => { - if (value === null || value === void 0) { - return 0; + async signString(stringToSign, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const { shortDate } = this.formatDate(signingDate); + const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); + hash.update((0, import_util_utf85.toUint8Array)(stringToSign)); + return (0, import_util_hex_encoding.toHex)(await hash.digest()); } - return strictParseFloat32("0." + value) * 1e3; -}, "parseMilliseconds"); -var parseOffsetToMilliseconds = /* @__PURE__ */ __name((value) => { - const directionStr = value[0]; - let direction = 1; - if (directionStr == "+") { - direction = 1; - } else if (directionStr == "-") { - direction = -1; - } else { - throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + async signRequest(requestToSign, { + signingDate = /* @__PURE__ */ new Date(), + signableHeaders, + unsignableHeaders, + signingRegion, + signingService + } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const request = prepareRequest(requestToSign); + const { longDate, shortDate } = this.formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + request.headers[AMZ_DATE_HEADER] = longDate; + if (credentials.sessionToken) { + request.headers[TOKEN_HEADER] = credentials.sessionToken; + } + const payloadHash = await getPayloadHash(request, this.sha256); + if (!hasHeader(SHA256_HEADER, request.headers) && this.applyChecksum) { + request.headers[SHA256_HEADER] = payloadHash; + } + const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); + const signature = await this.getSignature( + longDate, + scope, + this.getSigningKey(credentials, region, shortDate, signingService), + this.createCanonicalRequest(request, canonicalHeaders, payloadHash) + ); + request.headers[AUTH_HEADER] = `${ALGORITHM_IDENTIFIER} Credential=${credentials.accessKeyId}/${scope}, SignedHeaders=${this.getCanonicalHeaderList(canonicalHeaders)}, Signature=${signature}`; + return request; } - const hour = Number(value.substring(1, 3)); - const minute = Number(value.substring(4, 6)); - return direction * (hour * 60 + minute) * 60 * 1e3; -}, "parseOffsetToMilliseconds"); -var stripLeadingZeroes = /* @__PURE__ */ __name((value) => { - let idx = 0; - while (idx < value.length - 1 && value.charAt(idx) === "0") { - idx++; + async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { + const stringToSign = await this.createStringToSign( + longDate, + credentialScope, + canonicalRequest, + ALGORITHM_IDENTIFIER + ); + const hash = new this.sha256(await keyPromise); + hash.update((0, import_util_utf85.toUint8Array)(stringToSign)); + return (0, import_util_hex_encoding.toHex)(await hash.digest()); } - if (idx === 0) { - return value; + getSigningKey(credentials, region, shortDate, service) { + return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service); } - return value.slice(idx); -}, "stripLeadingZeroes"); +}; -// src/exceptions.ts -var _ServiceException = class _ServiceException extends Error { - constructor(options) { - super(options.message); - Object.setPrototypeOf(this, _ServiceException.prototype); - this.name = options.name; - this.$fault = options.$fault; - this.$metadata = options.$metadata; - } +// src/signature-v4a-container.ts +var signatureV4aContainer = { + SignatureV4a: null }; -__name(_ServiceException, "ServiceException"); -var ServiceException = _ServiceException; -var decorateServiceException = /* @__PURE__ */ __name((exception, additions = {}) => { - Object.entries(additions).filter(([, v]) => v !== void 0).forEach(([k, v]) => { - if (exception[k] == void 0 || exception[k] === "") { - exception[k] = v; - } - }); - const message = exception.message || exception.Message || "UnknownError"; - exception.message = message; - delete exception.Message; - return exception; -}, "decorateServiceException"); +// Annotate the CommonJS export names for ESM import in node: -// src/default-error-handler.ts -var throwDefaultError = /* @__PURE__ */ __name(({ output, parsedBody, exceptionCtor, errorCode }) => { - const $metadata = deserializeMetadata(output); - const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : void 0; - const response = new exceptionCtor({ - name: (parsedBody == null ? void 0 : parsedBody.code) || (parsedBody == null ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError", - $fault: "client", - $metadata - }); - throw decorateServiceException(response, parsedBody); -}, "throwDefaultError"); -var withBaseException = /* @__PURE__ */ __name((ExceptionCtor) => { - return ({ output, parsedBody, errorCode }) => { - throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode }); - }; -}, "withBaseException"); -var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] -}), "deserializeMetadata"); +0 && (0); -// src/defaults-mode.ts -var loadConfigsForDefaultMode = /* @__PURE__ */ __name((mode) => { - switch (mode) { - case "standard": - return { - retryMode: "standard", - connectionTimeout: 3100 - }; - case "in-region": - return { - retryMode: "standard", - connectionTimeout: 1100 - }; - case "cross-region": - return { - retryMode: "standard", - connectionTimeout: 3100 - }; - case "mobile": - return { - retryMode: "standard", - connectionTimeout: 3e4 - }; - default: - return {}; - } -}, "loadConfigsForDefaultMode"); -// src/emitWarningIfUnsupportedVersion.ts -var warningEmitted = false; -var emitWarningIfUnsupportedVersion = /* @__PURE__ */ __name((version) => { - if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) { - warningEmitted = true; + +/***/ }), + +/***/ 52706: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } -}, "emitWarningIfUnsupportedVersion"); + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/extended-encode-uri-component.ts -function extendedEncodeURIComponent(str) { - return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { - return "%" + c.charCodeAt(0).toString(16).toUpperCase(); - }); -} -__name(extendedEncodeURIComponent, "extendedEncodeURIComponent"); +// src/index.ts +var src_exports = {}; +__export(src_exports, { + isArrayBuffer: () => isArrayBuffer +}); +module.exports = __toCommonJS(src_exports); +var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); +// Annotate the CommonJS export names for ESM import in node: -// src/extensions/checksum.ts +0 && (0); + + + +/***/ }), + +/***/ 74996: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + Field: () => Field, + Fields: () => Fields, + HttpRequest: () => HttpRequest, + HttpResponse: () => HttpResponse, + IHttpRequest: () => import_types.HttpRequest, + getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, + isValidHostname: () => isValidHostname, + resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig +}); +module.exports = __toCommonJS(src_exports); -var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const checksumAlgorithms = []; - for (const id in import_types.AlgorithmId) { - const algorithmId = import_types.AlgorithmId[id]; - if (runtimeConfig[algorithmId] === void 0) { - continue; - } - checksumAlgorithms.push({ - algorithmId: () => algorithmId, - checksumConstructor: () => runtimeConfig[algorithmId] - }); - } +// src/extensions/httpExtensionConfiguration.ts +var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { return { - _checksumAlgorithms: checksumAlgorithms, - addChecksumAlgorithm(algo) { - this._checksumAlgorithms.push(algo); + setHttpHandler(handler) { + runtimeConfig.httpHandler = handler; }, - checksumAlgorithms() { - return this._checksumAlgorithms; - } - }; -}, "getChecksumConfiguration"); -var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { - const runtimeConfig = {}; - clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { - runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); - }); - return runtimeConfig; -}, "resolveChecksumRuntimeConfig"); - -// src/extensions/retry.ts -var getRetryConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - let _retryStrategy = runtimeConfig.retryStrategy; - return { - setRetryStrategy(retryStrategy) { - _retryStrategy = retryStrategy; + httpHandler() { + return runtimeConfig.httpHandler; }, - retryStrategy() { - return _retryStrategy; + updateHttpClientConfig(key, value) { + runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return runtimeConfig.httpHandler.httpHandlerConfigs(); } }; -}, "getRetryConfiguration"); -var resolveRetryRuntimeConfig = /* @__PURE__ */ __name((retryStrategyConfiguration) => { - const runtimeConfig = {}; - runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy(); - return runtimeConfig; -}, "resolveRetryRuntimeConfig"); - -// src/extensions/defaultExtensionConfiguration.ts -var getDefaultExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - ...getChecksumConfiguration(runtimeConfig), - ...getRetryConfiguration(runtimeConfig) - }; -}, "getDefaultExtensionConfiguration"); -var getDefaultClientConfiguration = getDefaultExtensionConfiguration; -var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { +}, "getHttpHandlerExtensionConfiguration"); +var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { return { - ...resolveChecksumRuntimeConfig(config), - ...resolveRetryRuntimeConfig(config) + httpHandler: httpHandlerExtensionConfiguration.httpHandler() }; -}, "resolveDefaultRuntimeConfig"); - -// src/get-array-if-single-item.ts -var getArrayIfSingleItem = /* @__PURE__ */ __name((mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray], "getArrayIfSingleItem"); - -// src/get-value-from-text-node.ts -var getValueFromTextNode = /* @__PURE__ */ __name((obj) => { - const textNodeName = "#text"; - for (const key in obj) { - if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== void 0) { - obj[key] = obj[key][textNodeName]; - } else if (typeof obj[key] === "object" && obj[key] !== null) { - obj[key] = getValueFromTextNode(obj[key]); - } - } - return obj; -}, "getValueFromTextNode"); - -// src/is-serializable-header-value.ts -var isSerializableHeaderValue = /* @__PURE__ */ __name((value) => { - return value != null; -}, "isSerializableHeaderValue"); +}, "resolveHttpHandlerRuntimeConfig"); -// src/lazy-json.ts -var StringWrapper = /* @__PURE__ */ __name(function() { - const Class = Object.getPrototypeOf(this).constructor; - const Constructor = Function.bind.apply(String, [null, ...arguments]); - const instance = new Constructor(); - Object.setPrototypeOf(instance, Class.prototype); - return instance; -}, "StringWrapper"); -StringWrapper.prototype = Object.create(String.prototype, { - constructor: { - value: StringWrapper, - enumerable: false, - writable: true, - configurable: true - } -}); -Object.setPrototypeOf(StringWrapper, String); -var _LazyJsonString = class _LazyJsonString extends StringWrapper { - deserializeJSON() { - return JSON.parse(super.toString()); - } - toJSON() { - return super.toString(); +// src/Field.ts +var import_types = __nccwpck_require__(59442); +var Field = class { + static { + __name(this, "Field"); } - static fromObject(object) { - if (object instanceof _LazyJsonString) { - return object; - } else if (object instanceof String || typeof object === "string") { - return new _LazyJsonString(object); - } - return new _LazyJsonString(JSON.stringify(object)); + constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; } -}; -__name(_LazyJsonString, "LazyJsonString"); -var LazyJsonString = _LazyJsonString; - -// src/NoOpLogger.ts -var _NoOpLogger = class _NoOpLogger { - trace() { + /** + * Appends a value to the field. + * + * @param value The value to append. + */ + add(value) { + this.values.push(value); } - debug() { + /** + * Overwrite existing field values. + * + * @param values The new field values. + */ + set(values) { + this.values = values; } - info() { + /** + * Remove all matching entries from list. + * + * @param value Value to remove. + */ + remove(value) { + this.values = this.values.filter((v) => v !== value); } - warn() { + /** + * Get comma-delimited string. + * + * @returns String representation of {@link Field}. + */ + toString() { + return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); } - error() { + /** + * Get string values as a list + * + * @returns Values in {@link Field} as a list. + */ + get() { + return this.values; } }; -__name(_NoOpLogger, "NoOpLogger"); -var NoOpLogger = _NoOpLogger; -// src/object-mapping.ts -function map(arg0, arg1, arg2) { - let target; - let filter; - let instructions; - if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { - target = {}; - instructions = arg0; - } else { - target = arg0; - if (typeof arg1 === "function") { - filter = arg1; - instructions = arg2; - return mapWithFilter(target, filter, instructions); - } else { - instructions = arg1; - } +// src/Fields.ts +var Fields = class { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; } - for (const key of Object.keys(instructions)) { - if (!Array.isArray(instructions[key])) { - target[key] = instructions[key]; - continue; - } - applyInstruction(target, null, instructions, key); + static { + __name(this, "Fields"); } - return target; -} -__name(map, "map"); -var convertMap = /* @__PURE__ */ __name((target) => { - const output = {}; - for (const [k, v] of Object.entries(target || {})) { - output[k] = [, v]; + /** + * Set entry for a {@link Field} name. The `name` + * attribute will be used to key the collection. + * + * @param field The {@link Field} to set. + */ + setField(field) { + this.entries[field.name.toLowerCase()] = field; } - return output; -}, "convertMap"); -var take = /* @__PURE__ */ __name((source, instructions) => { - const out = {}; - for (const key in instructions) { - applyInstruction(out, source, instructions, key); + /** + * Retrieve {@link Field} entry by name. + * + * @param name The name of the {@link Field} entry + * to retrieve + * @returns The {@link Field} if it exists. + */ + getField(name) { + return this.entries[name.toLowerCase()]; } - return out; -}, "take"); -var mapWithFilter = /* @__PURE__ */ __name((target, filter, instructions) => { - return map( - target, - Object.entries(instructions).reduce( - (_instructions, [key, value]) => { - if (Array.isArray(value)) { - _instructions[key] = value; - } else { - if (typeof value === "function") { - _instructions[key] = [filter, value()]; - } else { - _instructions[key] = [filter, value]; - } - } - return _instructions; - }, - {} - ) - ); -}, "mapWithFilter"); -var applyInstruction = /* @__PURE__ */ __name((target, source, instructions, targetKey) => { - if (source !== null) { - let instruction = instructions[targetKey]; - if (typeof instruction === "function") { - instruction = [, instruction]; - } - const [filter2 = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction; - if (typeof filter2 === "function" && filter2(source[sourceKey]) || typeof filter2 !== "function" && !!filter2) { - target[targetKey] = valueFn(source[sourceKey]); - } - return; + /** + * Delete entry from collection. + * + * @param name Name of the entry to delete. + */ + removeField(name) { + delete this.entries[name.toLowerCase()]; } - let [filter, value] = instructions[targetKey]; - if (typeof value === "function") { - let _value; - const defaultFilterPassed = filter === void 0 && (_value = value()) != null; - const customFilterPassed = typeof filter === "function" && !!filter(void 0) || typeof filter !== "function" && !!filter; - if (defaultFilterPassed) { - target[targetKey] = _value; - } else if (customFilterPassed) { - target[targetKey] = value(); - } - } else { - const defaultFilterPassed = filter === void 0 && value != null; - const customFilterPassed = typeof filter === "function" && !!filter(value) || typeof filter !== "function" && !!filter; - if (defaultFilterPassed || customFilterPassed) { - target[targetKey] = value; - } + /** + * Helper function for retrieving specific types of fields. + * Used to grab all headers or all trailers. + * + * @param kind {@link FieldPosition} of entries to retrieve. + * @returns The {@link Field} entries with the specified + * {@link FieldPosition}. + */ + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); } -}, "applyInstruction"); -var nonNullish = /* @__PURE__ */ __name((_) => _ != null, "nonNullish"); -var pass = /* @__PURE__ */ __name((_) => _, "pass"); +}; -// src/resolve-path.ts -var resolvedPath = /* @__PURE__ */ __name((resolvedPath2, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { - if (input != null && input[memberName] !== void 0) { - const labelValue = labelValueProvider(); - if (labelValue.length <= 0) { - throw new Error("Empty value provided for input HTTP label: " + memberName + "."); - } - resolvedPath2 = resolvedPath2.replace( - uriLabel, - isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) - ); - } else { - throw new Error("No value provided for input HTTP label: " + memberName + "."); - } - return resolvedPath2; -}, "resolvedPath"); +// src/httpRequest.ts -// src/ser-utils.ts -var serializeFloat = /* @__PURE__ */ __name((value) => { - if (value !== value) { - return "NaN"; - } - switch (value) { - case Infinity: - return "Infinity"; - case -Infinity: - return "-Infinity"; - default: - return value; +var HttpRequest = class _HttpRequest { + static { + __name(this, "HttpRequest"); } -}, "serializeFloat"); -var serializeDateTime = /* @__PURE__ */ __name((date) => date.toISOString().replace(".000Z", "Z"), "serializeDateTime"); - -// src/serde-json.ts -var _json = /* @__PURE__ */ __name((obj) => { - if (obj == null) { - return {}; + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; + this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; } - if (Array.isArray(obj)) { - return obj.filter((_) => _ != null).map(_json); + /** + * Note: this does not deep-clone the body. + */ + static clone(request) { + const cloned = new _HttpRequest({ + ...request, + headers: { ...request.headers } + }); + if (cloned.query) { + cloned.query = cloneQuery(cloned.query); + } + return cloned; } - if (typeof obj === "object") { - const target = {}; - for (const key of Object.keys(obj)) { - if (obj[key] == null) { - continue; - } - target[key] = _json(obj[key]); + /** + * This method only actually asserts that request is the interface {@link IHttpRequest}, + * and not necessarily this concrete class. Left in place for API stability. + * + * Do not call instance methods on the input of this function, and + * do not assume it has the HttpRequest prototype. + */ + static isInstance(request) { + if (!request) { + return false; } - return target; + const req = request; + return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; } - return obj; -}, "_json"); - -// src/split-every.ts -function splitEvery(value, delimiter, numDelimiters) { - if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { - throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); + /** + * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call + * this method because {@link HttpRequest.isInstance} incorrectly + * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). + */ + clone() { + return _HttpRequest.clone(this); } - const segments = value.split(delimiter); - if (numDelimiters === 1) { - return segments; +}; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param + }; + }, {}); +} +__name(cloneQuery, "cloneQuery"); + +// src/httpResponse.ts +var HttpResponse = class { + static { + __name(this, "HttpResponse"); } - const compoundSegments = []; - let currentSegment = ""; - for (let i = 0; i < segments.length; i++) { - if (currentSegment === "") { - currentSegment = segments[i]; - } else { - currentSegment += delimiter + segments[i]; - } - if ((i + 1) % numDelimiters === 0) { - compoundSegments.push(currentSegment); - currentSegment = ""; - } + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; } - if (currentSegment !== "") { - compoundSegments.push(currentSegment); + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; } - return compoundSegments; +}; + +// src/isValidHostname.ts +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); } -__name(splitEvery, "splitEvery"); +__name(isValidHostname, "isValidHostname"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -84081,7 +74885,7 @@ __name(splitEvery, "splitEvery"); /***/ }), -/***/ 90690: +/***/ 59442: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -84164,12 +74968,11 @@ var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { }); } return { - _checksumAlgorithms: checksumAlgorithms, addChecksumAlgorithm(algo) { - this._checksumAlgorithms.push(algo); + checksumAlgorithms.push(algo); }, checksumAlgorithms() { - return this._checksumAlgorithms; + return checksumAlgorithms; } }; }, "getChecksumConfiguration"); @@ -84183,14 +74986,10 @@ var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { // src/extensions/defaultClientConfiguration.ts var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - ...getChecksumConfiguration(runtimeConfig) - }; + return getChecksumConfiguration(runtimeConfig); }, "getDefaultClientConfiguration"); var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return { - ...resolveChecksumRuntimeConfig(config) - }; + return resolveChecksumRuntimeConfig(config); }, "resolveDefaultRuntimeConfig"); // src/http.ts @@ -84209,54 +75008,35 @@ var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { IniSectionType2["SSO_SESSION"] = "sso-session"; IniSectionType2["SERVICES"] = "services"; return IniSectionType2; -})(IniSectionType || {}); - -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 72674: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromBase64 = void 0; -const util_buffer_from_1 = __nccwpck_require__(44151); -const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; -const fromBase64 = (input) => { - if ((input.length * 3) % 4 !== 0) { - throw new TypeError(`Incorrect padding on base64 string.`); - } - if (!BASE64_REGEX.exec(input)) { - throw new TypeError(`Invalid base64 string.`); - } - const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); - return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); -}; -exports.fromBase64 = fromBase64; +})(IniSectionType || {}); + +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + /***/ }), -/***/ 68385: +/***/ 91207: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; var __copyProps = (to, from, except, desc) => { if (from && typeof from === "object" || typeof from === "function") { for (let key of __getOwnPropNames(from)) @@ -84265,14 +75045,29 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; +__export(src_exports, { + fromArrayBuffer: () => fromArrayBuffer, + fromString: () => fromString +}); module.exports = __toCommonJS(src_exports); -__reExport(src_exports, __nccwpck_require__(72674), module.exports); -__reExport(src_exports, __nccwpck_require__(14871), module.exports); +var import_is_array_buffer = __nccwpck_require__(52706); +var import_buffer = __nccwpck_require__(20181); +var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { + if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); + } + return import_buffer.Buffer.from(input, offset, length); +}, "fromArrayBuffer"); +var fromString = /* @__PURE__ */ __name((input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + } + return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); +}, "fromString"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -84281,34 +75076,78 @@ __reExport(src_exports, __nccwpck_require__(14871), module.exports); /***/ }), -/***/ 14871: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 7299: +/***/ ((module) => { -"use strict"; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toBase64 = void 0; -const util_buffer_from_1 = __nccwpck_require__(44151); -const util_utf8_1 = __nccwpck_require__(71577); -const toBase64 = (_input) => { - let input; - if (typeof _input === "string") { - input = (0, util_utf8_1.fromUtf8)(_input); - } - else { - input = _input; - } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromHex: () => fromHex, + toHex: () => toHex +}); +module.exports = __toCommonJS(src_exports); +var SHORT_TO_HEX = {}; +var HEX_TO_SHORT = {}; +for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; + } + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; +} +function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); + } + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; + } else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); } - return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); -}; -exports.toBase64 = toBase64; + } + return out; +} +__name(fromHex, "fromHex"); +function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; + } + return out; +} +__name(toHex, "toHex"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + /***/ }), -/***/ 13638: +/***/ 83732: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -84333,31 +75172,22 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - calculateBodyLength: () => calculateBodyLength + getSmithyContext: () => getSmithyContext, + normalizeProvider: () => normalizeProvider }); module.exports = __toCommonJS(src_exports); -// src/calculateBodyLength.ts -var import_fs = __nccwpck_require__(79896); -var calculateBodyLength = /* @__PURE__ */ __name((body) => { - if (!body) { - return 0; - } - if (typeof body === "string") { - return Buffer.byteLength(body); - } else if (typeof body.byteLength === "number") { - return body.byteLength; - } else if (typeof body.size === "number") { - return body.size; - } else if (typeof body.start === "number" && typeof body.end === "number") { - return body.end + 1 - body.start; - } else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { - return (0, import_fs.lstatSync)(body.path).size; - } else if (typeof body.fd === "number") { - return (0, import_fs.fstatSync)(body.fd).size; - } - throw new Error(`Body Length computation failed for ${body}`); -}, "calculateBodyLength"); +// src/getSmithyContext.ts +var import_types = __nccwpck_require__(59442); +var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); + +// src/normalizeProvider.ts +var normalizeProvider = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}, "normalizeProvider"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -84366,8 +75196,8 @@ var calculateBodyLength = /* @__PURE__ */ __name((body) => { /***/ }), -/***/ 44151: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 87938: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -84391,24 +75221,20 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - fromArrayBuffer: () => fromArrayBuffer, - fromString: () => fromString + escapeUri: () => escapeUri, + escapeUriPath: () => escapeUriPath }); module.exports = __toCommonJS(src_exports); -var import_is_array_buffer = __nccwpck_require__(86130); -var import_buffer = __nccwpck_require__(20181); -var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { - if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { - throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); - } - return import_buffer.Buffer.from(input, offset, length); -}, "fromArrayBuffer"); -var fromString = /* @__PURE__ */ __name((input, encoding) => { - if (typeof input !== "string") { - throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); - } - return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); -}, "fromString"); + +// src/escape-uri.ts +var escapeUri = /* @__PURE__ */ __name((uri) => ( + // AWS percent-encodes some extra non-standard characters in a URI + encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) +), "escapeUri"); +var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); + +// src/escape-uri-path.ts +var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -84417,8 +75243,8 @@ var fromString = /* @__PURE__ */ __name((input, encoding) => { /***/ }), -/***/ 56716: -/***/ ((module) => { +/***/ 67529: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -84442,40 +75268,41 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - SelectorType: () => SelectorType, - booleanSelector: () => booleanSelector, - numberSelector: () => numberSelector + fromUtf8: () => fromUtf8, + toUint8Array: () => toUint8Array, + toUtf8: () => toUtf8 }); module.exports = __toCommonJS(src_exports); -// src/booleanSelector.ts -var booleanSelector = /* @__PURE__ */ __name((obj, key, type) => { - if (!(key in obj)) - return void 0; - if (obj[key] === "true") - return true; - if (obj[key] === "false") - return false; - throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); -}, "booleanSelector"); +// src/fromUtf8.ts +var import_util_buffer_from = __nccwpck_require__(91207); +var fromUtf8 = /* @__PURE__ */ __name((input) => { + const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); + return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); +}, "fromUtf8"); -// src/numberSelector.ts -var numberSelector = /* @__PURE__ */ __name((obj, key, type) => { - if (!(key in obj)) - return void 0; - const numberValue = parseInt(obj[key], 10); - if (Number.isNaN(numberValue)) { - throw new TypeError(`Cannot load ${type} '${key}'. Expected number, got '${obj[key]}'.`); +// src/toUint8Array.ts +var toUint8Array = /* @__PURE__ */ __name((data) => { + if (typeof data === "string") { + return fromUtf8(data); } - return numberValue; -}, "numberSelector"); + if (ArrayBuffer.isView(data)) { + return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); + } + return new Uint8Array(data); +}, "toUint8Array"); -// src/types.ts -var SelectorType = /* @__PURE__ */ ((SelectorType2) => { - SelectorType2["ENV"] = "env"; - SelectorType2["CONFIG"] = "shared config entry"; - return SelectorType2; -})(SelectorType || {}); +// src/toUtf8.ts + +var toUtf8 = /* @__PURE__ */ __name((input) => { + if (typeof input === "string") { + return input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); + } + return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); +}, "toUtf8"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -84484,14 +75311,12 @@ var SelectorType = /* @__PURE__ */ ((SelectorType2) => { /***/ }), -/***/ 15435: +/***/ 61411: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var __create = Object.create; var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; var __hasOwnProp = Object.prototype.hasOwnProperty; var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); var __export = (target, all) => { @@ -84504,779 +75329,918 @@ var __copyProps = (to, from, except, desc) => { if (!__hasOwnProp.call(to, key) && key !== except) __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - return to; + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + Client: () => Client, + Command: () => Command, + LazyJsonString: () => LazyJsonString, + NoOpLogger: () => NoOpLogger, + SENSITIVE_STRING: () => SENSITIVE_STRING, + ServiceException: () => ServiceException, + StringWrapper: () => StringWrapper, + _json: () => _json, + collectBody: () => collectBody, + convertMap: () => convertMap, + createAggregatedClient: () => createAggregatedClient, + dateToUtcString: () => dateToUtcString, + decorateServiceException: () => decorateServiceException, + emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, + expectBoolean: () => expectBoolean, + expectByte: () => expectByte, + expectFloat32: () => expectFloat32, + expectInt: () => expectInt, + expectInt32: () => expectInt32, + expectLong: () => expectLong, + expectNonNull: () => expectNonNull, + expectNumber: () => expectNumber, + expectObject: () => expectObject, + expectShort: () => expectShort, + expectString: () => expectString, + expectUnion: () => expectUnion, + extendedEncodeURIComponent: () => extendedEncodeURIComponent, + getArrayIfSingleItem: () => getArrayIfSingleItem, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + getDefaultExtensionConfiguration: () => getDefaultExtensionConfiguration, + getValueFromTextNode: () => getValueFromTextNode, + handleFloat: () => handleFloat, + isSerializableHeaderValue: () => isSerializableHeaderValue, + limitedParseDouble: () => limitedParseDouble, + limitedParseFloat: () => limitedParseFloat, + limitedParseFloat32: () => limitedParseFloat32, + loadConfigsForDefaultMode: () => loadConfigsForDefaultMode, + logger: () => logger, + map: () => map, + parseBoolean: () => parseBoolean, + parseEpochTimestamp: () => parseEpochTimestamp, + parseRfc3339DateTime: () => parseRfc3339DateTime, + parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, + parseRfc7231DateTime: () => parseRfc7231DateTime, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig, + resolvedPath: () => resolvedPath, + serializeDateTime: () => serializeDateTime, + serializeFloat: () => serializeFloat, + splitEvery: () => splitEvery, + strictParseByte: () => strictParseByte, + strictParseDouble: () => strictParseDouble, + strictParseFloat: () => strictParseFloat, + strictParseFloat32: () => strictParseFloat32, + strictParseInt: () => strictParseInt, + strictParseInt32: () => strictParseInt32, + strictParseLong: () => strictParseLong, + strictParseShort: () => strictParseShort, + take: () => take, + throwDefaultError: () => throwDefaultError, + withBaseException: () => withBaseException +}); +module.exports = __toCommonJS(src_exports); + +// src/client.ts +var import_middleware_stack = __nccwpck_require__(9208); +var _Client = class _Client { + constructor(config) { + this.config = config; + this.middlewareStack = (0, import_middleware_stack.constructStack)(); + } + send(command, optionsOrCb, cb) { + const options = typeof optionsOrCb !== "function" ? optionsOrCb : void 0; + const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; + const useHandlerCache = options === void 0 && this.config.cacheMiddleware === true; + let handler; + if (useHandlerCache) { + if (!this.handlers) { + this.handlers = /* @__PURE__ */ new WeakMap(); + } + const handlers = this.handlers; + if (handlers.has(command.constructor)) { + handler = handlers.get(command.constructor); + } else { + handler = command.resolveMiddleware(this.middlewareStack, this.config, options); + handlers.set(command.constructor, handler); + } + } else { + delete this.handlers; + handler = command.resolveMiddleware(this.middlewareStack, this.config, options); + } + if (callback) { + handler(command).then( + (result) => callback(null, result.output), + (err) => callback(err) + ).catch( + // prevent any errors thrown in the callback from triggering an + // unhandled promise rejection + () => { + } + ); + } else { + return handler(command).then((result) => result.output); + } + } + destroy() { + var _a, _b, _c; + (_c = (_b = (_a = this.config) == null ? void 0 : _a.requestHandler) == null ? void 0 : _b.destroy) == null ? void 0 : _c.call(_b); + delete this.handlers; + } +}; +__name(_Client, "Client"); +var Client = _Client; + +// src/collect-stream-body.ts +var import_util_stream = __nccwpck_require__(4252); +var collectBody = /* @__PURE__ */ __name(async (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); + } + if (!streamBody) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); + } + const fromContext = context.streamCollector(streamBody); + return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); +}, "collectBody"); + +// src/command.ts + +var import_types = __nccwpck_require__(90690); +var _Command = class _Command { + constructor() { + this.middlewareStack = (0, import_middleware_stack.constructStack)(); + } + /** + * Factory for Command ClassBuilder. + * @internal + */ + static classBuilder() { + return new ClassBuilder(); + } + /** + * @internal + */ + resolveMiddlewareWithContext(clientStack, configuration, options, { + middlewareFn, + clientName, + commandName, + inputFilterSensitiveLog, + outputFilterSensitiveLog, + smithyContext, + additionalContext, + CommandCtor + }) { + for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) { + this.middlewareStack.use(mw); + } + const stack = clientStack.concat(this.middlewareStack); + const { logger: logger2 } = configuration; + const handlerExecutionContext = { + logger: logger2, + clientName, + commandName, + inputFilterSensitiveLog, + outputFilterSensitiveLog, + [import_types.SMITHY_CONTEXT_KEY]: { + commandInstance: this, + ...smithyContext + }, + ...additionalContext + }; + const { requestHandler } = configuration; + return stack.resolve( + (request) => requestHandler.handle(request.request, options || {}), + handlerExecutionContext + ); + } +}; +__name(_Command, "Command"); +var Command = _Command; +var _ClassBuilder = class _ClassBuilder { + constructor() { + this._init = () => { + }; + this._ep = {}; + this._middlewareFn = () => []; + this._commandName = ""; + this._clientName = ""; + this._additionalContext = {}; + this._smithyContext = {}; + this._inputFilterSensitiveLog = (_) => _; + this._outputFilterSensitiveLog = (_) => _; + this._serializer = null; + this._deserializer = null; + } + /** + * Optional init callback. + */ + init(cb) { + this._init = cb; + } + /** + * Set the endpoint parameter instructions. + */ + ep(endpointParameterInstructions) { + this._ep = endpointParameterInstructions; + return this; + } + /** + * Add any number of middleware. + */ + m(middlewareSupplier) { + this._middlewareFn = middlewareSupplier; + return this; + } + /** + * Set the initial handler execution context Smithy field. + */ + s(service, operation, smithyContext = {}) { + this._smithyContext = { + service, + operation, + ...smithyContext + }; + return this; + } + /** + * Set the initial handler execution context. + */ + c(additionalContext = {}) { + this._additionalContext = additionalContext; + return this; + } + /** + * Set constant string identifiers for the operation. + */ + n(clientName, commandName) { + this._clientName = clientName; + this._commandName = commandName; + return this; + } + /** + * Set the input and output sensistive log filters. + */ + f(inputFilter = (_) => _, outputFilter = (_) => _) { + this._inputFilterSensitiveLog = inputFilter; + this._outputFilterSensitiveLog = outputFilter; + return this; + } + /** + * Sets the serializer. + */ + ser(serializer) { + this._serializer = serializer; + return this; + } + /** + * Sets the deserializer. + */ + de(deserializer) { + this._deserializer = deserializer; + return this; + } + /** + * @returns a Command class with the classBuilder properties. + */ + build() { + var _a; + const closure = this; + let CommandRef; + return CommandRef = (_a = class extends Command { + /** + * @public + */ + constructor(...[input]) { + super(); + /** + * @internal + */ + // @ts-ignore used in middlewareFn closure. + this.serialize = closure._serializer; + /** + * @internal + */ + // @ts-ignore used in middlewareFn closure. + this.deserialize = closure._deserializer; + this.input = input ?? {}; + closure._init(this); + } + /** + * @public + */ + static getEndpointParameterInstructions() { + return closure._ep; + } + /** + * @internal + */ + resolveMiddleware(stack, configuration, options) { + return this.resolveMiddlewareWithContext(stack, configuration, options, { + CommandCtor: CommandRef, + middlewareFn: closure._middlewareFn, + clientName: closure._clientName, + commandName: closure._commandName, + inputFilterSensitiveLog: closure._inputFilterSensitiveLog, + outputFilterSensitiveLog: closure._outputFilterSensitiveLog, + smithyContext: closure._smithyContext, + additionalContext: closure._additionalContext + }); + } + }, __name(_a, "CommandRef"), _a); + } }; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - resolveDefaultsModeConfig: () => resolveDefaultsModeConfig -}); -module.exports = __toCommonJS(src_exports); - -// src/resolveDefaultsModeConfig.ts -var import_config_resolver = __nccwpck_require__(39316); -var import_node_config_provider = __nccwpck_require__(78257); -var import_property_provider = __nccwpck_require__(94377); +__name(_ClassBuilder, "ClassBuilder"); +var ClassBuilder = _ClassBuilder; // src/constants.ts -var AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; -var AWS_REGION_ENV = "AWS_REGION"; -var AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; -var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; -var DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; -var IMDS_REGION_PATH = "/latest/meta-data/placement/region"; +var SENSITIVE_STRING = "***SensitiveInformation***"; -// src/defaultsModeConfig.ts -var AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; -var AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; -var NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => { - return env[AWS_DEFAULTS_MODE_ENV]; - }, - configFileSelector: (profile) => { - return profile[AWS_DEFAULTS_MODE_CONFIG]; - }, - default: "legacy" -}; +// src/create-aggregated-client.ts +var createAggregatedClient = /* @__PURE__ */ __name((commands, Client2) => { + for (const command of Object.keys(commands)) { + const CommandCtor = commands[command]; + const methodImpl = /* @__PURE__ */ __name(async function(args, optionsOrCb, cb) { + const command2 = new CommandCtor(args); + if (typeof optionsOrCb === "function") { + this.send(command2, optionsOrCb); + } else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expected http options but got ${typeof optionsOrCb}`); + this.send(command2, optionsOrCb || {}, cb); + } else { + return this.send(command2, optionsOrCb); + } + }, "methodImpl"); + const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, ""); + Client2.prototype[methodName] = methodImpl; + } +}, "createAggregatedClient"); -// src/resolveDefaultsModeConfig.ts -var resolveDefaultsModeConfig = /* @__PURE__ */ __name(({ - region = (0, import_node_config_provider.loadConfig)(import_config_resolver.NODE_REGION_CONFIG_OPTIONS), - defaultsMode = (0, import_node_config_provider.loadConfig)(NODE_DEFAULTS_MODE_CONFIG_OPTIONS) -} = {}) => (0, import_property_provider.memoize)(async () => { - const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; - switch (mode?.toLowerCase()) { - case "auto": - return resolveNodeDefaultsModeAuto(region); - case "in-region": - case "cross-region": - case "mobile": - case "standard": - case "legacy": - return Promise.resolve(mode?.toLocaleLowerCase()); - case void 0: - return Promise.resolve("legacy"); +// src/parse-utils.ts +var parseBoolean = /* @__PURE__ */ __name((value) => { + switch (value) { + case "true": + return true; + case "false": + return false; default: - throw new Error( - `Invalid parameter for "defaultsMode", expect ${DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}` - ); + throw new Error(`Unable to parse boolean value "${value}"`); } -}), "resolveDefaultsModeConfig"); -var resolveNodeDefaultsModeAuto = /* @__PURE__ */ __name(async (clientRegion) => { - if (clientRegion) { - const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; - const inferredRegion = await inferPhysicalRegion(); - if (!inferredRegion) { - return "standard"; +}, "parseBoolean"); +var expectBoolean = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "number") { + if (value === 0 || value === 1) { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); } - if (resolvedRegion === inferredRegion) { - return "in-region"; - } else { - return "cross-region"; + if (value === 0) { + return false; + } + if (value === 1) { + return true; } } - return "standard"; -}, "resolveNodeDefaultsModeAuto"); -var inferPhysicalRegion = /* @__PURE__ */ __name(async () => { - if (process.env[AWS_EXECUTION_ENV] && (process.env[AWS_REGION_ENV] || process.env[AWS_DEFAULT_REGION_ENV])) { - return process.env[AWS_REGION_ENV] ?? process.env[AWS_DEFAULT_REGION_ENV]; - } - if (!process.env[ENV_IMDS_DISABLED]) { - try { - const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(40566))); - const endpoint = await getInstanceMetadataEndpoint(); - return (await httpRequest({ ...endpoint, path: IMDS_REGION_PATH })).toString(); - } catch (e) { + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (lower === "false") { + return false; + } + if (lower === "true") { + return true; } } -}, "inferPhysicalRegion"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 78257: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + if (typeof value === "boolean") { + return value; } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - loadConfig: () => loadConfig -}); -module.exports = __toCommonJS(src_exports); - -// src/configLoader.ts - - -// src/fromEnv.ts -var import_property_provider = __nccwpck_require__(94377); - -// src/getSelectorName.ts -function getSelectorName(functionString) { - try { - const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); - constants.delete("CONFIG"); - constants.delete("CONFIG_PREFIX_SEPARATOR"); - constants.delete("ENV"); - return [...constants].join(", "); - } catch (e) { - return functionString; + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); +}, "expectBoolean"); +var expectNumber = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; } -} -__name(getSelectorName, "getSelectorName"); - -// src/fromEnv.ts -var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { - try { - const config = envVarSelector(process.env, options); - if (config === void 0) { - throw new Error(); + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); + } + return parsed; } - return config; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, - { logger: options?.logger } - ); } -}, "fromEnv"); - -// src/fromSharedConfigFiles.ts - -var import_shared_ini_file_loader = __nccwpck_require__(59645); -var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, import_shared_ini_file_loader.getProfileName)(init); - const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; - try { - const cfgFile = preferredFile === "config" ? configFile : credentialsFile; - const configValue = configSelector(mergedProfile, cfgFile); - if (configValue === void 0) { - throw new Error(); + if (typeof value === "number") { + return value; + } + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); +}, "expectNumber"); +var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); +var expectFloat32 = /* @__PURE__ */ __name((value) => { + const expected = expectNumber(value); + if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); } - return configValue; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, - { logger: init.logger } - ); } -}, "fromSharedConfigFiles"); - -// src/fromStatic.ts - -var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); -var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); - -// src/configLoader.ts -var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { - const { signingName, logger } = configuration; - const envOptions = { signingName, logger }; - return (0, import_property_provider.memoize)( - (0, import_property_provider.chain)( - fromEnv(environmentVariableSelector, envOptions), - fromSharedConfigFiles(configFileSelector, configuration), - fromStatic(defaultValue) - ) - ); -}, "loadConfig"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 94377: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + return expected; +}, "expectFloat32"); +var expectLong = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize -}); -module.exports = __toCommonJS(src_exports); - -// src/ProviderError.ts -var ProviderError = class _ProviderError extends Error { - constructor(message, options = true) { - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); +}, "expectLong"); +var expectInt = expectLong; +var expectInt32 = /* @__PURE__ */ __name((value) => expectSizedInt(value, 32), "expectInt32"); +var expectShort = /* @__PURE__ */ __name((value) => expectSizedInt(value, 16), "expectShort"); +var expectByte = /* @__PURE__ */ __name((value) => expectSizedInt(value, 8), "expectByte"); +var expectSizedInt = /* @__PURE__ */ __name((value, size) => { + const expected = expectLong(value); + if (expected !== void 0 && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; +}, "expectSizedInt"); +var castInt = /* @__PURE__ */ __name((value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } +}, "castInt"); +var expectNonNull = /* @__PURE__ */ __name((value, location) => { + if (value === null || value === void 0) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError.prototype); - logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); + throw new TypeError("Expected a non-null value"); + } + return value; +}, "expectNonNull"); +var expectObject = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); +}, "expectObject"); +var expectString = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); +}, "expectString"); +var expectUnion = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + const asObject = expectObject(value); + const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); + } + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); + } + return asObject; +}, "expectUnion"); +var strictParseDouble = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return expectNumber(parseNumber(value)); + } + return expectNumber(value); +}, "strictParseDouble"); +var strictParseFloat = strictParseDouble; +var strictParseFloat32 = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return expectFloat32(parseNumber(value)); + } + return expectFloat32(value); +}, "strictParseFloat32"); +var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; +var parseNumber = /* @__PURE__ */ __name((value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); + } + return parseFloat(value); +}, "parseNumber"); +var limitedParseDouble = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectNumber(value); +}, "limitedParseDouble"); +var handleFloat = limitedParseDouble; +var limitedParseFloat = limitedParseDouble; +var limitedParseFloat32 = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectFloat32(value); +}, "limitedParseFloat32"); +var parseFloatString = /* @__PURE__ */ __name((value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); } - static { - __name(this, "ProviderError"); +}, "parseFloatString"); +var strictParseLong = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectLong(parseNumber(value)); } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); + return expectLong(value); +}, "strictParseLong"); +var strictParseInt = strictParseLong; +var strictParseInt32 = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectInt32(parseNumber(value)); } -}; - -// src/CredentialsProviderError.ts -var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError.prototype); + return expectInt32(value); +}, "strictParseInt32"); +var strictParseShort = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectShort(parseNumber(value)); } - static { - __name(this, "CredentialsProviderError"); + return expectShort(value); +}, "strictParseShort"); +var strictParseByte = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectByte(parseNumber(value)); } + return expectByte(value); +}, "strictParseByte"); +var stackTraceWarning = /* @__PURE__ */ __name((message) => { + return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); +}, "stackTraceWarning"); +var logger = { + warn: console.warn }; -// src/TokenProviderError.ts -var TokenProviderError = class _TokenProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError.prototype); +// src/date-utils.ts +var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; +var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; +function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; +} +__name(dateToUtcString, "dateToUtcString"); +var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); +var parseRfc3339DateTime = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; } - static { - __name(this, "TokenProviderError"); + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); } -}; - -// src/chain.ts -var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError("No providers in chain"); + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err?.tryNextLink) { - continue; - } - throw err; - } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); +}, "parseRfc3339DateTime"); +var RFC3339_WITH_OFFSET = new RegExp( + /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ +); +var parseRfc3339DateTimeWithOffset = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; } - throw lastProviderError; -}, "chain"); - -// src/fromStatic.ts -var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); - -// src/memoize.ts -var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - return resolved; - }; + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - if (isConstant) { - return resolved; - } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; - } - return resolved; - }; -}, "memoize"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 45819: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getHomeDir = void 0; -const os_1 = __nccwpck_require__(70857); -const path_1 = __nccwpck_require__(16928); -const homeDirCache = {}; -const getHomeDirCacheKey = () => { - if (process && process.geteuid) { - return `${process.geteuid()}`; - } - return "DEFAULT"; -}; -const getHomeDir = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - const homeDirCacheKey = getHomeDirCacheKey(); - if (!homeDirCache[homeDirCacheKey]) - homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); - return homeDirCache[homeDirCacheKey]; -}; -exports.getHomeDir = getHomeDir; - - -/***/ }), - -/***/ 2824: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFilepath = void 0; -const crypto_1 = __nccwpck_require__(76982); -const path_1 = __nccwpck_require__(16928); -const getHomeDir_1 = __nccwpck_require__(45819); -const getSSOTokenFilepath = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); -}; -exports.getSSOTokenFilepath = getSSOTokenFilepath; - - -/***/ }), - -/***/ 60127: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFromFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const getSSOTokenFilepath_1 = __nccwpck_require__(2824); -const { readFile } = fs_1.promises; -const getSSOTokenFromFile = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); -}; -exports.getSSOTokenFromFile = getSSOTokenFromFile; - - -/***/ }), - -/***/ 59645: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + const match = RFC3339_WITH_OFFSET.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - getProfileName: () => getProfileName, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles -}); -module.exports = __toCommonJS(src_exports); -__reExport(src_exports, __nccwpck_require__(45819), module.exports); - -// src/getProfileName.ts -var ENV_PROFILE = "AWS_PROFILE"; -var DEFAULT_PROFILE = "default"; -var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); - -// src/index.ts -__reExport(src_exports, __nccwpck_require__(2824), module.exports); -__reExport(src_exports, __nccwpck_require__(60127), module.exports); - -// src/loadSharedConfigFiles.ts - - -// src/getConfigData.ts -var import_types = __nccwpck_require__(79969); -var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + if (offsetStr.toUpperCase() != "Z") { + date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); } - return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); -}).reduce( - (acc, [key, value]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; - acc[updatedKey] = value; - return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } + return date; +}, "parseRfc3339DateTimeWithOffset"); +var IMF_FIXDATE = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ +); +var RFC_850_DATE = new RegExp( + /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ +); +var ASC_TIME = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ +); +var parseRfc7231DateTime = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; } -), "getConfigData"); - -// src/getConfigFilepath.ts -var import_path = __nccwpck_require__(16928); -var import_getHomeDir = __nccwpck_require__(45819); -var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; -var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); - -// src/getCredentialsFilepath.ts - -var import_getHomeDir2 = __nccwpck_require__(45819); -var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; -var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); - -// src/loadSharedConfigFiles.ts -var import_getHomeDir3 = __nccwpck_require__(45819); - -// src/parseIni.ts - -var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; -var profileNameBlockList = ["__proto__", "profile __proto__"]; -var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); - } - } else { - currentSection = sectionName; - } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); - } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; - } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; - } - } - } + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); + } + let match = IMF_FIXDATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr, "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + match = RFC_850_DATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year( + buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds + }) + ); + } + match = ASC_TIME.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr.trimLeft(), "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + throw new TypeError("Invalid RFC-7231 date-time value"); +}, "parseRfc7231DateTime"); +var parseEpochTimestamp = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } else if (typeof value === "string") { + valueAsDouble = strictParseDouble(value); + } else if (typeof value === "object" && value.tag === 1) { + valueAsDouble = value.value; + } else { + throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + } + if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { + throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); + } + return new Date(Math.round(valueAsDouble * 1e3)); +}, "parseEpochTimestamp"); +var buildDate = /* @__PURE__ */ __name((year, month, day, time) => { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date( + Date.UTC( + year, + adjustedMonth, + day, + parseDateValue(time.hours, "hour", 0, 23), + parseDateValue(time.minutes, "minute", 0, 59), + // seconds can go up to 60 for leap seconds + parseDateValue(time.seconds, "seconds", 0, 60), + parseMilliseconds(time.fractionalMilliseconds) + ) + ); +}, "buildDate"); +var parseTwoDigitYear = /* @__PURE__ */ __name((value) => { + const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; + } + return valueInThisCentury; +}, "parseTwoDigitYear"); +var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; +var adjustRfc850Year = /* @__PURE__ */ __name((input) => { + if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date( + Date.UTC( + input.getUTCFullYear() - 100, + input.getUTCMonth(), + input.getUTCDate(), + input.getUTCHours(), + input.getUTCMinutes(), + input.getUTCSeconds(), + input.getUTCMilliseconds() + ) + ); + } + return input; +}, "adjustRfc850Year"); +var parseMonthByShortName = /* @__PURE__ */ __name((value) => { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); + } + return monthIdx + 1; +}, "parseMonthByShortName"); +var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; +var validateDayOfMonth = /* @__PURE__ */ __name((year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; } - return map; -}, "parseIni"); - -// src/loadSharedConfigFiles.ts -var import_slurpFile = __nccwpck_require__(45103); -var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var CONFIG_PREFIX_SEPARATOR = "."; -var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); +}, "validateDayOfMonth"); +var isLeapYear = /* @__PURE__ */ __name((year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +}, "isLeapYear"); +var parseDateValue = /* @__PURE__ */ __name((value, type, lower, upper) => { + const dateVal = strictParseByte(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; -}, "loadSharedConfigFiles"); - -// src/getSsoSessionData.ts - -var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); - -// src/loadSsoSessionData.ts -var import_slurpFile2 = __nccwpck_require__(45103); -var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); - -// src/mergeConfigFiles.ts -var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); - } else { - merged[key] = values; - } - } + return dateVal; +}, "parseDateValue"); +var parseMilliseconds = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return 0; } - return merged; -}, "mergeConfigFiles"); - -// src/parseKnownFiles.ts -var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); -}, "parseKnownFiles"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 45103: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.slurpFile = void 0; -const fs_1 = __nccwpck_require__(79896); -const { readFile } = fs_1.promises; -const filePromisesHash = {}; -const slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); - } - return filePromisesHash[path]; -}; -exports.slurpFile = slurpFile; - - -/***/ }), - -/***/ 79969: -/***/ ((module) => { + return strictParseFloat32("0." + value) * 1e3; +}, "parseMilliseconds"); +var parseOffsetToMilliseconds = /* @__PURE__ */ __name((value) => { + const directionStr = value[0]; + let direction = 1; + if (directionStr == "+") { + direction = 1; + } else if (directionStr == "-") { + direction = -1; + } else { + throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + } + const hour = Number(value.substring(1, 3)); + const minute = Number(value.substring(4, 6)); + return direction * (hour * 60 + minute) * 60 * 1e3; +}, "parseOffsetToMilliseconds"); +var stripLeadingZeroes = /* @__PURE__ */ __name((value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; + } + if (idx === 0) { + return value; + } + return value.slice(idx); +}, "stripLeadingZeroes"); -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +// src/exceptions.ts +var _ServiceException = class _ServiceException extends Error { + constructor(options) { + super(options.message); + Object.setPrototypeOf(this, _ServiceException.prototype); + this.name = options.name; + this.$fault = options.$fault; + this.$metadata = options.$metadata; } - return to; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +__name(_ServiceException, "ServiceException"); +var ServiceException = _ServiceException; +var decorateServiceException = /* @__PURE__ */ __name((exception, additions = {}) => { + Object.entries(additions).filter(([, v]) => v !== void 0).forEach(([k, v]) => { + if (exception[k] == void 0 || exception[k] === "") { + exception[k] = v; + } + }); + const message = exception.message || exception.Message || "UnknownError"; + exception.message = message; + delete exception.Message; + return exception; +}, "decorateServiceException"); -// src/index.ts -var src_exports = {}; -__export(src_exports, { - AlgorithmId: () => AlgorithmId, - EndpointURLScheme: () => EndpointURLScheme, - FieldPosition: () => FieldPosition, - HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, - HttpAuthLocation: () => HttpAuthLocation, - IniSectionType: () => IniSectionType, - RequestHandlerProtocol: () => RequestHandlerProtocol, - SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig -}); -module.exports = __toCommonJS(src_exports); +// src/default-error-handler.ts +var throwDefaultError = /* @__PURE__ */ __name(({ output, parsedBody, exceptionCtor, errorCode }) => { + const $metadata = deserializeMetadata(output); + const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : void 0; + const response = new exceptionCtor({ + name: (parsedBody == null ? void 0 : parsedBody.code) || (parsedBody == null ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError", + $fault: "client", + $metadata + }); + throw decorateServiceException(response, parsedBody); +}, "throwDefaultError"); +var withBaseException = /* @__PURE__ */ __name((ExceptionCtor) => { + return ({ output, parsedBody, errorCode }) => { + throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode }); + }; +}, "withBaseException"); +var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] +}), "deserializeMetadata"); -// src/auth/auth.ts -var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { - HttpAuthLocation2["HEADER"] = "header"; - HttpAuthLocation2["QUERY"] = "query"; - return HttpAuthLocation2; -})(HttpAuthLocation || {}); +// src/defaults-mode.ts +var loadConfigsForDefaultMode = /* @__PURE__ */ __name((mode) => { + switch (mode) { + case "standard": + return { + retryMode: "standard", + connectionTimeout: 3100 + }; + case "in-region": + return { + retryMode: "standard", + connectionTimeout: 1100 + }; + case "cross-region": + return { + retryMode: "standard", + connectionTimeout: 3100 + }; + case "mobile": + return { + retryMode: "standard", + connectionTimeout: 3e4 + }; + default: + return {}; + } +}, "loadConfigsForDefaultMode"); -// src/auth/HttpApiKeyAuth.ts -var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { - HttpApiKeyAuthLocation2["HEADER"] = "header"; - HttpApiKeyAuthLocation2["QUERY"] = "query"; - return HttpApiKeyAuthLocation2; -})(HttpApiKeyAuthLocation || {}); +// src/emitWarningIfUnsupportedVersion.ts +var warningEmitted = false; +var emitWarningIfUnsupportedVersion = /* @__PURE__ */ __name((version) => { + if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) { + warningEmitted = true; + } +}, "emitWarningIfUnsupportedVersion"); -// src/endpoint.ts -var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { - EndpointURLScheme2["HTTP"] = "http"; - EndpointURLScheme2["HTTPS"] = "https"; - return EndpointURLScheme2; -})(EndpointURLScheme || {}); +// src/extended-encode-uri-component.ts +function extendedEncodeURIComponent(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); +} +__name(extendedEncodeURIComponent, "extendedEncodeURIComponent"); // src/extensions/checksum.ts -var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { - AlgorithmId2["MD5"] = "md5"; - AlgorithmId2["CRC32"] = "crc32"; - AlgorithmId2["CRC32C"] = "crc32c"; - AlgorithmId2["SHA1"] = "sha1"; - AlgorithmId2["SHA256"] = "sha256"; - return AlgorithmId2; -})(AlgorithmId || {}); + var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { const checksumAlgorithms = []; - if (runtimeConfig.sha256 !== void 0) { - checksumAlgorithms.push({ - algorithmId: () => "sha256" /* SHA256 */, - checksumConstructor: () => runtimeConfig.sha256 - }); - } - if (runtimeConfig.md5 != void 0) { + for (const id in import_types.AlgorithmId) { + const algorithmId = import_types.AlgorithmId[id]; + if (runtimeConfig[algorithmId] === void 0) { + continue; + } checksumAlgorithms.push({ - algorithmId: () => "md5" /* MD5 */, - checksumConstructor: () => runtimeConfig.md5 + algorithmId: () => algorithmId, + checksumConstructor: () => runtimeConfig[algorithmId] }); } return { + _checksumAlgorithms: checksumAlgorithms, addChecksumAlgorithm(algo) { - checksumAlgorithms.push(algo); + this._checksumAlgorithms.push(algo); }, checksumAlgorithms() { - return checksumAlgorithms; + return this._checksumAlgorithms; } }; }, "getChecksumConfiguration"); @@ -85288,583 +76252,289 @@ var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { return runtimeConfig; }, "resolveChecksumRuntimeConfig"); -// src/extensions/defaultClientConfiguration.ts -var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return getChecksumConfiguration(runtimeConfig); -}, "getDefaultClientConfiguration"); +// src/extensions/retry.ts +var getRetryConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let _retryStrategy = runtimeConfig.retryStrategy; + return { + setRetryStrategy(retryStrategy) { + _retryStrategy = retryStrategy; + }, + retryStrategy() { + return _retryStrategy; + } + }; +}, "getRetryConfiguration"); +var resolveRetryRuntimeConfig = /* @__PURE__ */ __name((retryStrategyConfiguration) => { + const runtimeConfig = {}; + runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy(); + return runtimeConfig; +}, "resolveRetryRuntimeConfig"); + +// src/extensions/defaultExtensionConfiguration.ts +var getDefaultExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return { + ...getChecksumConfiguration(runtimeConfig), + ...getRetryConfiguration(runtimeConfig) + }; +}, "getDefaultExtensionConfiguration"); +var getDefaultClientConfiguration = getDefaultExtensionConfiguration; var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return resolveChecksumRuntimeConfig(config); + return { + ...resolveChecksumRuntimeConfig(config), + ...resolveRetryRuntimeConfig(config) + }; }, "resolveDefaultRuntimeConfig"); -// src/http.ts -var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { - FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; - FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; - return FieldPosition2; -})(FieldPosition || {}); - -// src/middleware.ts -var SMITHY_CONTEXT_KEY = "__smithy_context"; - -// src/profile.ts -var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { - IniSectionType2["PROFILE"] = "profile"; - IniSectionType2["SSO_SESSION"] = "sso-session"; - IniSectionType2["SERVICES"] = "services"; - return IniSectionType2; -})(IniSectionType || {}); - -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 79674: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var src_exports = {}; -__export(src_exports, { - EndpointCache: () => EndpointCache, - EndpointError: () => EndpointError, - customEndpointFunctions: () => customEndpointFunctions, - isIpAddress: () => isIpAddress, - isValidHostLabel: () => isValidHostLabel, - resolveEndpoint: () => resolveEndpoint -}); -module.exports = __toCommonJS(src_exports); +// src/get-array-if-single-item.ts +var getArrayIfSingleItem = /* @__PURE__ */ __name((mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray], "getArrayIfSingleItem"); -// src/cache/EndpointCache.ts -var EndpointCache = class { - /** - * @param [size] - desired average maximum capacity. A buffer of 10 additional keys will be allowed - * before keys are dropped. - * @param [params] - list of params to consider as part of the cache key. - * - * If the params list is not populated, no caching will happen. - * This may be out of order depending on how the object is created and arrives to this class. - */ - constructor({ size, params }) { - this.data = /* @__PURE__ */ new Map(); - this.parameters = []; - this.capacity = size ?? 50; - if (params) { - this.parameters = params; - } - } - static { - __name(this, "EndpointCache"); - } - /** - * @param endpointParams - query for endpoint. - * @param resolver - provider of the value if not present. - * @returns endpoint corresponding to the query. - */ - get(endpointParams, resolver) { - const key = this.hash(endpointParams); - if (key === false) { - return resolver(); - } - if (!this.data.has(key)) { - if (this.data.size > this.capacity + 10) { - const keys = this.data.keys(); - let i = 0; - while (true) { - const { value, done } = keys.next(); - this.data.delete(value); - if (done || ++i > 10) { - break; - } - } - } - this.data.set(key, resolver()); - } - return this.data.get(key); - } - size() { - return this.data.size; - } - /** - * @returns cache key or false if not cachable. - */ - hash(endpointParams) { - let buffer = ""; - const { parameters } = this; - if (parameters.length === 0) { - return false; - } - for (const param of parameters) { - const val = String(endpointParams[param] ?? ""); - if (val.includes("|;")) { - return false; - } - buffer += val + "|;"; +// src/get-value-from-text-node.ts +var getValueFromTextNode = /* @__PURE__ */ __name((obj) => { + const textNodeName = "#text"; + for (const key in obj) { + if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== void 0) { + obj[key] = obj[key][textNodeName]; + } else if (typeof obj[key] === "object" && obj[key] !== null) { + obj[key] = getValueFromTextNode(obj[key]); } - return buffer; } -}; + return obj; +}, "getValueFromTextNode"); -// src/lib/isIpAddress.ts -var IP_V4_REGEX = new RegExp( - `^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$` -); -var isIpAddress = /* @__PURE__ */ __name((value) => IP_V4_REGEX.test(value) || value.startsWith("[") && value.endsWith("]"), "isIpAddress"); +// src/is-serializable-header-value.ts +var isSerializableHeaderValue = /* @__PURE__ */ __name((value) => { + return value != null; +}, "isSerializableHeaderValue"); -// src/lib/isValidHostLabel.ts -var VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); -var isValidHostLabel = /* @__PURE__ */ __name((value, allowSubDomains = false) => { - if (!allowSubDomains) { - return VALID_HOST_LABEL_REGEX.test(value); +// src/lazy-json.ts +var StringWrapper = /* @__PURE__ */ __name(function() { + const Class = Object.getPrototypeOf(this).constructor; + const Constructor = Function.bind.apply(String, [null, ...arguments]); + const instance = new Constructor(); + Object.setPrototypeOf(instance, Class.prototype); + return instance; +}, "StringWrapper"); +StringWrapper.prototype = Object.create(String.prototype, { + constructor: { + value: StringWrapper, + enumerable: false, + writable: true, + configurable: true } - const labels = value.split("."); - for (const label of labels) { - if (!isValidHostLabel(label)) { - return false; +}); +Object.setPrototypeOf(StringWrapper, String); +var _LazyJsonString = class _LazyJsonString extends StringWrapper { + deserializeJSON() { + return JSON.parse(super.toString()); + } + toJSON() { + return super.toString(); + } + static fromObject(object) { + if (object instanceof _LazyJsonString) { + return object; + } else if (object instanceof String || typeof object === "string") { + return new _LazyJsonString(object); } + return new _LazyJsonString(JSON.stringify(object)); } - return true; -}, "isValidHostLabel"); - -// src/utils/customEndpointFunctions.ts -var customEndpointFunctions = {}; - -// src/debug/debugId.ts -var debugId = "endpoints"; +}; +__name(_LazyJsonString, "LazyJsonString"); +var LazyJsonString = _LazyJsonString; -// src/debug/toDebugString.ts -function toDebugString(input) { - if (typeof input !== "object" || input == null) { - return input; +// src/NoOpLogger.ts +var _NoOpLogger = class _NoOpLogger { + trace() { } - if ("ref" in input) { - return `$${toDebugString(input.ref)}`; + debug() { } - if ("fn" in input) { - return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; + info() { } - return JSON.stringify(input, null, 2); -} -__name(toDebugString, "toDebugString"); - -// src/types/EndpointError.ts -var EndpointError = class extends Error { - static { - __name(this, "EndpointError"); + warn() { } - constructor(message) { - super(message); - this.name = "EndpointError"; + error() { } }; +__name(_NoOpLogger, "NoOpLogger"); +var NoOpLogger = _NoOpLogger; -// src/lib/booleanEquals.ts -var booleanEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "booleanEquals"); - -// src/lib/getAttrPathList.ts -var getAttrPathList = /* @__PURE__ */ __name((path) => { - const parts = path.split("."); - const pathList = []; - for (const part of parts) { - const squareBracketIndex = part.indexOf("["); - if (squareBracketIndex !== -1) { - if (part.indexOf("]") !== part.length - 1) { - throw new EndpointError(`Path: '${path}' does not end with ']'`); - } - const arrayIndex = part.slice(squareBracketIndex + 1, -1); - if (Number.isNaN(parseInt(arrayIndex))) { - throw new EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`); - } - if (squareBracketIndex !== 0) { - pathList.push(part.slice(0, squareBracketIndex)); - } - pathList.push(arrayIndex); +// src/object-mapping.ts +function map(arg0, arg1, arg2) { + let target; + let filter; + let instructions; + if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { + target = {}; + instructions = arg0; + } else { + target = arg0; + if (typeof arg1 === "function") { + filter = arg1; + instructions = arg2; + return mapWithFilter(target, filter, instructions); } else { - pathList.push(part); + instructions = arg1; } } - return pathList; -}, "getAttrPathList"); - -// src/lib/getAttr.ts -var getAttr = /* @__PURE__ */ __name((value, path) => getAttrPathList(path).reduce((acc, index) => { - if (typeof acc !== "object") { - throw new EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); - } else if (Array.isArray(acc)) { - return acc[parseInt(index)]; - } - return acc[index]; -}, value), "getAttr"); - -// src/lib/isSet.ts -var isSet = /* @__PURE__ */ __name((value) => value != null, "isSet"); - -// src/lib/not.ts -var not = /* @__PURE__ */ __name((value) => !value, "not"); - -// src/lib/parseURL.ts -var import_types3 = __nccwpck_require__(55430); -var DEFAULT_PORTS = { - [import_types3.EndpointURLScheme.HTTP]: 80, - [import_types3.EndpointURLScheme.HTTPS]: 443 -}; -var parseURL = /* @__PURE__ */ __name((value) => { - const whatwgURL = (() => { - try { - if (value instanceof URL) { - return value; - } - if (typeof value === "object" && "hostname" in value) { - const { hostname: hostname2, port, protocol: protocol2 = "", path = "", query = {} } = value; - const url = new URL(`${protocol2}//${hostname2}${port ? `:${port}` : ""}${path}`); - url.search = Object.entries(query).map(([k, v]) => `${k}=${v}`).join("&"); - return url; - } - return new URL(value); - } catch (error) { - return null; + for (const key of Object.keys(instructions)) { + if (!Array.isArray(instructions[key])) { + target[key] = instructions[key]; + continue; } - })(); - if (!whatwgURL) { - console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); - return null; - } - const urlString = whatwgURL.href; - const { host, hostname, pathname, protocol, search } = whatwgURL; - if (search) { - return null; - } - const scheme = protocol.slice(0, -1); - if (!Object.values(import_types3.EndpointURLScheme).includes(scheme)) { - return null; + applyInstruction(target, null, instructions, key); } - const isIp = isIpAddress(hostname); - const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`); - const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; - return { - scheme, - authority, - path: pathname, - normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, - isIp - }; -}, "parseURL"); - -// src/lib/stringEquals.ts -var stringEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "stringEquals"); - -// src/lib/substring.ts -var substring = /* @__PURE__ */ __name((input, start, stop, reverse) => { - if (start >= stop || input.length < stop) { - return null; + return target; +} +__name(map, "map"); +var convertMap = /* @__PURE__ */ __name((target) => { + const output = {}; + for (const [k, v] of Object.entries(target || {})) { + output[k] = [, v]; } - if (!reverse) { - return input.substring(start, stop); + return output; +}, "convertMap"); +var take = /* @__PURE__ */ __name((source, instructions) => { + const out = {}; + for (const key in instructions) { + applyInstruction(out, source, instructions, key); } - return input.substring(input.length - stop, input.length - start); -}, "substring"); - -// src/lib/uriEncode.ts -var uriEncode = /* @__PURE__ */ __name((value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`), "uriEncode"); - -// src/utils/endpointFunctions.ts -var endpointFunctions = { - booleanEquals, - getAttr, - isSet, - isValidHostLabel, - not, - parseURL, - stringEquals, - substring, - uriEncode -}; - -// src/utils/evaluateTemplate.ts -var evaluateTemplate = /* @__PURE__ */ __name((template, options) => { - const evaluatedTemplateArr = []; - const templateContext = { - ...options.endpointParams, - ...options.referenceRecord - }; - let currentIndex = 0; - while (currentIndex < template.length) { - const openingBraceIndex = template.indexOf("{", currentIndex); - if (openingBraceIndex === -1) { - evaluatedTemplateArr.push(template.slice(currentIndex)); - break; + return out; +}, "take"); +var mapWithFilter = /* @__PURE__ */ __name((target, filter, instructions) => { + return map( + target, + Object.entries(instructions).reduce( + (_instructions, [key, value]) => { + if (Array.isArray(value)) { + _instructions[key] = value; + } else { + if (typeof value === "function") { + _instructions[key] = [filter, value()]; + } else { + _instructions[key] = [filter, value]; + } + } + return _instructions; + }, + {} + ) + ); +}, "mapWithFilter"); +var applyInstruction = /* @__PURE__ */ __name((target, source, instructions, targetKey) => { + if (source !== null) { + let instruction = instructions[targetKey]; + if (typeof instruction === "function") { + instruction = [, instruction]; } - evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex)); - const closingBraceIndex = template.indexOf("}", openingBraceIndex); - if (closingBraceIndex === -1) { - evaluatedTemplateArr.push(template.slice(openingBraceIndex)); - break; + const [filter2 = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction; + if (typeof filter2 === "function" && filter2(source[sourceKey]) || typeof filter2 !== "function" && !!filter2) { + target[targetKey] = valueFn(source[sourceKey]); } - if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") { - evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex)); - currentIndex = closingBraceIndex + 2; + return; + } + let [filter, value] = instructions[targetKey]; + if (typeof value === "function") { + let _value; + const defaultFilterPassed = filter === void 0 && (_value = value()) != null; + const customFilterPassed = typeof filter === "function" && !!filter(void 0) || typeof filter !== "function" && !!filter; + if (defaultFilterPassed) { + target[targetKey] = _value; + } else if (customFilterPassed) { + target[targetKey] = value(); } - const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex); - if (parameterName.includes("#")) { - const [refName, attrName] = parameterName.split("#"); - evaluatedTemplateArr.push(getAttr(templateContext[refName], attrName)); - } else { - evaluatedTemplateArr.push(templateContext[parameterName]); + } else { + const defaultFilterPassed = filter === void 0 && value != null; + const customFilterPassed = typeof filter === "function" && !!filter(value) || typeof filter !== "function" && !!filter; + if (defaultFilterPassed || customFilterPassed) { + target[targetKey] = value; } - currentIndex = closingBraceIndex + 1; } - return evaluatedTemplateArr.join(""); -}, "evaluateTemplate"); - -// src/utils/getReferenceValue.ts -var getReferenceValue = /* @__PURE__ */ __name(({ ref }, options) => { - const referenceRecord = { - ...options.endpointParams, - ...options.referenceRecord - }; - return referenceRecord[ref]; -}, "getReferenceValue"); +}, "applyInstruction"); +var nonNullish = /* @__PURE__ */ __name((_) => _ != null, "nonNullish"); +var pass = /* @__PURE__ */ __name((_) => _, "pass"); -// src/utils/evaluateExpression.ts -var evaluateExpression = /* @__PURE__ */ __name((obj, keyName, options) => { - if (typeof obj === "string") { - return evaluateTemplate(obj, options); - } else if (obj["fn"]) { - return callFunction(obj, options); - } else if (obj["ref"]) { - return getReferenceValue(obj, options); +// src/resolve-path.ts +var resolvedPath = /* @__PURE__ */ __name((resolvedPath2, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== void 0) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); + } + resolvedPath2 = resolvedPath2.replace( + uriLabel, + isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) + ); + } else { + throw new Error("No value provided for input HTTP label: " + memberName + "."); } - throw new EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`); -}, "evaluateExpression"); + return resolvedPath2; +}, "resolvedPath"); -// src/utils/callFunction.ts -var callFunction = /* @__PURE__ */ __name(({ fn, argv }, options) => { - const evaluatedArgs = argv.map( - (arg) => ["boolean", "number"].includes(typeof arg) ? arg : evaluateExpression(arg, "arg", options) - ); - const fnSegments = fn.split("."); - if (fnSegments[0] in customEndpointFunctions && fnSegments[1] != null) { - return customEndpointFunctions[fnSegments[0]][fnSegments[1]](...evaluatedArgs); +// src/ser-utils.ts +var serializeFloat = /* @__PURE__ */ __name((value) => { + if (value !== value) { + return "NaN"; } - return endpointFunctions[fn](...evaluatedArgs); -}, "callFunction"); - -// src/utils/evaluateCondition.ts -var evaluateCondition = /* @__PURE__ */ __name(({ assign, ...fnArgs }, options) => { - if (assign && assign in options.referenceRecord) { - throw new EndpointError(`'${assign}' is already defined in Reference Record.`); + switch (value) { + case Infinity: + return "Infinity"; + case -Infinity: + return "-Infinity"; + default: + return value; } - const value = callFunction(fnArgs, options); - options.logger?.debug?.(`${debugId} evaluateCondition: ${toDebugString(fnArgs)} = ${toDebugString(value)}`); - return { - result: value === "" ? true : !!value, - ...assign != null && { toAssign: { name: assign, value } } - }; -}, "evaluateCondition"); +}, "serializeFloat"); +var serializeDateTime = /* @__PURE__ */ __name((date) => date.toISOString().replace(".000Z", "Z"), "serializeDateTime"); -// src/utils/evaluateConditions.ts -var evaluateConditions = /* @__PURE__ */ __name((conditions = [], options) => { - const conditionsReferenceRecord = {}; - for (const condition of conditions) { - const { result, toAssign } = evaluateCondition(condition, { - ...options, - referenceRecord: { - ...options.referenceRecord, - ...conditionsReferenceRecord - } - }); - if (!result) { - return { result }; - } - if (toAssign) { - conditionsReferenceRecord[toAssign.name] = toAssign.value; - options.logger?.debug?.(`${debugId} assign: ${toAssign.name} := ${toDebugString(toAssign.value)}`); - } +// src/serde-json.ts +var _json = /* @__PURE__ */ __name((obj) => { + if (obj == null) { + return {}; } - return { result: true, referenceRecord: conditionsReferenceRecord }; -}, "evaluateConditions"); - -// src/utils/getEndpointHeaders.ts -var getEndpointHeaders = /* @__PURE__ */ __name((headers, options) => Object.entries(headers).reduce( - (acc, [headerKey, headerVal]) => ({ - ...acc, - [headerKey]: headerVal.map((headerValEntry) => { - const processedExpr = evaluateExpression(headerValEntry, "Header value entry", options); - if (typeof processedExpr !== "string") { - throw new EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`); - } - return processedExpr; - }) - }), - {} -), "getEndpointHeaders"); - -// src/utils/getEndpointProperty.ts -var getEndpointProperty = /* @__PURE__ */ __name((property, options) => { - if (Array.isArray(property)) { - return property.map((propertyEntry) => getEndpointProperty(propertyEntry, options)); + if (Array.isArray(obj)) { + return obj.filter((_) => _ != null).map(_json); } - switch (typeof property) { - case "string": - return evaluateTemplate(property, options); - case "object": - if (property === null) { - throw new EndpointError(`Unexpected endpoint property: ${property}`); + if (typeof obj === "object") { + const target = {}; + for (const key of Object.keys(obj)) { + if (obj[key] == null) { + continue; } - return getEndpointProperties(property, options); - case "boolean": - return property; - default: - throw new EndpointError(`Unexpected endpoint property type: ${typeof property}`); - } -}, "getEndpointProperty"); - -// src/utils/getEndpointProperties.ts -var getEndpointProperties = /* @__PURE__ */ __name((properties, options) => Object.entries(properties).reduce( - (acc, [propertyKey, propertyVal]) => ({ - ...acc, - [propertyKey]: getEndpointProperty(propertyVal, options) - }), - {} -), "getEndpointProperties"); - -// src/utils/getEndpointUrl.ts -var getEndpointUrl = /* @__PURE__ */ __name((endpointUrl, options) => { - const expression = evaluateExpression(endpointUrl, "Endpoint URL", options); - if (typeof expression === "string") { - try { - return new URL(expression); - } catch (error) { - console.error(`Failed to construct URL with ${expression}`, error); - throw error; + target[key] = _json(obj[key]); } + return target; } - throw new EndpointError(`Endpoint URL must be a string, got ${typeof expression}`); -}, "getEndpointUrl"); - -// src/utils/evaluateEndpointRule.ts -var evaluateEndpointRule = /* @__PURE__ */ __name((endpointRule, options) => { - const { conditions, endpoint } = endpointRule; - const { result, referenceRecord } = evaluateConditions(conditions, options); - if (!result) { - return; - } - const endpointRuleOptions = { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord } - }; - const { url, properties, headers } = endpoint; - options.logger?.debug?.(`${debugId} Resolving endpoint from template: ${toDebugString(endpoint)}`); - return { - ...headers != void 0 && { - headers: getEndpointHeaders(headers, endpointRuleOptions) - }, - ...properties != void 0 && { - properties: getEndpointProperties(properties, endpointRuleOptions) - }, - url: getEndpointUrl(url, endpointRuleOptions) - }; -}, "evaluateEndpointRule"); + return obj; +}, "_json"); -// src/utils/evaluateErrorRule.ts -var evaluateErrorRule = /* @__PURE__ */ __name((errorRule, options) => { - const { conditions, error } = errorRule; - const { result, referenceRecord } = evaluateConditions(conditions, options); - if (!result) { - return; +// src/split-every.ts +function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); } - throw new EndpointError( - evaluateExpression(error, "Error", { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord } - }) - ); -}, "evaluateErrorRule"); - -// src/utils/evaluateTreeRule.ts -var evaluateTreeRule = /* @__PURE__ */ __name((treeRule, options) => { - const { conditions, rules } = treeRule; - const { result, referenceRecord } = evaluateConditions(conditions, options); - if (!result) { - return; + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; } - return evaluateRules(rules, { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord } - }); -}, "evaluateTreeRule"); - -// src/utils/evaluateRules.ts -var evaluateRules = /* @__PURE__ */ __name((rules, options) => { - for (const rule of rules) { - if (rule.type === "endpoint") { - const endpointOrUndefined = evaluateEndpointRule(rule, options); - if (endpointOrUndefined) { - return endpointOrUndefined; - } - } else if (rule.type === "error") { - evaluateErrorRule(rule, options); - } else if (rule.type === "tree") { - const endpointOrUndefined = evaluateTreeRule(rule, options); - if (endpointOrUndefined) { - return endpointOrUndefined; - } + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; } else { - throw new EndpointError(`Unknown endpoint rule: ${rule}`); + currentSegment += delimiter + segments[i]; } - } - throw new EndpointError(`Rules evaluation failed`); -}, "evaluateRules"); - -// src/resolveEndpoint.ts -var resolveEndpoint = /* @__PURE__ */ __name((ruleSetObject, options) => { - const { endpointParams, logger } = options; - const { parameters, rules } = ruleSetObject; - options.logger?.debug?.(`${debugId} Initial EndpointParams: ${toDebugString(endpointParams)}`); - const paramsWithDefault = Object.entries(parameters).filter(([, v]) => v.default != null).map(([k, v]) => [k, v.default]); - if (paramsWithDefault.length > 0) { - for (const [paramKey, paramDefaultValue] of paramsWithDefault) { - endpointParams[paramKey] = endpointParams[paramKey] ?? paramDefaultValue; + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; } } - const requiredParams = Object.entries(parameters).filter(([, v]) => v.required).map(([k]) => k); - for (const requiredParam of requiredParams) { - if (endpointParams[requiredParam] == null) { - throw new EndpointError(`Missing required parameter: '${requiredParam}'`); - } + if (currentSegment !== "") { + compoundSegments.push(currentSegment); } - const endpoint = evaluateRules(rules, { endpointParams, logger, referenceRecord: {} }); - options.logger?.debug?.(`${debugId} Resolved endpoint: ${toDebugString(endpoint)}`); - return endpoint; -}, "resolveEndpoint"); + return compoundSegments; +} +__name(splitEvery, "splitEvery"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -85873,7 +76543,7 @@ var resolveEndpoint = /* @__PURE__ */ __name((ruleSetObject, options) => { /***/ }), -/***/ 55430: +/***/ 90690: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -85956,11 +76626,12 @@ var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { }); } return { + _checksumAlgorithms: checksumAlgorithms, addChecksumAlgorithm(algo) { - checksumAlgorithms.push(algo); + this._checksumAlgorithms.push(algo); }, checksumAlgorithms() { - return checksumAlgorithms; + return this._checksumAlgorithms; } }; }, "getChecksumConfiguration"); @@ -85974,10 +76645,14 @@ var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { // src/extensions/defaultClientConfiguration.ts var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return getChecksumConfiguration(runtimeConfig); + return { + ...getChecksumConfiguration(runtimeConfig) + }; }, "getDefaultClientConfiguration"); var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return resolveChecksumRuntimeConfig(config); + return { + ...resolveChecksumRuntimeConfig(config) + }; }, "resolveDefaultRuntimeConfig"); // src/http.ts @@ -86013,8 +76688,90 @@ var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { /***/ }), -/***/ 96435: -/***/ ((module) => { +/***/ 72674: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(44151); +const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; +const fromBase64 = (input) => { + if ((input.length * 3) % 4 !== 0) { + throw new TypeError(`Incorrect padding on base64 string.`); + } + if (!BASE64_REGEX.exec(input)) { + throw new TypeError(`Invalid base64 string.`); + } + const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); +}; +exports.fromBase64 = fromBase64; + + +/***/ }), + +/***/ 68385: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(72674), module.exports); +__reExport(src_exports, __nccwpck_require__(14871), module.exports); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 14871: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(44151); +const util_utf8_1 = __nccwpck_require__(71577); +const toBase64 = (_input) => { + let input; + if (typeof _input === "string") { + input = (0, util_utf8_1.fromUtf8)(_input); + } + else { + input = _input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); + } + return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); +}; +exports.toBase64 = toBase64; + + +/***/ }), + +/***/ 13638: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -86038,44 +76795,31 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - fromHex: () => fromHex, - toHex: () => toHex + calculateBodyLength: () => calculateBodyLength }); module.exports = __toCommonJS(src_exports); -var SHORT_TO_HEX = {}; -var HEX_TO_SHORT = {}; -for (let i = 0; i < 256; i++) { - let encodedByte = i.toString(16).toLowerCase(); - if (encodedByte.length === 1) { - encodedByte = `0${encodedByte}`; - } - SHORT_TO_HEX[i] = encodedByte; - HEX_TO_SHORT[encodedByte] = i; -} -function fromHex(encoded) { - if (encoded.length % 2 !== 0) { - throw new Error("Hex encoded strings must have an even number length"); - } - const out = new Uint8Array(encoded.length / 2); - for (let i = 0; i < encoded.length; i += 2) { - const encodedByte = encoded.slice(i, i + 2).toLowerCase(); - if (encodedByte in HEX_TO_SHORT) { - out[i / 2] = HEX_TO_SHORT[encodedByte]; - } else { - throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); - } + +// src/calculateBodyLength.ts +var import_fs = __nccwpck_require__(79896); +var calculateBodyLength = /* @__PURE__ */ __name((body) => { + if (!body) { + return 0; } - return out; -} -__name(fromHex, "fromHex"); -function toHex(bytes) { - let out = ""; - for (let i = 0; i < bytes.byteLength; i++) { - out += SHORT_TO_HEX[bytes[i]]; + if (typeof body === "string") { + return Buffer.byteLength(body); + } else if (typeof body.byteLength === "number") { + return body.byteLength; + } else if (typeof body.size === "number") { + return body.size; + } else if (typeof body.start === "number" && typeof body.end === "number") { + return body.end + 1 - body.start; + } else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { + return (0, import_fs.lstatSync)(body.path).size; + } else if (typeof body.fd === "number") { + return (0, import_fs.fstatSync)(body.fd).size; } - return out; -} -__name(toHex, "toHex"); + throw new Error(`Body Length computation failed for ${body}`); +}, "calculateBodyLength"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -86084,7 +76828,7 @@ __name(toHex, "toHex"); /***/ }), -/***/ 15518: +/***/ 44151: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var __defProp = Object.defineProperty; @@ -86109,608 +76853,806 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, - ConfiguredRetryStrategy: () => ConfiguredRetryStrategy, - DEFAULT_MAX_ATTEMPTS: () => DEFAULT_MAX_ATTEMPTS, - DEFAULT_RETRY_DELAY_BASE: () => DEFAULT_RETRY_DELAY_BASE, - DEFAULT_RETRY_MODE: () => DEFAULT_RETRY_MODE, - DefaultRateLimiter: () => DefaultRateLimiter, - INITIAL_RETRY_TOKENS: () => INITIAL_RETRY_TOKENS, - INVOCATION_ID_HEADER: () => INVOCATION_ID_HEADER, - MAXIMUM_RETRY_DELAY: () => MAXIMUM_RETRY_DELAY, - NO_RETRY_INCREMENT: () => NO_RETRY_INCREMENT, - REQUEST_HEADER: () => REQUEST_HEADER, - RETRY_COST: () => RETRY_COST, - RETRY_MODES: () => RETRY_MODES, - StandardRetryStrategy: () => StandardRetryStrategy, - THROTTLING_RETRY_DELAY_BASE: () => THROTTLING_RETRY_DELAY_BASE, - TIMEOUT_RETRY_COST: () => TIMEOUT_RETRY_COST + fromArrayBuffer: () => fromArrayBuffer, + fromString: () => fromString }); module.exports = __toCommonJS(src_exports); +var import_is_array_buffer = __nccwpck_require__(86130); +var import_buffer = __nccwpck_require__(20181); +var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { + if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); + } + return import_buffer.Buffer.from(input, offset, length); +}, "fromArrayBuffer"); +var fromString = /* @__PURE__ */ __name((input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + } + return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); +}, "fromString"); +// Annotate the CommonJS export names for ESM import in node: -// src/config.ts -var RETRY_MODES = /* @__PURE__ */ ((RETRY_MODES2) => { - RETRY_MODES2["STANDARD"] = "standard"; - RETRY_MODES2["ADAPTIVE"] = "adaptive"; - return RETRY_MODES2; -})(RETRY_MODES || {}); -var DEFAULT_MAX_ATTEMPTS = 3; -var DEFAULT_RETRY_MODE = "standard" /* STANDARD */; +0 && (0); -// src/DefaultRateLimiter.ts -var import_service_error_classification = __nccwpck_require__(42058); -var DefaultRateLimiter = class _DefaultRateLimiter { - constructor(options) { - // Pre-set state variables - this.currentCapacity = 0; - this.enabled = false; - this.lastMaxRate = 0; - this.measuredTxRate = 0; - this.requestCount = 0; - this.lastTimestamp = 0; - this.timeWindow = 0; - this.beta = options?.beta ?? 0.7; - this.minCapacity = options?.minCapacity ?? 1; - this.minFillRate = options?.minFillRate ?? 0.5; - this.scaleConstant = options?.scaleConstant ?? 0.4; - this.smooth = options?.smooth ?? 0.8; - const currentTimeInSeconds = this.getCurrentTimeInSeconds(); - this.lastThrottleTime = currentTimeInSeconds; - this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); - this.fillRate = this.minFillRate; - this.maxCapacity = this.minCapacity; - } - static { - __name(this, "DefaultRateLimiter"); + + +/***/ }), + +/***/ 56716: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - static { - /** - * Only used in testing. - */ - this.setTimeoutFn = setTimeout; + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + SelectorType: () => SelectorType, + booleanSelector: () => booleanSelector, + numberSelector: () => numberSelector +}); +module.exports = __toCommonJS(src_exports); + +// src/booleanSelector.ts +var booleanSelector = /* @__PURE__ */ __name((obj, key, type) => { + if (!(key in obj)) + return void 0; + if (obj[key] === "true") + return true; + if (obj[key] === "false") + return false; + throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); +}, "booleanSelector"); + +// src/numberSelector.ts +var numberSelector = /* @__PURE__ */ __name((obj, key, type) => { + if (!(key in obj)) + return void 0; + const numberValue = parseInt(obj[key], 10); + if (Number.isNaN(numberValue)) { + throw new TypeError(`Cannot load ${type} '${key}'. Expected number, got '${obj[key]}'.`); } - getCurrentTimeInSeconds() { - return Date.now() / 1e3; + return numberValue; +}, "numberSelector"); + +// src/types.ts +var SelectorType = /* @__PURE__ */ ((SelectorType2) => { + SelectorType2["ENV"] = "env"; + SelectorType2["CONFIG"] = "shared config entry"; + return SelectorType2; +})(SelectorType || {}); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 15435: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __create = Object.create; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - async getSendToken() { - return this.acquireTokenBucket(1); + return to; +}; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + resolveDefaultsModeConfig: () => resolveDefaultsModeConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/resolveDefaultsModeConfig.ts +var import_config_resolver = __nccwpck_require__(39316); +var import_node_config_provider = __nccwpck_require__(78257); +var import_property_provider = __nccwpck_require__(94377); + +// src/constants.ts +var AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; +var AWS_REGION_ENV = "AWS_REGION"; +var AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; +var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +var DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; +var IMDS_REGION_PATH = "/latest/meta-data/placement/region"; + +// src/defaultsModeConfig.ts +var AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; +var AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; +var NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + return env[AWS_DEFAULTS_MODE_ENV]; + }, + configFileSelector: (profile) => { + return profile[AWS_DEFAULTS_MODE_CONFIG]; + }, + default: "legacy" +}; + +// src/resolveDefaultsModeConfig.ts +var resolveDefaultsModeConfig = /* @__PURE__ */ __name(({ + region = (0, import_node_config_provider.loadConfig)(import_config_resolver.NODE_REGION_CONFIG_OPTIONS), + defaultsMode = (0, import_node_config_provider.loadConfig)(NODE_DEFAULTS_MODE_CONFIG_OPTIONS) +} = {}) => (0, import_property_provider.memoize)(async () => { + const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; + switch (mode?.toLowerCase()) { + case "auto": + return resolveNodeDefaultsModeAuto(region); + case "in-region": + case "cross-region": + case "mobile": + case "standard": + case "legacy": + return Promise.resolve(mode?.toLocaleLowerCase()); + case void 0: + return Promise.resolve("legacy"); + default: + throw new Error( + `Invalid parameter for "defaultsMode", expect ${DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}` + ); } - async acquireTokenBucket(amount) { - if (!this.enabled) { - return; +}), "resolveDefaultsModeConfig"); +var resolveNodeDefaultsModeAuto = /* @__PURE__ */ __name(async (clientRegion) => { + if (clientRegion) { + const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; + const inferredRegion = await inferPhysicalRegion(); + if (!inferredRegion) { + return "standard"; } - this.refillTokenBucket(); - if (amount > this.currentCapacity) { - const delay = (amount - this.currentCapacity) / this.fillRate * 1e3; - await new Promise((resolve) => _DefaultRateLimiter.setTimeoutFn(resolve, delay)); + if (resolvedRegion === inferredRegion) { + return "in-region"; + } else { + return "cross-region"; } - this.currentCapacity = this.currentCapacity - amount; } - refillTokenBucket() { - const timestamp = this.getCurrentTimeInSeconds(); - if (!this.lastTimestamp) { - this.lastTimestamp = timestamp; - return; - } - const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; - this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); - this.lastTimestamp = timestamp; + return "standard"; +}, "resolveNodeDefaultsModeAuto"); +var inferPhysicalRegion = /* @__PURE__ */ __name(async () => { + if (process.env[AWS_EXECUTION_ENV] && (process.env[AWS_REGION_ENV] || process.env[AWS_DEFAULT_REGION_ENV])) { + return process.env[AWS_REGION_ENV] ?? process.env[AWS_DEFAULT_REGION_ENV]; } - updateClientSendingRate(response) { - let calculatedRate; - this.updateMeasuredRate(); - if ((0, import_service_error_classification.isThrottlingError)(response)) { - const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); - this.lastMaxRate = rateToUse; - this.calculateTimeWindow(); - this.lastThrottleTime = this.getCurrentTimeInSeconds(); - calculatedRate = this.cubicThrottle(rateToUse); - this.enableTokenBucket(); - } else { - this.calculateTimeWindow(); - calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); + if (!process.env[ENV_IMDS_DISABLED]) { + try { + const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(40566))); + const endpoint = await getInstanceMetadataEndpoint(); + return (await httpRequest({ ...endpoint, path: IMDS_REGION_PATH })).toString(); + } catch (e) { } - const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); - this.updateTokenBucketRate(newRate); } - calculateTimeWindow() { - this.timeWindow = this.getPrecise(Math.pow(this.lastMaxRate * (1 - this.beta) / this.scaleConstant, 1 / 3)); +}, "inferPhysicalRegion"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 78257: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - cubicThrottle(rateToUse) { - return this.getPrecise(rateToUse * this.beta); + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + loadConfig: () => loadConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/configLoader.ts + + +// src/fromEnv.ts +var import_property_provider = __nccwpck_require__(94377); + +// src/getSelectorName.ts +function getSelectorName(functionString) { + try { + const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); + constants.delete("CONFIG"); + constants.delete("CONFIG_PREFIX_SEPARATOR"); + constants.delete("ENV"); + return [...constants].join(", "); + } catch (e) { + return functionString; } - cubicSuccess(timestamp) { - return this.getPrecise( - this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate +} +__name(getSelectorName, "getSelectorName"); + +// src/fromEnv.ts +var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { + try { + const config = envVarSelector(process.env, options); + if (config === void 0) { + throw new Error(); + } + return config; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, + { logger: options?.logger } ); } - enableTokenBucket() { - this.enabled = true; - } - updateTokenBucketRate(newRate) { - this.refillTokenBucket(); - this.fillRate = Math.max(newRate, this.minFillRate); - this.maxCapacity = Math.max(newRate, this.minCapacity); - this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); - } - updateMeasuredRate() { - const t = this.getCurrentTimeInSeconds(); - const timeBucket = Math.floor(t * 2) / 2; - this.requestCount++; - if (timeBucket > this.lastTxRateBucket) { - const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); - this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); - this.requestCount = 0; - this.lastTxRateBucket = timeBucket; +}, "fromEnv"); + +// src/fromSharedConfigFiles.ts + +var import_shared_ini_file_loader = __nccwpck_require__(59645); +var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, import_shared_ini_file_loader.getProfileName)(init); + const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; + try { + const cfgFile = preferredFile === "config" ? configFile : credentialsFile; + const configValue = configSelector(mergedProfile, cfgFile); + if (configValue === void 0) { + throw new Error(); } + return configValue; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, + { logger: init.logger } + ); } - getPrecise(num) { - return parseFloat(num.toFixed(8)); - } -}; +}, "fromSharedConfigFiles"); -// src/constants.ts -var DEFAULT_RETRY_DELAY_BASE = 100; -var MAXIMUM_RETRY_DELAY = 20 * 1e3; -var THROTTLING_RETRY_DELAY_BASE = 500; -var INITIAL_RETRY_TOKENS = 500; -var RETRY_COST = 5; -var TIMEOUT_RETRY_COST = 10; -var NO_RETRY_INCREMENT = 1; -var INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; -var REQUEST_HEADER = "amz-sdk-request"; +// src/fromStatic.ts -// src/defaultRetryBackoffStrategy.ts -var getDefaultRetryBackoffStrategy = /* @__PURE__ */ __name(() => { - let delayBase = DEFAULT_RETRY_DELAY_BASE; - const computeNextBackoffDelay = /* @__PURE__ */ __name((attempts) => { - return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); - }, "computeNextBackoffDelay"); - const setDelayBase = /* @__PURE__ */ __name((delay) => { - delayBase = delay; - }, "setDelayBase"); - return { - computeNextBackoffDelay, - setDelayBase - }; -}, "getDefaultRetryBackoffStrategy"); +var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); +var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); -// src/defaultRetryToken.ts -var createDefaultRetryToken = /* @__PURE__ */ __name(({ - retryDelay, - retryCount, - retryCost -}) => { - const getRetryCount = /* @__PURE__ */ __name(() => retryCount, "getRetryCount"); - const getRetryDelay = /* @__PURE__ */ __name(() => Math.min(MAXIMUM_RETRY_DELAY, retryDelay), "getRetryDelay"); - const getRetryCost = /* @__PURE__ */ __name(() => retryCost, "getRetryCost"); - return { - getRetryCount, - getRetryDelay, - getRetryCost - }; -}, "createDefaultRetryToken"); +// src/configLoader.ts +var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { + const { signingName, logger } = configuration; + const envOptions = { signingName, logger }; + return (0, import_property_provider.memoize)( + (0, import_property_provider.chain)( + fromEnv(environmentVariableSelector, envOptions), + fromSharedConfigFiles(configFileSelector, configuration), + fromStatic(defaultValue) + ) + ); +}, "loadConfig"); +// Annotate the CommonJS export names for ESM import in node: -// src/StandardRetryStrategy.ts -var StandardRetryStrategy = class { - constructor(maxAttempts) { - this.maxAttempts = maxAttempts; - this.mode = "standard" /* STANDARD */; - this.capacity = INITIAL_RETRY_TOKENS; - this.retryBackoffStrategy = getDefaultRetryBackoffStrategy(); - this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; - } - static { - __name(this, "StandardRetryStrategy"); - } - // eslint-disable-next-line @typescript-eslint/no-unused-vars - async acquireInitialRetryToken(retryTokenScope) { - return createDefaultRetryToken({ - retryDelay: DEFAULT_RETRY_DELAY_BASE, - retryCount: 0 - }); +0 && (0); + + + +/***/ }), + +/***/ 94377: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } - async refreshRetryTokenForRetry(token, errorInfo) { - const maxAttempts = await this.getMaxAttempts(); - if (this.shouldRetry(token, errorInfo, maxAttempts)) { - const errorType = errorInfo.errorType; - this.retryBackoffStrategy.setDelayBase( - errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE - ); - const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); - const retryDelay = errorInfo.retryAfterHint ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) : delayFromErrorType; - const capacityCost = this.getCapacityCost(errorType); - this.capacity -= capacityCost; - return createDefaultRetryToken({ - retryDelay, - retryCount: token.getRetryCount() + 1, - retryCost: capacityCost - }); + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + CredentialsProviderError: () => CredentialsProviderError, + ProviderError: () => ProviderError, + TokenProviderError: () => TokenProviderError, + chain: () => chain, + fromStatic: () => fromStatic, + memoize: () => memoize +}); +module.exports = __toCommonJS(src_exports); + +// src/ProviderError.ts +var ProviderError = class _ProviderError extends Error { + constructor(message, options = true) { + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = void 0; + tryNextLink = options; + } else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; } - throw new Error("No retry token available"); + super(message); + this.name = "ProviderError"; + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, _ProviderError.prototype); + logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); } - recordSuccess(token) { - this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); + static { + __name(this, "ProviderError"); } /** - * @returns the current available retry capacity. - * - * This number decreases when retries are executed and refills when requests or retries succeed. + * @deprecated use new operator. */ - getCapacity() { - return this.capacity; - } - async getMaxAttempts() { - try { - return await this.maxAttemptsProvider(); - } catch (error) { - console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); - return DEFAULT_MAX_ATTEMPTS; - } - } - shouldRetry(tokenToRenew, errorInfo, maxAttempts) { - const attempts = tokenToRenew.getRetryCount() + 1; - return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType); - } - getCapacityCost(errorType) { - return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; - } - isRetryableError(errorType) { - return errorType === "THROTTLING" || errorType === "TRANSIENT"; + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); } }; -// src/AdaptiveRetryStrategy.ts -var AdaptiveRetryStrategy = class { - constructor(maxAttemptsProvider, options) { - this.maxAttemptsProvider = maxAttemptsProvider; - this.mode = "adaptive" /* ADAPTIVE */; - const { rateLimiter } = options ?? {}; - this.rateLimiter = rateLimiter ?? new DefaultRateLimiter(); - this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider); +// src/CredentialsProviderError.ts +var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, _CredentialsProviderError.prototype); } static { - __name(this, "AdaptiveRetryStrategy"); - } - async acquireInitialRetryToken(retryTokenScope) { - await this.rateLimiter.getSendToken(); - return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); - } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - this.rateLimiter.updateClientSendingRate(errorInfo); - return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - } - recordSuccess(token) { - this.rateLimiter.updateClientSendingRate({}); - this.standardRetryStrategy.recordSuccess(token); + __name(this, "CredentialsProviderError"); } }; -// src/ConfiguredRetryStrategy.ts -var ConfiguredRetryStrategy = class extends StandardRetryStrategy { - static { - __name(this, "ConfiguredRetryStrategy"); - } +// src/TokenProviderError.ts +var TokenProviderError = class _TokenProviderError extends ProviderError { /** - * @param maxAttempts - the maximum number of retry attempts allowed. - * e.g., if set to 3, then 4 total requests are possible. - * @param computeNextBackoffDelay - a millisecond delay for each retry or a function that takes the retry attempt - * and returns the delay. - * - * @example exponential backoff. - * ```js - * new Client({ - * retryStrategy: new ConfiguredRetryStrategy(3, (attempt) => attempt ** 2) - * }); - * ``` - * @example constant delay. - * ```js - * new Client({ - * retryStrategy: new ConfiguredRetryStrategy(3, 2000) - * }); - * ``` + * @override */ - constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { - super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); - if (typeof computeNextBackoffDelay === "number") { - this.computeNextBackoffDelay = () => computeNextBackoffDelay; - } else { - this.computeNextBackoffDelay = computeNextBackoffDelay; - } + constructor(message, options = true) { + super(message, options); + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, _TokenProviderError.prototype); } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); - return token; + static { + __name(this, "TokenProviderError"); } }; -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 87753: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ChecksumStream = void 0; -const ReadableStreamRef = typeof ReadableStream === "function" ? ReadableStream : function () { }; -class ChecksumStream extends ReadableStreamRef { -} -exports.ChecksumStream = ChecksumStream; - -/***/ }), - -/***/ 71775: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/chain.ts +var chain = /* @__PURE__ */ __name((...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } catch (err) { + lastProviderError = err; + if (err?.tryNextLink) { + continue; + } + throw err; + } + } + throw lastProviderError; +}, "chain"); -"use strict"; +// src/fromStatic.ts +var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ChecksumStream = void 0; -const util_base64_1 = __nccwpck_require__(68385); -const stream_1 = __nccwpck_require__(2203); -class ChecksumStream extends stream_1.Duplex { - constructor({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder, }) { - var _a, _b; - super(); - if (typeof source.pipe === "function") { - this.source = source; - } - else { - throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); - } - this.base64Encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; - this.expectedChecksum = expectedChecksum; - this.checksum = checksum; - this.checksumSourceLocation = checksumSourceLocation; - this.source.pipe(this); +// src/memoize.ts +var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async () => { + if (!pending) { + pending = provider(); } - _read(size) { } - _write(chunk, encoding, callback) { - try { - this.checksum.update(chunk); - this.push(chunk); - } - catch (e) { - return callback(e); - } - return callback(); + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; } - async _final(callback) { - try { - const digest = await this.checksum.digest(); - const received = this.base64Encoder(digest); - if (this.expectedChecksum !== received) { - return callback(new Error(`Checksum mismatch: expected "${this.expectedChecksum}" but received "${received}"` + - ` in response header "${this.checksumSourceLocation}".`)); - } - } - catch (e) { - return callback(e); - } - this.push(null); - return callback(); + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); } -} -exports.ChecksumStream = ChecksumStream; + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; +}, "memoize"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + /***/ }), -/***/ 94129: +/***/ 45819: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createChecksumStream = void 0; -const util_base64_1 = __nccwpck_require__(68385); -const stream_type_check_1 = __nccwpck_require__(4414); -const ChecksumStream_browser_1 = __nccwpck_require__(87753); -const createChecksumStream = ({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder, }) => { - var _a, _b; - if (!(0, stream_type_check_1.isReadableStream)(source)) { - throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); - } - const encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; - if (typeof TransformStream !== "function") { - throw new Error("@smithy/util-stream: unable to instantiate ChecksumStream because API unavailable: ReadableStream/TransformStream."); +exports.getHomeDir = void 0; +const os_1 = __nccwpck_require__(70857); +const path_1 = __nccwpck_require__(16928); +const homeDirCache = {}; +const getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; } - const transform = new TransformStream({ - start() { }, - async transform(chunk, controller) { - checksum.update(chunk); - controller.enqueue(chunk); - }, - async flush(controller) { - const digest = await checksum.digest(); - const received = encoder(digest); - if (expectedChecksum !== received) { - const error = new Error(`Checksum mismatch: expected "${expectedChecksum}" but received "${received}"` + - ` in response header "${checksumSourceLocation}".`); - controller.error(error); - } - else { - controller.terminate(); - } - }, - }); - source.pipeThrough(transform); - const readable = transform.readable; - Object.setPrototypeOf(readable, ChecksumStream_browser_1.ChecksumStream.prototype); - return readable; + return "DEFAULT"; +}; +const getHomeDir = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; }; -exports.createChecksumStream = createChecksumStream; +exports.getHomeDir = getHomeDir; /***/ }), -/***/ 5639: +/***/ 2824: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createChecksumStream = void 0; -const stream_type_check_1 = __nccwpck_require__(4414); -const ChecksumStream_1 = __nccwpck_require__(71775); -const createChecksumStream_browser_1 = __nccwpck_require__(94129); -function createChecksumStream(init) { - if (typeof ReadableStream === "function" && (0, stream_type_check_1.isReadableStream)(init.source)) { - return (0, createChecksumStream_browser_1.createChecksumStream)(init); - } - return new ChecksumStream_1.ChecksumStream(init); -} -exports.createChecksumStream = createChecksumStream; +exports.getSSOTokenFilepath = void 0; +const crypto_1 = __nccwpck_require__(76982); +const path_1 = __nccwpck_require__(16928); +const getHomeDir_1 = __nccwpck_require__(45819); +const getSSOTokenFilepath = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); +}; +exports.getSSOTokenFilepath = getSSOTokenFilepath; /***/ }), -/***/ 6522: +/***/ 60127: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getAwsChunkedEncodingStream = void 0; -const stream_1 = __nccwpck_require__(2203); -const getAwsChunkedEncodingStream = (readableStream, options) => { - const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; - const checksumRequired = base64Encoder !== undefined && - checksumAlgorithmFn !== undefined && - checksumLocationName !== undefined && - streamHasher !== undefined; - const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : undefined; - const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { } }); - readableStream.on("data", (data) => { - const length = bodyLengthChecker(data) || 0; - awsChunkedEncodingStream.push(`${length.toString(16)}\r\n`); - awsChunkedEncodingStream.push(data); - awsChunkedEncodingStream.push("\r\n"); - }); - readableStream.on("end", async () => { - awsChunkedEncodingStream.push(`0\r\n`); - if (checksumRequired) { - const checksum = base64Encoder(await digest); - awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r\n`); - awsChunkedEncodingStream.push(`\r\n`); - } - awsChunkedEncodingStream.push(null); - }); - return awsChunkedEncodingStream; +exports.getSSOTokenFromFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const getSSOTokenFilepath_1 = __nccwpck_require__(2824); +const { readFile } = fs_1.promises; +const getSSOTokenFromFile = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); }; -exports.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream; +exports.getSSOTokenFromFile = getSSOTokenFromFile; /***/ }), -/***/ 80066: -/***/ ((__unused_webpack_module, exports) => { +/***/ 59645: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -"use strict"; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.headStream = void 0; -async function headStream(stream, bytes) { - var _a; - let byteLengthCounter = 0; - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - byteLengthCounter += (_a = value === null || value === void 0 ? void 0 : value.byteLength) !== null && _a !== void 0 ? _a : 0; +// src/index.ts +var src_exports = {}; +__export(src_exports, { + CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, + DEFAULT_PROFILE: () => DEFAULT_PROFILE, + ENV_PROFILE: () => ENV_PROFILE, + getProfileName: () => getProfileName, + loadSharedConfigFiles: () => loadSharedConfigFiles, + loadSsoSessionData: () => loadSsoSessionData, + parseKnownFiles: () => parseKnownFiles +}); +module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(45819), module.exports); + +// src/getProfileName.ts +var ENV_PROFILE = "AWS_PROFILE"; +var DEFAULT_PROFILE = "default"; +var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); + +// src/index.ts +__reExport(src_exports, __nccwpck_require__(2824), module.exports); +__reExport(src_exports, __nccwpck_require__(60127), module.exports); + +// src/loadSharedConfigFiles.ts + + +// src/getConfigData.ts +var import_types = __nccwpck_require__(79969); +var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { + return false; + } + return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); +}).reduce( + (acc, [key, value]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + acc[updatedKey] = value; + return acc; + }, + { + // Populate default profile, if present. + ...data.default && { default: data.default } + } +), "getConfigData"); + +// src/getConfigFilepath.ts +var import_path = __nccwpck_require__(16928); +var import_getHomeDir = __nccwpck_require__(45819); +var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); + +// src/getCredentialsFilepath.ts + +var import_getHomeDir2 = __nccwpck_require__(45819); +var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); + +// src/loadSharedConfigFiles.ts +var import_getHomeDir3 = __nccwpck_require__(45819); + +// src/parseIni.ts + +var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; +var profileNameBlockList = ["__proto__", "profile __proto__"]; +var parseIni = /* @__PURE__ */ __name((iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = void 0; + currentSubSection = void 0; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(import_types.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); } - if (byteLengthCounter >= bytes) { - break; + } else { + currentSection = sectionName; + } + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } + } else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim() + ]; + if (value === "") { + currentSubSection = name; + } else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = void 0; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; } - isDone = done; + } } - reader.releaseLock(); - const collected = new Uint8Array(Math.min(bytes, byteLengthCounter)); - let offset = 0; - for (const chunk of chunks) { - if (chunk.byteLength > collected.byteLength - offset) { - collected.set(chunk.subarray(0, collected.byteLength - offset), offset); - break; - } - else { - collected.set(chunk, offset); - } - offset += chunk.length; + } + return map; +}, "parseIni"); + +// src/loadSharedConfigFiles.ts +var import_slurpFile = __nccwpck_require__(45103); +var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var CONFIG_PREFIX_SEPARATOR = "."; +var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const homeDir = (0, import_getHomeDir3.getHomeDir)(); + const relativeHomeDirPrefix = "~/"; + let resolvedFilepath = filepath; + if (filepath.startsWith(relativeHomeDirPrefix)) { + resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); + } + let resolvedConfigFilepath = configFilepath; + if (configFilepath.startsWith(relativeHomeDirPrefix)) { + resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); + } + const parsedFiles = await Promise.all([ + (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).then(getConfigData).catch(swallowError), + (0, import_slurpFile.slurpFile)(resolvedFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).catch(swallowError) + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1] + }; +}, "loadSharedConfigFiles"); + +// src/getSsoSessionData.ts + +var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); + +// src/loadSsoSessionData.ts +var import_slurpFile2 = __nccwpck_require__(45103); +var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); + +// src/mergeConfigFiles.ts +var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== void 0) { + Object.assign(merged[key], values); + } else { + merged[key] = values; + } } - return collected; -} -exports.headStream = headStream; + } + return merged; +}, "mergeConfigFiles"); + +// src/parseKnownFiles.ts +var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); +}, "parseKnownFiles"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + /***/ }), -/***/ 88412: +/***/ 45103: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.headStream = void 0; -const stream_1 = __nccwpck_require__(2203); -const headStream_browser_1 = __nccwpck_require__(80066); -const stream_type_check_1 = __nccwpck_require__(4414); -const headStream = (stream, bytes) => { - if ((0, stream_type_check_1.isReadableStream)(stream)) { - return (0, headStream_browser_1.headStream)(stream, bytes); +exports.slurpFile = void 0; +const fs_1 = __nccwpck_require__(79896); +const { readFile } = fs_1.promises; +const filePromisesHash = {}; +const slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); } - return new Promise((resolve, reject) => { - const collector = new Collector(); - collector.limit = bytes; - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function () { - const bytes = new Uint8Array(Buffer.concat(this.buffers)); - resolve(bytes); - }); - }); + return filePromisesHash[path]; }; -exports.headStream = headStream; -class Collector extends stream_1.Writable { - constructor() { - super(...arguments); - this.buffers = []; - this.limit = Infinity; - this.bytesBuffered = 0; - } - _write(chunk, encoding, callback) { - var _a; - this.buffers.push(chunk); - this.bytesBuffered += (_a = chunk.byteLength) !== null && _a !== void 0 ? _a : 0; - if (this.bytesBuffered >= this.limit) { - const excess = this.bytesBuffered - this.limit; - const tailBuffer = this.buffers[this.buffers.length - 1]; - this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess); - this.emit("finish"); - } - callback(); - } -} +exports.slurpFile = slurpFile; /***/ }), -/***/ 4252: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 79969: +/***/ ((module) => { var __defProp = Object.defineProperty; var __getOwnPropDesc = Object.getOwnPropertyDescriptor; @@ -86729,290 +77671,671 @@ var __copyProps = (to, from, except, desc) => { } return to; }; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); // src/index.ts var src_exports = {}; __export(src_exports, { - Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter + AlgorithmId: () => AlgorithmId, + EndpointURLScheme: () => EndpointURLScheme, + FieldPosition: () => FieldPosition, + HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, + HttpAuthLocation: () => HttpAuthLocation, + IniSectionType: () => IniSectionType, + RequestHandlerProtocol: () => RequestHandlerProtocol, + SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig }); module.exports = __toCommonJS(src_exports); -// src/blob/transforms.ts -var import_util_base64 = __nccwpck_require__(68385); -var import_util_utf8 = __nccwpck_require__(71577); -function transformToString(payload, encoding = "utf-8") { - if (encoding === "base64") { - return (0, import_util_base64.toBase64)(payload); +// src/auth/auth.ts +var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { + HttpAuthLocation2["HEADER"] = "header"; + HttpAuthLocation2["QUERY"] = "query"; + return HttpAuthLocation2; +})(HttpAuthLocation || {}); + +// src/auth/HttpApiKeyAuth.ts +var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { + HttpApiKeyAuthLocation2["HEADER"] = "header"; + HttpApiKeyAuthLocation2["QUERY"] = "query"; + return HttpApiKeyAuthLocation2; +})(HttpApiKeyAuthLocation || {}); + +// src/endpoint.ts +var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { + EndpointURLScheme2["HTTP"] = "http"; + EndpointURLScheme2["HTTPS"] = "https"; + return EndpointURLScheme2; +})(EndpointURLScheme || {}); + +// src/extensions/checksum.ts +var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { + AlgorithmId2["MD5"] = "md5"; + AlgorithmId2["CRC32"] = "crc32"; + AlgorithmId2["CRC32C"] = "crc32c"; + AlgorithmId2["SHA1"] = "sha1"; + AlgorithmId2["SHA256"] = "sha256"; + return AlgorithmId2; +})(AlgorithmId || {}); +var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== void 0) { + checksumAlgorithms.push({ + algorithmId: () => "sha256" /* SHA256 */, + checksumConstructor: () => runtimeConfig.sha256 + }); } - return (0, import_util_utf8.toUtf8)(payload); -} -__name(transformToString, "transformToString"); -function transformFromString(str, encoding) { - if (encoding === "base64") { - return Uint8ArrayBlobAdapter.mutate((0, import_util_base64.fromBase64)(str)); + if (runtimeConfig.md5 != void 0) { + checksumAlgorithms.push({ + algorithmId: () => "md5" /* MD5 */, + checksumConstructor: () => runtimeConfig.md5 + }); } - return Uint8ArrayBlobAdapter.mutate((0, import_util_utf8.fromUtf8)(str)); -} -__name(transformFromString, "transformFromString"); + return { + addChecksumAlgorithm(algo) { + checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return checksumAlgorithms; + } + }; +}, "getChecksumConfiguration"); +var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}, "resolveChecksumRuntimeConfig"); + +// src/extensions/defaultClientConfiguration.ts +var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return getChecksumConfiguration(runtimeConfig); +}, "getDefaultClientConfiguration"); +var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return resolveChecksumRuntimeConfig(config); +}, "resolveDefaultRuntimeConfig"); + +// src/http.ts +var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { + FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; + FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; + return FieldPosition2; +})(FieldPosition || {}); + +// src/middleware.ts +var SMITHY_CONTEXT_KEY = "__smithy_context"; + +// src/profile.ts +var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; +})(IniSectionType || {}); + +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 79674: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + EndpointCache: () => EndpointCache, + EndpointError: () => EndpointError, + customEndpointFunctions: () => customEndpointFunctions, + isIpAddress: () => isIpAddress, + isValidHostLabel: () => isValidHostLabel, + resolveEndpoint: () => resolveEndpoint +}); +module.exports = __toCommonJS(src_exports); -// src/blob/Uint8ArrayBlobAdapter.ts -var _Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter extends Uint8Array { +// src/cache/EndpointCache.ts +var EndpointCache = class { /** - * @param source - such as a string or Stream. - * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. + * @param [size] - desired average maximum capacity. A buffer of 10 additional keys will be allowed + * before keys are dropped. + * @param [params] - list of params to consider as part of the cache key. + * + * If the params list is not populated, no caching will happen. + * This may be out of order depending on how the object is created and arrives to this class. */ - static fromString(source, encoding = "utf-8") { - switch (typeof source) { - case "string": - return transformFromString(source, encoding); - default: - throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); + constructor({ size, params }) { + this.data = /* @__PURE__ */ new Map(); + this.parameters = []; + this.capacity = size ?? 50; + if (params) { + this.parameters = params; } } + static { + __name(this, "EndpointCache"); + } /** - * @param source - Uint8Array to be mutated. - * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. + * @param endpointParams - query for endpoint. + * @param resolver - provider of the value if not present. + * @returns endpoint corresponding to the query. */ - static mutate(source) { - Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter.prototype); - return source; + get(endpointParams, resolver) { + const key = this.hash(endpointParams); + if (key === false) { + return resolver(); + } + if (!this.data.has(key)) { + if (this.data.size > this.capacity + 10) { + const keys = this.data.keys(); + let i = 0; + while (true) { + const { value, done } = keys.next(); + this.data.delete(value); + if (done || ++i > 10) { + break; + } + } + } + this.data.set(key, resolver()); + } + return this.data.get(key); + } + size() { + return this.data.size; } /** - * @param encoding - default 'utf-8'. - * @returns the blob as string. + * @returns cache key or false if not cachable. */ - transformToString(encoding = "utf-8") { - return transformToString(this, encoding); + hash(endpointParams) { + let buffer = ""; + const { parameters } = this; + if (parameters.length === 0) { + return false; + } + for (const param of parameters) { + const val = String(endpointParams[param] ?? ""); + if (val.includes("|;")) { + return false; + } + buffer += val + "|;"; + } + return buffer; } }; -__name(_Uint8ArrayBlobAdapter, "Uint8ArrayBlobAdapter"); -var Uint8ArrayBlobAdapter = _Uint8ArrayBlobAdapter; -// src/index.ts -__reExport(src_exports, __nccwpck_require__(6522), module.exports); -__reExport(src_exports, __nccwpck_require__(77201), module.exports); -__reExport(src_exports, __nccwpck_require__(82108), module.exports); -__reExport(src_exports, __nccwpck_require__(88412), module.exports); -__reExport(src_exports, __nccwpck_require__(4414), module.exports); -__reExport(src_exports, __nccwpck_require__(5639), module.exports); -__reExport(src_exports, __nccwpck_require__(71775), module.exports); -// Annotate the CommonJS export names for ESM import in node: +// src/lib/isIpAddress.ts +var IP_V4_REGEX = new RegExp( + `^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$` +); +var isIpAddress = /* @__PURE__ */ __name((value) => IP_V4_REGEX.test(value) || value.startsWith("[") && value.endsWith("]"), "isIpAddress"); -0 && (0); +// src/lib/isValidHostLabel.ts +var VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); +var isValidHostLabel = /* @__PURE__ */ __name((value, allowSubDomains = false) => { + if (!allowSubDomains) { + return VALID_HOST_LABEL_REGEX.test(value); + } + const labels = value.split("."); + for (const label of labels) { + if (!isValidHostLabel(label)) { + return false; + } + } + return true; +}, "isValidHostLabel"); +// src/utils/customEndpointFunctions.ts +var customEndpointFunctions = {}; +// src/debug/debugId.ts +var debugId = "endpoints"; -/***/ }), +// src/debug/toDebugString.ts +function toDebugString(input) { + if (typeof input !== "object" || input == null) { + return input; + } + if ("ref" in input) { + return `$${toDebugString(input.ref)}`; + } + if ("fn" in input) { + return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; + } + return JSON.stringify(input, null, 2); +} +__name(toDebugString, "toDebugString"); -/***/ 82207: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/types/EndpointError.ts +var EndpointError = class extends Error { + static { + __name(this, "EndpointError"); + } + constructor(message) { + super(message); + this.name = "EndpointError"; + } +}; -"use strict"; +// src/lib/booleanEquals.ts +var booleanEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "booleanEquals"); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.sdkStreamMixin = void 0; -const fetch_http_handler_1 = __nccwpck_require__(47809); -const util_base64_1 = __nccwpck_require__(68385); -const util_hex_encoding_1 = __nccwpck_require__(96435); -const util_utf8_1 = __nccwpck_require__(71577); -const stream_type_check_1 = __nccwpck_require__(4414); -const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; -const sdkStreamMixin = (stream) => { - var _a, _b; - if (!isBlobInstance(stream) && !(0, stream_type_check_1.isReadableStream)(stream)) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); +// src/lib/getAttrPathList.ts +var getAttrPathList = /* @__PURE__ */ __name((path) => { + const parts = path.split("."); + const pathList = []; + for (const part of parts) { + const squareBracketIndex = part.indexOf("["); + if (squareBracketIndex !== -1) { + if (part.indexOf("]") !== part.length - 1) { + throw new EndpointError(`Path: '${path}' does not end with ']'`); + } + const arrayIndex = part.slice(squareBracketIndex + 1, -1); + if (Number.isNaN(parseInt(arrayIndex))) { + throw new EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`); + } + if (squareBracketIndex !== 0) { + pathList.push(part.slice(0, squareBracketIndex)); + } + pathList.push(arrayIndex); + } else { + pathList.push(part); } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - return await (0, fetch_http_handler_1.streamCollector)(stream); - }; - const blobToWebStream = (blob) => { - if (typeof blob.stream !== "function") { - throw new Error("Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\n" + - "If you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body"); - } - return blob.stream(); - }; - return Object.assign(stream, { - transformToByteArray: transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === "base64") { - return (0, util_base64_1.toBase64)(buf); - } - else if (encoding === "hex") { - return (0, util_hex_encoding_1.toHex)(buf); - } - else if (encoding === undefined || encoding === "utf8" || encoding === "utf-8") { - return (0, util_utf8_1.toUtf8)(buf); - } - else if (typeof TextDecoder === "function") { - return new TextDecoder(encoding).decode(buf); - } - else { - throw new Error("TextDecoder is not available, please make sure polyfill is provided."); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - if (isBlobInstance(stream)) { - return blobToWebStream(stream); - } - else if ((0, stream_type_check_1.isReadableStream)(stream)) { - return stream; - } - else { - throw new Error(`Cannot transform payload to web stream, got ${stream}`); - } - }, - }); + } + return pathList; +}, "getAttrPathList"); + +// src/lib/getAttr.ts +var getAttr = /* @__PURE__ */ __name((value, path) => getAttrPathList(path).reduce((acc, index) => { + if (typeof acc !== "object") { + throw new EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); + } else if (Array.isArray(acc)) { + return acc[parseInt(index)]; + } + return acc[index]; +}, value), "getAttr"); + +// src/lib/isSet.ts +var isSet = /* @__PURE__ */ __name((value) => value != null, "isSet"); + +// src/lib/not.ts +var not = /* @__PURE__ */ __name((value) => !value, "not"); + +// src/lib/parseURL.ts +var import_types3 = __nccwpck_require__(55430); +var DEFAULT_PORTS = { + [import_types3.EndpointURLScheme.HTTP]: 80, + [import_types3.EndpointURLScheme.HTTPS]: 443 }; -exports.sdkStreamMixin = sdkStreamMixin; -const isBlobInstance = (stream) => typeof Blob === "function" && stream instanceof Blob; +var parseURL = /* @__PURE__ */ __name((value) => { + const whatwgURL = (() => { + try { + if (value instanceof URL) { + return value; + } + if (typeof value === "object" && "hostname" in value) { + const { hostname: hostname2, port, protocol: protocol2 = "", path = "", query = {} } = value; + const url = new URL(`${protocol2}//${hostname2}${port ? `:${port}` : ""}${path}`); + url.search = Object.entries(query).map(([k, v]) => `${k}=${v}`).join("&"); + return url; + } + return new URL(value); + } catch (error) { + return null; + } + })(); + if (!whatwgURL) { + console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); + return null; + } + const urlString = whatwgURL.href; + const { host, hostname, pathname, protocol, search } = whatwgURL; + if (search) { + return null; + } + const scheme = protocol.slice(0, -1); + if (!Object.values(import_types3.EndpointURLScheme).includes(scheme)) { + return null; + } + const isIp = isIpAddress(hostname); + const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`); + const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; + return { + scheme, + authority, + path: pathname, + normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, + isIp + }; +}, "parseURL"); +// src/lib/stringEquals.ts +var stringEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "stringEquals"); -/***/ }), +// src/lib/substring.ts +var substring = /* @__PURE__ */ __name((input, start, stop, reverse) => { + if (start >= stop || input.length < stop) { + return null; + } + if (!reverse) { + return input.substring(start, stop); + } + return input.substring(input.length - stop, input.length - start); +}, "substring"); -/***/ 77201: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/lib/uriEncode.ts +var uriEncode = /* @__PURE__ */ __name((value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`), "uriEncode"); -"use strict"; +// src/utils/endpointFunctions.ts +var endpointFunctions = { + booleanEquals, + getAttr, + isSet, + isValidHostLabel, + not, + parseURL, + stringEquals, + substring, + uriEncode +}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.sdkStreamMixin = void 0; -const node_http_handler_1 = __nccwpck_require__(61279); -const util_buffer_from_1 = __nccwpck_require__(44151); -const stream_1 = __nccwpck_require__(2203); -const sdk_stream_mixin_browser_1 = __nccwpck_require__(82207); -const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; -const sdkStreamMixin = (stream) => { - var _a, _b; - if (!(stream instanceof stream_1.Readable)) { - try { - return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); - } - catch (e) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); - } +// src/utils/evaluateTemplate.ts +var evaluateTemplate = /* @__PURE__ */ __name((template, options) => { + const evaluatedTemplateArr = []; + const templateContext = { + ...options.endpointParams, + ...options.referenceRecord + }; + let currentIndex = 0; + while (currentIndex < template.length) { + const openingBraceIndex = template.indexOf("{", currentIndex); + if (openingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(currentIndex)); + break; } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - return await (0, node_http_handler_1.streamCollector)(stream); - }; - return Object.assign(stream, { - transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === undefined || Buffer.isEncoding(encoding)) { - return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); - } - else { - const decoder = new TextDecoder(encoding); - return decoder.decode(buf); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - if (stream.readableFlowing !== null) { - throw new Error("The stream has been consumed by other callbacks."); - } - if (typeof stream_1.Readable.toWeb !== "function") { - throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available."); - } - transformed = true; - return stream_1.Readable.toWeb(stream); - }, - }); -}; -exports.sdkStreamMixin = sdkStreamMixin; + evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex)); + const closingBraceIndex = template.indexOf("}", openingBraceIndex); + if (closingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(openingBraceIndex)); + break; + } + if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") { + evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex)); + currentIndex = closingBraceIndex + 2; + } + const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex); + if (parameterName.includes("#")) { + const [refName, attrName] = parameterName.split("#"); + evaluatedTemplateArr.push(getAttr(templateContext[refName], attrName)); + } else { + evaluatedTemplateArr.push(templateContext[parameterName]); + } + currentIndex = closingBraceIndex + 1; + } + return evaluatedTemplateArr.join(""); +}, "evaluateTemplate"); +// src/utils/getReferenceValue.ts +var getReferenceValue = /* @__PURE__ */ __name(({ ref }, options) => { + const referenceRecord = { + ...options.endpointParams, + ...options.referenceRecord + }; + return referenceRecord[ref]; +}, "getReferenceValue"); -/***/ }), +// src/utils/evaluateExpression.ts +var evaluateExpression = /* @__PURE__ */ __name((obj, keyName, options) => { + if (typeof obj === "string") { + return evaluateTemplate(obj, options); + } else if (obj["fn"]) { + return callFunction(obj, options); + } else if (obj["ref"]) { + return getReferenceValue(obj, options); + } + throw new EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`); +}, "evaluateExpression"); -/***/ 17570: -/***/ ((__unused_webpack_module, exports) => { +// src/utils/callFunction.ts +var callFunction = /* @__PURE__ */ __name(({ fn, argv }, options) => { + const evaluatedArgs = argv.map( + (arg) => ["boolean", "number"].includes(typeof arg) ? arg : evaluateExpression(arg, "arg", options) + ); + const fnSegments = fn.split("."); + if (fnSegments[0] in customEndpointFunctions && fnSegments[1] != null) { + return customEndpointFunctions[fnSegments[0]][fnSegments[1]](...evaluatedArgs); + } + return endpointFunctions[fn](...evaluatedArgs); +}, "callFunction"); + +// src/utils/evaluateCondition.ts +var evaluateCondition = /* @__PURE__ */ __name(({ assign, ...fnArgs }, options) => { + if (assign && assign in options.referenceRecord) { + throw new EndpointError(`'${assign}' is already defined in Reference Record.`); + } + const value = callFunction(fnArgs, options); + options.logger?.debug?.(`${debugId} evaluateCondition: ${toDebugString(fnArgs)} = ${toDebugString(value)}`); + return { + result: value === "" ? true : !!value, + ...assign != null && { toAssign: { name: assign, value } } + }; +}, "evaluateCondition"); + +// src/utils/evaluateConditions.ts +var evaluateConditions = /* @__PURE__ */ __name((conditions = [], options) => { + const conditionsReferenceRecord = {}; + for (const condition of conditions) { + const { result, toAssign } = evaluateCondition(condition, { + ...options, + referenceRecord: { + ...options.referenceRecord, + ...conditionsReferenceRecord + } + }); + if (!result) { + return { result }; + } + if (toAssign) { + conditionsReferenceRecord[toAssign.name] = toAssign.value; + options.logger?.debug?.(`${debugId} assign: ${toAssign.name} := ${toDebugString(toAssign.value)}`); + } + } + return { result: true, referenceRecord: conditionsReferenceRecord }; +}, "evaluateConditions"); + +// src/utils/getEndpointHeaders.ts +var getEndpointHeaders = /* @__PURE__ */ __name((headers, options) => Object.entries(headers).reduce( + (acc, [headerKey, headerVal]) => ({ + ...acc, + [headerKey]: headerVal.map((headerValEntry) => { + const processedExpr = evaluateExpression(headerValEntry, "Header value entry", options); + if (typeof processedExpr !== "string") { + throw new EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`); + } + return processedExpr; + }) + }), + {} +), "getEndpointHeaders"); + +// src/utils/getEndpointProperty.ts +var getEndpointProperty = /* @__PURE__ */ __name((property, options) => { + if (Array.isArray(property)) { + return property.map((propertyEntry) => getEndpointProperty(propertyEntry, options)); + } + switch (typeof property) { + case "string": + return evaluateTemplate(property, options); + case "object": + if (property === null) { + throw new EndpointError(`Unexpected endpoint property: ${property}`); + } + return getEndpointProperties(property, options); + case "boolean": + return property; + default: + throw new EndpointError(`Unexpected endpoint property type: ${typeof property}`); + } +}, "getEndpointProperty"); -"use strict"; +// src/utils/getEndpointProperties.ts +var getEndpointProperties = /* @__PURE__ */ __name((properties, options) => Object.entries(properties).reduce( + (acc, [propertyKey, propertyVal]) => ({ + ...acc, + [propertyKey]: getEndpointProperty(propertyVal, options) + }), + {} +), "getEndpointProperties"); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.splitStream = void 0; -async function splitStream(stream) { - if (typeof stream.stream === "function") { - stream = stream.stream(); +// src/utils/getEndpointUrl.ts +var getEndpointUrl = /* @__PURE__ */ __name((endpointUrl, options) => { + const expression = evaluateExpression(endpointUrl, "Endpoint URL", options); + if (typeof expression === "string") { + try { + return new URL(expression); + } catch (error) { + console.error(`Failed to construct URL with ${expression}`, error); + throw error; } - const readableStream = stream; - return readableStream.tee(); -} -exports.splitStream = splitStream; - + } + throw new EndpointError(`Endpoint URL must be a string, got ${typeof expression}`); +}, "getEndpointUrl"); -/***/ }), +// src/utils/evaluateEndpointRule.ts +var evaluateEndpointRule = /* @__PURE__ */ __name((endpointRule, options) => { + const { conditions, endpoint } = endpointRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + const endpointRuleOptions = { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }; + const { url, properties, headers } = endpoint; + options.logger?.debug?.(`${debugId} Resolving endpoint from template: ${toDebugString(endpoint)}`); + return { + ...headers != void 0 && { + headers: getEndpointHeaders(headers, endpointRuleOptions) + }, + ...properties != void 0 && { + properties: getEndpointProperties(properties, endpointRuleOptions) + }, + url: getEndpointUrl(url, endpointRuleOptions) + }; +}, "evaluateEndpointRule"); -/***/ 82108: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// src/utils/evaluateErrorRule.ts +var evaluateErrorRule = /* @__PURE__ */ __name((errorRule, options) => { + const { conditions, error } = errorRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + throw new EndpointError( + evaluateExpression(error, "Error", { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }) + ); +}, "evaluateErrorRule"); -"use strict"; +// src/utils/evaluateTreeRule.ts +var evaluateTreeRule = /* @__PURE__ */ __name((treeRule, options) => { + const { conditions, rules } = treeRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + return evaluateRules(rules, { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }); +}, "evaluateTreeRule"); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.splitStream = void 0; -const stream_1 = __nccwpck_require__(2203); -const splitStream_browser_1 = __nccwpck_require__(17570); -const stream_type_check_1 = __nccwpck_require__(4414); -async function splitStream(stream) { - if ((0, stream_type_check_1.isReadableStream)(stream) || (0, stream_type_check_1.isBlob)(stream)) { - return (0, splitStream_browser_1.splitStream)(stream); +// src/utils/evaluateRules.ts +var evaluateRules = /* @__PURE__ */ __name((rules, options) => { + for (const rule of rules) { + if (rule.type === "endpoint") { + const endpointOrUndefined = evaluateEndpointRule(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } else if (rule.type === "error") { + evaluateErrorRule(rule, options); + } else if (rule.type === "tree") { + const endpointOrUndefined = evaluateTreeRule(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } else { + throw new EndpointError(`Unknown endpoint rule: ${rule}`); } - const stream1 = new stream_1.PassThrough(); - const stream2 = new stream_1.PassThrough(); - stream.pipe(stream1); - stream.pipe(stream2); - return [stream1, stream2]; -} -exports.splitStream = splitStream; - - -/***/ }), + } + throw new EndpointError(`Rules evaluation failed`); +}, "evaluateRules"); -/***/ 4414: -/***/ ((__unused_webpack_module, exports) => { +// src/resolveEndpoint.ts +var resolveEndpoint = /* @__PURE__ */ __name((ruleSetObject, options) => { + const { endpointParams, logger } = options; + const { parameters, rules } = ruleSetObject; + options.logger?.debug?.(`${debugId} Initial EndpointParams: ${toDebugString(endpointParams)}`); + const paramsWithDefault = Object.entries(parameters).filter(([, v]) => v.default != null).map(([k, v]) => [k, v.default]); + if (paramsWithDefault.length > 0) { + for (const [paramKey, paramDefaultValue] of paramsWithDefault) { + endpointParams[paramKey] = endpointParams[paramKey] ?? paramDefaultValue; + } + } + const requiredParams = Object.entries(parameters).filter(([, v]) => v.required).map(([k]) => k); + for (const requiredParam of requiredParams) { + if (endpointParams[requiredParam] == null) { + throw new EndpointError(`Missing required parameter: '${requiredParam}'`); + } + } + const endpoint = evaluateRules(rules, { endpointParams, logger, referenceRecord: {} }); + options.logger?.debug?.(`${debugId} Resolved endpoint: ${toDebugString(endpoint)}`); + return endpoint; +}, "resolveEndpoint"); +// Annotate the CommonJS export names for ESM import in node: -"use strict"; +0 && (0); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isBlob = exports.isReadableStream = void 0; -const isReadableStream = (stream) => { - var _a; - return typeof ReadableStream === "function" && - (((_a = stream === null || stream === void 0 ? void 0 : stream.constructor) === null || _a === void 0 ? void 0 : _a.name) === ReadableStream.name || stream instanceof ReadableStream); -}; -exports.isReadableStream = isReadableStream; -const isBlob = (blob) => { - var _a; - return typeof Blob === "function" && (((_a = blob === null || blob === void 0 ? void 0 : blob.constructor) === null || _a === void 0 ? void 0 : _a.name) === Blob.name || blob instanceof Blob); -}; -exports.isBlob = isBlob; /***/ }), -/***/ 80146: +/***/ 55430: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -87037,88 +78360,113 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - escapeUri: () => escapeUri, - escapeUriPath: () => escapeUriPath + AlgorithmId: () => AlgorithmId, + EndpointURLScheme: () => EndpointURLScheme, + FieldPosition: () => FieldPosition, + HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, + HttpAuthLocation: () => HttpAuthLocation, + IniSectionType: () => IniSectionType, + RequestHandlerProtocol: () => RequestHandlerProtocol, + SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig }); module.exports = __toCommonJS(src_exports); -// src/escape-uri.ts -var escapeUri = /* @__PURE__ */ __name((uri) => ( - // AWS percent-encodes some extra non-standard characters in a URI - encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) -), "escapeUri"); -var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); - -// src/escape-uri-path.ts -var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - +// src/auth/auth.ts +var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { + HttpAuthLocation2["HEADER"] = "header"; + HttpAuthLocation2["QUERY"] = "query"; + return HttpAuthLocation2; +})(HttpAuthLocation || {}); -/***/ }), +// src/auth/HttpApiKeyAuth.ts +var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { + HttpApiKeyAuthLocation2["HEADER"] = "header"; + HttpApiKeyAuthLocation2["QUERY"] = "query"; + return HttpApiKeyAuthLocation2; +})(HttpApiKeyAuthLocation || {}); -/***/ 71577: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +// src/endpoint.ts +var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { + EndpointURLScheme2["HTTP"] = "http"; + EndpointURLScheme2["HTTPS"] = "https"; + return EndpointURLScheme2; +})(EndpointURLScheme || {}); -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); +// src/extensions/checksum.ts +var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { + AlgorithmId2["MD5"] = "md5"; + AlgorithmId2["CRC32"] = "crc32"; + AlgorithmId2["CRC32C"] = "crc32c"; + AlgorithmId2["SHA1"] = "sha1"; + AlgorithmId2["SHA256"] = "sha256"; + return AlgorithmId2; +})(AlgorithmId || {}); +var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== void 0) { + checksumAlgorithms.push({ + algorithmId: () => "sha256" /* SHA256 */, + checksumConstructor: () => runtimeConfig.sha256 + }); } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + if (runtimeConfig.md5 != void 0) { + checksumAlgorithms.push({ + algorithmId: () => "md5" /* MD5 */, + checksumConstructor: () => runtimeConfig.md5 + }); + } + return { + addChecksumAlgorithm(algo) { + checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return checksumAlgorithms; + } + }; +}, "getChecksumConfiguration"); +var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}, "resolveChecksumRuntimeConfig"); -// src/index.ts -var src_exports = {}; -__export(src_exports, { - fromUtf8: () => fromUtf8, - toUint8Array: () => toUint8Array, - toUtf8: () => toUtf8 -}); -module.exports = __toCommonJS(src_exports); +// src/extensions/defaultClientConfiguration.ts +var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return getChecksumConfiguration(runtimeConfig); +}, "getDefaultClientConfiguration"); +var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return resolveChecksumRuntimeConfig(config); +}, "resolveDefaultRuntimeConfig"); -// src/fromUtf8.ts -var import_util_buffer_from = __nccwpck_require__(44151); -var fromUtf8 = /* @__PURE__ */ __name((input) => { - const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); - return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); -}, "fromUtf8"); +// src/http.ts +var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { + FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; + FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; + return FieldPosition2; +})(FieldPosition || {}); -// src/toUint8Array.ts -var toUint8Array = /* @__PURE__ */ __name((data) => { - if (typeof data === "string") { - return fromUtf8(data); - } - if (ArrayBuffer.isView(data)) { - return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); - } - return new Uint8Array(data); -}, "toUint8Array"); +// src/middleware.ts +var SMITHY_CONTEXT_KEY = "__smithy_context"; -// src/toUtf8.ts +// src/profile.ts +var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; +})(IniSectionType || {}); -var toUtf8 = /* @__PURE__ */ __name((input) => { - if (typeof input === "string") { - return input; - } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); - } - return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); -}, "toUtf8"); +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -87127,7 +78475,7 @@ var toUtf8 = /* @__PURE__ */ __name((input) => { /***/ }), -/***/ 95290: +/***/ 96435: /***/ ((module) => { var __defProp = Object.defineProperty; @@ -87152,179 +78500,44 @@ var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: tru // src/index.ts var src_exports = {}; __export(src_exports, { - WaiterState: () => WaiterState, - checkExceptions: () => checkExceptions, - createWaiter: () => createWaiter, - waiterServiceDefaults: () => waiterServiceDefaults + fromHex: () => fromHex, + toHex: () => toHex }); module.exports = __toCommonJS(src_exports); - -// src/utils/sleep.ts -var sleep = /* @__PURE__ */ __name((seconds) => { - return new Promise((resolve) => setTimeout(resolve, seconds * 1e3)); -}, "sleep"); - -// src/waiter.ts -var waiterServiceDefaults = { - minDelay: 2, - maxDelay: 120 -}; -var WaiterState = /* @__PURE__ */ ((WaiterState2) => { - WaiterState2["ABORTED"] = "ABORTED"; - WaiterState2["FAILURE"] = "FAILURE"; - WaiterState2["SUCCESS"] = "SUCCESS"; - WaiterState2["RETRY"] = "RETRY"; - WaiterState2["TIMEOUT"] = "TIMEOUT"; - return WaiterState2; -})(WaiterState || {}); -var checkExceptions = /* @__PURE__ */ __name((result) => { - if (result.state === "ABORTED" /* ABORTED */) { - const abortError = new Error( - `${JSON.stringify({ - ...result, - reason: "Request was aborted" - })}` - ); - abortError.name = "AbortError"; - throw abortError; - } else if (result.state === "TIMEOUT" /* TIMEOUT */) { - const timeoutError = new Error( - `${JSON.stringify({ - ...result, - reason: "Waiter has timed out" - })}` - ); - timeoutError.name = "TimeoutError"; - throw timeoutError; - } else if (result.state !== "SUCCESS" /* SUCCESS */) { - throw new Error(`${JSON.stringify(result)}`); - } - return result; -}, "checkExceptions"); - -// src/poller.ts -var exponentialBackoffWithJitter = /* @__PURE__ */ __name((minDelay, maxDelay, attemptCeiling, attempt) => { - if (attempt > attemptCeiling) - return maxDelay; - const delay = minDelay * 2 ** (attempt - 1); - return randomInRange(minDelay, delay); -}, "exponentialBackoffWithJitter"); -var randomInRange = /* @__PURE__ */ __name((min, max) => min + Math.random() * (max - min), "randomInRange"); -var runPolling = /* @__PURE__ */ __name(async ({ minDelay, maxDelay, maxWaitTime, abortController, client, abortSignal }, input, acceptorChecks) => { - const observedResponses = {}; - const { state, reason } = await acceptorChecks(client, input); - if (reason) { - const message = createMessageFromResponse(reason); - observedResponses[message] |= 0; - observedResponses[message] += 1; - } - if (state !== "RETRY" /* RETRY */) { - return { state, reason, observedResponses }; - } - let currentAttempt = 1; - const waitUntil = Date.now() + maxWaitTime * 1e3; - const attemptCeiling = Math.log(maxDelay / minDelay) / Math.log(2) + 1; - while (true) { - if (abortController?.signal?.aborted || abortSignal?.aborted) { - const message = "AbortController signal aborted."; - observedResponses[message] |= 0; - observedResponses[message] += 1; - return { state: "ABORTED" /* ABORTED */, observedResponses }; - } - const delay = exponentialBackoffWithJitter(minDelay, maxDelay, attemptCeiling, currentAttempt); - if (Date.now() + delay * 1e3 > waitUntil) { - return { state: "TIMEOUT" /* TIMEOUT */, observedResponses }; - } - await sleep(delay); - const { state: state2, reason: reason2 } = await acceptorChecks(client, input); - if (reason2) { - const message = createMessageFromResponse(reason2); - observedResponses[message] |= 0; - observedResponses[message] += 1; - } - if (state2 !== "RETRY" /* RETRY */) { - return { state: state2, reason: reason2, observedResponses }; - } - currentAttempt += 1; - } -}, "runPolling"); -var createMessageFromResponse = /* @__PURE__ */ __name((reason) => { - if (reason?.$responseBodyText) { - return `Deserialization error for body: ${reason.$responseBodyText}`; - } - if (reason?.$metadata?.httpStatusCode) { - if (reason.$response || reason.message) { - return `${reason.$response.statusCode ?? reason.$metadata.httpStatusCode ?? "Unknown"}: ${reason.message}`; - } - return `${reason.$metadata.httpStatusCode}: OK`; +var SHORT_TO_HEX = {}; +var HEX_TO_SHORT = {}; +for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; } - return String(reason?.message ?? JSON.stringify(reason) ?? "Unknown"); -}, "createMessageFromResponse"); - -// src/utils/validate.ts -var validateWaiterOptions = /* @__PURE__ */ __name((options) => { - if (options.maxWaitTime <= 0) { - throw new Error(`WaiterConfiguration.maxWaitTime must be greater than 0`); - } else if (options.minDelay <= 0) { - throw new Error(`WaiterConfiguration.minDelay must be greater than 0`); - } else if (options.maxDelay <= 0) { - throw new Error(`WaiterConfiguration.maxDelay must be greater than 0`); - } else if (options.maxWaitTime <= options.minDelay) { - throw new Error( - `WaiterConfiguration.maxWaitTime [${options.maxWaitTime}] must be greater than WaiterConfiguration.minDelay [${options.minDelay}] for this waiter` - ); - } else if (options.maxDelay < options.minDelay) { - throw new Error( - `WaiterConfiguration.maxDelay [${options.maxDelay}] must be greater than WaiterConfiguration.minDelay [${options.minDelay}] for this waiter` - ); + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; +} +function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); } -}, "validateWaiterOptions"); - -// src/createWaiter.ts -var abortTimeout = /* @__PURE__ */ __name((abortSignal) => { - let onAbort; - const promise = new Promise((resolve) => { - onAbort = /* @__PURE__ */ __name(() => resolve({ state: "ABORTED" /* ABORTED */ }), "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - abortSignal.addEventListener("abort", onAbort); + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; } else { - abortSignal.onabort = onAbort; + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); } - }); - return { - clearListener() { - if (typeof abortSignal.removeEventListener === "function") { - abortSignal.removeEventListener("abort", onAbort); - } - }, - aborted: promise - }; -}, "abortTimeout"); -var createWaiter = /* @__PURE__ */ __name(async (options, input, acceptorChecks) => { - const params = { - ...waiterServiceDefaults, - ...options - }; - validateWaiterOptions(params); - const exitConditions = [runPolling(params, input, acceptorChecks)]; - const finalize = []; - if (options.abortSignal) { - const { aborted, clearListener } = abortTimeout(options.abortSignal); - finalize.push(clearListener); - exitConditions.push(aborted); } - if (options.abortController?.signal) { - const { aborted, clearListener } = abortTimeout(options.abortController.signal); - finalize.push(clearListener); - exitConditions.push(aborted); + return out; +} +__name(fromHex, "fromHex"); +function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; } - return Promise.race(exitConditions).then((result) => { - for (const fn of finalize) { - fn(); - } - return result; - }); -}, "createWaiter"); + return out; +} +__name(toHex, "toHex"); // Annotate the CommonJS export names for ESM import in node: 0 && (0); @@ -87333,2134 +78546,1251 @@ var createWaiter = /* @__PURE__ */ __name(async (options, input, acceptorChecks) /***/ }), -/***/ 39741: +/***/ 15518: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -"use strict"; - - -const validator = __nccwpck_require__(39433); -const XMLParser = __nccwpck_require__(79844); -const XMLBuilder = __nccwpck_require__(80659); - -module.exports = { - XMLParser: XMLParser, - XMLValidator: validator, - XMLBuilder: XMLBuilder -} - -/***/ }), - -/***/ 47019: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - - -const nameStartChar = ':A-Za-z_\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD'; -const nameChar = nameStartChar + '\\-.\\d\\u00B7\\u0300-\\u036F\\u203F-\\u2040'; -const nameRegexp = '[' + nameStartChar + '][' + nameChar + ']*' -const regexName = new RegExp('^' + nameRegexp + '$'); - -const getAllMatches = function(string, regex) { - const matches = []; - let match = regex.exec(string); - while (match) { - const allmatches = []; - allmatches.startIndex = regex.lastIndex - match[0].length; - const len = match.length; - for (let index = 0; index < len; index++) { - allmatches.push(match[index]); - } - matches.push(allmatches); - match = regex.exec(string); - } - return matches; -}; - -const isName = function(string) { - const match = regexName.exec(string); - return !(match === null || typeof match === 'undefined'); -}; - -exports.isExist = function(v) { - return typeof v !== 'undefined'; -}; - -exports.isEmptyObject = function(obj) { - return Object.keys(obj).length === 0; -}; - -/** - * Copy all the properties of a into b. - * @param {*} target - * @param {*} a - */ -exports.merge = function(target, a, arrayMode) { - if (a) { - const keys = Object.keys(a); // will return an array of own properties - const len = keys.length; //don't make it inline - for (let i = 0; i < len; i++) { - if (arrayMode === 'strict') { - target[keys[i]] = [ a[keys[i]] ]; - } else { - target[keys[i]] = a[keys[i]]; - } - } - } +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); }; -/* exports.merge =function (b,a){ - return Object.assign(b,a); -} */ - -exports.getValue = function(v) { - if (exports.isExist(v)) { - return v; - } else { - return ''; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); } + return to; }; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// const fakeCall = function(a) {return a;}; -// const fakeCallNoReturn = function() {}; - -exports.isName = isName; -exports.getAllMatches = getAllMatches; -exports.nameRegexp = nameRegexp; - - -/***/ }), - -/***/ 39433: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -const util = __nccwpck_require__(47019); - -const defaultOptions = { - allowBooleanAttributes: false, //A tag can have attributes without any value - unpairedTags: [] -}; - -//const tagsPattern = new RegExp("<\\/?([\\w:\\-_\.]+)\\s*\/?>","g"); -exports.validate = function (xmlData, options) { - options = Object.assign({}, defaultOptions, options); - - //xmlData = xmlData.replace(/(\r\n|\n|\r)/gm,"");//make it single line - //xmlData = xmlData.replace(/(^\s*<\?xml.*?\?>)/g,"");//Remove XML starting tag - //xmlData = xmlData.replace(/()/g,"");//Remove DOCTYPE - const tags = []; - let tagFound = false; +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, + ConfiguredRetryStrategy: () => ConfiguredRetryStrategy, + DEFAULT_MAX_ATTEMPTS: () => DEFAULT_MAX_ATTEMPTS, + DEFAULT_RETRY_DELAY_BASE: () => DEFAULT_RETRY_DELAY_BASE, + DEFAULT_RETRY_MODE: () => DEFAULT_RETRY_MODE, + DefaultRateLimiter: () => DefaultRateLimiter, + INITIAL_RETRY_TOKENS: () => INITIAL_RETRY_TOKENS, + INVOCATION_ID_HEADER: () => INVOCATION_ID_HEADER, + MAXIMUM_RETRY_DELAY: () => MAXIMUM_RETRY_DELAY, + NO_RETRY_INCREMENT: () => NO_RETRY_INCREMENT, + REQUEST_HEADER: () => REQUEST_HEADER, + RETRY_COST: () => RETRY_COST, + RETRY_MODES: () => RETRY_MODES, + StandardRetryStrategy: () => StandardRetryStrategy, + THROTTLING_RETRY_DELAY_BASE: () => THROTTLING_RETRY_DELAY_BASE, + TIMEOUT_RETRY_COST: () => TIMEOUT_RETRY_COST +}); +module.exports = __toCommonJS(src_exports); - //indicates that the root tag has been closed (aka. depth 0 has been reached) - let reachedRoot = false; +// src/config.ts +var RETRY_MODES = /* @__PURE__ */ ((RETRY_MODES2) => { + RETRY_MODES2["STANDARD"] = "standard"; + RETRY_MODES2["ADAPTIVE"] = "adaptive"; + return RETRY_MODES2; +})(RETRY_MODES || {}); +var DEFAULT_MAX_ATTEMPTS = 3; +var DEFAULT_RETRY_MODE = "standard" /* STANDARD */; - if (xmlData[0] === '\ufeff') { - // check for byte order mark (BOM) - xmlData = xmlData.substr(1); +// src/DefaultRateLimiter.ts +var import_service_error_classification = __nccwpck_require__(42058); +var DefaultRateLimiter = class _DefaultRateLimiter { + constructor(options) { + // Pre-set state variables + this.currentCapacity = 0; + this.enabled = false; + this.lastMaxRate = 0; + this.measuredTxRate = 0; + this.requestCount = 0; + this.lastTimestamp = 0; + this.timeWindow = 0; + this.beta = options?.beta ?? 0.7; + this.minCapacity = options?.minCapacity ?? 1; + this.minFillRate = options?.minFillRate ?? 0.5; + this.scaleConstant = options?.scaleConstant ?? 0.4; + this.smooth = options?.smooth ?? 0.8; + const currentTimeInSeconds = this.getCurrentTimeInSeconds(); + this.lastThrottleTime = currentTimeInSeconds; + this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); + this.fillRate = this.minFillRate; + this.maxCapacity = this.minCapacity; } - - for (let i = 0; i < xmlData.length; i++) { - - if (xmlData[i] === '<' && xmlData[i+1] === '?') { - i+=2; - i = readPI(xmlData,i); - if (i.err) return i; - }else if (xmlData[i] === '<') { - //starting of tag - //read until you reach to '>' avoiding any '>' in attribute value - let tagStartPos = i; - i++; - - if (xmlData[i] === '!') { - i = readCommentAndCDATA(xmlData, i); - continue; - } else { - let closingTag = false; - if (xmlData[i] === '/') { - //closing tag - closingTag = true; - i++; - } - //read tagname - let tagName = ''; - for (; i < xmlData.length && - xmlData[i] !== '>' && - xmlData[i] !== ' ' && - xmlData[i] !== '\t' && - xmlData[i] !== '\n' && - xmlData[i] !== '\r'; i++ - ) { - tagName += xmlData[i]; - } - tagName = tagName.trim(); - //console.log(tagName); - - if (tagName[tagName.length - 1] === '/') { - //self closing tag without attributes - tagName = tagName.substring(0, tagName.length - 1); - //continue; - i--; - } - if (!validateTagName(tagName)) { - let msg; - if (tagName.trim().length === 0) { - msg = "Invalid space after '<'."; - } else { - msg = "Tag '"+tagName+"' is an invalid name."; - } - return getErrorObject('InvalidTag', msg, getLineNumberForPosition(xmlData, i)); - } - - const result = readAttributeStr(xmlData, i); - if (result === false) { - return getErrorObject('InvalidAttr', "Attributes for '"+tagName+"' have open quote.", getLineNumberForPosition(xmlData, i)); - } - let attrStr = result.value; - i = result.index; - - if (attrStr[attrStr.length - 1] === '/') { - //self closing tag - const attrStrStart = i - attrStr.length; - attrStr = attrStr.substring(0, attrStr.length - 1); - const isValid = validateAttributeString(attrStr, options); - if (isValid === true) { - tagFound = true; - //continue; //text may presents after self closing tag - } else { - //the result from the nested function returns the position of the error within the attribute - //in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute - //this gives us the absolute index in the entire xml, which we can use to find the line at last - return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, attrStrStart + isValid.err.line)); - } - } else if (closingTag) { - if (!result.tagClosed) { - return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' doesn't have proper closing.", getLineNumberForPosition(xmlData, i)); - } else if (attrStr.trim().length > 0) { - return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' can't have attributes or invalid starting.", getLineNumberForPosition(xmlData, tagStartPos)); - } else if (tags.length === 0) { - return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' has not been opened.", getLineNumberForPosition(xmlData, tagStartPos)); - } else { - const otg = tags.pop(); - if (tagName !== otg.tagName) { - let openPos = getLineNumberForPosition(xmlData, otg.tagStartPos); - return getErrorObject('InvalidTag', - "Expected closing tag '"+otg.tagName+"' (opened in line "+openPos.line+", col "+openPos.col+") instead of closing tag '"+tagName+"'.", - getLineNumberForPosition(xmlData, tagStartPos)); - } - - //when there are no more tags, we reached the root level. - if (tags.length == 0) { - reachedRoot = true; - } - } - } else { - const isValid = validateAttributeString(attrStr, options); - if (isValid !== true) { - //the result from the nested function returns the position of the error within the attribute - //in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute - //this gives us the absolute index in the entire xml, which we can use to find the line at last - return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, i - attrStr.length + isValid.err.line)); - } - - //if the root level has been reached before ... - if (reachedRoot === true) { - return getErrorObject('InvalidXml', 'Multiple possible root nodes found.', getLineNumberForPosition(xmlData, i)); - } else if(options.unpairedTags.indexOf(tagName) !== -1){ - //don't push into stack - } else { - tags.push({tagName, tagStartPos}); - } - tagFound = true; - } - - //skip tag text value - //It may include comments and CDATA value - for (i++; i < xmlData.length; i++) { - if (xmlData[i] === '<') { - if (xmlData[i + 1] === '!') { - //comment or CADATA - i++; - i = readCommentAndCDATA(xmlData, i); - continue; - } else if (xmlData[i+1] === '?') { - i = readPI(xmlData, ++i); - if (i.err) return i; - } else{ - break; - } - } else if (xmlData[i] === '&') { - const afterAmp = validateAmpersand(xmlData, i); - if (afterAmp == -1) - return getErrorObject('InvalidChar', "char '&' is not expected.", getLineNumberForPosition(xmlData, i)); - i = afterAmp; - }else{ - if (reachedRoot === true && !isWhiteSpace(xmlData[i])) { - return getErrorObject('InvalidXml', "Extra text at the end", getLineNumberForPosition(xmlData, i)); - } - } - } //end of reading tag text value - if (xmlData[i] === '<') { - i--; - } - } - } else { - if ( isWhiteSpace(xmlData[i])) { - continue; - } - return getErrorObject('InvalidChar', "char '"+xmlData[i]+"' is not expected.", getLineNumberForPosition(xmlData, i)); - } + static { + __name(this, "DefaultRateLimiter"); } - - if (!tagFound) { - return getErrorObject('InvalidXml', 'Start tag expected.', 1); - }else if (tags.length == 1) { - return getErrorObject('InvalidTag', "Unclosed tag '"+tags[0].tagName+"'.", getLineNumberForPosition(xmlData, tags[0].tagStartPos)); - }else if (tags.length > 0) { - return getErrorObject('InvalidXml', "Invalid '"+ - JSON.stringify(tags.map(t => t.tagName), null, 4).replace(/\r?\n/g, '')+ - "' found.", {line: 1, col: 1}); + static { + /** + * Only used in testing. + */ + this.setTimeoutFn = setTimeout; } - - return true; -}; - -function isWhiteSpace(char){ - return char === ' ' || char === '\t' || char === '\n' || char === '\r'; -} -/** - * Read Processing insstructions and skip - * @param {*} xmlData - * @param {*} i - */ -function readPI(xmlData, i) { - const start = i; - for (; i < xmlData.length; i++) { - if (xmlData[i] == '?' || xmlData[i] == ' ') { - //tagname - const tagname = xmlData.substr(start, i - start); - if (i > 5 && tagname === 'xml') { - return getErrorObject('InvalidXml', 'XML declaration allowed only at the start of the document.', getLineNumberForPosition(xmlData, i)); - } else if (xmlData[i] == '?' && xmlData[i + 1] == '>') { - //check if valid attribut string - i++; - break; - } else { - continue; - } - } + getCurrentTimeInSeconds() { + return Date.now() / 1e3; } - return i; -} - -function readCommentAndCDATA(xmlData, i) { - if (xmlData.length > i + 5 && xmlData[i + 1] === '-' && xmlData[i + 2] === '-') { - //comment - for (i += 3; i < xmlData.length; i++) { - if (xmlData[i] === '-' && xmlData[i + 1] === '-' && xmlData[i + 2] === '>') { - i += 2; - break; - } - } - } else if ( - xmlData.length > i + 8 && - xmlData[i + 1] === 'D' && - xmlData[i + 2] === 'O' && - xmlData[i + 3] === 'C' && - xmlData[i + 4] === 'T' && - xmlData[i + 5] === 'Y' && - xmlData[i + 6] === 'P' && - xmlData[i + 7] === 'E' - ) { - let angleBracketsCount = 1; - for (i += 8; i < xmlData.length; i++) { - if (xmlData[i] === '<') { - angleBracketsCount++; - } else if (xmlData[i] === '>') { - angleBracketsCount--; - if (angleBracketsCount === 0) { - break; - } - } + async getSendToken() { + return this.acquireTokenBucket(1); + } + async acquireTokenBucket(amount) { + if (!this.enabled) { + return; } - } else if ( - xmlData.length > i + 9 && - xmlData[i + 1] === '[' && - xmlData[i + 2] === 'C' && - xmlData[i + 3] === 'D' && - xmlData[i + 4] === 'A' && - xmlData[i + 5] === 'T' && - xmlData[i + 6] === 'A' && - xmlData[i + 7] === '[' - ) { - for (i += 8; i < xmlData.length; i++) { - if (xmlData[i] === ']' && xmlData[i + 1] === ']' && xmlData[i + 2] === '>') { - i += 2; - break; - } + this.refillTokenBucket(); + if (amount > this.currentCapacity) { + const delay = (amount - this.currentCapacity) / this.fillRate * 1e3; + await new Promise((resolve) => _DefaultRateLimiter.setTimeoutFn(resolve, delay)); } + this.currentCapacity = this.currentCapacity - amount; } - - return i; -} - -const doubleQuote = '"'; -const singleQuote = "'"; - -/** - * Keep reading xmlData until '<' is found outside the attribute value. - * @param {string} xmlData - * @param {number} i - */ -function readAttributeStr(xmlData, i) { - let attrStr = ''; - let startChar = ''; - let tagClosed = false; - for (; i < xmlData.length; i++) { - if (xmlData[i] === doubleQuote || xmlData[i] === singleQuote) { - if (startChar === '') { - startChar = xmlData[i]; - } else if (startChar !== xmlData[i]) { - //if vaue is enclosed with double quote then single quotes are allowed inside the value and vice versa - } else { - startChar = ''; - } - } else if (xmlData[i] === '>') { - if (startChar === '') { - tagClosed = true; - break; - } + refillTokenBucket() { + const timestamp = this.getCurrentTimeInSeconds(); + if (!this.lastTimestamp) { + this.lastTimestamp = timestamp; + return; } - attrStr += xmlData[i]; - } - if (startChar !== '') { - return false; + const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; + this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); + this.lastTimestamp = timestamp; } - - return { - value: attrStr, - index: i, - tagClosed: tagClosed - }; -} - -/** - * Select all the attributes whether valid or invalid. - */ -const validAttrStrRegxp = new RegExp('(\\s*)([^\\s=]+)(\\s*=)?(\\s*([\'"])(([\\s\\S])*?)\\5)?', 'g'); - -//attr, ="sd", a="amit's", a="sd"b="saf", ab cd="" - -function validateAttributeString(attrStr, options) { - //console.log("start:"+attrStr+":end"); - - //if(attrStr.trim().length === 0) return true; //empty string - - const matches = util.getAllMatches(attrStr, validAttrStrRegxp); - const attrNames = {}; - - for (let i = 0; i < matches.length; i++) { - if (matches[i][1].length === 0) { - //nospace before attribute name: a="sd"b="saf" - return getErrorObject('InvalidAttr', "Attribute '"+matches[i][2]+"' has no space in starting.", getPositionFromMatch(matches[i])) - } else if (matches[i][3] !== undefined && matches[i][4] === undefined) { - return getErrorObject('InvalidAttr', "Attribute '"+matches[i][2]+"' is without value.", getPositionFromMatch(matches[i])); - } else if (matches[i][3] === undefined && !options.allowBooleanAttributes) { - //independent attribute: ab - return getErrorObject('InvalidAttr', "boolean attribute '"+matches[i][2]+"' is not allowed.", getPositionFromMatch(matches[i])); - } - /* else if(matches[i][6] === undefined){//attribute without value: ab= - return { err: { code:"InvalidAttr",msg:"attribute " + matches[i][2] + " has no value assigned."}}; - } */ - const attrName = matches[i][2]; - if (!validateAttrName(attrName)) { - return getErrorObject('InvalidAttr', "Attribute '"+attrName+"' is an invalid name.", getPositionFromMatch(matches[i])); - } - if (!attrNames.hasOwnProperty(attrName)) { - //check for duplicate attribute. - attrNames[attrName] = 1; + updateClientSendingRate(response) { + let calculatedRate; + this.updateMeasuredRate(); + if ((0, import_service_error_classification.isThrottlingError)(response)) { + const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); + this.lastMaxRate = rateToUse; + this.calculateTimeWindow(); + this.lastThrottleTime = this.getCurrentTimeInSeconds(); + calculatedRate = this.cubicThrottle(rateToUse); + this.enableTokenBucket(); } else { - return getErrorObject('InvalidAttr', "Attribute '"+attrName+"' is repeated.", getPositionFromMatch(matches[i])); + this.calculateTimeWindow(); + calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); } + const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); + this.updateTokenBucketRate(newRate); } - - return true; -} - -function validateNumberAmpersand(xmlData, i) { - let re = /\d/; - if (xmlData[i] === 'x') { - i++; - re = /[\da-fA-F]/; + calculateTimeWindow() { + this.timeWindow = this.getPrecise(Math.pow(this.lastMaxRate * (1 - this.beta) / this.scaleConstant, 1 / 3)); } - for (; i < xmlData.length; i++) { - if (xmlData[i] === ';') - return i; - if (!xmlData[i].match(re)) - break; + cubicThrottle(rateToUse) { + return this.getPrecise(rateToUse * this.beta); } - return -1; -} - -function validateAmpersand(xmlData, i) { - // https://www.w3.org/TR/xml/#dt-charref - i++; - if (xmlData[i] === ';') - return -1; - if (xmlData[i] === '#') { - i++; - return validateNumberAmpersand(xmlData, i); + cubicSuccess(timestamp) { + return this.getPrecise( + this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate + ); } - let count = 0; - for (; i < xmlData.length; i++, count++) { - if (xmlData[i].match(/\w/) && count < 20) - continue; - if (xmlData[i] === ';') - break; - return -1; + enableTokenBucket() { + this.enabled = true; } - return i; -} + updateTokenBucketRate(newRate) { + this.refillTokenBucket(); + this.fillRate = Math.max(newRate, this.minFillRate); + this.maxCapacity = Math.max(newRate, this.minCapacity); + this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); + } + updateMeasuredRate() { + const t = this.getCurrentTimeInSeconds(); + const timeBucket = Math.floor(t * 2) / 2; + this.requestCount++; + if (timeBucket > this.lastTxRateBucket) { + const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); + this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); + this.requestCount = 0; + this.lastTxRateBucket = timeBucket; + } + } + getPrecise(num) { + return parseFloat(num.toFixed(8)); + } +}; + +// src/constants.ts +var DEFAULT_RETRY_DELAY_BASE = 100; +var MAXIMUM_RETRY_DELAY = 20 * 1e3; +var THROTTLING_RETRY_DELAY_BASE = 500; +var INITIAL_RETRY_TOKENS = 500; +var RETRY_COST = 5; +var TIMEOUT_RETRY_COST = 10; +var NO_RETRY_INCREMENT = 1; +var INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; +var REQUEST_HEADER = "amz-sdk-request"; -function getErrorObject(code, message, lineNumber) { +// src/defaultRetryBackoffStrategy.ts +var getDefaultRetryBackoffStrategy = /* @__PURE__ */ __name(() => { + let delayBase = DEFAULT_RETRY_DELAY_BASE; + const computeNextBackoffDelay = /* @__PURE__ */ __name((attempts) => { + return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); + }, "computeNextBackoffDelay"); + const setDelayBase = /* @__PURE__ */ __name((delay) => { + delayBase = delay; + }, "setDelayBase"); return { - err: { - code: code, - msg: message, - line: lineNumber.line || lineNumber, - col: lineNumber.col, - }, + computeNextBackoffDelay, + setDelayBase }; -} - -function validateAttrName(attrName) { - return util.isName(attrName); -} - -// const startsWithXML = /^xml/i; - -function validateTagName(tagname) { - return util.isName(tagname) /* && !tagname.match(startsWithXML) */; -} +}, "getDefaultRetryBackoffStrategy"); -//this function returns the line number for the character at the given index -function getLineNumberForPosition(xmlData, index) { - const lines = xmlData.substring(0, index).split(/\r?\n/); +// src/defaultRetryToken.ts +var createDefaultRetryToken = /* @__PURE__ */ __name(({ + retryDelay, + retryCount, + retryCost +}) => { + const getRetryCount = /* @__PURE__ */ __name(() => retryCount, "getRetryCount"); + const getRetryDelay = /* @__PURE__ */ __name(() => Math.min(MAXIMUM_RETRY_DELAY, retryDelay), "getRetryDelay"); + const getRetryCost = /* @__PURE__ */ __name(() => retryCost, "getRetryCost"); return { - line: lines.length, - - // column number is last line's length + 1, because column numbering starts at 1: - col: lines[lines.length - 1].length + 1 + getRetryCount, + getRetryDelay, + getRetryCost }; -} - -//this function returns the position of the first character of match within attrStr -function getPositionFromMatch(match) { - return match.startIndex + match[1].length; -} - - -/***/ }), - -/***/ 80659: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; +}, "createDefaultRetryToken"); -//parse Empty Node as self closing node -const buildFromOrderedJs = __nccwpck_require__(43997); - -const defaultOptions = { - attributeNamePrefix: '@_', - attributesGroupName: false, - textNodeName: '#text', - ignoreAttributes: true, - cdataPropName: false, - format: false, - indentBy: ' ', - suppressEmptyNode: false, - suppressUnpairedNode: true, - suppressBooleanAttributes: true, - tagValueProcessor: function(key, a) { - return a; - }, - attributeValueProcessor: function(attrName, a) { - return a; - }, - preserveOrder: false, - commentPropName: false, - unpairedTags: [], - entities: [ - { regex: new RegExp("&", "g"), val: "&" },//it must be on top - { regex: new RegExp(">", "g"), val: ">" }, - { regex: new RegExp("<", "g"), val: "<" }, - { regex: new RegExp("\'", "g"), val: "'" }, - { regex: new RegExp("\"", "g"), val: """ } - ], - processEntities: true, - stopNodes: [], - // transformTagName: false, - // transformAttributeName: false, - oneListGroup: false -}; - -function Builder(options) { - this.options = Object.assign({}, defaultOptions, options); - if (this.options.ignoreAttributes || this.options.attributesGroupName) { - this.isAttribute = function(/*a*/) { - return false; - }; - } else { - this.attrPrefixLen = this.options.attributeNamePrefix.length; - this.isAttribute = isAttribute; +// src/StandardRetryStrategy.ts +var StandardRetryStrategy = class { + constructor(maxAttempts) { + this.maxAttempts = maxAttempts; + this.mode = "standard" /* STANDARD */; + this.capacity = INITIAL_RETRY_TOKENS; + this.retryBackoffStrategy = getDefaultRetryBackoffStrategy(); + this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; } - - this.processTextOrObjNode = processTextOrObjNode - - if (this.options.format) { - this.indentate = indentate; - this.tagEndChar = '>\n'; - this.newLine = '\n'; - } else { - this.indentate = function() { - return ''; - }; - this.tagEndChar = '>'; - this.newLine = ''; + static { + __name(this, "StandardRetryStrategy"); } -} - -Builder.prototype.build = function(jObj) { - if(this.options.preserveOrder){ - return buildFromOrderedJs(jObj, this.options); - }else { - if(Array.isArray(jObj) && this.options.arrayNodeName && this.options.arrayNodeName.length > 1){ - jObj = { - [this.options.arrayNodeName] : jObj - } + // eslint-disable-next-line @typescript-eslint/no-unused-vars + async acquireInitialRetryToken(retryTokenScope) { + return createDefaultRetryToken({ + retryDelay: DEFAULT_RETRY_DELAY_BASE, + retryCount: 0 + }); + } + async refreshRetryTokenForRetry(token, errorInfo) { + const maxAttempts = await this.getMaxAttempts(); + if (this.shouldRetry(token, errorInfo, maxAttempts)) { + const errorType = errorInfo.errorType; + this.retryBackoffStrategy.setDelayBase( + errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE + ); + const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); + const retryDelay = errorInfo.retryAfterHint ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) : delayFromErrorType; + const capacityCost = this.getCapacityCost(errorType); + this.capacity -= capacityCost; + return createDefaultRetryToken({ + retryDelay, + retryCount: token.getRetryCount() + 1, + retryCost: capacityCost + }); } - return this.j2x(jObj, 0).val; + throw new Error("No retry token available"); } -}; - -Builder.prototype.j2x = function(jObj, level) { - let attrStr = ''; - let val = ''; - for (let key in jObj) { - if(!Object.prototype.hasOwnProperty.call(jObj, key)) continue; - if (typeof jObj[key] === 'undefined') { - // supress undefined node only if it is not an attribute - if (this.isAttribute(key)) { - val += ''; - } - } else if (jObj[key] === null) { - // null attribute should be ignored by the attribute list, but should not cause the tag closing - if (this.isAttribute(key)) { - val += ''; - } else if (key[0] === '?') { - val += this.indentate(level) + '<' + key + '?' + this.tagEndChar; - } else { - val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; - } - // val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; - } else if (jObj[key] instanceof Date) { - val += this.buildTextValNode(jObj[key], key, '', level); - } else if (typeof jObj[key] !== 'object') { - //premitive type - const attr = this.isAttribute(key); - if (attr) { - attrStr += this.buildAttrPairStr(attr, '' + jObj[key]); - }else { - //tag value - if (key === this.options.textNodeName) { - let newval = this.options.tagValueProcessor(key, '' + jObj[key]); - val += this.replaceEntitiesValue(newval); - } else { - val += this.buildTextValNode(jObj[key], key, '', level); - } - } - } else if (Array.isArray(jObj[key])) { - //repeated nodes - const arrLen = jObj[key].length; - let listTagVal = ""; - let listTagAttr = ""; - for (let j = 0; j < arrLen; j++) { - const item = jObj[key][j]; - if (typeof item === 'undefined') { - // supress undefined node - } else if (item === null) { - if(key[0] === "?") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar; - else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; - // val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; - } else if (typeof item === 'object') { - if(this.options.oneListGroup){ - const result = this.j2x(item, level + 1); - listTagVal += result.val; - if (this.options.attributesGroupName && item.hasOwnProperty(this.options.attributesGroupName)) { - listTagAttr += result.attrStr - } - }else{ - listTagVal += this.processTextOrObjNode(item, key, level) - } - } else { - if (this.options.oneListGroup) { - let textValue = this.options.tagValueProcessor(key, item); - textValue = this.replaceEntitiesValue(textValue); - listTagVal += textValue; - } else { - listTagVal += this.buildTextValNode(item, key, '', level); - } - } - } - if(this.options.oneListGroup){ - listTagVal = this.buildObjectNode(listTagVal, key, listTagAttr, level); - } - val += listTagVal; - } else { - //nested node - if (this.options.attributesGroupName && key === this.options.attributesGroupName) { - const Ks = Object.keys(jObj[key]); - const L = Ks.length; - for (let j = 0; j < L; j++) { - attrStr += this.buildAttrPairStr(Ks[j], '' + jObj[key][Ks[j]]); - } - } else { - val += this.processTextOrObjNode(jObj[key], key, level) - } + recordSuccess(token) { + this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); + } + /** + * @returns the current available retry capacity. + * + * This number decreases when retries are executed and refills when requests or retries succeed. + */ + getCapacity() { + return this.capacity; + } + async getMaxAttempts() { + try { + return await this.maxAttemptsProvider(); + } catch (error) { + console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); + return DEFAULT_MAX_ATTEMPTS; } } - return {attrStr: attrStr, val: val}; + shouldRetry(tokenToRenew, errorInfo, maxAttempts) { + const attempts = tokenToRenew.getRetryCount() + 1; + return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType); + } + getCapacityCost(errorType) { + return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; + } + isRetryableError(errorType) { + return errorType === "THROTTLING" || errorType === "TRANSIENT"; + } }; -Builder.prototype.buildAttrPairStr = function(attrName, val){ - val = this.options.attributeValueProcessor(attrName, '' + val); - val = this.replaceEntitiesValue(val); - if (this.options.suppressBooleanAttributes && val === "true") { - return ' ' + attrName; - } else return ' ' + attrName + '="' + val + '"'; -} - -function processTextOrObjNode (object, key, level) { - const result = this.j2x(object, level + 1); - if (object[this.options.textNodeName] !== undefined && Object.keys(object).length === 1) { - return this.buildTextValNode(object[this.options.textNodeName], key, result.attrStr, level); - } else { - return this.buildObjectNode(result.val, key, result.attrStr, level); +// src/AdaptiveRetryStrategy.ts +var AdaptiveRetryStrategy = class { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = "adaptive" /* ADAPTIVE */; + const { rateLimiter } = options ?? {}; + this.rateLimiter = rateLimiter ?? new DefaultRateLimiter(); + this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider); } -} - -Builder.prototype.buildObjectNode = function(val, key, attrStr, level) { - if(val === ""){ - if(key[0] === "?") return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar; - else { - return this.indentate(level) + '<' + key + attrStr + this.closeTag(key) + this.tagEndChar; - } - }else{ - - let tagEndExp = '' + key + this.tagEndChar; - let piClosingChar = ""; - - if(key[0] === "?") { - piClosingChar = "?"; - tagEndExp = ""; - } - - // attrStr is an empty string in case the attribute came as undefined or null - if ((attrStr || attrStr === '') && val.indexOf('<') === -1) { - return ( this.indentate(level) + '<' + key + attrStr + piClosingChar + '>' + val + tagEndExp ); - } else if (this.options.commentPropName !== false && key === this.options.commentPropName && piClosingChar.length === 0) { - return this.indentate(level) + `` + this.newLine; - }else { - return ( - this.indentate(level) + '<' + key + attrStr + piClosingChar + this.tagEndChar + - val + - this.indentate(level) + tagEndExp ); - } + static { + __name(this, "AdaptiveRetryStrategy"); } -} - -Builder.prototype.closeTag = function(key){ - let closeTag = ""; - if(this.options.unpairedTags.indexOf(key) !== -1){ //unpaired - if(!this.options.suppressUnpairedNode) closeTag = "/" - }else if(this.options.suppressEmptyNode){ //empty - closeTag = "/"; - }else{ - closeTag = `>${key}` + async acquireInitialRetryToken(retryTokenScope) { + await this.rateLimiter.getSendToken(); + return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); } - return closeTag; -} - -function buildEmptyObjNode(val, key, attrStr, level) { - if (val !== '') { - return this.buildObjectNode(val, key, attrStr, level); - } else { - if(key[0] === "?") return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar; - else { - return this.indentate(level) + '<' + key + attrStr + '/' + this.tagEndChar; - // return this.buildTagStr(level,key, attrStr); - } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + this.rateLimiter.updateClientSendingRate(errorInfo); + return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); } -} + recordSuccess(token) { + this.rateLimiter.updateClientSendingRate({}); + this.standardRetryStrategy.recordSuccess(token); + } +}; -Builder.prototype.buildTextValNode = function(val, key, attrStr, level) { - if (this.options.cdataPropName !== false && key === this.options.cdataPropName) { - return this.indentate(level) + `` + this.newLine; - }else if (this.options.commentPropName !== false && key === this.options.commentPropName) { - return this.indentate(level) + `` + this.newLine; - }else if(key[0] === "?") {//PI tag - return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar; - }else{ - let textValue = this.options.tagValueProcessor(key, val); - textValue = this.replaceEntitiesValue(textValue); - - if( textValue === ''){ - return this.indentate(level) + '<' + key + attrStr + this.closeTag(key) + this.tagEndChar; - }else{ - return this.indentate(level) + '<' + key + attrStr + '>' + - textValue + - '' + key + this.tagEndChar; +// src/ConfiguredRetryStrategy.ts +var ConfiguredRetryStrategy = class extends StandardRetryStrategy { + static { + __name(this, "ConfiguredRetryStrategy"); + } + /** + * @param maxAttempts - the maximum number of retry attempts allowed. + * e.g., if set to 3, then 4 total requests are possible. + * @param computeNextBackoffDelay - a millisecond delay for each retry or a function that takes the retry attempt + * and returns the delay. + * + * @example exponential backoff. + * ```js + * new Client({ + * retryStrategy: new ConfiguredRetryStrategy(3, (attempt) => attempt ** 2) + * }); + * ``` + * @example constant delay. + * ```js + * new Client({ + * retryStrategy: new ConfiguredRetryStrategy(3, 2000) + * }); + * ``` + */ + constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { + super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); + if (typeof computeNextBackoffDelay === "number") { + this.computeNextBackoffDelay = () => computeNextBackoffDelay; + } else { + this.computeNextBackoffDelay = computeNextBackoffDelay; } } -} - -Builder.prototype.replaceEntitiesValue = function(textValue){ - if(textValue && textValue.length > 0 && this.options.processEntities){ - for (let i=0; i